From 36979df95af25bab6c397a9216d981833666c9fb Mon Sep 17 00:00:00 2001 From: nori3636 Date: Sun, 23 Nov 2025 14:38:34 +0900 Subject: [PATCH 1/4] feat: use uv --- Pipfile | 21 - pyproject.toml | 78 +++ setup.cfg | 7 - setup.py | 55 --- uv.lock | 1231 ++++++++++++++++++++++++++++++++++++++++++++++++ 5 files changed, 1309 insertions(+), 83 deletions(-) delete mode 100644 Pipfile create mode 100644 pyproject.toml delete mode 100644 setup.cfg delete mode 100644 setup.py create mode 100644 uv.lock diff --git a/Pipfile b/Pipfile deleted file mode 100644 index a230e4a..0000000 --- a/Pipfile +++ /dev/null @@ -1,21 +0,0 @@ -[[source]] -url = "https://pypi.python.org/simple" -verify_ssl = true -name = "pypi" - -[packages] -botocore = "==1.37.10" - -[dev-packages] -isort = "*" -"flake8" = "*" -pytest = "*" -requests = "*" -sphinx = "==5.3.0" -sphinx-rtd-theme = "*" - -[scripts] -isort = "isort" -lint = "/bin/bash -c 'flake8 .'" -test = "pytest --capture=sys" -unittest = "pytest tests/unit --capture=sys" diff --git a/pyproject.toml b/pyproject.toml new file mode 100644 index 0000000..fabccfd --- /dev/null +++ b/pyproject.toml @@ -0,0 +1,78 @@ +[build-system] +requires = ["setuptools>=45", "wheel"] +build-backend = "setuptools.build_meta" + +[project] +name = "nifcloud" +dynamic = ["version"] +description = "Data-driven NIFCLOUD SDK for Python" +readme = "README.md" +requires-python = ">=3.8" +license = {text = "Apache License 2.0"} +authors = [ + {name = "Fujitsu"}, +] +classifiers = [ + "Development Status :: 5 - Production/Stable", + "Intended Audience :: Developers", + "Intended Audience :: System Administrators", + "Natural Language :: English", + "License :: OSI Approved :: Apache Software License", + "Programming Language :: Python", + "Programming Language :: Python :: 3", + "Programming Language :: Python :: 3.8", + "Programming Language :: Python :: 3.9", + "Programming Language :: Python :: 3.10", + "Programming Language :: Python :: 3.11", + "Programming Language :: Python :: 3.12", + "Programming Language :: Python :: 3.13", +] +dependencies = [ + "botocore==1.37.10", +] + +[project.urls] +Repository = "https://github.com/nifcloud/nifcloud-sdk-python" + +[project.optional-dependencies] +dev = [ + "isort", + "flake8", + "pytest", + "requests", + "sphinx==5.3.0", + "sphinx-rtd-theme", +] + +[tool.uv] +# UV configuration +dev-dependencies = [ + "isort", + "flake8", + "pytest", + "requests", + "sphinx==5.3.0", + "sphinx-rtd-theme", +] + +[tool.setuptools] +packages = ["nifcloud"] + +[tool.setuptools.package-data] +nifcloud = [ + "data/*.json", + "data/*/*/*.json", +] + +[tool.setuptools.dynamic] +version = {attr = "nifcloud.__version__"} + +[tool.isort] +profile = "black" + +[tool.pytest.ini_options] +testpaths = ["tests"] +addopts = "--capture=sys" + +[tool.flake8] +max-line-length = 88 diff --git a/setup.cfg b/setup.cfg deleted file mode 100644 index d907fea..0000000 --- a/setup.cfg +++ /dev/null @@ -1,7 +0,0 @@ -[bdist_wheel] -universal = 1 - -[metadata] -requires-dist = - botocore>=1.31.1 -license_file = LICENSE.txt diff --git a/setup.py b/setup.py deleted file mode 100644 index d13baa0..0000000 --- a/setup.py +++ /dev/null @@ -1,55 +0,0 @@ -#!/usr/bin/env python -import codecs -import os.path -import re - -from setuptools import find_packages, setup - -here = os.path.abspath(os.path.dirname(__file__)) - - -def read(*parts): - with codecs.open(os.path.join(here, *parts), 'r') as f: - content = f.read() - return content - - -def find_version(*file_paths): - version_file = read(*file_paths) - version_match = re.search(r'^__version__ = [\'"]([^\'"]*)[\'"]', - version_file, re.M) - if version_match: - return version_match.group(1) - raise RuntimeError('Unable to find version string.') - - -setup( - name='nifcloud', - version=find_version('nifcloud', '__init__.py'), - description='Data-driven NIFCLOUD SDK for Python', - long_description=read('README.md'), - long_description_content_type='text/markdown', - author='Fujitsu', - url='https://github.com/nifcloud/nifcloud-sdk-python', - packages=find_packages(exclude=['tests*']), - package_data={'nifcloud': ['data/*.json', - 'data/*/*/*.json']}, - include_package_data=True, - install_requires=['botocore==1.37.10'], - license='Apache License 2.0', - classifiers=( - 'Development Status :: 5 - Production/Stable', - 'Intended Audience :: Developers', - 'Intended Audience :: System Administrators', - 'Natural Language :: English', - 'License :: OSI Approved :: Apache Software License', - 'Programming Language :: Python', - 'Programming Language :: Python :: 3', - 'Programming Language :: Python :: 3.8', - 'Programming Language :: Python :: 3.9', - 'Programming Language :: Python :: 3.10', - 'Programming Language :: Python :: 3.11', - 'Programming Language :: Python :: 3.12', - 'Programming Language :: Python :: 3.13', - ), -) diff --git a/uv.lock b/uv.lock new file mode 100644 index 0000000..862e48b --- /dev/null +++ b/uv.lock @@ -0,0 +1,1231 @@ +version = 1 +revision = 2 +requires-python = ">=3.8" +resolution-markers = [ + "python_full_version >= '3.10'", + "python_full_version == '3.9.*'", + "python_full_version >= '3.8.1' and python_full_version < '3.9'", + "python_full_version < '3.8.1'", +] + +[[package]] +name = "alabaster" +version = "0.7.13" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.8.1' and python_full_version < '3.9'", + "python_full_version < '3.8.1'", +] +sdist = { url = "https://files.pythonhosted.org/packages/94/71/a8ee96d1fd95ca04a0d2e2d9c4081dac4c2d2b12f7ddb899c8cb9bfd1532/alabaster-0.7.13.tar.gz", hash = "sha256:a27a4a084d5e690e16e01e03ad2b2e552c61a65469419b907243193de1a84ae2", size = 11454, upload_time = "2023-01-13T06:42:53.797Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/64/88/c7083fc61120ab661c5d0b82cb77079fc1429d3f913a456c1c82cf4658f7/alabaster-0.7.13-py3-none-any.whl", hash = "sha256:1ee19aca801bbabb5ba3f5f258e4422dfa86f82f3e9cefb0859b283cdd7f62a3", size = 13857, upload_time = "2023-01-13T06:42:52.336Z" }, +] + +[[package]] +name = "alabaster" +version = "0.7.16" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.10'", + "python_full_version == '3.9.*'", +] +sdist = { url = "https://files.pythonhosted.org/packages/c9/3e/13dd8e5ed9094e734ac430b5d0eb4f2bb001708a8b7856cbf8e084e001ba/alabaster-0.7.16.tar.gz", hash = "sha256:75a8b99c28a5dad50dd7f8ccdd447a121ddb3892da9e53d1ca5cca3106d58d65", size = 23776, upload_time = "2024-01-10T00:56:10.189Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/32/34/d4e1c02d3bee589efb5dfa17f88ea08bdb3e3eac12bc475462aec52ed223/alabaster-0.7.16-py3-none-any.whl", hash = "sha256:b46733c07dce03ae4e150330b975c75737fa60f0a7c591b6c8bf4928a28e2c92", size = 13511, upload_time = "2024-01-10T00:56:08.388Z" }, +] + +[[package]] +name = "babel" +version = "2.17.0" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "pytz", marker = "python_full_version < '3.9'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/7d/6b/d52e42361e1aa00709585ecc30b3f9684b3ab62530771402248b1b1d6240/babel-2.17.0.tar.gz", hash = "sha256:0c54cffb19f690cdcc52a3b50bcbf71e07a808d1c80d549f2459b9d2cf0afb9d", size = 9951852, upload_time = "2025-02-01T15:17:41.026Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/b7/b8/3fe70c75fe32afc4bb507f75563d39bc5642255d1d94f1f23604725780bf/babel-2.17.0-py3-none-any.whl", hash = "sha256:4d0b53093fdfb4b21c92b5213dba5a1b23885afa8383709427046b21c366e5f2", size = 10182537, upload_time = "2025-02-01T15:17:37.39Z" }, +] + +[[package]] +name = "botocore" +version = "1.37.10" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "jmespath" }, + { name = "python-dateutil" }, + { name = "urllib3", version = "1.26.20", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.10'" }, + { name = "urllib3", version = "2.5.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.10'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/6d/16/c782d8bb598da5e123cf6208bbe6527b5c391c81ae73f9fa7371a6f1820f/botocore-1.37.10.tar.gz", hash = "sha256:ab311982a9872eeb4e71906d3e3fcd2ba331a869d0fed16836ade7ce2e58bcea", size = 13636458, upload_time = "2025-03-10T19:26:18.773Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/56/82/86d1108838084cc591add7bf09762bdb0bbeeaf7f23e1a1b582b6f657978/botocore-1.37.10-py3-none-any.whl", hash = "sha256:7515c8dfaaf5ba02604db9cf73c172615afee976136f31d8aec628629f24029f", size = 13406391, upload_time = "2025-03-10T19:26:15.661Z" }, +] + +[[package]] +name = "certifi" +version = "2025.11.12" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/a2/8c/58f469717fa48465e4a50c014a0400602d3c437d7c0c468e17ada824da3a/certifi-2025.11.12.tar.gz", hash = "sha256:d8ab5478f2ecd78af242878415affce761ca6bc54a22a27e026d7c25357c3316", size = 160538, upload_time = "2025-11-12T02:54:51.517Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/70/7d/9bc192684cea499815ff478dfcdc13835ddf401365057044fb721ec6bddb/certifi-2025.11.12-py3-none-any.whl", hash = "sha256:97de8790030bbd5c2d96b7ec782fc2f7820ef8dba6db909ccf95449f2d062d4b", size = 159438, upload_time = "2025-11-12T02:54:49.735Z" }, +] + +[[package]] +name = "charset-normalizer" +version = "3.4.4" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/13/69/33ddede1939fdd074bce5434295f38fae7136463422fe4fd3e0e89b98062/charset_normalizer-3.4.4.tar.gz", hash = "sha256:94537985111c35f28720e43603b8e7b43a6ecfb2ce1d3058bbe955b73404e21a", size = 129418, upload_time = "2025-10-14T04:42:32.879Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/1f/b8/6d51fc1d52cbd52cd4ccedd5b5b2f0f6a11bbf6765c782298b0f3e808541/charset_normalizer-3.4.4-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:e824f1492727fa856dd6eda4f7cee25f8518a12f3c4a56a74e8095695089cf6d", size = 209709, upload_time = "2025-10-14T04:40:11.385Z" }, + { url = "https://files.pythonhosted.org/packages/5c/af/1f9d7f7faafe2ddfb6f72a2e07a548a629c61ad510fe60f9630309908fef/charset_normalizer-3.4.4-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:4bd5d4137d500351a30687c2d3971758aac9a19208fc110ccb9d7188fbe709e8", size = 148814, upload_time = "2025-10-14T04:40:13.135Z" }, + { url = "https://files.pythonhosted.org/packages/79/3d/f2e3ac2bbc056ca0c204298ea4e3d9db9b4afe437812638759db2c976b5f/charset_normalizer-3.4.4-cp310-cp310-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:027f6de494925c0ab2a55eab46ae5129951638a49a34d87f4c3eda90f696b4ad", size = 144467, upload_time = "2025-10-14T04:40:14.728Z" }, + { url = "https://files.pythonhosted.org/packages/ec/85/1bf997003815e60d57de7bd972c57dc6950446a3e4ccac43bc3070721856/charset_normalizer-3.4.4-cp310-cp310-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:f820802628d2694cb7e56db99213f930856014862f3fd943d290ea8438d07ca8", size = 162280, upload_time = "2025-10-14T04:40:16.14Z" }, + { url = "https://files.pythonhosted.org/packages/3e/8e/6aa1952f56b192f54921c436b87f2aaf7c7a7c3d0d1a765547d64fd83c13/charset_normalizer-3.4.4-cp310-cp310-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:798d75d81754988d2565bff1b97ba5a44411867c0cf32b77a7e8f8d84796b10d", size = 159454, upload_time = "2025-10-14T04:40:17.567Z" }, + { url = "https://files.pythonhosted.org/packages/36/3b/60cbd1f8e93aa25d1c669c649b7a655b0b5fb4c571858910ea9332678558/charset_normalizer-3.4.4-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:9d1bb833febdff5c8927f922386db610b49db6e0d4f4ee29601d71e7c2694313", size = 153609, upload_time = "2025-10-14T04:40:19.08Z" }, + { url = "https://files.pythonhosted.org/packages/64/91/6a13396948b8fd3c4b4fd5bc74d045f5637d78c9675585e8e9fbe5636554/charset_normalizer-3.4.4-cp310-cp310-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:9cd98cdc06614a2f768d2b7286d66805f94c48cde050acdbbb7db2600ab3197e", size = 151849, upload_time = "2025-10-14T04:40:20.607Z" }, + { url = "https://files.pythonhosted.org/packages/b7/7a/59482e28b9981d105691e968c544cc0df3b7d6133152fb3dcdc8f135da7a/charset_normalizer-3.4.4-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:077fbb858e903c73f6c9db43374fd213b0b6a778106bc7032446a8e8b5b38b93", size = 151586, upload_time = "2025-10-14T04:40:21.719Z" }, + { url = "https://files.pythonhosted.org/packages/92/59/f64ef6a1c4bdd2baf892b04cd78792ed8684fbc48d4c2afe467d96b4df57/charset_normalizer-3.4.4-cp310-cp310-musllinux_1_2_armv7l.whl", hash = "sha256:244bfb999c71b35de57821b8ea746b24e863398194a4014e4c76adc2bbdfeff0", size = 145290, upload_time = "2025-10-14T04:40:23.069Z" }, + { url = "https://files.pythonhosted.org/packages/6b/63/3bf9f279ddfa641ffa1962b0db6a57a9c294361cc2f5fcac997049a00e9c/charset_normalizer-3.4.4-cp310-cp310-musllinux_1_2_ppc64le.whl", hash = "sha256:64b55f9dce520635f018f907ff1b0df1fdc31f2795a922fb49dd14fbcdf48c84", size = 163663, upload_time = "2025-10-14T04:40:24.17Z" }, + { url = "https://files.pythonhosted.org/packages/ed/09/c9e38fc8fa9e0849b172b581fd9803bdf6e694041127933934184e19f8c3/charset_normalizer-3.4.4-cp310-cp310-musllinux_1_2_riscv64.whl", hash = "sha256:faa3a41b2b66b6e50f84ae4a68c64fcd0c44355741c6374813a800cd6695db9e", size = 151964, upload_time = "2025-10-14T04:40:25.368Z" }, + { url = "https://files.pythonhosted.org/packages/d2/d1/d28b747e512d0da79d8b6a1ac18b7ab2ecfd81b2944c4c710e166d8dd09c/charset_normalizer-3.4.4-cp310-cp310-musllinux_1_2_s390x.whl", hash = "sha256:6515f3182dbe4ea06ced2d9e8666d97b46ef4c75e326b79bb624110f122551db", size = 161064, upload_time = "2025-10-14T04:40:26.806Z" }, + { url = "https://files.pythonhosted.org/packages/bb/9a/31d62b611d901c3b9e5500c36aab0ff5eb442043fb3a1c254200d3d397d9/charset_normalizer-3.4.4-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:cc00f04ed596e9dc0da42ed17ac5e596c6ccba999ba6bd92b0e0aef2f170f2d6", size = 155015, upload_time = "2025-10-14T04:40:28.284Z" }, + { url = "https://files.pythonhosted.org/packages/1f/f3/107e008fa2bff0c8b9319584174418e5e5285fef32f79d8ee6a430d0039c/charset_normalizer-3.4.4-cp310-cp310-win32.whl", hash = "sha256:f34be2938726fc13801220747472850852fe6b1ea75869a048d6f896838c896f", size = 99792, upload_time = "2025-10-14T04:40:29.613Z" }, + { url = "https://files.pythonhosted.org/packages/eb/66/e396e8a408843337d7315bab30dbf106c38966f1819f123257f5520f8a96/charset_normalizer-3.4.4-cp310-cp310-win_amd64.whl", hash = "sha256:a61900df84c667873b292c3de315a786dd8dac506704dea57bc957bd31e22c7d", size = 107198, upload_time = "2025-10-14T04:40:30.644Z" }, + { url = "https://files.pythonhosted.org/packages/b5/58/01b4f815bf0312704c267f2ccb6e5d42bcc7752340cd487bc9f8c3710597/charset_normalizer-3.4.4-cp310-cp310-win_arm64.whl", hash = "sha256:cead0978fc57397645f12578bfd2d5ea9138ea0fac82b2f63f7f7c6877986a69", size = 100262, upload_time = "2025-10-14T04:40:32.108Z" }, + { url = "https://files.pythonhosted.org/packages/ed/27/c6491ff4954e58a10f69ad90aca8a1b6fe9c5d3c6f380907af3c37435b59/charset_normalizer-3.4.4-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:6e1fcf0720908f200cd21aa4e6750a48ff6ce4afe7ff5a79a90d5ed8a08296f8", size = 206988, upload_time = "2025-10-14T04:40:33.79Z" }, + { url = "https://files.pythonhosted.org/packages/94/59/2e87300fe67ab820b5428580a53cad894272dbb97f38a7a814a2a1ac1011/charset_normalizer-3.4.4-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:5f819d5fe9234f9f82d75bdfa9aef3a3d72c4d24a6e57aeaebba32a704553aa0", size = 147324, upload_time = "2025-10-14T04:40:34.961Z" }, + { url = "https://files.pythonhosted.org/packages/07/fb/0cf61dc84b2b088391830f6274cb57c82e4da8bbc2efeac8c025edb88772/charset_normalizer-3.4.4-cp311-cp311-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:a59cb51917aa591b1c4e6a43c132f0cdc3c76dbad6155df4e28ee626cc77a0a3", size = 142742, upload_time = "2025-10-14T04:40:36.105Z" }, + { url = "https://files.pythonhosted.org/packages/62/8b/171935adf2312cd745d290ed93cf16cf0dfe320863ab7cbeeae1dcd6535f/charset_normalizer-3.4.4-cp311-cp311-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:8ef3c867360f88ac904fd3f5e1f902f13307af9052646963ee08ff4f131adafc", size = 160863, upload_time = "2025-10-14T04:40:37.188Z" }, + { url = "https://files.pythonhosted.org/packages/09/73/ad875b192bda14f2173bfc1bc9a55e009808484a4b256748d931b6948442/charset_normalizer-3.4.4-cp311-cp311-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:d9e45d7faa48ee908174d8fe84854479ef838fc6a705c9315372eacbc2f02897", size = 157837, upload_time = "2025-10-14T04:40:38.435Z" }, + { url = "https://files.pythonhosted.org/packages/6d/fc/de9cce525b2c5b94b47c70a4b4fb19f871b24995c728e957ee68ab1671ea/charset_normalizer-3.4.4-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:840c25fb618a231545cbab0564a799f101b63b9901f2569faecd6b222ac72381", size = 151550, upload_time = "2025-10-14T04:40:40.053Z" }, + { url = "https://files.pythonhosted.org/packages/55/c2/43edd615fdfba8c6f2dfbd459b25a6b3b551f24ea21981e23fb768503ce1/charset_normalizer-3.4.4-cp311-cp311-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:ca5862d5b3928c4940729dacc329aa9102900382fea192fc5e52eb69d6093815", size = 149162, upload_time = "2025-10-14T04:40:41.163Z" }, + { url = "https://files.pythonhosted.org/packages/03/86/bde4ad8b4d0e9429a4e82c1e8f5c659993a9a863ad62c7df05cf7b678d75/charset_normalizer-3.4.4-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:d9c7f57c3d666a53421049053eaacdd14bbd0a528e2186fcb2e672effd053bb0", size = 150019, upload_time = "2025-10-14T04:40:42.276Z" }, + { url = "https://files.pythonhosted.org/packages/1f/86/a151eb2af293a7e7bac3a739b81072585ce36ccfb4493039f49f1d3cae8c/charset_normalizer-3.4.4-cp311-cp311-musllinux_1_2_armv7l.whl", hash = "sha256:277e970e750505ed74c832b4bf75dac7476262ee2a013f5574dd49075879e161", size = 143310, upload_time = "2025-10-14T04:40:43.439Z" }, + { url = "https://files.pythonhosted.org/packages/b5/fe/43dae6144a7e07b87478fdfc4dbe9efd5defb0e7ec29f5f58a55aeef7bf7/charset_normalizer-3.4.4-cp311-cp311-musllinux_1_2_ppc64le.whl", hash = "sha256:31fd66405eaf47bb62e8cd575dc621c56c668f27d46a61d975a249930dd5e2a4", size = 162022, upload_time = "2025-10-14T04:40:44.547Z" }, + { url = "https://files.pythonhosted.org/packages/80/e6/7aab83774f5d2bca81f42ac58d04caf44f0cc2b65fc6db2b3b2e8a05f3b3/charset_normalizer-3.4.4-cp311-cp311-musllinux_1_2_riscv64.whl", hash = "sha256:0d3d8f15c07f86e9ff82319b3d9ef6f4bf907608f53fe9d92b28ea9ae3d1fd89", size = 149383, upload_time = "2025-10-14T04:40:46.018Z" }, + { url = "https://files.pythonhosted.org/packages/4f/e8/b289173b4edae05c0dde07f69f8db476a0b511eac556dfe0d6bda3c43384/charset_normalizer-3.4.4-cp311-cp311-musllinux_1_2_s390x.whl", hash = "sha256:9f7fcd74d410a36883701fafa2482a6af2ff5ba96b9a620e9e0721e28ead5569", size = 159098, upload_time = "2025-10-14T04:40:47.081Z" }, + { url = "https://files.pythonhosted.org/packages/d8/df/fe699727754cae3f8478493c7f45f777b17c3ef0600e28abfec8619eb49c/charset_normalizer-3.4.4-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:ebf3e58c7ec8a8bed6d66a75d7fb37b55e5015b03ceae72a8e7c74495551e224", size = 152991, upload_time = "2025-10-14T04:40:48.246Z" }, + { url = "https://files.pythonhosted.org/packages/1a/86/584869fe4ddb6ffa3bd9f491b87a01568797fb9bd8933f557dba9771beaf/charset_normalizer-3.4.4-cp311-cp311-win32.whl", hash = "sha256:eecbc200c7fd5ddb9a7f16c7decb07b566c29fa2161a16cf67b8d068bd21690a", size = 99456, upload_time = "2025-10-14T04:40:49.376Z" }, + { url = "https://files.pythonhosted.org/packages/65/f6/62fdd5feb60530f50f7e38b4f6a1d5203f4d16ff4f9f0952962c044e919a/charset_normalizer-3.4.4-cp311-cp311-win_amd64.whl", hash = "sha256:5ae497466c7901d54b639cf42d5b8c1b6a4fead55215500d2f486d34db48d016", size = 106978, upload_time = "2025-10-14T04:40:50.844Z" }, + { url = "https://files.pythonhosted.org/packages/7a/9d/0710916e6c82948b3be62d9d398cb4fcf4e97b56d6a6aeccd66c4b2f2bd5/charset_normalizer-3.4.4-cp311-cp311-win_arm64.whl", hash = "sha256:65e2befcd84bc6f37095f5961e68a6f077bf44946771354a28ad434c2cce0ae1", size = 99969, upload_time = "2025-10-14T04:40:52.272Z" }, + { url = "https://files.pythonhosted.org/packages/f3/85/1637cd4af66fa687396e757dec650f28025f2a2f5a5531a3208dc0ec43f2/charset_normalizer-3.4.4-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:0a98e6759f854bd25a58a73fa88833fba3b7c491169f86ce1180c948ab3fd394", size = 208425, upload_time = "2025-10-14T04:40:53.353Z" }, + { url = "https://files.pythonhosted.org/packages/9d/6a/04130023fef2a0d9c62d0bae2649b69f7b7d8d24ea5536feef50551029df/charset_normalizer-3.4.4-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:b5b290ccc2a263e8d185130284f8501e3e36c5e02750fc6b6bdeb2e9e96f1e25", size = 148162, upload_time = "2025-10-14T04:40:54.558Z" }, + { url = "https://files.pythonhosted.org/packages/78/29/62328d79aa60da22c9e0b9a66539feae06ca0f5a4171ac4f7dc285b83688/charset_normalizer-3.4.4-cp312-cp312-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:74bb723680f9f7a6234dcf67aea57e708ec1fbdf5699fb91dfd6f511b0a320ef", size = 144558, upload_time = "2025-10-14T04:40:55.677Z" }, + { url = "https://files.pythonhosted.org/packages/86/bb/b32194a4bf15b88403537c2e120b817c61cd4ecffa9b6876e941c3ee38fe/charset_normalizer-3.4.4-cp312-cp312-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:f1e34719c6ed0b92f418c7c780480b26b5d9c50349e9a9af7d76bf757530350d", size = 161497, upload_time = "2025-10-14T04:40:57.217Z" }, + { url = "https://files.pythonhosted.org/packages/19/89/a54c82b253d5b9b111dc74aca196ba5ccfcca8242d0fb64146d4d3183ff1/charset_normalizer-3.4.4-cp312-cp312-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:2437418e20515acec67d86e12bf70056a33abdacb5cb1655042f6538d6b085a8", size = 159240, upload_time = "2025-10-14T04:40:58.358Z" }, + { url = "https://files.pythonhosted.org/packages/c0/10/d20b513afe03acc89ec33948320a5544d31f21b05368436d580dec4e234d/charset_normalizer-3.4.4-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:11d694519d7f29d6cd09f6ac70028dba10f92f6cdd059096db198c283794ac86", size = 153471, upload_time = "2025-10-14T04:40:59.468Z" }, + { url = "https://files.pythonhosted.org/packages/61/fa/fbf177b55bdd727010f9c0a3c49eefa1d10f960e5f09d1d887bf93c2e698/charset_normalizer-3.4.4-cp312-cp312-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:ac1c4a689edcc530fc9d9aa11f5774b9e2f33f9a0c6a57864e90908f5208d30a", size = 150864, upload_time = "2025-10-14T04:41:00.623Z" }, + { url = "https://files.pythonhosted.org/packages/05/12/9fbc6a4d39c0198adeebbde20b619790e9236557ca59fc40e0e3cebe6f40/charset_normalizer-3.4.4-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:21d142cc6c0ec30d2efee5068ca36c128a30b0f2c53c1c07bd78cb6bc1d3be5f", size = 150647, upload_time = "2025-10-14T04:41:01.754Z" }, + { url = "https://files.pythonhosted.org/packages/ad/1f/6a9a593d52e3e8c5d2b167daf8c6b968808efb57ef4c210acb907c365bc4/charset_normalizer-3.4.4-cp312-cp312-musllinux_1_2_armv7l.whl", hash = "sha256:5dbe56a36425d26d6cfb40ce79c314a2e4dd6211d51d6d2191c00bed34f354cc", size = 145110, upload_time = "2025-10-14T04:41:03.231Z" }, + { url = "https://files.pythonhosted.org/packages/30/42/9a52c609e72471b0fc54386dc63c3781a387bb4fe61c20231a4ebcd58bdd/charset_normalizer-3.4.4-cp312-cp312-musllinux_1_2_ppc64le.whl", hash = "sha256:5bfbb1b9acf3334612667b61bd3002196fe2a1eb4dd74d247e0f2a4d50ec9bbf", size = 162839, upload_time = "2025-10-14T04:41:04.715Z" }, + { url = "https://files.pythonhosted.org/packages/c4/5b/c0682bbf9f11597073052628ddd38344a3d673fda35a36773f7d19344b23/charset_normalizer-3.4.4-cp312-cp312-musllinux_1_2_riscv64.whl", hash = "sha256:d055ec1e26e441f6187acf818b73564e6e6282709e9bcb5b63f5b23068356a15", size = 150667, upload_time = "2025-10-14T04:41:05.827Z" }, + { url = "https://files.pythonhosted.org/packages/e4/24/a41afeab6f990cf2daf6cb8c67419b63b48cf518e4f56022230840c9bfb2/charset_normalizer-3.4.4-cp312-cp312-musllinux_1_2_s390x.whl", hash = "sha256:af2d8c67d8e573d6de5bc30cdb27e9b95e49115cd9baad5ddbd1a6207aaa82a9", size = 160535, upload_time = "2025-10-14T04:41:06.938Z" }, + { url = "https://files.pythonhosted.org/packages/2a/e5/6a4ce77ed243c4a50a1fecca6aaaab419628c818a49434be428fe24c9957/charset_normalizer-3.4.4-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:780236ac706e66881f3b7f2f32dfe90507a09e67d1d454c762cf642e6e1586e0", size = 154816, upload_time = "2025-10-14T04:41:08.101Z" }, + { url = "https://files.pythonhosted.org/packages/a8/ef/89297262b8092b312d29cdb2517cb1237e51db8ecef2e9af5edbe7b683b1/charset_normalizer-3.4.4-cp312-cp312-win32.whl", hash = "sha256:5833d2c39d8896e4e19b689ffc198f08ea58116bee26dea51e362ecc7cd3ed26", size = 99694, upload_time = "2025-10-14T04:41:09.23Z" }, + { url = "https://files.pythonhosted.org/packages/3d/2d/1e5ed9dd3b3803994c155cd9aacb60c82c331bad84daf75bcb9c91b3295e/charset_normalizer-3.4.4-cp312-cp312-win_amd64.whl", hash = "sha256:a79cfe37875f822425b89a82333404539ae63dbdddf97f84dcbc3d339aae9525", size = 107131, upload_time = "2025-10-14T04:41:10.467Z" }, + { url = "https://files.pythonhosted.org/packages/d0/d9/0ed4c7098a861482a7b6a95603edce4c0d9db2311af23da1fb2b75ec26fc/charset_normalizer-3.4.4-cp312-cp312-win_arm64.whl", hash = "sha256:376bec83a63b8021bb5c8ea75e21c4ccb86e7e45ca4eb81146091b56599b80c3", size = 100390, upload_time = "2025-10-14T04:41:11.915Z" }, + { url = "https://files.pythonhosted.org/packages/97/45/4b3a1239bbacd321068ea6e7ac28875b03ab8bc0aa0966452db17cd36714/charset_normalizer-3.4.4-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:e1f185f86a6f3403aa2420e815904c67b2f9ebc443f045edd0de921108345794", size = 208091, upload_time = "2025-10-14T04:41:13.346Z" }, + { url = "https://files.pythonhosted.org/packages/7d/62/73a6d7450829655a35bb88a88fca7d736f9882a27eacdca2c6d505b57e2e/charset_normalizer-3.4.4-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:6b39f987ae8ccdf0d2642338faf2abb1862340facc796048b604ef14919e55ed", size = 147936, upload_time = "2025-10-14T04:41:14.461Z" }, + { url = "https://files.pythonhosted.org/packages/89/c5/adb8c8b3d6625bef6d88b251bbb0d95f8205831b987631ab0c8bb5d937c2/charset_normalizer-3.4.4-cp313-cp313-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:3162d5d8ce1bb98dd51af660f2121c55d0fa541b46dff7bb9b9f86ea1d87de72", size = 144180, upload_time = "2025-10-14T04:41:15.588Z" }, + { url = "https://files.pythonhosted.org/packages/91/ed/9706e4070682d1cc219050b6048bfd293ccf67b3d4f5a4f39207453d4b99/charset_normalizer-3.4.4-cp313-cp313-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:81d5eb2a312700f4ecaa977a8235b634ce853200e828fbadf3a9c50bab278328", size = 161346, upload_time = "2025-10-14T04:41:16.738Z" }, + { url = "https://files.pythonhosted.org/packages/d5/0d/031f0d95e4972901a2f6f09ef055751805ff541511dc1252ba3ca1f80cf5/charset_normalizer-3.4.4-cp313-cp313-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:5bd2293095d766545ec1a8f612559f6b40abc0eb18bb2f5d1171872d34036ede", size = 158874, upload_time = "2025-10-14T04:41:17.923Z" }, + { url = "https://files.pythonhosted.org/packages/f5/83/6ab5883f57c9c801ce5e5677242328aa45592be8a00644310a008d04f922/charset_normalizer-3.4.4-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:a8a8b89589086a25749f471e6a900d3f662d1d3b6e2e59dcecf787b1cc3a1894", size = 153076, upload_time = "2025-10-14T04:41:19.106Z" }, + { url = "https://files.pythonhosted.org/packages/75/1e/5ff781ddf5260e387d6419959ee89ef13878229732732ee73cdae01800f2/charset_normalizer-3.4.4-cp313-cp313-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:bc7637e2f80d8530ee4a78e878bce464f70087ce73cf7c1caf142416923b98f1", size = 150601, upload_time = "2025-10-14T04:41:20.245Z" }, + { url = "https://files.pythonhosted.org/packages/d7/57/71be810965493d3510a6ca79b90c19e48696fb1ff964da319334b12677f0/charset_normalizer-3.4.4-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:f8bf04158c6b607d747e93949aa60618b61312fe647a6369f88ce2ff16043490", size = 150376, upload_time = "2025-10-14T04:41:21.398Z" }, + { url = "https://files.pythonhosted.org/packages/e5/d5/c3d057a78c181d007014feb7e9f2e65905a6c4ef182c0ddf0de2924edd65/charset_normalizer-3.4.4-cp313-cp313-musllinux_1_2_armv7l.whl", hash = "sha256:554af85e960429cf30784dd47447d5125aaa3b99a6f0683589dbd27e2f45da44", size = 144825, upload_time = "2025-10-14T04:41:22.583Z" }, + { url = "https://files.pythonhosted.org/packages/e6/8c/d0406294828d4976f275ffbe66f00266c4b3136b7506941d87c00cab5272/charset_normalizer-3.4.4-cp313-cp313-musllinux_1_2_ppc64le.whl", hash = "sha256:74018750915ee7ad843a774364e13a3db91682f26142baddf775342c3f5b1133", size = 162583, upload_time = "2025-10-14T04:41:23.754Z" }, + { url = "https://files.pythonhosted.org/packages/d7/24/e2aa1f18c8f15c4c0e932d9287b8609dd30ad56dbe41d926bd846e22fb8d/charset_normalizer-3.4.4-cp313-cp313-musllinux_1_2_riscv64.whl", hash = "sha256:c0463276121fdee9c49b98908b3a89c39be45d86d1dbaa22957e38f6321d4ce3", size = 150366, upload_time = "2025-10-14T04:41:25.27Z" }, + { url = "https://files.pythonhosted.org/packages/e4/5b/1e6160c7739aad1e2df054300cc618b06bf784a7a164b0f238360721ab86/charset_normalizer-3.4.4-cp313-cp313-musllinux_1_2_s390x.whl", hash = "sha256:362d61fd13843997c1c446760ef36f240cf81d3ebf74ac62652aebaf7838561e", size = 160300, upload_time = "2025-10-14T04:41:26.725Z" }, + { url = "https://files.pythonhosted.org/packages/7a/10/f882167cd207fbdd743e55534d5d9620e095089d176d55cb22d5322f2afd/charset_normalizer-3.4.4-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:9a26f18905b8dd5d685d6d07b0cdf98a79f3c7a918906af7cc143ea2e164c8bc", size = 154465, upload_time = "2025-10-14T04:41:28.322Z" }, + { url = "https://files.pythonhosted.org/packages/89/66/c7a9e1b7429be72123441bfdbaf2bc13faab3f90b933f664db506dea5915/charset_normalizer-3.4.4-cp313-cp313-win32.whl", hash = "sha256:9b35f4c90079ff2e2edc5b26c0c77925e5d2d255c42c74fdb70fb49b172726ac", size = 99404, upload_time = "2025-10-14T04:41:29.95Z" }, + { url = "https://files.pythonhosted.org/packages/c4/26/b9924fa27db384bdcd97ab83b4f0a8058d96ad9626ead570674d5e737d90/charset_normalizer-3.4.4-cp313-cp313-win_amd64.whl", hash = "sha256:b435cba5f4f750aa6c0a0d92c541fb79f69a387c91e61f1795227e4ed9cece14", size = 107092, upload_time = "2025-10-14T04:41:31.188Z" }, + { url = "https://files.pythonhosted.org/packages/af/8f/3ed4bfa0c0c72a7ca17f0380cd9e4dd842b09f664e780c13cff1dcf2ef1b/charset_normalizer-3.4.4-cp313-cp313-win_arm64.whl", hash = "sha256:542d2cee80be6f80247095cc36c418f7bddd14f4a6de45af91dfad36d817bba2", size = 100408, upload_time = "2025-10-14T04:41:32.624Z" }, + { url = "https://files.pythonhosted.org/packages/2a/35/7051599bd493e62411d6ede36fd5af83a38f37c4767b92884df7301db25d/charset_normalizer-3.4.4-cp314-cp314-macosx_10_13_universal2.whl", hash = "sha256:da3326d9e65ef63a817ecbcc0df6e94463713b754fe293eaa03da99befb9a5bd", size = 207746, upload_time = "2025-10-14T04:41:33.773Z" }, + { url = "https://files.pythonhosted.org/packages/10/9a/97c8d48ef10d6cd4fcead2415523221624bf58bcf68a802721a6bc807c8f/charset_normalizer-3.4.4-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:8af65f14dc14a79b924524b1e7fffe304517b2bff5a58bf64f30b98bbc5079eb", size = 147889, upload_time = "2025-10-14T04:41:34.897Z" }, + { url = "https://files.pythonhosted.org/packages/10/bf/979224a919a1b606c82bd2c5fa49b5c6d5727aa47b4312bb27b1734f53cd/charset_normalizer-3.4.4-cp314-cp314-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:74664978bb272435107de04e36db5a9735e78232b85b77d45cfb38f758efd33e", size = 143641, upload_time = "2025-10-14T04:41:36.116Z" }, + { url = "https://files.pythonhosted.org/packages/ba/33/0ad65587441fc730dc7bd90e9716b30b4702dc7b617e6ba4997dc8651495/charset_normalizer-3.4.4-cp314-cp314-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:752944c7ffbfdd10c074dc58ec2d5a8a4cd9493b314d367c14d24c17684ddd14", size = 160779, upload_time = "2025-10-14T04:41:37.229Z" }, + { url = "https://files.pythonhosted.org/packages/67/ed/331d6b249259ee71ddea93f6f2f0a56cfebd46938bde6fcc6f7b9a3d0e09/charset_normalizer-3.4.4-cp314-cp314-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:d1f13550535ad8cff21b8d757a3257963e951d96e20ec82ab44bc64aeb62a191", size = 159035, upload_time = "2025-10-14T04:41:38.368Z" }, + { url = "https://files.pythonhosted.org/packages/67/ff/f6b948ca32e4f2a4576aa129d8bed61f2e0543bf9f5f2b7fc3758ed005c9/charset_normalizer-3.4.4-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:ecaae4149d99b1c9e7b88bb03e3221956f68fd6d50be2ef061b2381b61d20838", size = 152542, upload_time = "2025-10-14T04:41:39.862Z" }, + { url = "https://files.pythonhosted.org/packages/16/85/276033dcbcc369eb176594de22728541a925b2632f9716428c851b149e83/charset_normalizer-3.4.4-cp314-cp314-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:cb6254dc36b47a990e59e1068afacdcd02958bdcce30bb50cc1700a8b9d624a6", size = 149524, upload_time = "2025-10-14T04:41:41.319Z" }, + { url = "https://files.pythonhosted.org/packages/9e/f2/6a2a1f722b6aba37050e626530a46a68f74e63683947a8acff92569f979a/charset_normalizer-3.4.4-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:c8ae8a0f02f57a6e61203a31428fa1d677cbe50c93622b4149d5c0f319c1d19e", size = 150395, upload_time = "2025-10-14T04:41:42.539Z" }, + { url = "https://files.pythonhosted.org/packages/60/bb/2186cb2f2bbaea6338cad15ce23a67f9b0672929744381e28b0592676824/charset_normalizer-3.4.4-cp314-cp314-musllinux_1_2_armv7l.whl", hash = "sha256:47cc91b2f4dd2833fddaedd2893006b0106129d4b94fdb6af1f4ce5a9965577c", size = 143680, upload_time = "2025-10-14T04:41:43.661Z" }, + { url = "https://files.pythonhosted.org/packages/7d/a5/bf6f13b772fbb2a90360eb620d52ed8f796f3c5caee8398c3b2eb7b1c60d/charset_normalizer-3.4.4-cp314-cp314-musllinux_1_2_ppc64le.whl", hash = "sha256:82004af6c302b5d3ab2cfc4cc5f29db16123b1a8417f2e25f9066f91d4411090", size = 162045, upload_time = "2025-10-14T04:41:44.821Z" }, + { url = "https://files.pythonhosted.org/packages/df/c5/d1be898bf0dc3ef9030c3825e5d3b83f2c528d207d246cbabe245966808d/charset_normalizer-3.4.4-cp314-cp314-musllinux_1_2_riscv64.whl", hash = "sha256:2b7d8f6c26245217bd2ad053761201e9f9680f8ce52f0fcd8d0755aeae5b2152", size = 149687, upload_time = "2025-10-14T04:41:46.442Z" }, + { url = "https://files.pythonhosted.org/packages/a5/42/90c1f7b9341eef50c8a1cb3f098ac43b0508413f33affd762855f67a410e/charset_normalizer-3.4.4-cp314-cp314-musllinux_1_2_s390x.whl", hash = "sha256:799a7a5e4fb2d5898c60b640fd4981d6a25f1c11790935a44ce38c54e985f828", size = 160014, upload_time = "2025-10-14T04:41:47.631Z" }, + { url = "https://files.pythonhosted.org/packages/76/be/4d3ee471e8145d12795ab655ece37baed0929462a86e72372fd25859047c/charset_normalizer-3.4.4-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:99ae2cffebb06e6c22bdc25801d7b30f503cc87dbd283479e7b606f70aff57ec", size = 154044, upload_time = "2025-10-14T04:41:48.81Z" }, + { url = "https://files.pythonhosted.org/packages/b0/6f/8f7af07237c34a1defe7defc565a9bc1807762f672c0fde711a4b22bf9c0/charset_normalizer-3.4.4-cp314-cp314-win32.whl", hash = "sha256:f9d332f8c2a2fcbffe1378594431458ddbef721c1769d78e2cbc06280d8155f9", size = 99940, upload_time = "2025-10-14T04:41:49.946Z" }, + { url = "https://files.pythonhosted.org/packages/4b/51/8ade005e5ca5b0d80fb4aff72a3775b325bdc3d27408c8113811a7cbe640/charset_normalizer-3.4.4-cp314-cp314-win_amd64.whl", hash = "sha256:8a6562c3700cce886c5be75ade4a5db4214fda19fede41d9792d100288d8f94c", size = 107104, upload_time = "2025-10-14T04:41:51.051Z" }, + { url = "https://files.pythonhosted.org/packages/da/5f/6b8f83a55bb8278772c5ae54a577f3099025f9ade59d0136ac24a0df4bde/charset_normalizer-3.4.4-cp314-cp314-win_arm64.whl", hash = "sha256:de00632ca48df9daf77a2c65a484531649261ec9f25489917f09e455cb09ddb2", size = 100743, upload_time = "2025-10-14T04:41:52.122Z" }, + { url = "https://files.pythonhosted.org/packages/0a/4e/3926a1c11f0433791985727965263f788af00db3482d89a7545ca5ecc921/charset_normalizer-3.4.4-cp38-cp38-macosx_10_9_universal2.whl", hash = "sha256:ce8a0633f41a967713a59c4139d29110c07e826d131a316b50ce11b1d79b4f84", size = 198599, upload_time = "2025-10-14T04:41:53.213Z" }, + { url = "https://files.pythonhosted.org/packages/ec/7c/b92d1d1dcffc34592e71ea19c882b6709e43d20fa498042dea8b815638d7/charset_normalizer-3.4.4-cp38-cp38-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:eaabd426fe94daf8fd157c32e571c85cb12e66692f15516a83a03264b08d06c3", size = 143090, upload_time = "2025-10-14T04:41:54.385Z" }, + { url = "https://files.pythonhosted.org/packages/84/ce/61a28d3bb77281eb24107b937a497f3c43089326d27832a63dcedaab0478/charset_normalizer-3.4.4-cp38-cp38-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:c4ef880e27901b6cc782f1b95f82da9313c0eb95c3af699103088fa0ac3ce9ac", size = 139490, upload_time = "2025-10-14T04:41:55.551Z" }, + { url = "https://files.pythonhosted.org/packages/c0/bd/c9e59a91b2061c6f8bb98a150670cb16d4cd7c4ba7d11ad0cdf789155f41/charset_normalizer-3.4.4-cp38-cp38-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:2aaba3b0819274cc41757a1da876f810a3e4d7b6eb25699253a4effef9e8e4af", size = 155334, upload_time = "2025-10-14T04:41:56.724Z" }, + { url = "https://files.pythonhosted.org/packages/bf/37/f17ae176a80f22ff823456af91ba3bc59df308154ff53aef0d39eb3d3419/charset_normalizer-3.4.4-cp38-cp38-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:778d2e08eda00f4256d7f672ca9fef386071c9202f5e4607920b86d7803387f2", size = 152823, upload_time = "2025-10-14T04:41:58.236Z" }, + { url = "https://files.pythonhosted.org/packages/bf/fa/cf5bb2409a385f78750e78c8d2e24780964976acdaaed65dbd6083ae5b40/charset_normalizer-3.4.4-cp38-cp38-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:f155a433c2ec037d4e8df17d18922c3a0d9b3232a396690f17175d2946f0218d", size = 147618, upload_time = "2025-10-14T04:41:59.409Z" }, + { url = "https://files.pythonhosted.org/packages/9b/63/579784a65bc7de2d4518d40bb8f1870900163e86f17f21fd1384318c459d/charset_normalizer-3.4.4-cp38-cp38-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:a8bf8d0f749c5757af2142fe7903a9df1d2e8aa3841559b2bad34b08d0e2bcf3", size = 145516, upload_time = "2025-10-14T04:42:00.579Z" }, + { url = "https://files.pythonhosted.org/packages/a3/a9/94ec6266cd394e8f93a4d69cca651d61bf6ac58d2a0422163b30c698f2c7/charset_normalizer-3.4.4-cp38-cp38-musllinux_1_2_aarch64.whl", hash = "sha256:194f08cbb32dc406d6e1aea671a68be0823673db2832b38405deba2fb0d88f63", size = 145266, upload_time = "2025-10-14T04:42:01.684Z" }, + { url = "https://files.pythonhosted.org/packages/09/14/d6626eb97764b58c2779fa7928fa7d1a49adb8ce687c2dbba4db003c1939/charset_normalizer-3.4.4-cp38-cp38-musllinux_1_2_armv7l.whl", hash = "sha256:6aee717dcfead04c6eb1ce3bd29ac1e22663cdea57f943c87d1eab9a025438d7", size = 139559, upload_time = "2025-10-14T04:42:02.902Z" }, + { url = "https://files.pythonhosted.org/packages/09/01/ddbe6b01313ba191dbb0a43c7563bc770f2448c18127f9ea4b119c44dff0/charset_normalizer-3.4.4-cp38-cp38-musllinux_1_2_ppc64le.whl", hash = "sha256:cd4b7ca9984e5e7985c12bc60a6f173f3c958eae74f3ef6624bb6b26e2abbae4", size = 156653, upload_time = "2025-10-14T04:42:04.005Z" }, + { url = "https://files.pythonhosted.org/packages/95/c8/d05543378bea89296e9af4510b44c704626e191da447235c8fdedfc5b7b2/charset_normalizer-3.4.4-cp38-cp38-musllinux_1_2_riscv64.whl", hash = "sha256:b7cf1017d601aa35e6bb650b6ad28652c9cd78ee6caff19f3c28d03e1c80acbf", size = 145644, upload_time = "2025-10-14T04:42:05.211Z" }, + { url = "https://files.pythonhosted.org/packages/72/01/2866c4377998ef8a1f6802f6431e774a4c8ebe75b0a6e569ceec55c9cbfb/charset_normalizer-3.4.4-cp38-cp38-musllinux_1_2_s390x.whl", hash = "sha256:e912091979546adf63357d7e2ccff9b44f026c075aeaf25a52d0e95ad2281074", size = 153964, upload_time = "2025-10-14T04:42:06.341Z" }, + { url = "https://files.pythonhosted.org/packages/4a/66/66c72468a737b4cbd7851ba2c522fe35c600575fbeac944460b4fd4a06fe/charset_normalizer-3.4.4-cp38-cp38-musllinux_1_2_x86_64.whl", hash = "sha256:5cb4d72eea50c8868f5288b7f7f33ed276118325c1dfd3957089f6b519e1382a", size = 148777, upload_time = "2025-10-14T04:42:07.535Z" }, + { url = "https://files.pythonhosted.org/packages/50/94/d0d56677fdddbffa8ca00ec411f67bb8c947f9876374ddc9d160d4f2c4b3/charset_normalizer-3.4.4-cp38-cp38-win32.whl", hash = "sha256:837c2ce8c5a65a2035be9b3569c684358dfbf109fd3b6969630a87535495ceaa", size = 98687, upload_time = "2025-10-14T04:42:08.678Z" }, + { url = "https://files.pythonhosted.org/packages/00/64/c3bc303d1b586480b1c8e6e1e2191a6d6dd40255244e5cf16763dcec52e6/charset_normalizer-3.4.4-cp38-cp38-win_amd64.whl", hash = "sha256:44c2a8734b333e0578090c4cd6b16f275e07aa6614ca8715e6c038e865e70576", size = 106115, upload_time = "2025-10-14T04:42:09.793Z" }, + { url = "https://files.pythonhosted.org/packages/46/7c/0c4760bccf082737ca7ab84a4c2034fcc06b1f21cf3032ea98bd6feb1725/charset_normalizer-3.4.4-cp39-cp39-macosx_10_9_universal2.whl", hash = "sha256:a9768c477b9d7bd54bc0c86dbaebdec6f03306675526c9927c0e8a04e8f94af9", size = 209609, upload_time = "2025-10-14T04:42:10.922Z" }, + { url = "https://files.pythonhosted.org/packages/bb/a4/69719daef2f3d7f1819de60c9a6be981b8eeead7542d5ec4440f3c80e111/charset_normalizer-3.4.4-cp39-cp39-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:1bee1e43c28aa63cb16e5c14e582580546b08e535299b8b6158a7c9c768a1f3d", size = 149029, upload_time = "2025-10-14T04:42:12.38Z" }, + { url = "https://files.pythonhosted.org/packages/e6/21/8d4e1d6c1e6070d3672908b8e4533a71b5b53e71d16828cc24d0efec564c/charset_normalizer-3.4.4-cp39-cp39-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:fd44c878ea55ba351104cb93cc85e74916eb8fa440ca7903e57575e97394f608", size = 144580, upload_time = "2025-10-14T04:42:13.549Z" }, + { url = "https://files.pythonhosted.org/packages/a7/0a/a616d001b3f25647a9068e0b9199f697ce507ec898cacb06a0d5a1617c99/charset_normalizer-3.4.4-cp39-cp39-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:0f04b14ffe5fdc8c4933862d8306109a2c51e0704acfa35d51598eb45a1e89fc", size = 162340, upload_time = "2025-10-14T04:42:14.892Z" }, + { url = "https://files.pythonhosted.org/packages/85/93/060b52deb249a5450460e0585c88a904a83aec474ab8e7aba787f45e79f2/charset_normalizer-3.4.4-cp39-cp39-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:cd09d08005f958f370f539f186d10aec3377d55b9eeb0d796025d4886119d76e", size = 159619, upload_time = "2025-10-14T04:42:16.676Z" }, + { url = "https://files.pythonhosted.org/packages/dd/21/0274deb1cc0632cd587a9a0ec6b4674d9108e461cb4cd40d457adaeb0564/charset_normalizer-3.4.4-cp39-cp39-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:4fe7859a4e3e8457458e2ff592f15ccb02f3da787fcd31e0183879c3ad4692a1", size = 153980, upload_time = "2025-10-14T04:42:17.917Z" }, + { url = "https://files.pythonhosted.org/packages/28/2b/e3d7d982858dccc11b31906976323d790dded2017a0572f093ff982d692f/charset_normalizer-3.4.4-cp39-cp39-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:fa09f53c465e532f4d3db095e0c55b615f010ad81803d383195b6b5ca6cbf5f3", size = 152174, upload_time = "2025-10-14T04:42:19.018Z" }, + { url = "https://files.pythonhosted.org/packages/6e/ff/4a269f8e35f1e58b2df52c131a1fa019acb7ef3f8697b7d464b07e9b492d/charset_normalizer-3.4.4-cp39-cp39-musllinux_1_2_aarch64.whl", hash = "sha256:7fa17817dc5625de8a027cb8b26d9fefa3ea28c8253929b8d6649e705d2835b6", size = 151666, upload_time = "2025-10-14T04:42:20.171Z" }, + { url = "https://files.pythonhosted.org/packages/da/c9/ec39870f0b330d58486001dd8e532c6b9a905f5765f58a6f8204926b4a93/charset_normalizer-3.4.4-cp39-cp39-musllinux_1_2_armv7l.whl", hash = "sha256:5947809c8a2417be3267efc979c47d76a079758166f7d43ef5ae8e9f92751f88", size = 145550, upload_time = "2025-10-14T04:42:21.324Z" }, + { url = "https://files.pythonhosted.org/packages/75/8f/d186ab99e40e0ed9f82f033d6e49001701c81244d01905dd4a6924191a30/charset_normalizer-3.4.4-cp39-cp39-musllinux_1_2_ppc64le.whl", hash = "sha256:4902828217069c3c5c71094537a8e623f5d097858ac6ca8252f7b4d10b7560f1", size = 163721, upload_time = "2025-10-14T04:42:22.46Z" }, + { url = "https://files.pythonhosted.org/packages/96/b1/6047663b9744df26a7e479ac1e77af7134b1fcf9026243bb48ee2d18810f/charset_normalizer-3.4.4-cp39-cp39-musllinux_1_2_riscv64.whl", hash = "sha256:7c308f7e26e4363d79df40ca5b2be1c6ba9f02bdbccfed5abddb7859a6ce72cf", size = 152127, upload_time = "2025-10-14T04:42:23.712Z" }, + { url = "https://files.pythonhosted.org/packages/59/78/e5a6eac9179f24f704d1be67d08704c3c6ab9f00963963524be27c18ed87/charset_normalizer-3.4.4-cp39-cp39-musllinux_1_2_s390x.whl", hash = "sha256:2c9d3c380143a1fedbff95a312aa798578371eb29da42106a29019368a475318", size = 161175, upload_time = "2025-10-14T04:42:24.87Z" }, + { url = "https://files.pythonhosted.org/packages/e5/43/0e626e42d54dd2f8dd6fc5e1c5ff00f05fbca17cb699bedead2cae69c62f/charset_normalizer-3.4.4-cp39-cp39-musllinux_1_2_x86_64.whl", hash = "sha256:cb01158d8b88ee68f15949894ccc6712278243d95f344770fa7593fa2d94410c", size = 155375, upload_time = "2025-10-14T04:42:27.246Z" }, + { url = "https://files.pythonhosted.org/packages/e9/91/d9615bf2e06f35e4997616ff31248c3657ed649c5ab9d35ea12fce54e380/charset_normalizer-3.4.4-cp39-cp39-win32.whl", hash = "sha256:2677acec1a2f8ef614c6888b5b4ae4060cc184174a938ed4e8ef690e15d3e505", size = 99692, upload_time = "2025-10-14T04:42:28.425Z" }, + { url = "https://files.pythonhosted.org/packages/d1/a9/6c040053909d9d1ef4fcab45fddec083aedc9052c10078339b47c8573ea8/charset_normalizer-3.4.4-cp39-cp39-win_amd64.whl", hash = "sha256:f8e160feb2aed042cd657a72acc0b481212ed28b1b9a95c0cee1621b524e1966", size = 107192, upload_time = "2025-10-14T04:42:29.482Z" }, + { url = "https://files.pythonhosted.org/packages/f0/c6/4fa536b2c0cd3edfb7ccf8469fa0f363ea67b7213a842b90909ca33dd851/charset_normalizer-3.4.4-cp39-cp39-win_arm64.whl", hash = "sha256:b5d84d37db046c5ca74ee7bb47dd6cbc13f80665fdde3e8040bdd3fb015ecb50", size = 100220, upload_time = "2025-10-14T04:42:30.632Z" }, + { url = "https://files.pythonhosted.org/packages/0a/4c/925909008ed5a988ccbb72dcc897407e5d6d3bd72410d69e051fc0c14647/charset_normalizer-3.4.4-py3-none-any.whl", hash = "sha256:7a32c560861a02ff789ad905a2fe94e3f840803362c84fecf1851cb4cf3dc37f", size = 53402, upload_time = "2025-10-14T04:42:31.76Z" }, +] + +[[package]] +name = "colorama" +version = "0.4.6" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/d8/53/6f443c9a4a8358a93a6792e2acffb9d9d5cb0a5cfd8802644b7b1c9a02e4/colorama-0.4.6.tar.gz", hash = "sha256:08695f5cb7ed6e0531a20572697297273c47b8cae5a63ffc6d6ed5c201be6e44", size = 27697, upload_time = "2022-10-25T02:36:22.414Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/d1/d6/3965ed04c63042e047cb6a3e6ed1a63a35087b6a609aa3a15ed8ac56c221/colorama-0.4.6-py2.py3-none-any.whl", hash = "sha256:4f1d9991f5acc0ca119f9d443620b77f9d6b33703e51011c16baf57afb285fc6", size = 25335, upload_time = "2022-10-25T02:36:20.889Z" }, +] + +[[package]] +name = "docutils" +version = "0.19" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/6b/5c/330ea8d383eb2ce973df34d1239b3b21e91cd8c865d21ff82902d952f91f/docutils-0.19.tar.gz", hash = "sha256:33995a6753c30b7f577febfc2c50411fec6aac7f7ffeb7c4cfe5991072dcf9e6", size = 2056383, upload_time = "2022-07-05T20:17:31.045Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/93/69/e391bd51bc08ed9141ecd899a0ddb61ab6465309f1eb470905c0c8868081/docutils-0.19-py3-none-any.whl", hash = "sha256:5e1de4d849fee02c63b040a4a3fd567f4ab104defd8a5511fbbc24a8a017efbc", size = 570472, upload_time = "2022-07-05T20:17:26.388Z" }, +] + +[[package]] +name = "exceptiongroup" +version = "1.3.1" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "typing-extensions", version = "4.13.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, + { name = "typing-extensions", version = "4.15.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.9' and python_full_version < '3.13'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/50/79/66800aadf48771f6b62f7eb014e352e5d06856655206165d775e675a02c9/exceptiongroup-1.3.1.tar.gz", hash = "sha256:8b412432c6055b0b7d14c310000ae93352ed6754f70fa8f7c34141f91c4e3219", size = 30371, upload_time = "2025-11-21T23:01:54.787Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/8a/0e/97c33bf5009bdbac74fd2beace167cab3f978feb69cc36f1ef79360d6c4e/exceptiongroup-1.3.1-py3-none-any.whl", hash = "sha256:a7a39a3bd276781e98394987d3a5701d0c4edffb633bb7a5144577f82c773598", size = 16740, upload_time = "2025-11-21T23:01:53.443Z" }, +] + +[[package]] +name = "flake8" +version = "5.0.4" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version < '3.8.1'", +] +dependencies = [ + { name = "mccabe", marker = "python_full_version < '3.8.1'" }, + { name = "pycodestyle", version = "2.9.1", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.8.1'" }, + { name = "pyflakes", version = "2.5.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.8.1'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/ad/00/9808c62b2d529cefc69ce4e4a1ea42c0f855effa55817b7327ec5b75e60a/flake8-5.0.4.tar.gz", hash = "sha256:6fbe320aad8d6b95cec8b8e47bc933004678dc63095be98528b7bdd2a9f510db", size = 145862, upload_time = "2022-08-03T23:21:27.108Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/cf/a0/b881b63a17a59d9d07f5c0cc91a29182c8e8a9aa2bde5b3b2b16519c02f4/flake8-5.0.4-py2.py3-none-any.whl", hash = "sha256:7a1cf6b73744f5806ab95e526f6f0d8c01c66d7bbe349562d22dfca20610b248", size = 61897, upload_time = "2022-08-03T23:21:25.027Z" }, +] + +[[package]] +name = "flake8" +version = "7.1.2" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.8.1' and python_full_version < '3.9'", +] +dependencies = [ + { name = "mccabe", marker = "python_full_version >= '3.8.1' and python_full_version < '3.9'" }, + { name = "pycodestyle", version = "2.12.1", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.8.1' and python_full_version < '3.9'" }, + { name = "pyflakes", version = "3.2.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.8.1' and python_full_version < '3.9'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/58/16/3f2a0bb700ad65ac9663262905a025917c020a3f92f014d2ba8964b4602c/flake8-7.1.2.tar.gz", hash = "sha256:c586ffd0b41540951ae41af572e6790dbd49fc12b3aa2541685d253d9bd504bd", size = 48119, upload_time = "2025-02-16T18:45:44.296Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/35/f8/08d37b2cd89da306e3520bd27f8a85692122b42b56c0c2c3784ff09c022f/flake8-7.1.2-py2.py3-none-any.whl", hash = "sha256:1cbc62e65536f65e6d754dfe6f1bada7f5cf392d6f5db3c2b85892466c3e7c1a", size = 57745, upload_time = "2025-02-16T18:45:42.351Z" }, +] + +[[package]] +name = "flake8" +version = "7.3.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.10'", + "python_full_version == '3.9.*'", +] +dependencies = [ + { name = "mccabe", marker = "python_full_version >= '3.9'" }, + { name = "pycodestyle", version = "2.14.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.9'" }, + { name = "pyflakes", version = "3.4.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.9'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/9b/af/fbfe3c4b5a657d79e5c47a2827a362f9e1b763336a52f926126aa6dc7123/flake8-7.3.0.tar.gz", hash = "sha256:fe044858146b9fc69b551a4b490d69cf960fcb78ad1edcb84e7fbb1b4a8e3872", size = 48326, upload_time = "2025-06-20T19:31:35.838Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/9f/56/13ab06b4f93ca7cac71078fbe37fcea175d3216f31f85c3168a6bbd0bb9a/flake8-7.3.0-py2.py3-none-any.whl", hash = "sha256:b9696257b9ce8beb888cdbe31cf885c90d31928fe202be0889a7cdafad32f01e", size = 57922, upload_time = "2025-06-20T19:31:34.425Z" }, +] + +[[package]] +name = "idna" +version = "3.11" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/6f/6d/0703ccc57f3a7233505399edb88de3cbd678da106337b9fcde432b65ed60/idna-3.11.tar.gz", hash = "sha256:795dafcc9c04ed0c1fb032c2aa73654d8e8c5023a7df64a53f39190ada629902", size = 194582, upload_time = "2025-10-12T14:55:20.501Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/0e/61/66938bbb5fc52dbdf84594873d5b51fb1f7c7794e9c0f5bd885f30bc507b/idna-3.11-py3-none-any.whl", hash = "sha256:771a87f49d9defaf64091e6e6fe9c18d4833f140bd19464795bc32d966ca37ea", size = 71008, upload_time = "2025-10-12T14:55:18.883Z" }, +] + +[[package]] +name = "imagesize" +version = "1.4.1" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/a7/84/62473fb57d61e31fef6e36d64a179c8781605429fd927b5dd608c997be31/imagesize-1.4.1.tar.gz", hash = "sha256:69150444affb9cb0d5cc5a92b3676f0b2fb7cd9ae39e947a5e11a36b4497cd4a", size = 1280026, upload_time = "2022-07-01T12:21:05.687Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/ff/62/85c4c919272577931d407be5ba5d71c20f0b616d31a0befe0ae45bb79abd/imagesize-1.4.1-py2.py3-none-any.whl", hash = "sha256:0d8d18d08f840c19d0ee7ca1fd82490fdc3729b7ac93f49870406ddde8ef8d8b", size = 8769, upload_time = "2022-07-01T12:21:02.467Z" }, +] + +[[package]] +name = "importlib-metadata" +version = "8.5.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.8.1' and python_full_version < '3.9'", + "python_full_version < '3.8.1'", +] +dependencies = [ + { name = "zipp", version = "3.20.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/cd/12/33e59336dca5be0c398a7482335911a33aa0e20776128f038019f1a95f1b/importlib_metadata-8.5.0.tar.gz", hash = "sha256:71522656f0abace1d072b9e5481a48f07c138e00f079c38c8f883823f9c26bd7", size = 55304, upload_time = "2024-09-11T14:56:08.937Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/a0/d9/a1e041c5e7caa9a05c925f4bdbdfb7f006d1f74996af53467bc394c97be7/importlib_metadata-8.5.0-py3-none-any.whl", hash = "sha256:45e54197d28b7a7f1559e60b95e7c567032b602131fbd588f1497f47880aa68b", size = 26514, upload_time = "2024-09-11T14:56:07.019Z" }, +] + +[[package]] +name = "importlib-metadata" +version = "8.7.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version == '3.9.*'", +] +dependencies = [ + { name = "zipp", version = "3.23.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version == '3.9.*'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/76/66/650a33bd90f786193e4de4b3ad86ea60b53c89b669a5c7be931fac31cdb0/importlib_metadata-8.7.0.tar.gz", hash = "sha256:d13b81ad223b890aa16c5471f2ac3056cf76c5f10f82d6f9292f0b415f389000", size = 56641, upload_time = "2025-04-27T15:29:01.736Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/20/b0/36bd937216ec521246249be3bf9855081de4c5e06a0c9b4219dbeda50373/importlib_metadata-8.7.0-py3-none-any.whl", hash = "sha256:e5dd1551894c77868a30651cef00984d50e1002d06942a7101d34870c5f02afd", size = 27656, upload_time = "2025-04-27T15:29:00.214Z" }, +] + +[[package]] +name = "iniconfig" +version = "2.1.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version == '3.9.*'", + "python_full_version >= '3.8.1' and python_full_version < '3.9'", + "python_full_version < '3.8.1'", +] +sdist = { url = "https://files.pythonhosted.org/packages/f2/97/ebf4da567aa6827c909642694d71c9fcf53e5b504f2d96afea02718862f3/iniconfig-2.1.0.tar.gz", hash = "sha256:3abbd2e30b36733fee78f9c7f7308f2d0050e88f0087fd25c2645f63c773e1c7", size = 4793, upload_time = "2025-03-19T20:09:59.721Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/2c/e1/e6716421ea10d38022b952c159d5161ca1193197fb744506875fbb87ea7b/iniconfig-2.1.0-py3-none-any.whl", hash = "sha256:9deba5723312380e77435581c6bf4935c94cbfab9b1ed33ef8d238ea168eb760", size = 6050, upload_time = "2025-03-19T20:10:01.071Z" }, +] + +[[package]] +name = "iniconfig" +version = "2.3.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.10'", +] +sdist = { url = "https://files.pythonhosted.org/packages/72/34/14ca021ce8e5dfedc35312d08ba8bf51fdd999c576889fc2c24cb97f4f10/iniconfig-2.3.0.tar.gz", hash = "sha256:c76315c77db068650d49c5b56314774a7804df16fee4402c1f19d6d15d8c4730", size = 20503, upload_time = "2025-10-18T21:55:43.219Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/cb/b1/3846dd7f199d53cb17f49cba7e651e9ce294d8497c8c150530ed11865bb8/iniconfig-2.3.0-py3-none-any.whl", hash = "sha256:f631c04d2c48c52b84d0d0549c99ff3859c98df65b3101406327ecc7d53fbf12", size = 7484, upload_time = "2025-10-18T21:55:41.639Z" }, +] + +[[package]] +name = "isort" +version = "5.13.2" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.8.1' and python_full_version < '3.9'", + "python_full_version < '3.8.1'", +] +sdist = { url = "https://files.pythonhosted.org/packages/87/f9/c1eb8635a24e87ade2efce21e3ce8cd6b8630bb685ddc9cdaca1349b2eb5/isort-5.13.2.tar.gz", hash = "sha256:48fdfcb9face5d58a4f6dde2e72a1fb8dcaf8ab26f95ab49fab84c2ddefb0109", size = 175303, upload_time = "2023-12-13T20:37:26.124Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/d1/b3/8def84f539e7d2289a02f0524b944b15d7c75dab7628bedf1c4f0992029c/isort-5.13.2-py3-none-any.whl", hash = "sha256:8ca5e72a8d85860d5a3fa69b8745237f2939afe12dbf656afbcb47fe72d947a6", size = 92310, upload_time = "2023-12-13T20:37:23.244Z" }, +] + +[[package]] +name = "isort" +version = "6.1.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version == '3.9.*'", +] +dependencies = [ + { name = "importlib-metadata", version = "8.7.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version == '3.9.*'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/1e/82/fa43935523efdfcce6abbae9da7f372b627b27142c3419fcf13bf5b0c397/isort-6.1.0.tar.gz", hash = "sha256:9b8f96a14cfee0677e78e941ff62f03769a06d412aabb9e2a90487b3b7e8d481", size = 824325, upload_time = "2025-10-01T16:26:45.027Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/7f/cc/9b681a170efab4868a032631dea1e8446d8ec718a7f657b94d49d1a12643/isort-6.1.0-py3-none-any.whl", hash = "sha256:58d8927ecce74e5087aef019f778d4081a3b6c98f15a80ba35782ca8a2097784", size = 94329, upload_time = "2025-10-01T16:26:43.291Z" }, +] + +[[package]] +name = "isort" +version = "7.0.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.10'", +] +sdist = { url = "https://files.pythonhosted.org/packages/63/53/4f3c058e3bace40282876f9b553343376ee687f3c35a525dc79dbd450f88/isort-7.0.0.tar.gz", hash = "sha256:5513527951aadb3ac4292a41a16cbc50dd1642432f5e8c20057d414bdafb4187", size = 805049, upload_time = "2025-10-11T13:30:59.107Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/7f/ed/e3705d6d02b4f7aea715a353c8ce193efd0b5db13e204df895d38734c244/isort-7.0.0-py3-none-any.whl", hash = "sha256:1bcabac8bc3c36c7fb7b98a76c8abb18e0f841a3ba81decac7691008592499c1", size = 94672, upload_time = "2025-10-11T13:30:57.665Z" }, +] + +[[package]] +name = "jinja2" +version = "3.1.6" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "markupsafe", version = "2.1.5", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, + { name = "markupsafe", version = "3.0.3", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.9'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/df/bf/f7da0350254c0ed7c72f3e33cef02e048281fec7ecec5f032d4aac52226b/jinja2-3.1.6.tar.gz", hash = "sha256:0137fb05990d35f1275a587e9aee6d56da821fc83491a0fb838183be43f66d6d", size = 245115, upload_time = "2025-03-05T20:05:02.478Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/62/a1/3d680cbfd5f4b8f15abc1d571870c5fc3e594bb582bc3b64ea099db13e56/jinja2-3.1.6-py3-none-any.whl", hash = "sha256:85ece4451f492d0c13c5dd7c13a64681a86afae63a5f347908daf103ce6d2f67", size = 134899, upload_time = "2025-03-05T20:05:00.369Z" }, +] + +[[package]] +name = "jmespath" +version = "1.0.1" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/00/2a/e867e8531cf3e36b41201936b7fa7ba7b5702dbef42922193f05c8976cd6/jmespath-1.0.1.tar.gz", hash = "sha256:90261b206d6defd58fdd5e85f478bf633a2901798906be2ad389150c5c60edbe", size = 25843, upload_time = "2022-06-17T18:00:12.224Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/31/b4/b9b800c45527aadd64d5b442f9b932b00648617eb5d63d2c7a6587b7cafc/jmespath-1.0.1-py3-none-any.whl", hash = "sha256:02e2e4cc71b5bcab88332eebf907519190dd9e6e82107fa7f83b1003a6252980", size = 20256, upload_time = "2022-06-17T18:00:10.251Z" }, +] + +[[package]] +name = "markupsafe" +version = "2.1.5" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.8.1' and python_full_version < '3.9'", + "python_full_version < '3.8.1'", +] +sdist = { url = "https://files.pythonhosted.org/packages/87/5b/aae44c6655f3801e81aa3eef09dbbf012431987ba564d7231722f68df02d/MarkupSafe-2.1.5.tar.gz", hash = "sha256:d283d37a890ba4c1ae73ffadf8046435c76e7bc2247bbb63c00bd1a709c6544b", size = 19384, upload_time = "2024-02-02T16:31:22.863Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/e4/54/ad5eb37bf9d51800010a74e4665425831a9db4e7c4e0fde4352e391e808e/MarkupSafe-2.1.5-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:a17a92de5231666cfbe003f0e4b9b3a7ae3afb1ec2845aadc2bacc93ff85febc", size = 18206, upload_time = "2024-02-02T16:30:04.105Z" }, + { url = "https://files.pythonhosted.org/packages/6a/4a/a4d49415e600bacae038c67f9fecc1d5433b9d3c71a4de6f33537b89654c/MarkupSafe-2.1.5-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:72b6be590cc35924b02c78ef34b467da4ba07e4e0f0454a2c5907f473fc50ce5", size = 14079, upload_time = "2024-02-02T16:30:06.5Z" }, + { url = "https://files.pythonhosted.org/packages/0a/7b/85681ae3c33c385b10ac0f8dd025c30af83c78cec1c37a6aa3b55e67f5ec/MarkupSafe-2.1.5-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:e61659ba32cf2cf1481e575d0462554625196a1f2fc06a1c777d3f48e8865d46", size = 26620, upload_time = "2024-02-02T16:30:08.31Z" }, + { url = "https://files.pythonhosted.org/packages/7c/52/2b1b570f6b8b803cef5ac28fdf78c0da318916c7d2fe9402a84d591b394c/MarkupSafe-2.1.5-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:2174c595a0d73a3080ca3257b40096db99799265e1c27cc5a610743acd86d62f", size = 25818, upload_time = "2024-02-02T16:30:09.577Z" }, + { url = "https://files.pythonhosted.org/packages/29/fe/a36ba8c7ca55621620b2d7c585313efd10729e63ef81e4e61f52330da781/MarkupSafe-2.1.5-cp310-cp310-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:ae2ad8ae6ebee9d2d94b17fb62763125f3f374c25618198f40cbb8b525411900", size = 25493, upload_time = "2024-02-02T16:30:11.488Z" }, + { url = "https://files.pythonhosted.org/packages/60/ae/9c60231cdfda003434e8bd27282b1f4e197ad5a710c14bee8bea8a9ca4f0/MarkupSafe-2.1.5-cp310-cp310-musllinux_1_1_aarch64.whl", hash = "sha256:075202fa5b72c86ad32dc7d0b56024ebdbcf2048c0ba09f1cde31bfdd57bcfff", size = 30630, upload_time = "2024-02-02T16:30:13.144Z" }, + { url = "https://files.pythonhosted.org/packages/65/dc/1510be4d179869f5dafe071aecb3f1f41b45d37c02329dfba01ff59e5ac5/MarkupSafe-2.1.5-cp310-cp310-musllinux_1_1_i686.whl", hash = "sha256:598e3276b64aff0e7b3451b72e94fa3c238d452e7ddcd893c3ab324717456bad", size = 29745, upload_time = "2024-02-02T16:30:14.222Z" }, + { url = "https://files.pythonhosted.org/packages/30/39/8d845dd7d0b0613d86e0ef89549bfb5f61ed781f59af45fc96496e897f3a/MarkupSafe-2.1.5-cp310-cp310-musllinux_1_1_x86_64.whl", hash = "sha256:fce659a462a1be54d2ffcacea5e3ba2d74daa74f30f5f143fe0c58636e355fdd", size = 30021, upload_time = "2024-02-02T16:30:16.032Z" }, + { url = "https://files.pythonhosted.org/packages/c7/5c/356a6f62e4f3c5fbf2602b4771376af22a3b16efa74eb8716fb4e328e01e/MarkupSafe-2.1.5-cp310-cp310-win32.whl", hash = "sha256:d9fad5155d72433c921b782e58892377c44bd6252b5af2f67f16b194987338a4", size = 16659, upload_time = "2024-02-02T16:30:17.079Z" }, + { url = "https://files.pythonhosted.org/packages/69/48/acbf292615c65f0604a0c6fc402ce6d8c991276e16c80c46a8f758fbd30c/MarkupSafe-2.1.5-cp310-cp310-win_amd64.whl", hash = "sha256:bf50cd79a75d181c9181df03572cdce0fbb75cc353bc350712073108cba98de5", size = 17213, upload_time = "2024-02-02T16:30:18.251Z" }, + { url = "https://files.pythonhosted.org/packages/11/e7/291e55127bb2ae67c64d66cef01432b5933859dfb7d6949daa721b89d0b3/MarkupSafe-2.1.5-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:629ddd2ca402ae6dbedfceeba9c46d5f7b2a61d9749597d4307f943ef198fc1f", size = 18219, upload_time = "2024-02-02T16:30:19.988Z" }, + { url = "https://files.pythonhosted.org/packages/6b/cb/aed7a284c00dfa7c0682d14df85ad4955a350a21d2e3b06d8240497359bf/MarkupSafe-2.1.5-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:5b7b716f97b52c5a14bffdf688f971b2d5ef4029127f1ad7a513973cfd818df2", size = 14098, upload_time = "2024-02-02T16:30:21.063Z" }, + { url = "https://files.pythonhosted.org/packages/1c/cf/35fe557e53709e93feb65575c93927942087e9b97213eabc3fe9d5b25a55/MarkupSafe-2.1.5-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:6ec585f69cec0aa07d945b20805be741395e28ac1627333b1c5b0105962ffced", size = 29014, upload_time = "2024-02-02T16:30:22.926Z" }, + { url = "https://files.pythonhosted.org/packages/97/18/c30da5e7a0e7f4603abfc6780574131221d9148f323752c2755d48abad30/MarkupSafe-2.1.5-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:b91c037585eba9095565a3556f611e3cbfaa42ca1e865f7b8015fe5c7336d5a5", size = 28220, upload_time = "2024-02-02T16:30:24.76Z" }, + { url = "https://files.pythonhosted.org/packages/0c/40/2e73e7d532d030b1e41180807a80d564eda53babaf04d65e15c1cf897e40/MarkupSafe-2.1.5-cp311-cp311-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:7502934a33b54030eaf1194c21c692a534196063db72176b0c4028e140f8f32c", size = 27756, upload_time = "2024-02-02T16:30:25.877Z" }, + { url = "https://files.pythonhosted.org/packages/18/46/5dca760547e8c59c5311b332f70605d24c99d1303dd9a6e1fc3ed0d73561/MarkupSafe-2.1.5-cp311-cp311-musllinux_1_1_aarch64.whl", hash = "sha256:0e397ac966fdf721b2c528cf028494e86172b4feba51d65f81ffd65c63798f3f", size = 33988, upload_time = "2024-02-02T16:30:26.935Z" }, + { url = "https://files.pythonhosted.org/packages/6d/c5/27febe918ac36397919cd4a67d5579cbbfa8da027fa1238af6285bb368ea/MarkupSafe-2.1.5-cp311-cp311-musllinux_1_1_i686.whl", hash = "sha256:c061bb86a71b42465156a3ee7bd58c8c2ceacdbeb95d05a99893e08b8467359a", size = 32718, upload_time = "2024-02-02T16:30:28.111Z" }, + { url = "https://files.pythonhosted.org/packages/f8/81/56e567126a2c2bc2684d6391332e357589a96a76cb9f8e5052d85cb0ead8/MarkupSafe-2.1.5-cp311-cp311-musllinux_1_1_x86_64.whl", hash = "sha256:3a57fdd7ce31c7ff06cdfbf31dafa96cc533c21e443d57f5b1ecc6cdc668ec7f", size = 33317, upload_time = "2024-02-02T16:30:29.214Z" }, + { url = "https://files.pythonhosted.org/packages/00/0b/23f4b2470accb53285c613a3ab9ec19dc944eaf53592cb6d9e2af8aa24cc/MarkupSafe-2.1.5-cp311-cp311-win32.whl", hash = "sha256:397081c1a0bfb5124355710fe79478cdbeb39626492b15d399526ae53422b906", size = 16670, upload_time = "2024-02-02T16:30:30.915Z" }, + { url = "https://files.pythonhosted.org/packages/b7/a2/c78a06a9ec6d04b3445a949615c4c7ed86a0b2eb68e44e7541b9d57067cc/MarkupSafe-2.1.5-cp311-cp311-win_amd64.whl", hash = "sha256:2b7c57a4dfc4f16f7142221afe5ba4e093e09e728ca65c51f5620c9aaeb9a617", size = 17224, upload_time = "2024-02-02T16:30:32.09Z" }, + { url = "https://files.pythonhosted.org/packages/53/bd/583bf3e4c8d6a321938c13f49d44024dbe5ed63e0a7ba127e454a66da974/MarkupSafe-2.1.5-cp312-cp312-macosx_10_9_universal2.whl", hash = "sha256:8dec4936e9c3100156f8a2dc89c4b88d5c435175ff03413b443469c7c8c5f4d1", size = 18215, upload_time = "2024-02-02T16:30:33.081Z" }, + { url = "https://files.pythonhosted.org/packages/48/d6/e7cd795fc710292c3af3a06d80868ce4b02bfbbf370b7cee11d282815a2a/MarkupSafe-2.1.5-cp312-cp312-macosx_10_9_x86_64.whl", hash = "sha256:3c6b973f22eb18a789b1460b4b91bf04ae3f0c4234a0a6aa6b0a92f6f7b951d4", size = 14069, upload_time = "2024-02-02T16:30:34.148Z" }, + { url = "https://files.pythonhosted.org/packages/51/b5/5d8ec796e2a08fc814a2c7d2584b55f889a55cf17dd1a90f2beb70744e5c/MarkupSafe-2.1.5-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:ac07bad82163452a6884fe8fa0963fb98c2346ba78d779ec06bd7a6262132aee", size = 29452, upload_time = "2024-02-02T16:30:35.149Z" }, + { url = "https://files.pythonhosted.org/packages/0a/0d/2454f072fae3b5a137c119abf15465d1771319dfe9e4acbb31722a0fff91/MarkupSafe-2.1.5-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:f5dfb42c4604dddc8e4305050aa6deb084540643ed5804d7455b5df8fe16f5e5", size = 28462, upload_time = "2024-02-02T16:30:36.166Z" }, + { url = "https://files.pythonhosted.org/packages/2d/75/fd6cb2e68780f72d47e6671840ca517bda5ef663d30ada7616b0462ad1e3/MarkupSafe-2.1.5-cp312-cp312-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:ea3d8a3d18833cf4304cd2fc9cbb1efe188ca9b5efef2bdac7adc20594a0e46b", size = 27869, upload_time = "2024-02-02T16:30:37.834Z" }, + { url = "https://files.pythonhosted.org/packages/b0/81/147c477391c2750e8fc7705829f7351cf1cd3be64406edcf900dc633feb2/MarkupSafe-2.1.5-cp312-cp312-musllinux_1_1_aarch64.whl", hash = "sha256:d050b3361367a06d752db6ead6e7edeb0009be66bc3bae0ee9d97fb326badc2a", size = 33906, upload_time = "2024-02-02T16:30:39.366Z" }, + { url = "https://files.pythonhosted.org/packages/8b/ff/9a52b71839d7a256b563e85d11050e307121000dcebc97df120176b3ad93/MarkupSafe-2.1.5-cp312-cp312-musllinux_1_1_i686.whl", hash = "sha256:bec0a414d016ac1a18862a519e54b2fd0fc8bbfd6890376898a6c0891dd82e9f", size = 32296, upload_time = "2024-02-02T16:30:40.413Z" }, + { url = "https://files.pythonhosted.org/packages/88/07/2dc76aa51b481eb96a4c3198894f38b480490e834479611a4053fbf08623/MarkupSafe-2.1.5-cp312-cp312-musllinux_1_1_x86_64.whl", hash = "sha256:58c98fee265677f63a4385256a6d7683ab1832f3ddd1e66fe948d5880c21a169", size = 33038, upload_time = "2024-02-02T16:30:42.243Z" }, + { url = "https://files.pythonhosted.org/packages/96/0c/620c1fb3661858c0e37eb3cbffd8c6f732a67cd97296f725789679801b31/MarkupSafe-2.1.5-cp312-cp312-win32.whl", hash = "sha256:8590b4ae07a35970728874632fed7bd57b26b0102df2d2b233b6d9d82f6c62ad", size = 16572, upload_time = "2024-02-02T16:30:43.326Z" }, + { url = "https://files.pythonhosted.org/packages/3f/14/c3554d512d5f9100a95e737502f4a2323a1959f6d0d01e0d0997b35f7b10/MarkupSafe-2.1.5-cp312-cp312-win_amd64.whl", hash = "sha256:823b65d8706e32ad2df51ed89496147a42a2a6e01c13cfb6ffb8b1e92bc910bb", size = 17127, upload_time = "2024-02-02T16:30:44.418Z" }, + { url = "https://files.pythonhosted.org/packages/f8/ff/2c942a82c35a49df5de3a630ce0a8456ac2969691b230e530ac12314364c/MarkupSafe-2.1.5-cp38-cp38-macosx_10_9_universal2.whl", hash = "sha256:656f7526c69fac7f600bd1f400991cc282b417d17539a1b228617081106feb4a", size = 18192, upload_time = "2024-02-02T16:30:57.715Z" }, + { url = "https://files.pythonhosted.org/packages/4f/14/6f294b9c4f969d0c801a4615e221c1e084722ea6114ab2114189c5b8cbe0/MarkupSafe-2.1.5-cp38-cp38-macosx_10_9_x86_64.whl", hash = "sha256:97cafb1f3cbcd3fd2b6fbfb99ae11cdb14deea0736fc2b0952ee177f2b813a46", size = 14072, upload_time = "2024-02-02T16:30:58.844Z" }, + { url = "https://files.pythonhosted.org/packages/81/d4/fd74714ed30a1dedd0b82427c02fa4deec64f173831ec716da11c51a50aa/MarkupSafe-2.1.5-cp38-cp38-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:1f3fbcb7ef1f16e48246f704ab79d79da8a46891e2da03f8783a5b6fa41a9532", size = 26928, upload_time = "2024-02-02T16:30:59.922Z" }, + { url = "https://files.pythonhosted.org/packages/c7/bd/50319665ce81bb10e90d1cf76f9e1aa269ea6f7fa30ab4521f14d122a3df/MarkupSafe-2.1.5-cp38-cp38-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:fa9db3f79de01457b03d4f01b34cf91bc0048eb2c3846ff26f66687c2f6d16ab", size = 26106, upload_time = "2024-02-02T16:31:01.582Z" }, + { url = "https://files.pythonhosted.org/packages/4c/6f/f2b0f675635b05f6afd5ea03c094557bdb8622fa8e673387444fe8d8e787/MarkupSafe-2.1.5-cp38-cp38-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:ffee1f21e5ef0d712f9033568f8344d5da8cc2869dbd08d87c84656e6a2d2f68", size = 25781, upload_time = "2024-02-02T16:31:02.71Z" }, + { url = "https://files.pythonhosted.org/packages/51/e0/393467cf899b34a9d3678e78961c2c8cdf49fb902a959ba54ece01273fb1/MarkupSafe-2.1.5-cp38-cp38-musllinux_1_1_aarch64.whl", hash = "sha256:5dedb4db619ba5a2787a94d877bc8ffc0566f92a01c0ef214865e54ecc9ee5e0", size = 30518, upload_time = "2024-02-02T16:31:04.392Z" }, + { url = "https://files.pythonhosted.org/packages/f6/02/5437e2ad33047290dafced9df741d9efc3e716b75583bbd73a9984f1b6f7/MarkupSafe-2.1.5-cp38-cp38-musllinux_1_1_i686.whl", hash = "sha256:30b600cf0a7ac9234b2638fbc0fb6158ba5bdcdf46aeb631ead21248b9affbc4", size = 29669, upload_time = "2024-02-02T16:31:05.53Z" }, + { url = "https://files.pythonhosted.org/packages/0e/7d/968284145ffd9d726183ed6237c77938c021abacde4e073020f920e060b2/MarkupSafe-2.1.5-cp38-cp38-musllinux_1_1_x86_64.whl", hash = "sha256:8dd717634f5a044f860435c1d8c16a270ddf0ef8588d4887037c5028b859b0c3", size = 29933, upload_time = "2024-02-02T16:31:06.636Z" }, + { url = "https://files.pythonhosted.org/packages/bf/f3/ecb00fc8ab02b7beae8699f34db9357ae49d9f21d4d3de6f305f34fa949e/MarkupSafe-2.1.5-cp38-cp38-win32.whl", hash = "sha256:daa4ee5a243f0f20d528d939d06670a298dd39b1ad5f8a72a4275124a7819eff", size = 16656, upload_time = "2024-02-02T16:31:07.767Z" }, + { url = "https://files.pythonhosted.org/packages/92/21/357205f03514a49b293e214ac39de01fadd0970a6e05e4bf1ddd0ffd0881/MarkupSafe-2.1.5-cp38-cp38-win_amd64.whl", hash = "sha256:619bc166c4f2de5caa5a633b8b7326fbe98e0ccbfacabd87268a2b15ff73a029", size = 17206, upload_time = "2024-02-02T16:31:08.843Z" }, + { url = "https://files.pythonhosted.org/packages/0f/31/780bb297db036ba7b7bbede5e1d7f1e14d704ad4beb3ce53fb495d22bc62/MarkupSafe-2.1.5-cp39-cp39-macosx_10_9_universal2.whl", hash = "sha256:7a68b554d356a91cce1236aa7682dc01df0edba8d043fd1ce607c49dd3c1edcf", size = 18193, upload_time = "2024-02-02T16:31:10.155Z" }, + { url = "https://files.pythonhosted.org/packages/6c/77/d77701bbef72892affe060cdacb7a2ed7fd68dae3b477a8642f15ad3b132/MarkupSafe-2.1.5-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:db0b55e0f3cc0be60c1f19efdde9a637c32740486004f20d1cff53c3c0ece4d2", size = 14073, upload_time = "2024-02-02T16:31:11.442Z" }, + { url = "https://files.pythonhosted.org/packages/d9/a7/1e558b4f78454c8a3a0199292d96159eb4d091f983bc35ef258314fe7269/MarkupSafe-2.1.5-cp39-cp39-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:3e53af139f8579a6d5f7b76549125f0d94d7e630761a2111bc431fd820e163b8", size = 26486, upload_time = "2024-02-02T16:31:12.488Z" }, + { url = "https://files.pythonhosted.org/packages/5f/5a/360da85076688755ea0cceb92472923086993e86b5613bbae9fbc14136b0/MarkupSafe-2.1.5-cp39-cp39-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:17b950fccb810b3293638215058e432159d2b71005c74371d784862b7e4683f3", size = 25685, upload_time = "2024-02-02T16:31:13.726Z" }, + { url = "https://files.pythonhosted.org/packages/6a/18/ae5a258e3401f9b8312f92b028c54d7026a97ec3ab20bfaddbdfa7d8cce8/MarkupSafe-2.1.5-cp39-cp39-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:4c31f53cdae6ecfa91a77820e8b151dba54ab528ba65dfd235c80b086d68a465", size = 25338, upload_time = "2024-02-02T16:31:14.812Z" }, + { url = "https://files.pythonhosted.org/packages/0b/cc/48206bd61c5b9d0129f4d75243b156929b04c94c09041321456fd06a876d/MarkupSafe-2.1.5-cp39-cp39-musllinux_1_1_aarch64.whl", hash = "sha256:bff1b4290a66b490a2f4719358c0cdcd9bafb6b8f061e45c7a2460866bf50c2e", size = 30439, upload_time = "2024-02-02T16:31:15.946Z" }, + { url = "https://files.pythonhosted.org/packages/d1/06/a41c112ab9ffdeeb5f77bc3e331fdadf97fa65e52e44ba31880f4e7f983c/MarkupSafe-2.1.5-cp39-cp39-musllinux_1_1_i686.whl", hash = "sha256:bc1667f8b83f48511b94671e0e441401371dfd0f0a795c7daa4a3cd1dde55bea", size = 29531, upload_time = "2024-02-02T16:31:17.13Z" }, + { url = "https://files.pythonhosted.org/packages/02/8c/ab9a463301a50dab04d5472e998acbd4080597abc048166ded5c7aa768c8/MarkupSafe-2.1.5-cp39-cp39-musllinux_1_1_x86_64.whl", hash = "sha256:5049256f536511ee3f7e1b3f87d1d1209d327e818e6ae1365e8653d7e3abb6a6", size = 29823, upload_time = "2024-02-02T16:31:18.247Z" }, + { url = "https://files.pythonhosted.org/packages/bc/29/9bc18da763496b055d8e98ce476c8e718dcfd78157e17f555ce6dd7d0895/MarkupSafe-2.1.5-cp39-cp39-win32.whl", hash = "sha256:00e046b6dd71aa03a41079792f8473dc494d564611a8f89bbbd7cb93295ebdcf", size = 16658, upload_time = "2024-02-02T16:31:19.583Z" }, + { url = "https://files.pythonhosted.org/packages/f6/f8/4da07de16f10551ca1f640c92b5f316f9394088b183c6a57183df6de5ae4/MarkupSafe-2.1.5-cp39-cp39-win_amd64.whl", hash = "sha256:fa173ec60341d6bb97a89f5ea19c85c5643c1e7dedebc22f5181eb73573142c5", size = 17211, upload_time = "2024-02-02T16:31:20.96Z" }, +] + +[[package]] +name = "markupsafe" +version = "3.0.3" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.10'", + "python_full_version == '3.9.*'", +] +sdist = { url = "https://files.pythonhosted.org/packages/7e/99/7690b6d4034fffd95959cbe0c02de8deb3098cc577c67bb6a24fe5d7caa7/markupsafe-3.0.3.tar.gz", hash = "sha256:722695808f4b6457b320fdc131280796bdceb04ab50fe1795cd540799ebe1698", size = 80313, upload_time = "2025-09-27T18:37:40.426Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/e8/4b/3541d44f3937ba468b75da9eebcae497dcf67adb65caa16760b0a6807ebb/markupsafe-3.0.3-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:2f981d352f04553a7171b8e44369f2af4055f888dfb147d55e42d29e29e74559", size = 11631, upload_time = "2025-09-27T18:36:05.558Z" }, + { url = "https://files.pythonhosted.org/packages/98/1b/fbd8eed11021cabd9226c37342fa6ca4e8a98d8188a8d9b66740494960e4/markupsafe-3.0.3-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:e1c1493fb6e50ab01d20a22826e57520f1284df32f2d8601fdd90b6304601419", size = 12057, upload_time = "2025-09-27T18:36:07.165Z" }, + { url = "https://files.pythonhosted.org/packages/40/01/e560d658dc0bb8ab762670ece35281dec7b6c1b33f5fbc09ebb57a185519/markupsafe-3.0.3-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:1ba88449deb3de88bd40044603fafffb7bc2b055d626a330323a9ed736661695", size = 22050, upload_time = "2025-09-27T18:36:08.005Z" }, + { url = "https://files.pythonhosted.org/packages/af/cd/ce6e848bbf2c32314c9b237839119c5a564a59725b53157c856e90937b7a/markupsafe-3.0.3-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:f42d0984e947b8adf7dd6dde396e720934d12c506ce84eea8476409563607591", size = 20681, upload_time = "2025-09-27T18:36:08.881Z" }, + { url = "https://files.pythonhosted.org/packages/c9/2a/b5c12c809f1c3045c4d580b035a743d12fcde53cf685dbc44660826308da/markupsafe-3.0.3-cp310-cp310-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:c0c0b3ade1c0b13b936d7970b1d37a57acde9199dc2aecc4c336773e1d86049c", size = 20705, upload_time = "2025-09-27T18:36:10.131Z" }, + { url = "https://files.pythonhosted.org/packages/cf/e3/9427a68c82728d0a88c50f890d0fc072a1484de2f3ac1ad0bfc1a7214fd5/markupsafe-3.0.3-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:0303439a41979d9e74d18ff5e2dd8c43ed6c6001fd40e5bf2e43f7bd9bbc523f", size = 21524, upload_time = "2025-09-27T18:36:11.324Z" }, + { url = "https://files.pythonhosted.org/packages/bc/36/23578f29e9e582a4d0278e009b38081dbe363c5e7165113fad546918a232/markupsafe-3.0.3-cp310-cp310-musllinux_1_2_riscv64.whl", hash = "sha256:d2ee202e79d8ed691ceebae8e0486bd9a2cd4794cec4824e1c99b6f5009502f6", size = 20282, upload_time = "2025-09-27T18:36:12.573Z" }, + { url = "https://files.pythonhosted.org/packages/56/21/dca11354e756ebd03e036bd8ad58d6d7168c80ce1fe5e75218e4945cbab7/markupsafe-3.0.3-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:177b5253b2834fe3678cb4a5f0059808258584c559193998be2601324fdeafb1", size = 20745, upload_time = "2025-09-27T18:36:13.504Z" }, + { url = "https://files.pythonhosted.org/packages/87/99/faba9369a7ad6e4d10b6a5fbf71fa2a188fe4a593b15f0963b73859a1bbd/markupsafe-3.0.3-cp310-cp310-win32.whl", hash = "sha256:2a15a08b17dd94c53a1da0438822d70ebcd13f8c3a95abe3a9ef9f11a94830aa", size = 14571, upload_time = "2025-09-27T18:36:14.779Z" }, + { url = "https://files.pythonhosted.org/packages/d6/25/55dc3ab959917602c96985cb1253efaa4ff42f71194bddeb61eb7278b8be/markupsafe-3.0.3-cp310-cp310-win_amd64.whl", hash = "sha256:c4ffb7ebf07cfe8931028e3e4c85f0357459a3f9f9490886198848f4fa002ec8", size = 15056, upload_time = "2025-09-27T18:36:16.125Z" }, + { url = "https://files.pythonhosted.org/packages/d0/9e/0a02226640c255d1da0b8d12e24ac2aa6734da68bff14c05dd53b94a0fc3/markupsafe-3.0.3-cp310-cp310-win_arm64.whl", hash = "sha256:e2103a929dfa2fcaf9bb4e7c091983a49c9ac3b19c9061b6d5427dd7d14d81a1", size = 13932, upload_time = "2025-09-27T18:36:17.311Z" }, + { url = "https://files.pythonhosted.org/packages/08/db/fefacb2136439fc8dd20e797950e749aa1f4997ed584c62cfb8ef7c2be0e/markupsafe-3.0.3-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:1cc7ea17a6824959616c525620e387f6dd30fec8cb44f649e31712db02123dad", size = 11631, upload_time = "2025-09-27T18:36:18.185Z" }, + { url = "https://files.pythonhosted.org/packages/e1/2e/5898933336b61975ce9dc04decbc0a7f2fee78c30353c5efba7f2d6ff27a/markupsafe-3.0.3-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:4bd4cd07944443f5a265608cc6aab442e4f74dff8088b0dfc8238647b8f6ae9a", size = 12058, upload_time = "2025-09-27T18:36:19.444Z" }, + { url = "https://files.pythonhosted.org/packages/1d/09/adf2df3699d87d1d8184038df46a9c80d78c0148492323f4693df54e17bb/markupsafe-3.0.3-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:6b5420a1d9450023228968e7e6a9ce57f65d148ab56d2313fcd589eee96a7a50", size = 24287, upload_time = "2025-09-27T18:36:20.768Z" }, + { url = "https://files.pythonhosted.org/packages/30/ac/0273f6fcb5f42e314c6d8cd99effae6a5354604d461b8d392b5ec9530a54/markupsafe-3.0.3-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:0bf2a864d67e76e5c9a34dc26ec616a66b9888e25e7b9460e1c76d3293bd9dbf", size = 22940, upload_time = "2025-09-27T18:36:22.249Z" }, + { url = "https://files.pythonhosted.org/packages/19/ae/31c1be199ef767124c042c6c3e904da327a2f7f0cd63a0337e1eca2967a8/markupsafe-3.0.3-cp311-cp311-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:bc51efed119bc9cfdf792cdeaa4d67e8f6fcccab66ed4bfdd6bde3e59bfcbb2f", size = 21887, upload_time = "2025-09-27T18:36:23.535Z" }, + { url = "https://files.pythonhosted.org/packages/b2/76/7edcab99d5349a4532a459e1fe64f0b0467a3365056ae550d3bcf3f79e1e/markupsafe-3.0.3-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:068f375c472b3e7acbe2d5318dea141359e6900156b5b2ba06a30b169086b91a", size = 23692, upload_time = "2025-09-27T18:36:24.823Z" }, + { url = "https://files.pythonhosted.org/packages/a4/28/6e74cdd26d7514849143d69f0bf2399f929c37dc2b31e6829fd2045b2765/markupsafe-3.0.3-cp311-cp311-musllinux_1_2_riscv64.whl", hash = "sha256:7be7b61bb172e1ed687f1754f8e7484f1c8019780f6f6b0786e76bb01c2ae115", size = 21471, upload_time = "2025-09-27T18:36:25.95Z" }, + { url = "https://files.pythonhosted.org/packages/62/7e/a145f36a5c2945673e590850a6f8014318d5577ed7e5920a4b3448e0865d/markupsafe-3.0.3-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:f9e130248f4462aaa8e2552d547f36ddadbeaa573879158d721bbd33dfe4743a", size = 22923, upload_time = "2025-09-27T18:36:27.109Z" }, + { url = "https://files.pythonhosted.org/packages/0f/62/d9c46a7f5c9adbeeeda52f5b8d802e1094e9717705a645efc71b0913a0a8/markupsafe-3.0.3-cp311-cp311-win32.whl", hash = "sha256:0db14f5dafddbb6d9208827849fad01f1a2609380add406671a26386cdf15a19", size = 14572, upload_time = "2025-09-27T18:36:28.045Z" }, + { url = "https://files.pythonhosted.org/packages/83/8a/4414c03d3f891739326e1783338e48fb49781cc915b2e0ee052aa490d586/markupsafe-3.0.3-cp311-cp311-win_amd64.whl", hash = "sha256:de8a88e63464af587c950061a5e6a67d3632e36df62b986892331d4620a35c01", size = 15077, upload_time = "2025-09-27T18:36:29.025Z" }, + { url = "https://files.pythonhosted.org/packages/35/73/893072b42e6862f319b5207adc9ae06070f095b358655f077f69a35601f0/markupsafe-3.0.3-cp311-cp311-win_arm64.whl", hash = "sha256:3b562dd9e9ea93f13d53989d23a7e775fdfd1066c33494ff43f5418bc8c58a5c", size = 13876, upload_time = "2025-09-27T18:36:29.954Z" }, + { url = "https://files.pythonhosted.org/packages/5a/72/147da192e38635ada20e0a2e1a51cf8823d2119ce8883f7053879c2199b5/markupsafe-3.0.3-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:d53197da72cc091b024dd97249dfc7794d6a56530370992a5e1a08983ad9230e", size = 11615, upload_time = "2025-09-27T18:36:30.854Z" }, + { url = "https://files.pythonhosted.org/packages/9a/81/7e4e08678a1f98521201c3079f77db69fb552acd56067661f8c2f534a718/markupsafe-3.0.3-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:1872df69a4de6aead3491198eaf13810b565bdbeec3ae2dc8780f14458ec73ce", size = 12020, upload_time = "2025-09-27T18:36:31.971Z" }, + { url = "https://files.pythonhosted.org/packages/1e/2c/799f4742efc39633a1b54a92eec4082e4f815314869865d876824c257c1e/markupsafe-3.0.3-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:3a7e8ae81ae39e62a41ec302f972ba6ae23a5c5396c8e60113e9066ef893da0d", size = 24332, upload_time = "2025-09-27T18:36:32.813Z" }, + { url = "https://files.pythonhosted.org/packages/3c/2e/8d0c2ab90a8c1d9a24f0399058ab8519a3279d1bd4289511d74e909f060e/markupsafe-3.0.3-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:d6dd0be5b5b189d31db7cda48b91d7e0a9795f31430b7f271219ab30f1d3ac9d", size = 22947, upload_time = "2025-09-27T18:36:33.86Z" }, + { url = "https://files.pythonhosted.org/packages/2c/54/887f3092a85238093a0b2154bd629c89444f395618842e8b0c41783898ea/markupsafe-3.0.3-cp312-cp312-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:94c6f0bb423f739146aec64595853541634bde58b2135f27f61c1ffd1cd4d16a", size = 21962, upload_time = "2025-09-27T18:36:35.099Z" }, + { url = "https://files.pythonhosted.org/packages/c9/2f/336b8c7b6f4a4d95e91119dc8521402461b74a485558d8f238a68312f11c/markupsafe-3.0.3-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:be8813b57049a7dc738189df53d69395eba14fb99345e0a5994914a3864c8a4b", size = 23760, upload_time = "2025-09-27T18:36:36.001Z" }, + { url = "https://files.pythonhosted.org/packages/32/43/67935f2b7e4982ffb50a4d169b724d74b62a3964bc1a9a527f5ac4f1ee2b/markupsafe-3.0.3-cp312-cp312-musllinux_1_2_riscv64.whl", hash = "sha256:83891d0e9fb81a825d9a6d61e3f07550ca70a076484292a70fde82c4b807286f", size = 21529, upload_time = "2025-09-27T18:36:36.906Z" }, + { url = "https://files.pythonhosted.org/packages/89/e0/4486f11e51bbba8b0c041098859e869e304d1c261e59244baa3d295d47b7/markupsafe-3.0.3-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:77f0643abe7495da77fb436f50f8dab76dbc6e5fd25d39589a0f1fe6548bfa2b", size = 23015, upload_time = "2025-09-27T18:36:37.868Z" }, + { url = "https://files.pythonhosted.org/packages/2f/e1/78ee7a023dac597a5825441ebd17170785a9dab23de95d2c7508ade94e0e/markupsafe-3.0.3-cp312-cp312-win32.whl", hash = "sha256:d88b440e37a16e651bda4c7c2b930eb586fd15ca7406cb39e211fcff3bf3017d", size = 14540, upload_time = "2025-09-27T18:36:38.761Z" }, + { url = "https://files.pythonhosted.org/packages/aa/5b/bec5aa9bbbb2c946ca2733ef9c4ca91c91b6a24580193e891b5f7dbe8e1e/markupsafe-3.0.3-cp312-cp312-win_amd64.whl", hash = "sha256:26a5784ded40c9e318cfc2bdb30fe164bdb8665ded9cd64d500a34fb42067b1c", size = 15105, upload_time = "2025-09-27T18:36:39.701Z" }, + { url = "https://files.pythonhosted.org/packages/e5/f1/216fc1bbfd74011693a4fd837e7026152e89c4bcf3e77b6692fba9923123/markupsafe-3.0.3-cp312-cp312-win_arm64.whl", hash = "sha256:35add3b638a5d900e807944a078b51922212fb3dedb01633a8defc4b01a3c85f", size = 13906, upload_time = "2025-09-27T18:36:40.689Z" }, + { url = "https://files.pythonhosted.org/packages/38/2f/907b9c7bbba283e68f20259574b13d005c121a0fa4c175f9bed27c4597ff/markupsafe-3.0.3-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:e1cf1972137e83c5d4c136c43ced9ac51d0e124706ee1c8aa8532c1287fa8795", size = 11622, upload_time = "2025-09-27T18:36:41.777Z" }, + { url = "https://files.pythonhosted.org/packages/9c/d9/5f7756922cdd676869eca1c4e3c0cd0df60ed30199ffd775e319089cb3ed/markupsafe-3.0.3-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:116bb52f642a37c115f517494ea5feb03889e04df47eeff5b130b1808ce7c219", size = 12029, upload_time = "2025-09-27T18:36:43.257Z" }, + { url = "https://files.pythonhosted.org/packages/00/07/575a68c754943058c78f30db02ee03a64b3c638586fba6a6dd56830b30a3/markupsafe-3.0.3-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:133a43e73a802c5562be9bbcd03d090aa5a1fe899db609c29e8c8d815c5f6de6", size = 24374, upload_time = "2025-09-27T18:36:44.508Z" }, + { url = "https://files.pythonhosted.org/packages/a9/21/9b05698b46f218fc0e118e1f8168395c65c8a2c750ae2bab54fc4bd4e0e8/markupsafe-3.0.3-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:ccfcd093f13f0f0b7fdd0f198b90053bf7b2f02a3927a30e63f3ccc9df56b676", size = 22980, upload_time = "2025-09-27T18:36:45.385Z" }, + { url = "https://files.pythonhosted.org/packages/7f/71/544260864f893f18b6827315b988c146b559391e6e7e8f7252839b1b846a/markupsafe-3.0.3-cp313-cp313-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:509fa21c6deb7a7a273d629cf5ec029bc209d1a51178615ddf718f5918992ab9", size = 21990, upload_time = "2025-09-27T18:36:46.916Z" }, + { url = "https://files.pythonhosted.org/packages/c2/28/b50fc2f74d1ad761af2f5dcce7492648b983d00a65b8c0e0cb457c82ebbe/markupsafe-3.0.3-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:a4afe79fb3de0b7097d81da19090f4df4f8d3a2b3adaa8764138aac2e44f3af1", size = 23784, upload_time = "2025-09-27T18:36:47.884Z" }, + { url = "https://files.pythonhosted.org/packages/ed/76/104b2aa106a208da8b17a2fb72e033a5a9d7073c68f7e508b94916ed47a9/markupsafe-3.0.3-cp313-cp313-musllinux_1_2_riscv64.whl", hash = "sha256:795e7751525cae078558e679d646ae45574b47ed6e7771863fcc079a6171a0fc", size = 21588, upload_time = "2025-09-27T18:36:48.82Z" }, + { url = "https://files.pythonhosted.org/packages/b5/99/16a5eb2d140087ebd97180d95249b00a03aa87e29cc224056274f2e45fd6/markupsafe-3.0.3-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:8485f406a96febb5140bfeca44a73e3ce5116b2501ac54fe953e488fb1d03b12", size = 23041, upload_time = "2025-09-27T18:36:49.797Z" }, + { url = "https://files.pythonhosted.org/packages/19/bc/e7140ed90c5d61d77cea142eed9f9c303f4c4806f60a1044c13e3f1471d0/markupsafe-3.0.3-cp313-cp313-win32.whl", hash = "sha256:bdd37121970bfd8be76c5fb069c7751683bdf373db1ed6c010162b2a130248ed", size = 14543, upload_time = "2025-09-27T18:36:51.584Z" }, + { url = "https://files.pythonhosted.org/packages/05/73/c4abe620b841b6b791f2edc248f556900667a5a1cf023a6646967ae98335/markupsafe-3.0.3-cp313-cp313-win_amd64.whl", hash = "sha256:9a1abfdc021a164803f4d485104931fb8f8c1efd55bc6b748d2f5774e78b62c5", size = 15113, upload_time = "2025-09-27T18:36:52.537Z" }, + { url = "https://files.pythonhosted.org/packages/f0/3a/fa34a0f7cfef23cf9500d68cb7c32dd64ffd58a12b09225fb03dd37d5b80/markupsafe-3.0.3-cp313-cp313-win_arm64.whl", hash = "sha256:7e68f88e5b8799aa49c85cd116c932a1ac15caaa3f5db09087854d218359e485", size = 13911, upload_time = "2025-09-27T18:36:53.513Z" }, + { url = "https://files.pythonhosted.org/packages/e4/d7/e05cd7efe43a88a17a37b3ae96e79a19e846f3f456fe79c57ca61356ef01/markupsafe-3.0.3-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:218551f6df4868a8d527e3062d0fb968682fe92054e89978594c28e642c43a73", size = 11658, upload_time = "2025-09-27T18:36:54.819Z" }, + { url = "https://files.pythonhosted.org/packages/99/9e/e412117548182ce2148bdeacdda3bb494260c0b0184360fe0d56389b523b/markupsafe-3.0.3-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:3524b778fe5cfb3452a09d31e7b5adefeea8c5be1d43c4f810ba09f2ceb29d37", size = 12066, upload_time = "2025-09-27T18:36:55.714Z" }, + { url = "https://files.pythonhosted.org/packages/bc/e6/fa0ffcda717ef64a5108eaa7b4f5ed28d56122c9a6d70ab8b72f9f715c80/markupsafe-3.0.3-cp313-cp313t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:4e885a3d1efa2eadc93c894a21770e4bc67899e3543680313b09f139e149ab19", size = 25639, upload_time = "2025-09-27T18:36:56.908Z" }, + { url = "https://files.pythonhosted.org/packages/96/ec/2102e881fe9d25fc16cb4b25d5f5cde50970967ffa5dddafdb771237062d/markupsafe-3.0.3-cp313-cp313t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:8709b08f4a89aa7586de0aadc8da56180242ee0ada3999749b183aa23df95025", size = 23569, upload_time = "2025-09-27T18:36:57.913Z" }, + { url = "https://files.pythonhosted.org/packages/4b/30/6f2fce1f1f205fc9323255b216ca8a235b15860c34b6798f810f05828e32/markupsafe-3.0.3-cp313-cp313t-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:b8512a91625c9b3da6f127803b166b629725e68af71f8184ae7e7d54686a56d6", size = 23284, upload_time = "2025-09-27T18:36:58.833Z" }, + { url = "https://files.pythonhosted.org/packages/58/47/4a0ccea4ab9f5dcb6f79c0236d954acb382202721e704223a8aafa38b5c8/markupsafe-3.0.3-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:9b79b7a16f7fedff2495d684f2b59b0457c3b493778c9eed31111be64d58279f", size = 24801, upload_time = "2025-09-27T18:36:59.739Z" }, + { url = "https://files.pythonhosted.org/packages/6a/70/3780e9b72180b6fecb83a4814d84c3bf4b4ae4bf0b19c27196104149734c/markupsafe-3.0.3-cp313-cp313t-musllinux_1_2_riscv64.whl", hash = "sha256:12c63dfb4a98206f045aa9563db46507995f7ef6d83b2f68eda65c307c6829eb", size = 22769, upload_time = "2025-09-27T18:37:00.719Z" }, + { url = "https://files.pythonhosted.org/packages/98/c5/c03c7f4125180fc215220c035beac6b9cb684bc7a067c84fc69414d315f5/markupsafe-3.0.3-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:8f71bc33915be5186016f675cd83a1e08523649b0e33efdb898db577ef5bb009", size = 23642, upload_time = "2025-09-27T18:37:01.673Z" }, + { url = "https://files.pythonhosted.org/packages/80/d6/2d1b89f6ca4bff1036499b1e29a1d02d282259f3681540e16563f27ebc23/markupsafe-3.0.3-cp313-cp313t-win32.whl", hash = "sha256:69c0b73548bc525c8cb9a251cddf1931d1db4d2258e9599c28c07ef3580ef354", size = 14612, upload_time = "2025-09-27T18:37:02.639Z" }, + { url = "https://files.pythonhosted.org/packages/2b/98/e48a4bfba0a0ffcf9925fe2d69240bfaa19c6f7507b8cd09c70684a53c1e/markupsafe-3.0.3-cp313-cp313t-win_amd64.whl", hash = "sha256:1b4b79e8ebf6b55351f0d91fe80f893b4743f104bff22e90697db1590e47a218", size = 15200, upload_time = "2025-09-27T18:37:03.582Z" }, + { url = "https://files.pythonhosted.org/packages/0e/72/e3cc540f351f316e9ed0f092757459afbc595824ca724cbc5a5d4263713f/markupsafe-3.0.3-cp313-cp313t-win_arm64.whl", hash = "sha256:ad2cf8aa28b8c020ab2fc8287b0f823d0a7d8630784c31e9ee5edea20f406287", size = 13973, upload_time = "2025-09-27T18:37:04.929Z" }, + { url = "https://files.pythonhosted.org/packages/33/8a/8e42d4838cd89b7dde187011e97fe6c3af66d8c044997d2183fbd6d31352/markupsafe-3.0.3-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:eaa9599de571d72e2daf60164784109f19978b327a3910d3e9de8c97b5b70cfe", size = 11619, upload_time = "2025-09-27T18:37:06.342Z" }, + { url = "https://files.pythonhosted.org/packages/b5/64/7660f8a4a8e53c924d0fa05dc3a55c9cee10bbd82b11c5afb27d44b096ce/markupsafe-3.0.3-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:c47a551199eb8eb2121d4f0f15ae0f923d31350ab9280078d1e5f12b249e0026", size = 12029, upload_time = "2025-09-27T18:37:07.213Z" }, + { url = "https://files.pythonhosted.org/packages/da/ef/e648bfd021127bef5fa12e1720ffed0c6cbb8310c8d9bea7266337ff06de/markupsafe-3.0.3-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:f34c41761022dd093b4b6896d4810782ffbabe30f2d443ff5f083e0cbbb8c737", size = 24408, upload_time = "2025-09-27T18:37:09.572Z" }, + { url = "https://files.pythonhosted.org/packages/41/3c/a36c2450754618e62008bf7435ccb0f88053e07592e6028a34776213d877/markupsafe-3.0.3-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:457a69a9577064c05a97c41f4e65148652db078a3a509039e64d3467b9e7ef97", size = 23005, upload_time = "2025-09-27T18:37:10.58Z" }, + { url = "https://files.pythonhosted.org/packages/bc/20/b7fdf89a8456b099837cd1dc21974632a02a999ec9bf7ca3e490aacd98e7/markupsafe-3.0.3-cp314-cp314-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:e8afc3f2ccfa24215f8cb28dcf43f0113ac3c37c2f0f0806d8c70e4228c5cf4d", size = 22048, upload_time = "2025-09-27T18:37:11.547Z" }, + { url = "https://files.pythonhosted.org/packages/9a/a7/591f592afdc734f47db08a75793a55d7fbcc6902a723ae4cfbab61010cc5/markupsafe-3.0.3-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:ec15a59cf5af7be74194f7ab02d0f59a62bdcf1a537677ce67a2537c9b87fcda", size = 23821, upload_time = "2025-09-27T18:37:12.48Z" }, + { url = "https://files.pythonhosted.org/packages/7d/33/45b24e4f44195b26521bc6f1a82197118f74df348556594bd2262bda1038/markupsafe-3.0.3-cp314-cp314-musllinux_1_2_riscv64.whl", hash = "sha256:0eb9ff8191e8498cca014656ae6b8d61f39da5f95b488805da4bb029cccbfbaf", size = 21606, upload_time = "2025-09-27T18:37:13.485Z" }, + { url = "https://files.pythonhosted.org/packages/ff/0e/53dfaca23a69fbfbbf17a4b64072090e70717344c52eaaaa9c5ddff1e5f0/markupsafe-3.0.3-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:2713baf880df847f2bece4230d4d094280f4e67b1e813eec43b4c0e144a34ffe", size = 23043, upload_time = "2025-09-27T18:37:14.408Z" }, + { url = "https://files.pythonhosted.org/packages/46/11/f333a06fc16236d5238bfe74daccbca41459dcd8d1fa952e8fbd5dccfb70/markupsafe-3.0.3-cp314-cp314-win32.whl", hash = "sha256:729586769a26dbceff69f7a7dbbf59ab6572b99d94576a5592625d5b411576b9", size = 14747, upload_time = "2025-09-27T18:37:15.36Z" }, + { url = "https://files.pythonhosted.org/packages/28/52/182836104b33b444e400b14f797212f720cbc9ed6ba34c800639d154e821/markupsafe-3.0.3-cp314-cp314-win_amd64.whl", hash = "sha256:bdc919ead48f234740ad807933cdf545180bfbe9342c2bb451556db2ed958581", size = 15341, upload_time = "2025-09-27T18:37:16.496Z" }, + { url = "https://files.pythonhosted.org/packages/6f/18/acf23e91bd94fd7b3031558b1f013adfa21a8e407a3fdb32745538730382/markupsafe-3.0.3-cp314-cp314-win_arm64.whl", hash = "sha256:5a7d5dc5140555cf21a6fefbdbf8723f06fcd2f63ef108f2854de715e4422cb4", size = 14073, upload_time = "2025-09-27T18:37:17.476Z" }, + { url = "https://files.pythonhosted.org/packages/3c/f0/57689aa4076e1b43b15fdfa646b04653969d50cf30c32a102762be2485da/markupsafe-3.0.3-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:1353ef0c1b138e1907ae78e2f6c63ff67501122006b0f9abad68fda5f4ffc6ab", size = 11661, upload_time = "2025-09-27T18:37:18.453Z" }, + { url = "https://files.pythonhosted.org/packages/89/c3/2e67a7ca217c6912985ec766c6393b636fb0c2344443ff9d91404dc4c79f/markupsafe-3.0.3-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:1085e7fbddd3be5f89cc898938f42c0b3c711fdcb37d75221de2666af647c175", size = 12069, upload_time = "2025-09-27T18:37:19.332Z" }, + { url = "https://files.pythonhosted.org/packages/f0/00/be561dce4e6ca66b15276e184ce4b8aec61fe83662cce2f7d72bd3249d28/markupsafe-3.0.3-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:1b52b4fb9df4eb9ae465f8d0c228a00624de2334f216f178a995ccdcf82c4634", size = 25670, upload_time = "2025-09-27T18:37:20.245Z" }, + { url = "https://files.pythonhosted.org/packages/50/09/c419f6f5a92e5fadde27efd190eca90f05e1261b10dbd8cbcb39cd8ea1dc/markupsafe-3.0.3-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:fed51ac40f757d41b7c48425901843666a6677e3e8eb0abcff09e4ba6e664f50", size = 23598, upload_time = "2025-09-27T18:37:21.177Z" }, + { url = "https://files.pythonhosted.org/packages/22/44/a0681611106e0b2921b3033fc19bc53323e0b50bc70cffdd19f7d679bb66/markupsafe-3.0.3-cp314-cp314t-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:f190daf01f13c72eac4efd5c430a8de82489d9cff23c364c3ea822545032993e", size = 23261, upload_time = "2025-09-27T18:37:22.167Z" }, + { url = "https://files.pythonhosted.org/packages/5f/57/1b0b3f100259dc9fffe780cfb60d4be71375510e435efec3d116b6436d43/markupsafe-3.0.3-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:e56b7d45a839a697b5eb268c82a71bd8c7f6c94d6fd50c3d577fa39a9f1409f5", size = 24835, upload_time = "2025-09-27T18:37:23.296Z" }, + { url = "https://files.pythonhosted.org/packages/26/6a/4bf6d0c97c4920f1597cc14dd720705eca0bf7c787aebc6bb4d1bead5388/markupsafe-3.0.3-cp314-cp314t-musllinux_1_2_riscv64.whl", hash = "sha256:f3e98bb3798ead92273dc0e5fd0f31ade220f59a266ffd8a4f6065e0a3ce0523", size = 22733, upload_time = "2025-09-27T18:37:24.237Z" }, + { url = "https://files.pythonhosted.org/packages/14/c7/ca723101509b518797fedc2fdf79ba57f886b4aca8a7d31857ba3ee8281f/markupsafe-3.0.3-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:5678211cb9333a6468fb8d8be0305520aa073f50d17f089b5b4b477ea6e67fdc", size = 23672, upload_time = "2025-09-27T18:37:25.271Z" }, + { url = "https://files.pythonhosted.org/packages/fb/df/5bd7a48c256faecd1d36edc13133e51397e41b73bb77e1a69deab746ebac/markupsafe-3.0.3-cp314-cp314t-win32.whl", hash = "sha256:915c04ba3851909ce68ccc2b8e2cd691618c4dc4c4232fb7982bca3f41fd8c3d", size = 14819, upload_time = "2025-09-27T18:37:26.285Z" }, + { url = "https://files.pythonhosted.org/packages/1a/8a/0402ba61a2f16038b48b39bccca271134be00c5c9f0f623208399333c448/markupsafe-3.0.3-cp314-cp314t-win_amd64.whl", hash = "sha256:4faffd047e07c38848ce017e8725090413cd80cbc23d86e55c587bf979e579c9", size = 15426, upload_time = "2025-09-27T18:37:27.316Z" }, + { url = "https://files.pythonhosted.org/packages/70/bc/6f1c2f612465f5fa89b95bead1f44dcb607670fd42891d8fdcd5d039f4f4/markupsafe-3.0.3-cp314-cp314t-win_arm64.whl", hash = "sha256:32001d6a8fc98c8cb5c947787c5d08b0a50663d139f1305bac5885d98d9b40fa", size = 14146, upload_time = "2025-09-27T18:37:28.327Z" }, + { url = "https://files.pythonhosted.org/packages/56/23/0d8c13a44bde9154821586520840643467aee574d8ce79a17da539ee7fed/markupsafe-3.0.3-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:15d939a21d546304880945ca1ecb8a039db6b4dc49b2c5a400387cdae6a62e26", size = 11623, upload_time = "2025-09-27T18:37:29.296Z" }, + { url = "https://files.pythonhosted.org/packages/fd/23/07a2cb9a8045d5f3f0890a8c3bc0859d7a47bfd9a560b563899bec7b72ed/markupsafe-3.0.3-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:f71a396b3bf33ecaa1626c255855702aca4d3d9fea5e051b41ac59a9c1c41edc", size = 12049, upload_time = "2025-09-27T18:37:30.234Z" }, + { url = "https://files.pythonhosted.org/packages/bc/e4/6be85eb81503f8e11b61c0b6369b6e077dcf0a74adbd9ebf6b349937b4e9/markupsafe-3.0.3-cp39-cp39-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:0f4b68347f8c5eab4a13419215bdfd7f8c9b19f2b25520968adfad23eb0ce60c", size = 21923, upload_time = "2025-09-27T18:37:31.177Z" }, + { url = "https://files.pythonhosted.org/packages/6f/bc/4dc914ead3fe6ddaef035341fee0fc956949bbd27335b611829292b89ee2/markupsafe-3.0.3-cp39-cp39-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:e8fc20152abba6b83724d7ff268c249fa196d8259ff481f3b1476383f8f24e42", size = 20543, upload_time = "2025-09-27T18:37:32.168Z" }, + { url = "https://files.pythonhosted.org/packages/89/6e/5fe81fbcfba4aef4093d5f856e5c774ec2057946052d18d168219b7bd9f9/markupsafe-3.0.3-cp39-cp39-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:949b8d66bc381ee8b007cd945914c721d9aba8e27f71959d750a46f7c282b20b", size = 20585, upload_time = "2025-09-27T18:37:33.166Z" }, + { url = "https://files.pythonhosted.org/packages/f6/f6/e0e5a3d3ae9c4020f696cd055f940ef86b64fe88de26f3a0308b9d3d048c/markupsafe-3.0.3-cp39-cp39-musllinux_1_2_aarch64.whl", hash = "sha256:3537e01efc9d4dccdf77221fb1cb3b8e1a38d5428920e0657ce299b20324d758", size = 21387, upload_time = "2025-09-27T18:37:34.185Z" }, + { url = "https://files.pythonhosted.org/packages/c8/25/651753ef4dea08ea790f4fbb65146a9a44a014986996ca40102e237aa49a/markupsafe-3.0.3-cp39-cp39-musllinux_1_2_riscv64.whl", hash = "sha256:591ae9f2a647529ca990bc681daebdd52c8791ff06c2bfa05b65163e28102ef2", size = 20133, upload_time = "2025-09-27T18:37:35.138Z" }, + { url = "https://files.pythonhosted.org/packages/dc/0a/c3cf2b4fef5f0426e8a6d7fce3cb966a17817c568ce59d76b92a233fdbec/markupsafe-3.0.3-cp39-cp39-musllinux_1_2_x86_64.whl", hash = "sha256:a320721ab5a1aba0a233739394eb907f8c8da5c98c9181d1161e77a0c8e36f2d", size = 20588, upload_time = "2025-09-27T18:37:36.096Z" }, + { url = "https://files.pythonhosted.org/packages/cd/1b/a7782984844bd519ad4ffdbebbba2671ec5d0ebbeac34736c15fb86399e8/markupsafe-3.0.3-cp39-cp39-win32.whl", hash = "sha256:df2449253ef108a379b8b5d6b43f4b1a8e81a061d6537becd5582fba5f9196d7", size = 14566, upload_time = "2025-09-27T18:37:37.09Z" }, + { url = "https://files.pythonhosted.org/packages/18/1f/8d9c20e1c9440e215a44be5ab64359e207fcb4f675543f1cf9a2a7f648d0/markupsafe-3.0.3-cp39-cp39-win_amd64.whl", hash = "sha256:7c3fb7d25180895632e5d3148dbdc29ea38ccb7fd210aa27acbd1201a1902c6e", size = 15053, upload_time = "2025-09-27T18:37:38.054Z" }, + { url = "https://files.pythonhosted.org/packages/4e/d3/fe08482b5cd995033556d45041a4f4e76e7f0521112a9c9991d40d39825f/markupsafe-3.0.3-cp39-cp39-win_arm64.whl", hash = "sha256:38664109c14ffc9e7437e86b4dceb442b0096dfe3541d7864d9cbe1da4cf36c8", size = 13928, upload_time = "2025-09-27T18:37:39.037Z" }, +] + +[[package]] +name = "mccabe" +version = "0.7.0" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/e7/ff/0ffefdcac38932a54d2b5eed4e0ba8a408f215002cd178ad1df0f2806ff8/mccabe-0.7.0.tar.gz", hash = "sha256:348e0240c33b60bbdf4e523192ef919f28cb2c3d7d5c7794f74009290f236325", size = 9658, upload_time = "2022-01-24T01:14:51.113Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/27/1a/1f68f9ba0c207934b35b86a8ca3aad8395a3d6dd7921c0686e23853ff5a9/mccabe-0.7.0-py2.py3-none-any.whl", hash = "sha256:6c2d30ab6be0e4a46919781807b4f0d834ebdd6c6e3dca0bda5a15f863427b6e", size = 7350, upload_time = "2022-01-24T01:14:49.62Z" }, +] + +[[package]] +name = "nifcloud" +source = { editable = "." } +dependencies = [ + { name = "botocore" }, +] + +[package.optional-dependencies] +dev = [ + { name = "flake8", version = "5.0.4", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.8.1'" }, + { name = "flake8", version = "7.1.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.8.1' and python_full_version < '3.9'" }, + { name = "flake8", version = "7.3.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.9'" }, + { name = "isort", version = "5.13.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, + { name = "isort", version = "6.1.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version == '3.9.*'" }, + { name = "isort", version = "7.0.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.10'" }, + { name = "pytest", version = "8.3.5", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, + { name = "pytest", version = "8.4.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version == '3.9.*'" }, + { name = "pytest", version = "9.0.1", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.10'" }, + { name = "requests", version = "2.32.4", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, + { name = "requests", version = "2.32.5", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.9'" }, + { name = "sphinx" }, + { name = "sphinx-rtd-theme" }, +] + +[package.dev-dependencies] +dev = [ + { name = "flake8", version = "5.0.4", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.8.1'" }, + { name = "flake8", version = "7.1.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.8.1' and python_full_version < '3.9'" }, + { name = "flake8", version = "7.3.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.9'" }, + { name = "isort", version = "5.13.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, + { name = "isort", version = "6.1.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version == '3.9.*'" }, + { name = "isort", version = "7.0.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.10'" }, + { name = "pytest", version = "8.3.5", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, + { name = "pytest", version = "8.4.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version == '3.9.*'" }, + { name = "pytest", version = "9.0.1", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.10'" }, + { name = "requests", version = "2.32.4", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, + { name = "requests", version = "2.32.5", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.9'" }, + { name = "sphinx" }, + { name = "sphinx-rtd-theme" }, +] + +[package.metadata] +requires-dist = [ + { name = "botocore", specifier = "==1.37.10" }, + { name = "flake8", marker = "extra == 'dev'" }, + { name = "isort", marker = "extra == 'dev'" }, + { name = "pytest", marker = "extra == 'dev'" }, + { name = "requests", marker = "extra == 'dev'" }, + { name = "sphinx", marker = "extra == 'dev'", specifier = "==5.3.0" }, + { name = "sphinx-rtd-theme", marker = "extra == 'dev'" }, +] +provides-extras = ["dev"] + +[package.metadata.requires-dev] +dev = [ + { name = "flake8" }, + { name = "isort" }, + { name = "pytest" }, + { name = "requests" }, + { name = "sphinx", specifier = "==5.3.0" }, + { name = "sphinx-rtd-theme" }, +] + +[[package]] +name = "packaging" +version = "25.0" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/a1/d4/1fc4078c65507b51b96ca8f8c3ba19e6a61c8253c72794544580a7b6c24d/packaging-25.0.tar.gz", hash = "sha256:d443872c98d677bf60f6a1f2f8c1cb748e8fe762d2bf9d3148b5599295b0fc4f", size = 165727, upload_time = "2025-04-19T11:48:59.673Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/20/12/38679034af332785aac8774540895e234f4d07f7545804097de4b666afd8/packaging-25.0-py3-none-any.whl", hash = "sha256:29572ef2b1f17581046b3a2227d5c611fb25ec70ca1ba8554b24b0e69331a484", size = 66469, upload_time = "2025-04-19T11:48:57.875Z" }, +] + +[[package]] +name = "pluggy" +version = "1.5.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.8.1' and python_full_version < '3.9'", + "python_full_version < '3.8.1'", +] +sdist = { url = "https://files.pythonhosted.org/packages/96/2d/02d4312c973c6050a18b314a5ad0b3210edb65a906f868e31c111dede4a6/pluggy-1.5.0.tar.gz", hash = "sha256:2cffa88e94fdc978c4c574f15f9e59b7f4201d439195c3715ca9e2486f1d0cf1", size = 67955, upload_time = "2024-04-20T21:34:42.531Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/88/5f/e351af9a41f866ac3f1fac4ca0613908d9a41741cfcf2228f4ad853b697d/pluggy-1.5.0-py3-none-any.whl", hash = "sha256:44e1ad92c8ca002de6377e165f3e0f1be63266ab4d554740532335b9d75ea669", size = 20556, upload_time = "2024-04-20T21:34:40.434Z" }, +] + +[[package]] +name = "pluggy" +version = "1.6.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.10'", + "python_full_version == '3.9.*'", +] +sdist = { url = "https://files.pythonhosted.org/packages/f9/e2/3e91f31a7d2b083fe6ef3fa267035b518369d9511ffab804f839851d2779/pluggy-1.6.0.tar.gz", hash = "sha256:7dcc130b76258d33b90f61b658791dede3486c3e6bfb003ee5c9bfb396dd22f3", size = 69412, upload_time = "2025-05-15T12:30:07.975Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/54/20/4d324d65cc6d9205fabedc306948156824eb9f0ee1633355a8f7ec5c66bf/pluggy-1.6.0-py3-none-any.whl", hash = "sha256:e920276dd6813095e9377c0bc5566d94c932c33b27a3e3945d8389c374dd4746", size = 20538, upload_time = "2025-05-15T12:30:06.134Z" }, +] + +[[package]] +name = "pycodestyle" +version = "2.9.1" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version < '3.8.1'", +] +sdist = { url = "https://files.pythonhosted.org/packages/b6/83/5bcaedba1f47200f0665ceb07bcb00e2be123192742ee0edfb66b600e5fd/pycodestyle-2.9.1.tar.gz", hash = "sha256:2c9607871d58c76354b697b42f5d57e1ada7d261c261efac224b664affdc5785", size = 102127, upload_time = "2022-08-03T23:13:29.715Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/67/e4/fc77f1039c34b3612c4867b69cbb2b8a4e569720b1f19b0637002ee03aff/pycodestyle-2.9.1-py2.py3-none-any.whl", hash = "sha256:d1735fc58b418fd7c5f658d28d943854f8a849b01a5d0a1e6f3f3fdd0166804b", size = 41493, upload_time = "2022-08-03T23:13:27.416Z" }, +] + +[[package]] +name = "pycodestyle" +version = "2.12.1" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.8.1' and python_full_version < '3.9'", +] +sdist = { url = "https://files.pythonhosted.org/packages/43/aa/210b2c9aedd8c1cbeea31a50e42050ad56187754b34eb214c46709445801/pycodestyle-2.12.1.tar.gz", hash = "sha256:6838eae08bbce4f6accd5d5572075c63626a15ee3e6f842df996bf62f6d73521", size = 39232, upload_time = "2024-08-04T20:26:54.576Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/3a/d8/a211b3f85e99a0daa2ddec96c949cac6824bd305b040571b82a03dd62636/pycodestyle-2.12.1-py2.py3-none-any.whl", hash = "sha256:46f0fb92069a7c28ab7bb558f05bfc0110dac69a0cd23c61ea0040283a9d78b3", size = 31284, upload_time = "2024-08-04T20:26:53.173Z" }, +] + +[[package]] +name = "pycodestyle" +version = "2.14.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.10'", + "python_full_version == '3.9.*'", +] +sdist = { url = "https://files.pythonhosted.org/packages/11/e0/abfd2a0d2efe47670df87f3e3a0e2edda42f055053c85361f19c0e2c1ca8/pycodestyle-2.14.0.tar.gz", hash = "sha256:c4b5b517d278089ff9d0abdec919cd97262a3367449ea1c8b49b91529167b783", size = 39472, upload_time = "2025-06-20T18:49:48.75Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/d7/27/a58ddaf8c588a3ef080db9d0b7e0b97215cee3a45df74f3a94dbbf5c893a/pycodestyle-2.14.0-py2.py3-none-any.whl", hash = "sha256:dd6bf7cb4ee77f8e016f9c8e74a35ddd9f67e1d5fd4184d86c3b98e07099f42d", size = 31594, upload_time = "2025-06-20T18:49:47.491Z" }, +] + +[[package]] +name = "pyflakes" +version = "2.5.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version < '3.8.1'", +] +sdist = { url = "https://files.pythonhosted.org/packages/07/92/f0cb5381f752e89a598dd2850941e7f570ac3cb8ea4a344854de486db152/pyflakes-2.5.0.tar.gz", hash = "sha256:491feb020dca48ccc562a8c0cbe8df07ee13078df59813b83959cbdada312ea3", size = 66388, upload_time = "2022-07-30T17:29:05.816Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/dc/13/63178f59f74e53acc2165aee4b002619a3cfa7eeaeac989a9eb41edf364e/pyflakes-2.5.0-py2.py3-none-any.whl", hash = "sha256:4579f67d887f804e67edb544428f264b7b24f435b263c4614f384135cea553d2", size = 66116, upload_time = "2022-07-30T17:29:04.179Z" }, +] + +[[package]] +name = "pyflakes" +version = "3.2.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.8.1' and python_full_version < '3.9'", +] +sdist = { url = "https://files.pythonhosted.org/packages/57/f9/669d8c9c86613c9d568757c7f5824bd3197d7b1c6c27553bc5618a27cce2/pyflakes-3.2.0.tar.gz", hash = "sha256:1c61603ff154621fb2a9172037d84dca3500def8c8b630657d1701f026f8af3f", size = 63788, upload_time = "2024-01-05T00:28:47.703Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/d4/d7/f1b7db88d8e4417c5d47adad627a93547f44bdc9028372dbd2313f34a855/pyflakes-3.2.0-py2.py3-none-any.whl", hash = "sha256:84b5be138a2dfbb40689ca07e2152deb896a65c3a3e24c251c5c62489568074a", size = 62725, upload_time = "2024-01-05T00:28:45.903Z" }, +] + +[[package]] +name = "pyflakes" +version = "3.4.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.10'", + "python_full_version == '3.9.*'", +] +sdist = { url = "https://files.pythonhosted.org/packages/45/dc/fd034dc20b4b264b3d015808458391acbf9df40b1e54750ef175d39180b1/pyflakes-3.4.0.tar.gz", hash = "sha256:b24f96fafb7d2ab0ec5075b7350b3d2d2218eab42003821c06344973d3ea2f58", size = 64669, upload_time = "2025-06-20T18:45:27.834Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/c2/2f/81d580a0fb83baeb066698975cb14a618bdbed7720678566f1b046a95fe8/pyflakes-3.4.0-py2.py3-none-any.whl", hash = "sha256:f742a7dbd0d9cb9ea41e9a24a918996e8170c799fa528688d40dd582c8265f4f", size = 63551, upload_time = "2025-06-20T18:45:26.937Z" }, +] + +[[package]] +name = "pygments" +version = "2.19.2" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/b0/77/a5b8c569bf593b0140bde72ea885a803b82086995367bf2037de0159d924/pygments-2.19.2.tar.gz", hash = "sha256:636cb2477cec7f8952536970bc533bc43743542f70392ae026374600add5b887", size = 4968631, upload_time = "2025-06-21T13:39:12.283Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/c7/21/705964c7812476f378728bdf590ca4b771ec72385c533964653c68e86bdc/pygments-2.19.2-py3-none-any.whl", hash = "sha256:86540386c03d588bb81d44bc3928634ff26449851e99741617ecb9037ee5ec0b", size = 1225217, upload_time = "2025-06-21T13:39:07.939Z" }, +] + +[[package]] +name = "pytest" +version = "8.3.5" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.8.1' and python_full_version < '3.9'", + "python_full_version < '3.8.1'", +] +dependencies = [ + { name = "colorama", marker = "python_full_version < '3.9' and sys_platform == 'win32'" }, + { name = "exceptiongroup", marker = "python_full_version < '3.9'" }, + { name = "iniconfig", version = "2.1.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, + { name = "packaging", marker = "python_full_version < '3.9'" }, + { name = "pluggy", version = "1.5.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, + { name = "tomli", marker = "python_full_version < '3.9'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/ae/3c/c9d525a414d506893f0cd8a8d0de7706446213181570cdbd766691164e40/pytest-8.3.5.tar.gz", hash = "sha256:f4efe70cc14e511565ac476b57c279e12a855b11f48f212af1080ef2263d3845", size = 1450891, upload_time = "2025-03-02T12:54:54.503Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/30/3d/64ad57c803f1fa1e963a7946b6e0fea4a70df53c1a7fed304586539c2bac/pytest-8.3.5-py3-none-any.whl", hash = "sha256:c69214aa47deac29fad6c2a4f590b9c4a9fdb16a403176fe154b79c0b4d4d820", size = 343634, upload_time = "2025-03-02T12:54:52.069Z" }, +] + +[[package]] +name = "pytest" +version = "8.4.2" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version == '3.9.*'", +] +dependencies = [ + { name = "colorama", marker = "python_full_version == '3.9.*' and sys_platform == 'win32'" }, + { name = "exceptiongroup", marker = "python_full_version == '3.9.*'" }, + { name = "iniconfig", version = "2.1.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version == '3.9.*'" }, + { name = "packaging", marker = "python_full_version == '3.9.*'" }, + { name = "pluggy", version = "1.6.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version == '3.9.*'" }, + { name = "pygments", marker = "python_full_version == '3.9.*'" }, + { name = "tomli", marker = "python_full_version == '3.9.*'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/a3/5c/00a0e072241553e1a7496d638deababa67c5058571567b92a7eaa258397c/pytest-8.4.2.tar.gz", hash = "sha256:86c0d0b93306b961d58d62a4db4879f27fe25513d4b969df351abdddb3c30e01", size = 1519618, upload_time = "2025-09-04T14:34:22.711Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/a8/a4/20da314d277121d6534b3a980b29035dcd51e6744bd79075a6ce8fa4eb8d/pytest-8.4.2-py3-none-any.whl", hash = "sha256:872f880de3fc3a5bdc88a11b39c9710c3497a547cfa9320bc3c5e62fbf272e79", size = 365750, upload_time = "2025-09-04T14:34:20.226Z" }, +] + +[[package]] +name = "pytest" +version = "9.0.1" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.10'", +] +dependencies = [ + { name = "colorama", marker = "python_full_version >= '3.10' and sys_platform == 'win32'" }, + { name = "exceptiongroup", marker = "python_full_version == '3.10.*'" }, + { name = "iniconfig", version = "2.3.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.10'" }, + { name = "packaging", marker = "python_full_version >= '3.10'" }, + { name = "pluggy", version = "1.6.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.10'" }, + { name = "pygments", marker = "python_full_version >= '3.10'" }, + { name = "tomli", marker = "python_full_version == '3.10.*'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/07/56/f013048ac4bc4c1d9be45afd4ab209ea62822fb1598f40687e6bf45dcea4/pytest-9.0.1.tar.gz", hash = "sha256:3e9c069ea73583e255c3b21cf46b8d3c56f6e3a1a8f6da94ccb0fcf57b9d73c8", size = 1564125, upload_time = "2025-11-12T13:05:09.333Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/0b/8b/6300fb80f858cda1c51ffa17075df5d846757081d11ab4aa35cef9e6258b/pytest-9.0.1-py3-none-any.whl", hash = "sha256:67be0030d194df2dfa7b556f2e56fb3c3315bd5c8822c6951162b92b32ce7dad", size = 373668, upload_time = "2025-11-12T13:05:07.379Z" }, +] + +[[package]] +name = "python-dateutil" +version = "2.9.0.post0" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "six" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/66/c0/0c8b6ad9f17a802ee498c46e004a0eb49bc148f2fd230864601a86dcf6db/python-dateutil-2.9.0.post0.tar.gz", hash = "sha256:37dd54208da7e1cd875388217d5e00ebd4179249f90fb72437e91a35459a0ad3", size = 342432, upload_time = "2024-03-01T18:36:20.211Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/ec/57/56b9bcc3c9c6a792fcbaf139543cee77261f3651ca9da0c93f5c1221264b/python_dateutil-2.9.0.post0-py2.py3-none-any.whl", hash = "sha256:a8b2bc7bffae282281c8140a97d3aa9c14da0b136dfe83f850eea9a5f7470427", size = 229892, upload_time = "2024-03-01T18:36:18.57Z" }, +] + +[[package]] +name = "pytz" +version = "2025.2" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/f8/bf/abbd3cdfb8fbc7fb3d4d38d320f2441b1e7cbe29be4f23797b4a2b5d8aac/pytz-2025.2.tar.gz", hash = "sha256:360b9e3dbb49a209c21ad61809c7fb453643e048b38924c765813546746e81c3", size = 320884, upload_time = "2025-03-25T02:25:00.538Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/81/c4/34e93fe5f5429d7570ec1fa436f1986fb1f00c3e0f43a589fe2bbcd22c3f/pytz-2025.2-py2.py3-none-any.whl", hash = "sha256:5ddf76296dd8c44c26eb8f4b6f35488f3ccbf6fbbd7adee0b7262d43f0ec2f00", size = 509225, upload_time = "2025-03-25T02:24:58.468Z" }, +] + +[[package]] +name = "requests" +version = "2.32.4" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.8.1' and python_full_version < '3.9'", + "python_full_version < '3.8.1'", +] +dependencies = [ + { name = "certifi", marker = "python_full_version < '3.9'" }, + { name = "charset-normalizer", marker = "python_full_version < '3.9'" }, + { name = "idna", marker = "python_full_version < '3.9'" }, + { name = "urllib3", version = "1.26.20", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/e1/0a/929373653770d8a0d7ea76c37de6e41f11eb07559b103b1c02cafb3f7cf8/requests-2.32.4.tar.gz", hash = "sha256:27d0316682c8a29834d3264820024b62a36942083d52caf2f14c0591336d3422", size = 135258, upload_time = "2025-06-09T16:43:07.34Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/7c/e4/56027c4a6b4ae70ca9de302488c5ca95ad4a39e190093d6c1a8ace08341b/requests-2.32.4-py3-none-any.whl", hash = "sha256:27babd3cda2a6d50b30443204ee89830707d396671944c998b5975b031ac2b2c", size = 64847, upload_time = "2025-06-09T16:43:05.728Z" }, +] + +[[package]] +name = "requests" +version = "2.32.5" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.10'", + "python_full_version == '3.9.*'", +] +dependencies = [ + { name = "certifi", marker = "python_full_version >= '3.9'" }, + { name = "charset-normalizer", marker = "python_full_version >= '3.9'" }, + { name = "idna", marker = "python_full_version >= '3.9'" }, + { name = "urllib3", version = "1.26.20", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version == '3.9.*'" }, + { name = "urllib3", version = "2.5.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.10'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/c9/74/b3ff8e6c8446842c3f5c837e9c3dfcfe2018ea6ecef224c710c85ef728f4/requests-2.32.5.tar.gz", hash = "sha256:dbba0bac56e100853db0ea71b82b4dfd5fe2bf6d3754a8893c3af500cec7d7cf", size = 134517, upload_time = "2025-08-18T20:46:02.573Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/1e/db/4254e3eabe8020b458f1a747140d32277ec7a271daf1d235b70dc0b4e6e3/requests-2.32.5-py3-none-any.whl", hash = "sha256:2462f94637a34fd532264295e186976db0f5d453d1cdd31473c85a6a161affb6", size = 64738, upload_time = "2025-08-18T20:46:00.542Z" }, +] + +[[package]] +name = "six" +version = "1.17.0" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/94/e7/b2c673351809dca68a0e064b6af791aa332cf192da575fd474ed7d6f16a2/six-1.17.0.tar.gz", hash = "sha256:ff70335d468e7eb6ec65b95b99d3a2836546063f63acc5171de367e834932a81", size = 34031, upload_time = "2024-12-04T17:35:28.174Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/b7/ce/149a00dd41f10bc29e5921b496af8b574d8413afcd5e30dfa0ed46c2cc5e/six-1.17.0-py2.py3-none-any.whl", hash = "sha256:4721f391ed90541fddacab5acf947aa0d3dc7d27b2e1e8eda2be8970586c3274", size = 11050, upload_time = "2024-12-04T17:35:26.475Z" }, +] + +[[package]] +name = "snowballstemmer" +version = "3.0.1" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/75/a7/9810d872919697c9d01295633f5d574fb416d47e535f258272ca1f01f447/snowballstemmer-3.0.1.tar.gz", hash = "sha256:6d5eeeec8e9f84d4d56b847692bacf79bc2c8e90c7f80ca4444ff8b6f2e52895", size = 105575, upload_time = "2025-05-09T16:34:51.843Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/c8/78/3565d011c61f5a43488987ee32b6f3f656e7f107ac2782dd57bdd7d91d9a/snowballstemmer-3.0.1-py3-none-any.whl", hash = "sha256:6cd7b3897da8d6c9ffb968a6781fa6532dce9c3618a4b127d920dab764a19064", size = 103274, upload_time = "2025-05-09T16:34:50.371Z" }, +] + +[[package]] +name = "sphinx" +version = "5.3.0" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "alabaster", version = "0.7.13", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, + { name = "alabaster", version = "0.7.16", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.9'" }, + { name = "babel" }, + { name = "colorama", marker = "sys_platform == 'win32'" }, + { name = "docutils" }, + { name = "imagesize" }, + { name = "importlib-metadata", version = "8.5.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, + { name = "importlib-metadata", version = "8.7.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version == '3.9.*'" }, + { name = "jinja2" }, + { name = "packaging" }, + { name = "pygments" }, + { name = "requests", version = "2.32.4", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, + { name = "requests", version = "2.32.5", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.9'" }, + { name = "snowballstemmer" }, + { name = "sphinxcontrib-applehelp", version = "1.0.4", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, + { name = "sphinxcontrib-applehelp", version = "2.0.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.9'" }, + { name = "sphinxcontrib-devhelp", version = "1.0.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, + { name = "sphinxcontrib-devhelp", version = "2.0.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.9'" }, + { name = "sphinxcontrib-htmlhelp", version = "2.0.1", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, + { name = "sphinxcontrib-htmlhelp", version = "2.1.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.9'" }, + { name = "sphinxcontrib-jsmath" }, + { name = "sphinxcontrib-qthelp", version = "1.0.3", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, + { name = "sphinxcontrib-qthelp", version = "2.0.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.9'" }, + { name = "sphinxcontrib-serializinghtml", version = "1.1.5", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, + { name = "sphinxcontrib-serializinghtml", version = "2.0.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.9'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/af/b2/02a43597980903483fe5eb081ee8e0ba2bb62ea43a70499484343795f3bf/Sphinx-5.3.0.tar.gz", hash = "sha256:51026de0a9ff9fc13c05d74913ad66047e104f56a129ff73e174eb5c3ee794b5", size = 6811365, upload_time = "2022-10-16T09:58:25.963Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/67/a7/01dd6fd9653c056258d65032aa09a615b5d7b07dd840845a9f41a8860fbc/sphinx-5.3.0-py3-none-any.whl", hash = "sha256:060ca5c9f7ba57a08a1219e547b269fadf125ae25b06b9fa7f66768efb652d6d", size = 3183160, upload_time = "2022-10-16T09:58:21.63Z" }, +] + +[[package]] +name = "sphinx-rtd-theme" +version = "2.0.0" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "docutils" }, + { name = "sphinx" }, + { name = "sphinxcontrib-jquery" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/fe/33/2a35a9cdbfda9086bda11457bcc872173ab3565b16b6d7f6b3efaa6dc3d6/sphinx_rtd_theme-2.0.0.tar.gz", hash = "sha256:bd5d7b80622406762073a04ef8fadc5f9151261563d47027de09910ce03afe6b", size = 2785005, upload_time = "2023-11-28T04:14:03.104Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/ea/46/00fda84467815c29951a9c91e3ae7503c409ddad04373e7cfc78daad4300/sphinx_rtd_theme-2.0.0-py2.py3-none-any.whl", hash = "sha256:ec93d0856dc280cf3aee9a4c9807c60e027c7f7b461b77aeffed682e68f0e586", size = 2824721, upload_time = "2023-11-28T04:13:59.589Z" }, +] + +[[package]] +name = "sphinxcontrib-applehelp" +version = "1.0.4" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.8.1' and python_full_version < '3.9'", + "python_full_version < '3.8.1'", +] +sdist = { url = "https://files.pythonhosted.org/packages/32/df/45e827f4d7e7fcc84e853bcef1d836effd762d63ccb86f43ede4e98b478c/sphinxcontrib-applehelp-1.0.4.tar.gz", hash = "sha256:828f867945bbe39817c210a1abfd1bc4895c8b73fcaade56d45357a348a07d7e", size = 24766, upload_time = "2023-01-23T09:41:54.435Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/06/c1/5e2cafbd03105ce50d8500f9b4e8a6e8d02e22d0475b574c3b3e9451a15f/sphinxcontrib_applehelp-1.0.4-py3-none-any.whl", hash = "sha256:29d341f67fb0f6f586b23ad80e072c8e6ad0b48417db2bde114a4c9746feb228", size = 120601, upload_time = "2023-01-23T09:41:52.364Z" }, +] + +[[package]] +name = "sphinxcontrib-applehelp" +version = "2.0.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.10'", + "python_full_version == '3.9.*'", +] +sdist = { url = "https://files.pythonhosted.org/packages/ba/6e/b837e84a1a704953c62ef8776d45c3e8d759876b4a84fe14eba2859106fe/sphinxcontrib_applehelp-2.0.0.tar.gz", hash = "sha256:2f29ef331735ce958efa4734873f084941970894c6090408b079c61b2e1c06d1", size = 20053, upload_time = "2024-07-29T01:09:00.465Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/5d/85/9ebeae2f76e9e77b952f4b274c27238156eae7979c5421fba91a28f4970d/sphinxcontrib_applehelp-2.0.0-py3-none-any.whl", hash = "sha256:4cd3f0ec4ac5dd9c17ec65e9ab272c9b867ea77425228e68ecf08d6b28ddbdb5", size = 119300, upload_time = "2024-07-29T01:08:58.99Z" }, +] + +[[package]] +name = "sphinxcontrib-devhelp" +version = "1.0.2" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.8.1' and python_full_version < '3.9'", + "python_full_version < '3.8.1'", +] +sdist = { url = "https://files.pythonhosted.org/packages/98/33/dc28393f16385f722c893cb55539c641c9aaec8d1bc1c15b69ce0ac2dbb3/sphinxcontrib-devhelp-1.0.2.tar.gz", hash = "sha256:ff7f1afa7b9642e7060379360a67e9c41e8f3121f2ce9164266f61b9f4b338e4", size = 17398, upload_time = "2020-02-29T04:14:43.378Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/c5/09/5de5ed43a521387f18bdf5f5af31d099605c992fd25372b2b9b825ce48ee/sphinxcontrib_devhelp-1.0.2-py2.py3-none-any.whl", hash = "sha256:8165223f9a335cc1af7ffe1ed31d2871f325254c0423bc0c4c7cd1c1e4734a2e", size = 84690, upload_time = "2020-02-29T04:14:40.765Z" }, +] + +[[package]] +name = "sphinxcontrib-devhelp" +version = "2.0.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.10'", + "python_full_version == '3.9.*'", +] +sdist = { url = "https://files.pythonhosted.org/packages/f6/d2/5beee64d3e4e747f316bae86b55943f51e82bb86ecd325883ef65741e7da/sphinxcontrib_devhelp-2.0.0.tar.gz", hash = "sha256:411f5d96d445d1d73bb5d52133377b4248ec79db5c793ce7dbe59e074b4dd1ad", size = 12967, upload_time = "2024-07-29T01:09:23.417Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/35/7a/987e583882f985fe4d7323774889ec58049171828b58c2217e7f79cdf44e/sphinxcontrib_devhelp-2.0.0-py3-none-any.whl", hash = "sha256:aefb8b83854e4b0998877524d1029fd3e6879210422ee3780459e28a1f03a8a2", size = 82530, upload_time = "2024-07-29T01:09:21.945Z" }, +] + +[[package]] +name = "sphinxcontrib-htmlhelp" +version = "2.0.1" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.8.1' and python_full_version < '3.9'", + "python_full_version < '3.8.1'", +] +sdist = { url = "https://files.pythonhosted.org/packages/b3/47/64cff68ea3aa450c373301e5bebfbb9fce0a3e70aca245fcadd4af06cd75/sphinxcontrib-htmlhelp-2.0.1.tar.gz", hash = "sha256:0cbdd302815330058422b98a113195c9249825d681e18f11e8b1f78a2f11efff", size = 27967, upload_time = "2023-01-31T17:29:20.935Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/6e/ee/a1f5e39046cbb5f8bc8fba87d1ddf1c6643fbc9194e58d26e606de4b9074/sphinxcontrib_htmlhelp-2.0.1-py3-none-any.whl", hash = "sha256:c38cb46dccf316c79de6e5515e1770414b797162b23cd3d06e67020e1d2a6903", size = 99833, upload_time = "2023-01-31T17:29:18.489Z" }, +] + +[[package]] +name = "sphinxcontrib-htmlhelp" +version = "2.1.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.10'", + "python_full_version == '3.9.*'", +] +sdist = { url = "https://files.pythonhosted.org/packages/43/93/983afd9aa001e5201eab16b5a444ed5b9b0a7a010541e0ddfbbfd0b2470c/sphinxcontrib_htmlhelp-2.1.0.tar.gz", hash = "sha256:c9e2916ace8aad64cc13a0d233ee22317f2b9025b9cf3295249fa985cc7082e9", size = 22617, upload_time = "2024-07-29T01:09:37.889Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/0a/7b/18a8c0bcec9182c05a0b3ec2a776bba4ead82750a55ff798e8d406dae604/sphinxcontrib_htmlhelp-2.1.0-py3-none-any.whl", hash = "sha256:166759820b47002d22914d64a075ce08f4c46818e17cfc9470a9786b759b19f8", size = 98705, upload_time = "2024-07-29T01:09:36.407Z" }, +] + +[[package]] +name = "sphinxcontrib-jquery" +version = "4.1" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "sphinx" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/de/f3/aa67467e051df70a6330fe7770894b3e4f09436dea6881ae0b4f3d87cad8/sphinxcontrib-jquery-4.1.tar.gz", hash = "sha256:1620739f04e36a2c779f1a131a2dfd49b2fd07351bf1968ced074365933abc7a", size = 122331, upload_time = "2023-03-14T15:01:01.944Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/76/85/749bd22d1a68db7291c89e2ebca53f4306c3f205853cf31e9de279034c3c/sphinxcontrib_jquery-4.1-py2.py3-none-any.whl", hash = "sha256:f936030d7d0147dd026a4f2b5a57343d233f1fc7b363f68b3d4f1cb0993878ae", size = 121104, upload_time = "2023-03-14T15:01:00.356Z" }, +] + +[[package]] +name = "sphinxcontrib-jsmath" +version = "1.0.1" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/b2/e8/9ed3830aeed71f17c026a07a5097edcf44b692850ef215b161b8ad875729/sphinxcontrib-jsmath-1.0.1.tar.gz", hash = "sha256:a9925e4a4587247ed2191a22df5f6970656cb8ca2bd6284309578f2153e0c4b8", size = 5787, upload_time = "2019-01-21T16:10:16.347Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/c2/42/4c8646762ee83602e3fb3fbe774c2fac12f317deb0b5dbeeedd2d3ba4b77/sphinxcontrib_jsmath-1.0.1-py2.py3-none-any.whl", hash = "sha256:2ec2eaebfb78f3f2078e73666b1415417a116cc848b72e5172e596c871103178", size = 5071, upload_time = "2019-01-21T16:10:14.333Z" }, +] + +[[package]] +name = "sphinxcontrib-qthelp" +version = "1.0.3" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.8.1' and python_full_version < '3.9'", + "python_full_version < '3.8.1'", +] +sdist = { url = "https://files.pythonhosted.org/packages/b1/8e/c4846e59f38a5f2b4a0e3b27af38f2fcf904d4bfd82095bf92de0b114ebd/sphinxcontrib-qthelp-1.0.3.tar.gz", hash = "sha256:4c33767ee058b70dba89a6fc5c1892c0d57a54be67ddd3e7875a18d14cba5a72", size = 21658, upload_time = "2020-02-29T04:19:10.026Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/2b/14/05f9206cf4e9cfca1afb5fd224c7cd434dcc3a433d6d9e4e0264d29c6cdb/sphinxcontrib_qthelp-1.0.3-py2.py3-none-any.whl", hash = "sha256:bd9fc24bcb748a8d51fd4ecaade681350aa63009a347a8c14e637895444dfab6", size = 90609, upload_time = "2020-02-29T04:19:08.451Z" }, +] + +[[package]] +name = "sphinxcontrib-qthelp" +version = "2.0.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.10'", + "python_full_version == '3.9.*'", +] +sdist = { url = "https://files.pythonhosted.org/packages/68/bc/9104308fc285eb3e0b31b67688235db556cd5b0ef31d96f30e45f2e51cae/sphinxcontrib_qthelp-2.0.0.tar.gz", hash = "sha256:4fe7d0ac8fc171045be623aba3e2a8f613f8682731f9153bb2e40ece16b9bbab", size = 17165, upload_time = "2024-07-29T01:09:56.435Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/27/83/859ecdd180cacc13b1f7e857abf8582a64552ea7a061057a6c716e790fce/sphinxcontrib_qthelp-2.0.0-py3-none-any.whl", hash = "sha256:b18a828cdba941ccd6ee8445dbe72ffa3ef8cbe7505d8cd1fa0d42d3f2d5f3eb", size = 88743, upload_time = "2024-07-29T01:09:54.885Z" }, +] + +[[package]] +name = "sphinxcontrib-serializinghtml" +version = "1.1.5" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.8.1' and python_full_version < '3.9'", + "python_full_version < '3.8.1'", +] +sdist = { url = "https://files.pythonhosted.org/packages/b5/72/835d6fadb9e5d02304cf39b18f93d227cd93abd3c41ebf58e6853eeb1455/sphinxcontrib-serializinghtml-1.1.5.tar.gz", hash = "sha256:aa5f6de5dfdf809ef505c4895e51ef5c9eac17d0f287933eb49ec495280b6952", size = 21019, upload_time = "2021-05-22T16:07:43.043Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/c6/77/5464ec50dd0f1c1037e3c93249b040c8fc8078fdda97530eeb02424b6eea/sphinxcontrib_serializinghtml-1.1.5-py2.py3-none-any.whl", hash = "sha256:352a9a00ae864471d3a7ead8d7d79f5fc0b57e8b3f95e9867eb9eb28999b92fd", size = 94021, upload_time = "2021-05-22T16:07:41.627Z" }, +] + +[[package]] +name = "sphinxcontrib-serializinghtml" +version = "2.0.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.10'", + "python_full_version == '3.9.*'", +] +sdist = { url = "https://files.pythonhosted.org/packages/3b/44/6716b257b0aa6bfd51a1b31665d1c205fb12cb5ad56de752dfa15657de2f/sphinxcontrib_serializinghtml-2.0.0.tar.gz", hash = "sha256:e9d912827f872c029017a53f0ef2180b327c3f7fd23c87229f7a8e8b70031d4d", size = 16080, upload_time = "2024-07-29T01:10:09.332Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/52/a7/d2782e4e3f77c8450f727ba74a8f12756d5ba823d81b941f1b04da9d033a/sphinxcontrib_serializinghtml-2.0.0-py3-none-any.whl", hash = "sha256:6e2cb0eef194e10c27ec0023bfeb25badbbb5868244cf5bc5bdc04e4464bf331", size = 92072, upload_time = "2024-07-29T01:10:08.203Z" }, +] + +[[package]] +name = "tomli" +version = "2.3.0" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/52/ed/3f73f72945444548f33eba9a87fc7a6e969915e7b1acc8260b30e1f76a2f/tomli-2.3.0.tar.gz", hash = "sha256:64be704a875d2a59753d80ee8a533c3fe183e3f06807ff7dc2232938ccb01549", size = 17392, upload_time = "2025-10-08T22:01:47.119Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/b3/2e/299f62b401438d5fe1624119c723f5d877acc86a4c2492da405626665f12/tomli-2.3.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:88bd15eb972f3664f5ed4b57c1634a97153b4bac4479dcb6a495f41921eb7f45", size = 153236, upload_time = "2025-10-08T22:01:00.137Z" }, + { url = "https://files.pythonhosted.org/packages/86/7f/d8fffe6a7aefdb61bced88fcb5e280cfd71e08939da5894161bd71bea022/tomli-2.3.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:883b1c0d6398a6a9d29b508c331fa56adbcdff647f6ace4dfca0f50e90dfd0ba", size = 148084, upload_time = "2025-10-08T22:01:01.63Z" }, + { url = "https://files.pythonhosted.org/packages/47/5c/24935fb6a2ee63e86d80e4d3b58b222dafaf438c416752c8b58537c8b89a/tomli-2.3.0-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:d1381caf13ab9f300e30dd8feadb3de072aeb86f1d34a8569453ff32a7dea4bf", size = 234832, upload_time = "2025-10-08T22:01:02.543Z" }, + { url = "https://files.pythonhosted.org/packages/89/da/75dfd804fc11e6612846758a23f13271b76d577e299592b4371a4ca4cd09/tomli-2.3.0-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:a0e285d2649b78c0d9027570d4da3425bdb49830a6156121360b3f8511ea3441", size = 242052, upload_time = "2025-10-08T22:01:03.836Z" }, + { url = "https://files.pythonhosted.org/packages/70/8c/f48ac899f7b3ca7eb13af73bacbc93aec37f9c954df3c08ad96991c8c373/tomli-2.3.0-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:0a154a9ae14bfcf5d8917a59b51ffd5a3ac1fd149b71b47a3a104ca4edcfa845", size = 239555, upload_time = "2025-10-08T22:01:04.834Z" }, + { url = "https://files.pythonhosted.org/packages/ba/28/72f8afd73f1d0e7829bfc093f4cb98ce0a40ffc0cc997009ee1ed94ba705/tomli-2.3.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:74bf8464ff93e413514fefd2be591c3b0b23231a77f901db1eb30d6f712fc42c", size = 245128, upload_time = "2025-10-08T22:01:05.84Z" }, + { url = "https://files.pythonhosted.org/packages/b6/eb/a7679c8ac85208706d27436e8d421dfa39d4c914dcf5fa8083a9305f58d9/tomli-2.3.0-cp311-cp311-win32.whl", hash = "sha256:00b5f5d95bbfc7d12f91ad8c593a1659b6387b43f054104cda404be6bda62456", size = 96445, upload_time = "2025-10-08T22:01:06.896Z" }, + { url = "https://files.pythonhosted.org/packages/0a/fe/3d3420c4cb1ad9cb462fb52967080575f15898da97e21cb6f1361d505383/tomli-2.3.0-cp311-cp311-win_amd64.whl", hash = "sha256:4dc4ce8483a5d429ab602f111a93a6ab1ed425eae3122032db7e9acf449451be", size = 107165, upload_time = "2025-10-08T22:01:08.107Z" }, + { url = "https://files.pythonhosted.org/packages/ff/b7/40f36368fcabc518bb11c8f06379a0fd631985046c038aca08c6d6a43c6e/tomli-2.3.0-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:d7d86942e56ded512a594786a5ba0a5e521d02529b3826e7761a05138341a2ac", size = 154891, upload_time = "2025-10-08T22:01:09.082Z" }, + { url = "https://files.pythonhosted.org/packages/f9/3f/d9dd692199e3b3aab2e4e4dd948abd0f790d9ded8cd10cbaae276a898434/tomli-2.3.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:73ee0b47d4dad1c5e996e3cd33b8a76a50167ae5f96a2607cbe8cc773506ab22", size = 148796, upload_time = "2025-10-08T22:01:10.266Z" }, + { url = "https://files.pythonhosted.org/packages/60/83/59bff4996c2cf9f9387a0f5a3394629c7efa5ef16142076a23a90f1955fa/tomli-2.3.0-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:792262b94d5d0a466afb5bc63c7daa9d75520110971ee269152083270998316f", size = 242121, upload_time = "2025-10-08T22:01:11.332Z" }, + { url = "https://files.pythonhosted.org/packages/45/e5/7c5119ff39de8693d6baab6c0b6dcb556d192c165596e9fc231ea1052041/tomli-2.3.0-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:4f195fe57ecceac95a66a75ac24d9d5fbc98ef0962e09b2eddec5d39375aae52", size = 250070, upload_time = "2025-10-08T22:01:12.498Z" }, + { url = "https://files.pythonhosted.org/packages/45/12/ad5126d3a278f27e6701abde51d342aa78d06e27ce2bb596a01f7709a5a2/tomli-2.3.0-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:e31d432427dcbf4d86958c184b9bfd1e96b5b71f8eb17e6d02531f434fd335b8", size = 245859, upload_time = "2025-10-08T22:01:13.551Z" }, + { url = "https://files.pythonhosted.org/packages/fb/a1/4d6865da6a71c603cfe6ad0e6556c73c76548557a8d658f9e3b142df245f/tomli-2.3.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:7b0882799624980785240ab732537fcfc372601015c00f7fc367c55308c186f6", size = 250296, upload_time = "2025-10-08T22:01:14.614Z" }, + { url = "https://files.pythonhosted.org/packages/a0/b7/a7a7042715d55c9ba6e8b196d65d2cb662578b4d8cd17d882d45322b0d78/tomli-2.3.0-cp312-cp312-win32.whl", hash = "sha256:ff72b71b5d10d22ecb084d345fc26f42b5143c5533db5e2eaba7d2d335358876", size = 97124, upload_time = "2025-10-08T22:01:15.629Z" }, + { url = "https://files.pythonhosted.org/packages/06/1e/f22f100db15a68b520664eb3328fb0ae4e90530887928558112c8d1f4515/tomli-2.3.0-cp312-cp312-win_amd64.whl", hash = "sha256:1cb4ed918939151a03f33d4242ccd0aa5f11b3547d0cf30f7c74a408a5b99878", size = 107698, upload_time = "2025-10-08T22:01:16.51Z" }, + { url = "https://files.pythonhosted.org/packages/89/48/06ee6eabe4fdd9ecd48bf488f4ac783844fd777f547b8d1b61c11939974e/tomli-2.3.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:5192f562738228945d7b13d4930baffda67b69425a7f0da96d360b0a3888136b", size = 154819, upload_time = "2025-10-08T22:01:17.964Z" }, + { url = "https://files.pythonhosted.org/packages/f1/01/88793757d54d8937015c75dcdfb673c65471945f6be98e6a0410fba167ed/tomli-2.3.0-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:be71c93a63d738597996be9528f4abe628d1adf5e6eb11607bc8fe1a510b5dae", size = 148766, upload_time = "2025-10-08T22:01:18.959Z" }, + { url = "https://files.pythonhosted.org/packages/42/17/5e2c956f0144b812e7e107f94f1cc54af734eb17b5191c0bbfb72de5e93e/tomli-2.3.0-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:c4665508bcbac83a31ff8ab08f424b665200c0e1e645d2bd9ab3d3e557b6185b", size = 240771, upload_time = "2025-10-08T22:01:20.106Z" }, + { url = "https://files.pythonhosted.org/packages/d5/f4/0fbd014909748706c01d16824eadb0307115f9562a15cbb012cd9b3512c5/tomli-2.3.0-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:4021923f97266babc6ccab9f5068642a0095faa0a51a246a6a02fccbb3514eaf", size = 248586, upload_time = "2025-10-08T22:01:21.164Z" }, + { url = "https://files.pythonhosted.org/packages/30/77/fed85e114bde5e81ecf9bc5da0cc69f2914b38f4708c80ae67d0c10180c5/tomli-2.3.0-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:a4ea38c40145a357d513bffad0ed869f13c1773716cf71ccaa83b0fa0cc4e42f", size = 244792, upload_time = "2025-10-08T22:01:22.417Z" }, + { url = "https://files.pythonhosted.org/packages/55/92/afed3d497f7c186dc71e6ee6d4fcb0acfa5f7d0a1a2878f8beae379ae0cc/tomli-2.3.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:ad805ea85eda330dbad64c7ea7a4556259665bdf9d2672f5dccc740eb9d3ca05", size = 248909, upload_time = "2025-10-08T22:01:23.859Z" }, + { url = "https://files.pythonhosted.org/packages/f8/84/ef50c51b5a9472e7265ce1ffc7f24cd4023d289e109f669bdb1553f6a7c2/tomli-2.3.0-cp313-cp313-win32.whl", hash = "sha256:97d5eec30149fd3294270e889b4234023f2c69747e555a27bd708828353ab606", size = 96946, upload_time = "2025-10-08T22:01:24.893Z" }, + { url = "https://files.pythonhosted.org/packages/b2/b7/718cd1da0884f281f95ccfa3a6cc572d30053cba64603f79d431d3c9b61b/tomli-2.3.0-cp313-cp313-win_amd64.whl", hash = "sha256:0c95ca56fbe89e065c6ead5b593ee64b84a26fca063b5d71a1122bf26e533999", size = 107705, upload_time = "2025-10-08T22:01:26.153Z" }, + { url = "https://files.pythonhosted.org/packages/19/94/aeafa14a52e16163008060506fcb6aa1949d13548d13752171a755c65611/tomli-2.3.0-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:cebc6fe843e0733ee827a282aca4999b596241195f43b4cc371d64fc6639da9e", size = 154244, upload_time = "2025-10-08T22:01:27.06Z" }, + { url = "https://files.pythonhosted.org/packages/db/e4/1e58409aa78eefa47ccd19779fc6f36787edbe7d4cd330eeeedb33a4515b/tomli-2.3.0-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:4c2ef0244c75aba9355561272009d934953817c49f47d768070c3c94355c2aa3", size = 148637, upload_time = "2025-10-08T22:01:28.059Z" }, + { url = "https://files.pythonhosted.org/packages/26/b6/d1eccb62f665e44359226811064596dd6a366ea1f985839c566cd61525ae/tomli-2.3.0-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:c22a8bf253bacc0cf11f35ad9808b6cb75ada2631c2d97c971122583b129afbc", size = 241925, upload_time = "2025-10-08T22:01:29.066Z" }, + { url = "https://files.pythonhosted.org/packages/70/91/7cdab9a03e6d3d2bb11beae108da5bdc1c34bdeb06e21163482544ddcc90/tomli-2.3.0-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:0eea8cc5c5e9f89c9b90c4896a8deefc74f518db5927d0e0e8d4a80953d774d0", size = 249045, upload_time = "2025-10-08T22:01:31.98Z" }, + { url = "https://files.pythonhosted.org/packages/15/1b/8c26874ed1f6e4f1fcfeb868db8a794cbe9f227299402db58cfcc858766c/tomli-2.3.0-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:b74a0e59ec5d15127acdabd75ea17726ac4c5178ae51b85bfe39c4f8a278e879", size = 245835, upload_time = "2025-10-08T22:01:32.989Z" }, + { url = "https://files.pythonhosted.org/packages/fd/42/8e3c6a9a4b1a1360c1a2a39f0b972cef2cc9ebd56025168c4137192a9321/tomli-2.3.0-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:b5870b50c9db823c595983571d1296a6ff3e1b88f734a4c8f6fc6188397de005", size = 253109, upload_time = "2025-10-08T22:01:34.052Z" }, + { url = "https://files.pythonhosted.org/packages/22/0c/b4da635000a71b5f80130937eeac12e686eefb376b8dee113b4a582bba42/tomli-2.3.0-cp314-cp314-win32.whl", hash = "sha256:feb0dacc61170ed7ab602d3d972a58f14ee3ee60494292d384649a3dc38ef463", size = 97930, upload_time = "2025-10-08T22:01:35.082Z" }, + { url = "https://files.pythonhosted.org/packages/b9/74/cb1abc870a418ae99cd5c9547d6bce30701a954e0e721821df483ef7223c/tomli-2.3.0-cp314-cp314-win_amd64.whl", hash = "sha256:b273fcbd7fc64dc3600c098e39136522650c49bca95df2d11cf3b626422392c8", size = 107964, upload_time = "2025-10-08T22:01:36.057Z" }, + { url = "https://files.pythonhosted.org/packages/54/78/5c46fff6432a712af9f792944f4fcd7067d8823157949f4e40c56b8b3c83/tomli-2.3.0-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:940d56ee0410fa17ee1f12b817b37a4d4e4dc4d27340863cc67236c74f582e77", size = 163065, upload_time = "2025-10-08T22:01:37.27Z" }, + { url = "https://files.pythonhosted.org/packages/39/67/f85d9bd23182f45eca8939cd2bc7050e1f90c41f4a2ecbbd5963a1d1c486/tomli-2.3.0-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:f85209946d1fe94416debbb88d00eb92ce9cd5266775424ff81bc959e001acaf", size = 159088, upload_time = "2025-10-08T22:01:38.235Z" }, + { url = "https://files.pythonhosted.org/packages/26/5a/4b546a0405b9cc0659b399f12b6adb750757baf04250b148d3c5059fc4eb/tomli-2.3.0-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:a56212bdcce682e56b0aaf79e869ba5d15a6163f88d5451cbde388d48b13f530", size = 268193, upload_time = "2025-10-08T22:01:39.712Z" }, + { url = "https://files.pythonhosted.org/packages/42/4f/2c12a72ae22cf7b59a7fe75b3465b7aba40ea9145d026ba41cb382075b0e/tomli-2.3.0-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:c5f3ffd1e098dfc032d4d3af5c0ac64f6d286d98bc148698356847b80fa4de1b", size = 275488, upload_time = "2025-10-08T22:01:40.773Z" }, + { url = "https://files.pythonhosted.org/packages/92/04/a038d65dbe160c3aa5a624e93ad98111090f6804027d474ba9c37c8ae186/tomli-2.3.0-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:5e01decd096b1530d97d5d85cb4dff4af2d8347bd35686654a004f8dea20fc67", size = 272669, upload_time = "2025-10-08T22:01:41.824Z" }, + { url = "https://files.pythonhosted.org/packages/be/2f/8b7c60a9d1612a7cbc39ffcca4f21a73bf368a80fc25bccf8253e2563267/tomli-2.3.0-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:8a35dd0e643bb2610f156cca8db95d213a90015c11fee76c946aa62b7ae7e02f", size = 279709, upload_time = "2025-10-08T22:01:43.177Z" }, + { url = "https://files.pythonhosted.org/packages/7e/46/cc36c679f09f27ded940281c38607716c86cf8ba4a518d524e349c8b4874/tomli-2.3.0-cp314-cp314t-win32.whl", hash = "sha256:a1f7f282fe248311650081faafa5f4732bdbfef5d45fe3f2e702fbc6f2d496e0", size = 107563, upload_time = "2025-10-08T22:01:44.233Z" }, + { url = "https://files.pythonhosted.org/packages/84/ff/426ca8683cf7b753614480484f6437f568fd2fda2edbdf57a2d3d8b27a0b/tomli-2.3.0-cp314-cp314t-win_amd64.whl", hash = "sha256:70a251f8d4ba2d9ac2542eecf008b3c8a9fc5c3f9f02c56a9d7952612be2fdba", size = 119756, upload_time = "2025-10-08T22:01:45.234Z" }, + { url = "https://files.pythonhosted.org/packages/77/b8/0135fadc89e73be292b473cb820b4f5a08197779206b33191e801feeae40/tomli-2.3.0-py3-none-any.whl", hash = "sha256:e95b1af3c5b07d9e643909b5abbec77cd9f1217e6d0bca72b0234736b9fb1f1b", size = 14408, upload_time = "2025-10-08T22:01:46.04Z" }, +] + +[[package]] +name = "typing-extensions" +version = "4.13.2" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.8.1' and python_full_version < '3.9'", + "python_full_version < '3.8.1'", +] +sdist = { url = "https://files.pythonhosted.org/packages/f6/37/23083fcd6e35492953e8d2aaaa68b860eb422b34627b13f2ce3eb6106061/typing_extensions-4.13.2.tar.gz", hash = "sha256:e6c81219bd689f51865d9e372991c540bda33a0379d5573cddb9a3a23f7caaef", size = 106967, upload_time = "2025-04-10T14:19:05.416Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/8b/54/b1ae86c0973cc6f0210b53d508ca3641fb6d0c56823f288d108bc7ab3cc8/typing_extensions-4.13.2-py3-none-any.whl", hash = "sha256:a439e7c04b49fec3e5d3e2beaa21755cadbbdc391694e28ccdd36ca4a1408f8c", size = 45806, upload_time = "2025-04-10T14:19:03.967Z" }, +] + +[[package]] +name = "typing-extensions" +version = "4.15.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.10'", + "python_full_version == '3.9.*'", +] +sdist = { url = "https://files.pythonhosted.org/packages/72/94/1a15dd82efb362ac84269196e94cf00f187f7ed21c242792a923cdb1c61f/typing_extensions-4.15.0.tar.gz", hash = "sha256:0cea48d173cc12fa28ecabc3b837ea3cf6f38c6d1136f85cbaaf598984861466", size = 109391, upload_time = "2025-08-25T13:49:26.313Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/18/67/36e9267722cc04a6b9f15c7f3441c2363321a3ea07da7ae0c0707beb2a9c/typing_extensions-4.15.0-py3-none-any.whl", hash = "sha256:f0fa19c6845758ab08074a0cfa8b7aecb71c999ca73d62883bc25cc018c4e548", size = 44614, upload_time = "2025-08-25T13:49:24.86Z" }, +] + +[[package]] +name = "urllib3" +version = "1.26.20" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version == '3.9.*'", + "python_full_version >= '3.8.1' and python_full_version < '3.9'", + "python_full_version < '3.8.1'", +] +sdist = { url = "https://files.pythonhosted.org/packages/e4/e8/6ff5e6bc22095cfc59b6ea711b687e2b7ed4bdb373f7eeec370a97d7392f/urllib3-1.26.20.tar.gz", hash = "sha256:40c2dc0c681e47eb8f90e7e27bf6ff7df2e677421fd46756da1161c39ca70d32", size = 307380, upload_time = "2024-08-29T15:43:11.37Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/33/cf/8435d5a7159e2a9c83a95896ed596f68cf798005fe107cc655b5c5c14704/urllib3-1.26.20-py2.py3-none-any.whl", hash = "sha256:0ed14ccfbf1c30a9072c7ca157e4319b70d65f623e91e7b32fadb2853431016e", size = 144225, upload_time = "2024-08-29T15:43:08.921Z" }, +] + +[[package]] +name = "urllib3" +version = "2.5.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.10'", +] +sdist = { url = "https://files.pythonhosted.org/packages/15/22/9ee70a2574a4f4599c47dd506532914ce044817c7752a79b6a51286319bc/urllib3-2.5.0.tar.gz", hash = "sha256:3fc47733c7e419d4bc3f6b3dc2b4f890bb743906a30d56ba4a5bfa4bbff92760", size = 393185, upload_time = "2025-06-18T14:07:41.644Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/a7/c2/fe1e52489ae3122415c51f387e221dd0773709bad6c6cdaa599e8a2c5185/urllib3-2.5.0-py3-none-any.whl", hash = "sha256:e6b01673c0fa6a13e374b50871808eb3bf7046c4b125b216f6bf1cc604cff0dc", size = 129795, upload_time = "2025-06-18T14:07:40.39Z" }, +] + +[[package]] +name = "zipp" +version = "3.20.2" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.8.1' and python_full_version < '3.9'", + "python_full_version < '3.8.1'", +] +sdist = { url = "https://files.pythonhosted.org/packages/54/bf/5c0000c44ebc80123ecbdddba1f5dcd94a5ada602a9c225d84b5aaa55e86/zipp-3.20.2.tar.gz", hash = "sha256:bc9eb26f4506fda01b81bcde0ca78103b6e62f991b381fec825435c836edbc29", size = 24199, upload_time = "2024-09-13T13:44:16.101Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/62/8b/5ba542fa83c90e09eac972fc9baca7a88e7e7ca4b221a89251954019308b/zipp-3.20.2-py3-none-any.whl", hash = "sha256:a817ac80d6cf4b23bf7f2828b7cabf326f15a001bea8b1f9b49631780ba28350", size = 9200, upload_time = "2024-09-13T13:44:14.38Z" }, +] + +[[package]] +name = "zipp" +version = "3.23.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version == '3.9.*'", +] +sdist = { url = "https://files.pythonhosted.org/packages/e3/02/0f2892c661036d50ede074e376733dca2ae7c6eb617489437771209d4180/zipp-3.23.0.tar.gz", hash = "sha256:a07157588a12518c9d4034df3fbbee09c814741a33ff63c05fa29d26a2404166", size = 25547, upload_time = "2025-06-08T17:06:39.4Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/2e/54/647ade08bf0db230bfea292f893923872fd20be6ac6f53b2b936ba839d75/zipp-3.23.0-py3-none-any.whl", hash = "sha256:071652d6115ed432f5ce1d34c336c0adfd6a884660d1e9712a256d3d3bd4b14e", size = 10276, upload_time = "2025-06-08T17:06:38.034Z" }, +] From 3c42aaa8f3cca1b9660b0c37c264b6a622cc7ba2 Mon Sep 17 00:00:00 2001 From: nori3636 Date: Sun, 23 Nov 2025 14:50:13 +0900 Subject: [PATCH 2/4] feat: modernizing package management --- .github/workflows/acceptance-tests.yml | 17 +- .github/workflows/publish-to-pypi.yml | 45 +- .github/workflows/unit-tests.yml | 32 +- .pre-commit-config.yaml | 43 ++ Dockerfile | 10 +- docker-compose.yml => compose.yaml | 1 - pyproject.toml | 34 +- uv.lock | 885 +++++++++++++++++++++---- 8 files changed, 880 insertions(+), 187 deletions(-) create mode 100644 .pre-commit-config.yaml rename docker-compose.yml => compose.yaml (91%) diff --git a/.github/workflows/acceptance-tests.yml b/.github/workflows/acceptance-tests.yml index 24eb034..dd75b7a 100644 --- a/.github/workflows/acceptance-tests.yml +++ b/.github/workflows/acceptance-tests.yml @@ -20,18 +20,17 @@ jobs: python-version: ["3.8", "3.9", "3.10", "3.11", "3.12", "3.13"] steps: - name: Checkout - uses: actions/checkout@v2 + uses: actions/checkout@v4 - name: Setup Python ${{ matrix.python-version }} - uses: actions/setup-python@v2 + uses: actions/setup-python@v5 with: python-version: ${{ matrix.python-version }} - - name: Install pipenv - run: pip install pipenv==2024.4.1 - - - name: Install dependencies - run: pipenv install --skip-lock -d + - name: Install uv + uses: astral-sh/setup-uv@v3 + with: + enable-cache: true - - name: Run acceptance minimal - run: pipenv run test + - name: Run acceptance minimal + run: uv run pytest tests/acceptance/minimal --capture=sys diff --git a/.github/workflows/publish-to-pypi.yml b/.github/workflows/publish-to-pypi.yml index bf869b3..a2ceea9 100644 --- a/.github/workflows/publish-to-pypi.yml +++ b/.github/workflows/publish-to-pypi.yml @@ -9,35 +9,26 @@ jobs: name: Build and publish Python 🐍 distributions 📦 to PyPI and TestPyPI runs-on: ubuntu-latest steps: - - uses: actions/checkout@v2 + - uses: actions/checkout@v4 - - name: Set up Python - uses: actions/setup-python@v2 - with: - python-version: 3.x + - name: Set up Python + uses: actions/setup-python@v5 + with: + python-version: "3.x" - - name: Install pypa/build - run: >- - python -m - pip install - build - --user + - name: Install uv + uses: astral-sh/setup-uv@v3 - - name: Build a binary wheel and a source tarball - run: >- - python -m - build - --sdist - --wheel - --outdir dist/ + - name: Build a binary wheel and a source tarball + run: uv build --sdist --wheel --outdir dist/ - - name: Publish distribution 📦 to Test PyPI - uses: pypa/gh-action-pypi-publish@release/v1 - with: - password: ${{ secrets.TEST_PYPI_API_TOKEN }} - repository_url: https://test.pypi.org/legacy/ + - name: Publish distribution 📦 to Test PyPI + uses: pypa/gh-action-pypi-publish@release/v1 + with: + password: ${{ secrets.TEST_PYPI_API_TOKEN }} + repository_url: https://test.pypi.org/legacy/ - - name: Publish distribution 📦 to PyPI - uses: pypa/gh-action-pypi-publish@release/v1 - with: - password: ${{ secrets.PYPI_API_TOKEN }} + - name: Publish distribution 📦 to PyPI + uses: pypa/gh-action-pypi-publish@release/v1 + with: + password: ${{ secrets.PYPI_API_TOKEN }} diff --git a/.github/workflows/unit-tests.yml b/.github/workflows/unit-tests.yml index 5d46267..b0e4e7f 100644 --- a/.github/workflows/unit-tests.yml +++ b/.github/workflows/unit-tests.yml @@ -8,24 +8,23 @@ jobs: python-version: ["3.13"] steps: - name: Checkout - uses: actions/checkout@v2 + uses: actions/checkout@v4 - name: Setup Python ${{ matrix.python-version }} - uses: actions/setup-python@v2 + uses: actions/setup-python@v5 with: python-version: ${{ matrix.python-version }} - - name: Install pipenv - run: pip install pipenv==2024.4.1 - - - name: Install dependencies - run: pipenv install --skip-lock -d + - name: Install uv + uses: astral-sh/setup-uv@v3 + with: + enable-cache: true - name: Check isort - run: pipenv run isort . --check-only --diff --quiet + run: uv run isort . --check-only --diff --quiet - name: Check flake8 - run: pipenv run lint + run: uv run flake8 . unittest: # ubuntu-24.04 later does not support Python 3.7 runs-on: ubuntu-22.04 @@ -34,18 +33,17 @@ jobs: python-version: ["3.8", "3.9", "3.10", "3.11", "3.12", "3.13"] steps: - name: Checkout - uses: actions/checkout@v2 + uses: actions/checkout@v4 - name: Setup Python ${{ matrix.python-version }} - uses: actions/setup-python@v2 + uses: actions/setup-python@v5 with: python-version: ${{ matrix.python-version }} - - name: Install pipenv - run: pip install pipenv==2024.4.1 - - - name: Install dependencies - run: pipenv install --skip-lock -d + - name: Install uv + uses: astral-sh/setup-uv@v3 + with: + enable-cache: true - name: Run UnitTest - run: pipenv run unittest + run: uv run pytest tests/unit --capture=sys diff --git a/.pre-commit-config.yaml b/.pre-commit-config.yaml new file mode 100644 index 0000000..001f552 --- /dev/null +++ b/.pre-commit-config.yaml @@ -0,0 +1,43 @@ +# Pre-commit hooks configuration +# Install with: pre-commit install +# Run manually with: pre-commit run --all-files + +repos: + # Code formatting with ruff (combines flake8, isort, black) + - repo: https://github.com/astral-sh/ruff-pre-commit + rev: v0.7.4 + hooks: + - id: ruff + name: Ruff linter + args: ["--fix"] + - id: ruff-format + name: Ruff formatter + + # Trailing whitespace and line ending fixes + - repo: https://github.com/pre-commit/pre-commit-hooks + rev: v4.5.0 + hooks: + - id: trailing-whitespace + - id: end-of-file-fixer + - id: check-yaml + - id: check-added-large-files + args: ["--maxkb=1000"] + - id: detect-private-key + + # Type checking with mypy + - repo: https://github.com/pre-commit/mirrors-mypy + rev: v1.14.0 + hooks: + - id: mypy + additional_dependencies: ["types-all"] + args: ["--ignore-missing-imports"] + exclude: ^tests/ + +ci: + autofix_commit_msg: "chore: auto fixes from pre-commit hooks" + autofix_prs: true + autoupdate_branch: "" + autoupdate_commit_msg: "chore: pre-commit autoupdate" + autoupdate_schedule: weekly + skip: [] + submodules: false diff --git a/Dockerfile b/Dockerfile index 5f7d38e..89f88b4 100644 --- a/Dockerfile +++ b/Dockerfile @@ -1,6 +1,6 @@ -FROM python:3.13.2 +FROM python:3.13-slim WORKDIR /usr/local/app -RUN apt-get update && apt-get install -y groff-base -ADD Pipfile /usr/local/app -RUN pip install pipenv==2024.4.1 && pipenv install --skip-lock -d -ENTRYPOINT ["pipenv", "run"] +RUN pip install uv +COPY pyproject.toml uv.lock ./ +RUN uv sync --frozen +ENTRYPOINT ["uv", "run"] diff --git a/docker-compose.yml b/compose.yaml similarity index 91% rename from docker-compose.yml rename to compose.yaml index e2e1f62..24bd029 100644 --- a/docker-compose.yml +++ b/compose.yaml @@ -1,4 +1,3 @@ -version: "3" services: app: build: . diff --git a/pyproject.toml b/pyproject.toml index fabccfd..0fd5661 100644 --- a/pyproject.toml +++ b/pyproject.toml @@ -36,23 +36,27 @@ Repository = "https://github.com/nifcloud/nifcloud-sdk-python" [project.optional-dependencies] dev = [ - "isort", - "flake8", + "ruff", "pytest", + "pytest-cov", + "mypy", "requests", "sphinx==5.3.0", "sphinx-rtd-theme", + "pre-commit", ] [tool.uv] # UV configuration dev-dependencies = [ - "isort", - "flake8", + "ruff", "pytest", + "pytest-cov", + "mypy", "requests", "sphinx==5.3.0", "sphinx-rtd-theme", + "pre-commit", ] [tool.setuptools] @@ -74,5 +78,25 @@ profile = "black" testpaths = ["tests"] addopts = "--capture=sys" +[tool.ruff] +line-length = 120 +target-version = "py38" + +[tool.ruff.lint] +select = [ + "E", + "W", + "F", + "I", + "N", + "D", + "UP", +] +ignore = [ + "E501", # Line too long (handled by formatter) + "D100", # Missing module docstring + "D104", # Missing package docstring +] + [tool.flake8] -max-line-length = 88 +max-line-length = 120 diff --git a/uv.lock b/uv.lock index 862e48b..1eb0664 100644 --- a/uv.lock +++ b/uv.lock @@ -70,6 +70,32 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/70/7d/9bc192684cea499815ff478dfcdc13835ddf401365057044fb721ec6bddb/certifi-2025.11.12-py3-none-any.whl", hash = "sha256:97de8790030bbd5c2d96b7ec782fc2f7820ef8dba6db909ccf95449f2d062d4b", size = 159438, upload_time = "2025-11-12T02:54:49.735Z" }, ] +[[package]] +name = "cfgv" +version = "3.4.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version == '3.9.*'", + "python_full_version >= '3.8.1' and python_full_version < '3.9'", + "python_full_version < '3.8.1'", +] +sdist = { url = "https://files.pythonhosted.org/packages/11/74/539e56497d9bd1d484fd863dd69cbbfa653cd2aa27abfe35653494d85e94/cfgv-3.4.0.tar.gz", hash = "sha256:e52591d4c5f5dead8e0f673fb16db7949d2cfb3f7da4582893288f0ded8fe560", size = 7114, upload_time = "2023-08-12T20:38:17.776Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/c5/55/51844dd50c4fc7a33b653bfaba4c2456f06955289ca770a5dbd5fd267374/cfgv-3.4.0-py2.py3-none-any.whl", hash = "sha256:b7265b1f29fd3316bfcd2b330d63d024f2bfd8bcb8b0272f8e19a504856c48f9", size = 7249, upload_time = "2023-08-12T20:38:16.269Z" }, +] + +[[package]] +name = "cfgv" +version = "3.5.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.10'", +] +sdist = { url = "https://files.pythonhosted.org/packages/4e/b5/721b8799b04bf9afe054a3899c6cf4e880fcf8563cc71c15610242490a0c/cfgv-3.5.0.tar.gz", hash = "sha256:d5b1034354820651caa73ede66a6294d6e95c1b00acc5e9b098e917404669132", size = 7334, upload_time = "2025-11-19T20:55:51.612Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/db/3c/33bac158f8ab7f89b2e59426d5fe2e4f63f7ed25df84c036890172b412b5/cfgv-3.5.0-py2.py3-none-any.whl", hash = "sha256:a8dc6b26ad22ff227d2634a65cb388215ce6cc96bbcc5cfde7641ae87e8dacc0", size = 7445, upload_time = "2025-11-19T20:55:50.744Z" }, +] + [[package]] name = "charset-normalizer" version = "3.4.4" @@ -199,6 +225,329 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/d1/d6/3965ed04c63042e047cb6a3e6ed1a63a35087b6a609aa3a15ed8ac56c221/colorama-0.4.6-py2.py3-none-any.whl", hash = "sha256:4f1d9991f5acc0ca119f9d443620b77f9d6b33703e51011c16baf57afb285fc6", size = 25335, upload_time = "2022-10-25T02:36:20.889Z" }, ] +[[package]] +name = "coverage" +version = "7.6.1" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.8.1' and python_full_version < '3.9'", + "python_full_version < '3.8.1'", +] +sdist = { url = "https://files.pythonhosted.org/packages/f7/08/7e37f82e4d1aead42a7443ff06a1e406aabf7302c4f00a546e4b320b994c/coverage-7.6.1.tar.gz", hash = "sha256:953510dfb7b12ab69d20135a0662397f077c59b1e6379a768e97c59d852ee51d", size = 798791, upload_time = "2024-08-04T19:45:30.9Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/7e/61/eb7ce5ed62bacf21beca4937a90fe32545c91a3c8a42a30c6616d48fc70d/coverage-7.6.1-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:b06079abebbc0e89e6163b8e8f0e16270124c154dc6e4a47b413dd538859af16", size = 206690, upload_time = "2024-08-04T19:43:07.695Z" }, + { url = "https://files.pythonhosted.org/packages/7d/73/041928e434442bd3afde5584bdc3f932fb4562b1597629f537387cec6f3d/coverage-7.6.1-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:cf4b19715bccd7ee27b6b120e7e9dd56037b9c0681dcc1adc9ba9db3d417fa36", size = 207127, upload_time = "2024-08-04T19:43:10.15Z" }, + { url = "https://files.pythonhosted.org/packages/c7/c8/6ca52b5147828e45ad0242388477fdb90df2c6cbb9a441701a12b3c71bc8/coverage-7.6.1-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:e61c0abb4c85b095a784ef23fdd4aede7a2628478e7baba7c5e3deba61070a02", size = 235654, upload_time = "2024-08-04T19:43:12.405Z" }, + { url = "https://files.pythonhosted.org/packages/d5/da/9ac2b62557f4340270942011d6efeab9833648380109e897d48ab7c1035d/coverage-7.6.1-cp310-cp310-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:fd21f6ae3f08b41004dfb433fa895d858f3f5979e7762d052b12aef444e29afc", size = 233598, upload_time = "2024-08-04T19:43:14.078Z" }, + { url = "https://files.pythonhosted.org/packages/53/23/9e2c114d0178abc42b6d8d5281f651a8e6519abfa0ef460a00a91f80879d/coverage-7.6.1-cp310-cp310-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:8f59d57baca39b32db42b83b2a7ba6f47ad9c394ec2076b084c3f029b7afca23", size = 234732, upload_time = "2024-08-04T19:43:16.632Z" }, + { url = "https://files.pythonhosted.org/packages/0f/7e/a0230756fb133343a52716e8b855045f13342b70e48e8ad41d8a0d60ab98/coverage-7.6.1-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:a1ac0ae2b8bd743b88ed0502544847c3053d7171a3cff9228af618a068ed9c34", size = 233816, upload_time = "2024-08-04T19:43:19.049Z" }, + { url = "https://files.pythonhosted.org/packages/28/7c/3753c8b40d232b1e5eeaed798c875537cf3cb183fb5041017c1fdb7ec14e/coverage-7.6.1-cp310-cp310-musllinux_1_2_i686.whl", hash = "sha256:e6a08c0be454c3b3beb105c0596ebdc2371fab6bb90c0c0297f4e58fd7e1012c", size = 232325, upload_time = "2024-08-04T19:43:21.246Z" }, + { url = "https://files.pythonhosted.org/packages/57/e3/818a2b2af5b7573b4b82cf3e9f137ab158c90ea750a8f053716a32f20f06/coverage-7.6.1-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:f5796e664fe802da4f57a168c85359a8fbf3eab5e55cd4e4569fbacecc903959", size = 233418, upload_time = "2024-08-04T19:43:22.945Z" }, + { url = "https://files.pythonhosted.org/packages/c8/fb/4532b0b0cefb3f06d201648715e03b0feb822907edab3935112b61b885e2/coverage-7.6.1-cp310-cp310-win32.whl", hash = "sha256:7bb65125fcbef8d989fa1dd0e8a060999497629ca5b0efbca209588a73356232", size = 209343, upload_time = "2024-08-04T19:43:25.121Z" }, + { url = "https://files.pythonhosted.org/packages/5a/25/af337cc7421eca1c187cc9c315f0a755d48e755d2853715bfe8c418a45fa/coverage-7.6.1-cp310-cp310-win_amd64.whl", hash = "sha256:3115a95daa9bdba70aea750db7b96b37259a81a709223c8448fa97727d546fe0", size = 210136, upload_time = "2024-08-04T19:43:26.851Z" }, + { url = "https://files.pythonhosted.org/packages/ad/5f/67af7d60d7e8ce61a4e2ddcd1bd5fb787180c8d0ae0fbd073f903b3dd95d/coverage-7.6.1-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:7dea0889685db8550f839fa202744652e87c60015029ce3f60e006f8c4462c93", size = 206796, upload_time = "2024-08-04T19:43:29.115Z" }, + { url = "https://files.pythonhosted.org/packages/e1/0e/e52332389e057daa2e03be1fbfef25bb4d626b37d12ed42ae6281d0a274c/coverage-7.6.1-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:ed37bd3c3b063412f7620464a9ac1314d33100329f39799255fb8d3027da50d3", size = 207244, upload_time = "2024-08-04T19:43:31.285Z" }, + { url = "https://files.pythonhosted.org/packages/aa/cd/766b45fb6e090f20f8927d9c7cb34237d41c73a939358bc881883fd3a40d/coverage-7.6.1-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:d85f5e9a5f8b73e2350097c3756ef7e785f55bd71205defa0bfdaf96c31616ff", size = 239279, upload_time = "2024-08-04T19:43:33.581Z" }, + { url = "https://files.pythonhosted.org/packages/70/6c/a9ccd6fe50ddaf13442a1e2dd519ca805cbe0f1fcd377fba6d8339b98ccb/coverage-7.6.1-cp311-cp311-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:9bc572be474cafb617672c43fe989d6e48d3c83af02ce8de73fff1c6bb3c198d", size = 236859, upload_time = "2024-08-04T19:43:35.301Z" }, + { url = "https://files.pythonhosted.org/packages/14/6f/8351b465febb4dbc1ca9929505202db909c5a635c6fdf33e089bbc3d7d85/coverage-7.6.1-cp311-cp311-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:0c0420b573964c760df9e9e86d1a9a622d0d27f417e1a949a8a66dd7bcee7bc6", size = 238549, upload_time = "2024-08-04T19:43:37.578Z" }, + { url = "https://files.pythonhosted.org/packages/68/3c/289b81fa18ad72138e6d78c4c11a82b5378a312c0e467e2f6b495c260907/coverage-7.6.1-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:1f4aa8219db826ce6be7099d559f8ec311549bfc4046f7f9fe9b5cea5c581c56", size = 237477, upload_time = "2024-08-04T19:43:39.92Z" }, + { url = "https://files.pythonhosted.org/packages/ed/1c/aa1efa6459d822bd72c4abc0b9418cf268de3f60eeccd65dc4988553bd8d/coverage-7.6.1-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:fc5a77d0c516700ebad189b587de289a20a78324bc54baee03dd486f0855d234", size = 236134, upload_time = "2024-08-04T19:43:41.453Z" }, + { url = "https://files.pythonhosted.org/packages/fb/c8/521c698f2d2796565fe9c789c2ee1ccdae610b3aa20b9b2ef980cc253640/coverage-7.6.1-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:b48f312cca9621272ae49008c7f613337c53fadca647d6384cc129d2996d1133", size = 236910, upload_time = "2024-08-04T19:43:43.037Z" }, + { url = "https://files.pythonhosted.org/packages/7d/30/033e663399ff17dca90d793ee8a2ea2890e7fdf085da58d82468b4220bf7/coverage-7.6.1-cp311-cp311-win32.whl", hash = "sha256:1125ca0e5fd475cbbba3bb67ae20bd2c23a98fac4e32412883f9bcbaa81c314c", size = 209348, upload_time = "2024-08-04T19:43:44.787Z" }, + { url = "https://files.pythonhosted.org/packages/20/05/0d1ccbb52727ccdadaa3ff37e4d2dc1cd4d47f0c3df9eb58d9ec8508ca88/coverage-7.6.1-cp311-cp311-win_amd64.whl", hash = "sha256:8ae539519c4c040c5ffd0632784e21b2f03fc1340752af711f33e5be83a9d6c6", size = 210230, upload_time = "2024-08-04T19:43:46.707Z" }, + { url = "https://files.pythonhosted.org/packages/7e/d4/300fc921dff243cd518c7db3a4c614b7e4b2431b0d1145c1e274fd99bd70/coverage-7.6.1-cp312-cp312-macosx_10_9_x86_64.whl", hash = "sha256:95cae0efeb032af8458fc27d191f85d1717b1d4e49f7cb226cf526ff28179778", size = 206983, upload_time = "2024-08-04T19:43:49.082Z" }, + { url = "https://files.pythonhosted.org/packages/e1/ab/6bf00de5327ecb8db205f9ae596885417a31535eeda6e7b99463108782e1/coverage-7.6.1-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:5621a9175cf9d0b0c84c2ef2b12e9f5f5071357c4d2ea6ca1cf01814f45d2391", size = 207221, upload_time = "2024-08-04T19:43:52.15Z" }, + { url = "https://files.pythonhosted.org/packages/92/8f/2ead05e735022d1a7f3a0a683ac7f737de14850395a826192f0288703472/coverage-7.6.1-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:260933720fdcd75340e7dbe9060655aff3af1f0c5d20f46b57f262ab6c86a5e8", size = 240342, upload_time = "2024-08-04T19:43:53.746Z" }, + { url = "https://files.pythonhosted.org/packages/0f/ef/94043e478201ffa85b8ae2d2c79b4081e5a1b73438aafafccf3e9bafb6b5/coverage-7.6.1-cp312-cp312-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:07e2ca0ad381b91350c0ed49d52699b625aab2b44b65e1b4e02fa9df0e92ad2d", size = 237371, upload_time = "2024-08-04T19:43:55.993Z" }, + { url = "https://files.pythonhosted.org/packages/1f/0f/c890339dd605f3ebc269543247bdd43b703cce6825b5ed42ff5f2d6122c7/coverage-7.6.1-cp312-cp312-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:c44fee9975f04b33331cb8eb272827111efc8930cfd582e0320613263ca849ca", size = 239455, upload_time = "2024-08-04T19:43:57.618Z" }, + { url = "https://files.pythonhosted.org/packages/d1/04/7fd7b39ec7372a04efb0f70c70e35857a99b6a9188b5205efb4c77d6a57a/coverage-7.6.1-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:877abb17e6339d96bf08e7a622d05095e72b71f8afd8a9fefc82cf30ed944163", size = 238924, upload_time = "2024-08-04T19:44:00.012Z" }, + { url = "https://files.pythonhosted.org/packages/ed/bf/73ce346a9d32a09cf369f14d2a06651329c984e106f5992c89579d25b27e/coverage-7.6.1-cp312-cp312-musllinux_1_2_i686.whl", hash = "sha256:3e0cadcf6733c09154b461f1ca72d5416635e5e4ec4e536192180d34ec160f8a", size = 237252, upload_time = "2024-08-04T19:44:01.713Z" }, + { url = "https://files.pythonhosted.org/packages/86/74/1dc7a20969725e917b1e07fe71a955eb34bc606b938316bcc799f228374b/coverage-7.6.1-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:c3c02d12f837d9683e5ab2f3d9844dc57655b92c74e286c262e0fc54213c216d", size = 238897, upload_time = "2024-08-04T19:44:03.898Z" }, + { url = "https://files.pythonhosted.org/packages/b6/e9/d9cc3deceb361c491b81005c668578b0dfa51eed02cd081620e9a62f24ec/coverage-7.6.1-cp312-cp312-win32.whl", hash = "sha256:e05882b70b87a18d937ca6768ff33cc3f72847cbc4de4491c8e73880766718e5", size = 209606, upload_time = "2024-08-04T19:44:05.532Z" }, + { url = "https://files.pythonhosted.org/packages/47/c8/5a2e41922ea6740f77d555c4d47544acd7dc3f251fe14199c09c0f5958d3/coverage-7.6.1-cp312-cp312-win_amd64.whl", hash = "sha256:b5d7b556859dd85f3a541db6a4e0167b86e7273e1cdc973e5b175166bb634fdb", size = 210373, upload_time = "2024-08-04T19:44:07.079Z" }, + { url = "https://files.pythonhosted.org/packages/8c/f9/9aa4dfb751cb01c949c990d136a0f92027fbcc5781c6e921df1cb1563f20/coverage-7.6.1-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:a4acd025ecc06185ba2b801f2de85546e0b8ac787cf9d3b06e7e2a69f925b106", size = 207007, upload_time = "2024-08-04T19:44:09.453Z" }, + { url = "https://files.pythonhosted.org/packages/b9/67/e1413d5a8591622a46dd04ff80873b04c849268831ed5c304c16433e7e30/coverage-7.6.1-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:a6d3adcf24b624a7b778533480e32434a39ad8fa30c315208f6d3e5542aeb6e9", size = 207269, upload_time = "2024-08-04T19:44:11.045Z" }, + { url = "https://files.pythonhosted.org/packages/14/5b/9dec847b305e44a5634d0fb8498d135ab1d88330482b74065fcec0622224/coverage-7.6.1-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:d0c212c49b6c10e6951362f7c6df3329f04c2b1c28499563d4035d964ab8e08c", size = 239886, upload_time = "2024-08-04T19:44:12.83Z" }, + { url = "https://files.pythonhosted.org/packages/7b/b7/35760a67c168e29f454928f51f970342d23cf75a2bb0323e0f07334c85f3/coverage-7.6.1-cp313-cp313-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:6e81d7a3e58882450ec4186ca59a3f20a5d4440f25b1cff6f0902ad890e6748a", size = 237037, upload_time = "2024-08-04T19:44:15.393Z" }, + { url = "https://files.pythonhosted.org/packages/f7/95/d2fd31f1d638df806cae59d7daea5abf2b15b5234016a5ebb502c2f3f7ee/coverage-7.6.1-cp313-cp313-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:78b260de9790fd81e69401c2dc8b17da47c8038176a79092a89cb2b7d945d060", size = 239038, upload_time = "2024-08-04T19:44:17.466Z" }, + { url = "https://files.pythonhosted.org/packages/6e/bd/110689ff5752b67924efd5e2aedf5190cbbe245fc81b8dec1abaffba619d/coverage-7.6.1-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:a78d169acd38300060b28d600344a803628c3fd585c912cacc9ea8790fe96862", size = 238690, upload_time = "2024-08-04T19:44:19.336Z" }, + { url = "https://files.pythonhosted.org/packages/d3/a8/08d7b38e6ff8df52331c83130d0ab92d9c9a8b5462f9e99c9f051a4ae206/coverage-7.6.1-cp313-cp313-musllinux_1_2_i686.whl", hash = "sha256:2c09f4ce52cb99dd7505cd0fc8e0e37c77b87f46bc9c1eb03fe3bc9991085388", size = 236765, upload_time = "2024-08-04T19:44:20.994Z" }, + { url = "https://files.pythonhosted.org/packages/d6/6a/9cf96839d3147d55ae713eb2d877f4d777e7dc5ba2bce227167d0118dfe8/coverage-7.6.1-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:6878ef48d4227aace338d88c48738a4258213cd7b74fd9a3d4d7582bb1d8a155", size = 238611, upload_time = "2024-08-04T19:44:22.616Z" }, + { url = "https://files.pythonhosted.org/packages/74/e4/7ff20d6a0b59eeaab40b3140a71e38cf52547ba21dbcf1d79c5a32bba61b/coverage-7.6.1-cp313-cp313-win32.whl", hash = "sha256:44df346d5215a8c0e360307d46ffaabe0f5d3502c8a1cefd700b34baf31d411a", size = 209671, upload_time = "2024-08-04T19:44:24.418Z" }, + { url = "https://files.pythonhosted.org/packages/35/59/1812f08a85b57c9fdb6d0b383d779e47b6f643bc278ed682859512517e83/coverage-7.6.1-cp313-cp313-win_amd64.whl", hash = "sha256:8284cf8c0dd272a247bc154eb6c95548722dce90d098c17a883ed36e67cdb129", size = 210368, upload_time = "2024-08-04T19:44:26.276Z" }, + { url = "https://files.pythonhosted.org/packages/9c/15/08913be1c59d7562a3e39fce20661a98c0a3f59d5754312899acc6cb8a2d/coverage-7.6.1-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:d3296782ca4eab572a1a4eca686d8bfb00226300dcefdf43faa25b5242ab8a3e", size = 207758, upload_time = "2024-08-04T19:44:29.028Z" }, + { url = "https://files.pythonhosted.org/packages/c4/ae/b5d58dff26cade02ada6ca612a76447acd69dccdbb3a478e9e088eb3d4b9/coverage-7.6.1-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:502753043567491d3ff6d08629270127e0c31d4184c4c8d98f92c26f65019962", size = 208035, upload_time = "2024-08-04T19:44:30.673Z" }, + { url = "https://files.pythonhosted.org/packages/b8/d7/62095e355ec0613b08dfb19206ce3033a0eedb6f4a67af5ed267a8800642/coverage-7.6.1-cp313-cp313t-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:6a89ecca80709d4076b95f89f308544ec8f7b4727e8a547913a35f16717856cb", size = 250839, upload_time = "2024-08-04T19:44:32.412Z" }, + { url = "https://files.pythonhosted.org/packages/7c/1e/c2967cb7991b112ba3766df0d9c21de46b476d103e32bb401b1b2adf3380/coverage-7.6.1-cp313-cp313t-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:a318d68e92e80af8b00fa99609796fdbcdfef3629c77c6283566c6f02c6d6704", size = 246569, upload_time = "2024-08-04T19:44:34.547Z" }, + { url = "https://files.pythonhosted.org/packages/8b/61/a7a6a55dd266007ed3b1df7a3386a0d760d014542d72f7c2c6938483b7bd/coverage-7.6.1-cp313-cp313t-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:13b0a73a0896988f053e4fbb7de6d93388e6dd292b0d87ee51d106f2c11b465b", size = 248927, upload_time = "2024-08-04T19:44:36.313Z" }, + { url = "https://files.pythonhosted.org/packages/c8/fa/13a6f56d72b429f56ef612eb3bc5ce1b75b7ee12864b3bd12526ab794847/coverage-7.6.1-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:4421712dbfc5562150f7554f13dde997a2e932a6b5f352edcce948a815efee6f", size = 248401, upload_time = "2024-08-04T19:44:38.155Z" }, + { url = "https://files.pythonhosted.org/packages/75/06/0429c652aa0fb761fc60e8c6b291338c9173c6aa0f4e40e1902345b42830/coverage-7.6.1-cp313-cp313t-musllinux_1_2_i686.whl", hash = "sha256:166811d20dfea725e2e4baa71fffd6c968a958577848d2131f39b60043400223", size = 246301, upload_time = "2024-08-04T19:44:39.883Z" }, + { url = "https://files.pythonhosted.org/packages/52/76/1766bb8b803a88f93c3a2d07e30ffa359467810e5cbc68e375ebe6906efb/coverage-7.6.1-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:225667980479a17db1048cb2bf8bfb39b8e5be8f164b8f6628b64f78a72cf9d3", size = 247598, upload_time = "2024-08-04T19:44:41.59Z" }, + { url = "https://files.pythonhosted.org/packages/66/8b/f54f8db2ae17188be9566e8166ac6df105c1c611e25da755738025708d54/coverage-7.6.1-cp313-cp313t-win32.whl", hash = "sha256:170d444ab405852903b7d04ea9ae9b98f98ab6d7e63e1115e82620807519797f", size = 210307, upload_time = "2024-08-04T19:44:43.301Z" }, + { url = "https://files.pythonhosted.org/packages/9f/b0/e0dca6da9170aefc07515cce067b97178cefafb512d00a87a1c717d2efd5/coverage-7.6.1-cp313-cp313t-win_amd64.whl", hash = "sha256:b9f222de8cded79c49bf184bdbc06630d4c58eec9459b939b4a690c82ed05657", size = 211453, upload_time = "2024-08-04T19:44:45.677Z" }, + { url = "https://files.pythonhosted.org/packages/81/d0/d9e3d554e38beea5a2e22178ddb16587dbcbe9a1ef3211f55733924bf7fa/coverage-7.6.1-cp38-cp38-macosx_10_9_x86_64.whl", hash = "sha256:6db04803b6c7291985a761004e9060b2bca08da6d04f26a7f2294b8623a0c1a0", size = 206674, upload_time = "2024-08-04T19:44:47.694Z" }, + { url = "https://files.pythonhosted.org/packages/38/ea/cab2dc248d9f45b2b7f9f1f596a4d75a435cb364437c61b51d2eb33ceb0e/coverage-7.6.1-cp38-cp38-macosx_11_0_arm64.whl", hash = "sha256:f1adfc8ac319e1a348af294106bc6a8458a0f1633cc62a1446aebc30c5fa186a", size = 207101, upload_time = "2024-08-04T19:44:49.32Z" }, + { url = "https://files.pythonhosted.org/packages/ca/6f/f82f9a500c7c5722368978a5390c418d2a4d083ef955309a8748ecaa8920/coverage-7.6.1-cp38-cp38-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:a95324a9de9650a729239daea117df21f4b9868ce32e63f8b650ebe6cef5595b", size = 236554, upload_time = "2024-08-04T19:44:51.631Z" }, + { url = "https://files.pythonhosted.org/packages/a6/94/d3055aa33d4e7e733d8fa309d9adf147b4b06a82c1346366fc15a2b1d5fa/coverage-7.6.1-cp38-cp38-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:b43c03669dc4618ec25270b06ecd3ee4fa94c7f9b3c14bae6571ca00ef98b0d3", size = 234440, upload_time = "2024-08-04T19:44:53.464Z" }, + { url = "https://files.pythonhosted.org/packages/e4/6e/885bcd787d9dd674de4a7d8ec83faf729534c63d05d51d45d4fa168f7102/coverage-7.6.1-cp38-cp38-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:8929543a7192c13d177b770008bc4e8119f2e1f881d563fc6b6305d2d0ebe9de", size = 235889, upload_time = "2024-08-04T19:44:55.165Z" }, + { url = "https://files.pythonhosted.org/packages/f4/63/df50120a7744492710854860783d6819ff23e482dee15462c9a833cc428a/coverage-7.6.1-cp38-cp38-musllinux_1_2_aarch64.whl", hash = "sha256:a09ece4a69cf399510c8ab25e0950d9cf2b42f7b3cb0374f95d2e2ff594478a6", size = 235142, upload_time = "2024-08-04T19:44:57.269Z" }, + { url = "https://files.pythonhosted.org/packages/3a/5d/9d0acfcded2b3e9ce1c7923ca52ccc00c78a74e112fc2aee661125b7843b/coverage-7.6.1-cp38-cp38-musllinux_1_2_i686.whl", hash = "sha256:9054a0754de38d9dbd01a46621636689124d666bad1936d76c0341f7d71bf569", size = 233805, upload_time = "2024-08-04T19:44:59.033Z" }, + { url = "https://files.pythonhosted.org/packages/c4/56/50abf070cb3cd9b1dd32f2c88f083aab561ecbffbcd783275cb51c17f11d/coverage-7.6.1-cp38-cp38-musllinux_1_2_x86_64.whl", hash = "sha256:0dbde0f4aa9a16fa4d754356a8f2e36296ff4d83994b2c9d8398aa32f222f989", size = 234655, upload_time = "2024-08-04T19:45:01.398Z" }, + { url = "https://files.pythonhosted.org/packages/25/ee/b4c246048b8485f85a2426ef4abab88e48c6e80c74e964bea5cd4cd4b115/coverage-7.6.1-cp38-cp38-win32.whl", hash = "sha256:da511e6ad4f7323ee5702e6633085fb76c2f893aaf8ce4c51a0ba4fc07580ea7", size = 209296, upload_time = "2024-08-04T19:45:03.819Z" }, + { url = "https://files.pythonhosted.org/packages/5c/1c/96cf86b70b69ea2b12924cdf7cabb8ad10e6130eab8d767a1099fbd2a44f/coverage-7.6.1-cp38-cp38-win_amd64.whl", hash = "sha256:3f1156e3e8f2872197af3840d8ad307a9dd18e615dc64d9ee41696f287c57ad8", size = 210137, upload_time = "2024-08-04T19:45:06.25Z" }, + { url = "https://files.pythonhosted.org/packages/19/d3/d54c5aa83268779d54c86deb39c1c4566e5d45c155369ca152765f8db413/coverage-7.6.1-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:abd5fd0db5f4dc9289408aaf34908072f805ff7792632250dcb36dc591d24255", size = 206688, upload_time = "2024-08-04T19:45:08.358Z" }, + { url = "https://files.pythonhosted.org/packages/a5/fe/137d5dca72e4a258b1bc17bb04f2e0196898fe495843402ce826a7419fe3/coverage-7.6.1-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:547f45fa1a93154bd82050a7f3cddbc1a7a4dd2a9bf5cb7d06f4ae29fe94eaf8", size = 207120, upload_time = "2024-08-04T19:45:11.526Z" }, + { url = "https://files.pythonhosted.org/packages/78/5b/a0a796983f3201ff5485323b225d7c8b74ce30c11f456017e23d8e8d1945/coverage-7.6.1-cp39-cp39-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:645786266c8f18a931b65bfcefdbf6952dd0dea98feee39bd188607a9d307ed2", size = 235249, upload_time = "2024-08-04T19:45:13.202Z" }, + { url = "https://files.pythonhosted.org/packages/4e/e1/76089d6a5ef9d68f018f65411fcdaaeb0141b504587b901d74e8587606ad/coverage-7.6.1-cp39-cp39-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:9e0b2df163b8ed01d515807af24f63de04bebcecbd6c3bfeff88385789fdf75a", size = 233237, upload_time = "2024-08-04T19:45:14.961Z" }, + { url = "https://files.pythonhosted.org/packages/9a/6f/eef79b779a540326fee9520e5542a8b428cc3bfa8b7c8f1022c1ee4fc66c/coverage-7.6.1-cp39-cp39-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:609b06f178fe8e9f89ef676532760ec0b4deea15e9969bf754b37f7c40326dbc", size = 234311, upload_time = "2024-08-04T19:45:16.924Z" }, + { url = "https://files.pythonhosted.org/packages/75/e1/656d65fb126c29a494ef964005702b012f3498db1a30dd562958e85a4049/coverage-7.6.1-cp39-cp39-musllinux_1_2_aarch64.whl", hash = "sha256:702855feff378050ae4f741045e19a32d57d19f3e0676d589df0575008ea5004", size = 233453, upload_time = "2024-08-04T19:45:18.672Z" }, + { url = "https://files.pythonhosted.org/packages/68/6a/45f108f137941a4a1238c85f28fd9d048cc46b5466d6b8dda3aba1bb9d4f/coverage-7.6.1-cp39-cp39-musllinux_1_2_i686.whl", hash = "sha256:2bdb062ea438f22d99cba0d7829c2ef0af1d768d1e4a4f528087224c90b132cb", size = 231958, upload_time = "2024-08-04T19:45:20.63Z" }, + { url = "https://files.pythonhosted.org/packages/9b/e7/47b809099168b8b8c72ae311efc3e88c8d8a1162b3ba4b8da3cfcdb85743/coverage-7.6.1-cp39-cp39-musllinux_1_2_x86_64.whl", hash = "sha256:9c56863d44bd1c4fe2abb8a4d6f5371d197f1ac0ebdee542f07f35895fc07f36", size = 232938, upload_time = "2024-08-04T19:45:23.062Z" }, + { url = "https://files.pythonhosted.org/packages/52/80/052222ba7058071f905435bad0ba392cc12006380731c37afaf3fe749b88/coverage-7.6.1-cp39-cp39-win32.whl", hash = "sha256:6e2cd258d7d927d09493c8df1ce9174ad01b381d4729a9d8d4e38670ca24774c", size = 209352, upload_time = "2024-08-04T19:45:25.042Z" }, + { url = "https://files.pythonhosted.org/packages/b8/d8/1b92e0b3adcf384e98770a00ca095da1b5f7b483e6563ae4eb5e935d24a1/coverage-7.6.1-cp39-cp39-win_amd64.whl", hash = "sha256:06a737c882bd26d0d6ee7269b20b12f14a8704807a01056c80bb881a4b2ce6ca", size = 210153, upload_time = "2024-08-04T19:45:27.079Z" }, + { url = "https://files.pythonhosted.org/packages/a5/2b/0354ed096bca64dc8e32a7cbcae28b34cb5ad0b1fe2125d6d99583313ac0/coverage-7.6.1-pp38.pp39.pp310-none-any.whl", hash = "sha256:e9a6e0eb86070e8ccaedfbd9d38fec54864f3125ab95419970575b42af7541df", size = 198926, upload_time = "2024-08-04T19:45:28.875Z" }, +] + +[package.optional-dependencies] +toml = [ + { name = "tomli", marker = "python_full_version < '3.9'" }, +] + +[[package]] +name = "coverage" +version = "7.10.7" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version == '3.9.*'", +] +sdist = { url = "https://files.pythonhosted.org/packages/51/26/d22c300112504f5f9a9fd2297ce33c35f3d353e4aeb987c8419453b2a7c2/coverage-7.10.7.tar.gz", hash = "sha256:f4ab143ab113be368a3e9b795f9cd7906c5ef407d6173fe9675a902e1fffc239", size = 827704, upload_time = "2025-09-21T20:03:56.815Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/e5/6c/3a3f7a46888e69d18abe3ccc6fe4cb16cccb1e6a2f99698931dafca489e6/coverage-7.10.7-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:fc04cc7a3db33664e0c2d10eb8990ff6b3536f6842c9590ae8da4c614b9ed05a", size = 217987, upload_time = "2025-09-21T20:00:57.218Z" }, + { url = "https://files.pythonhosted.org/packages/03/94/952d30f180b1a916c11a56f5c22d3535e943aa22430e9e3322447e520e1c/coverage-7.10.7-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:e201e015644e207139f7e2351980feb7040e6f4b2c2978892f3e3789d1c125e5", size = 218388, upload_time = "2025-09-21T20:01:00.081Z" }, + { url = "https://files.pythonhosted.org/packages/50/2b/9e0cf8ded1e114bcd8b2fd42792b57f1c4e9e4ea1824cde2af93a67305be/coverage-7.10.7-cp310-cp310-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:240af60539987ced2c399809bd34f7c78e8abe0736af91c3d7d0e795df633d17", size = 245148, upload_time = "2025-09-21T20:01:01.768Z" }, + { url = "https://files.pythonhosted.org/packages/19/20/d0384ac06a6f908783d9b6aa6135e41b093971499ec488e47279f5b846e6/coverage-7.10.7-cp310-cp310-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:8421e088bc051361b01c4b3a50fd39a4b9133079a2229978d9d30511fd05231b", size = 246958, upload_time = "2025-09-21T20:01:03.355Z" }, + { url = "https://files.pythonhosted.org/packages/60/83/5c283cff3d41285f8eab897651585db908a909c572bdc014bcfaf8a8b6ae/coverage-7.10.7-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:6be8ed3039ae7f7ac5ce058c308484787c86e8437e72b30bf5e88b8ea10f3c87", size = 248819, upload_time = "2025-09-21T20:01:04.968Z" }, + { url = "https://files.pythonhosted.org/packages/60/22/02eb98fdc5ff79f423e990d877693e5310ae1eab6cb20ae0b0b9ac45b23b/coverage-7.10.7-cp310-cp310-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:e28299d9f2e889e6d51b1f043f58d5f997c373cc12e6403b90df95b8b047c13e", size = 245754, upload_time = "2025-09-21T20:01:06.321Z" }, + { url = "https://files.pythonhosted.org/packages/b4/bc/25c83bcf3ad141b32cd7dc45485ef3c01a776ca3aa8ef0a93e77e8b5bc43/coverage-7.10.7-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:c4e16bd7761c5e454f4efd36f345286d6f7c5fa111623c355691e2755cae3b9e", size = 246860, upload_time = "2025-09-21T20:01:07.605Z" }, + { url = "https://files.pythonhosted.org/packages/3c/b7/95574702888b58c0928a6e982038c596f9c34d52c5e5107f1eef729399b5/coverage-7.10.7-cp310-cp310-musllinux_1_2_i686.whl", hash = "sha256:b1c81d0e5e160651879755c9c675b974276f135558cf4ba79fee7b8413a515df", size = 244877, upload_time = "2025-09-21T20:01:08.829Z" }, + { url = "https://files.pythonhosted.org/packages/47/b6/40095c185f235e085df0e0b158f6bd68cc6e1d80ba6c7721dc81d97ec318/coverage-7.10.7-cp310-cp310-musllinux_1_2_riscv64.whl", hash = "sha256:606cc265adc9aaedcc84f1f064f0e8736bc45814f15a357e30fca7ecc01504e0", size = 245108, upload_time = "2025-09-21T20:01:10.527Z" }, + { url = "https://files.pythonhosted.org/packages/c8/50/4aea0556da7a4b93ec9168420d170b55e2eb50ae21b25062513d020c6861/coverage-7.10.7-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:10b24412692df990dbc34f8fb1b6b13d236ace9dfdd68df5b28c2e39cafbba13", size = 245752, upload_time = "2025-09-21T20:01:11.857Z" }, + { url = "https://files.pythonhosted.org/packages/6a/28/ea1a84a60828177ae3b100cb6723838523369a44ec5742313ed7db3da160/coverage-7.10.7-cp310-cp310-win32.whl", hash = "sha256:b51dcd060f18c19290d9b8a9dd1e0181538df2ce0717f562fff6cf74d9fc0b5b", size = 220497, upload_time = "2025-09-21T20:01:13.459Z" }, + { url = "https://files.pythonhosted.org/packages/fc/1a/a81d46bbeb3c3fd97b9602ebaa411e076219a150489bcc2c025f151bd52d/coverage-7.10.7-cp310-cp310-win_amd64.whl", hash = "sha256:3a622ac801b17198020f09af3eaf45666b344a0d69fc2a6ffe2ea83aeef1d807", size = 221392, upload_time = "2025-09-21T20:01:14.722Z" }, + { url = "https://files.pythonhosted.org/packages/d2/5d/c1a17867b0456f2e9ce2d8d4708a4c3a089947d0bec9c66cdf60c9e7739f/coverage-7.10.7-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:a609f9c93113be646f44c2a0256d6ea375ad047005d7f57a5c15f614dc1b2f59", size = 218102, upload_time = "2025-09-21T20:01:16.089Z" }, + { url = "https://files.pythonhosted.org/packages/54/f0/514dcf4b4e3698b9a9077f084429681bf3aad2b4a72578f89d7f643eb506/coverage-7.10.7-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:65646bb0359386e07639c367a22cf9b5bf6304e8630b565d0626e2bdf329227a", size = 218505, upload_time = "2025-09-21T20:01:17.788Z" }, + { url = "https://files.pythonhosted.org/packages/20/f6/9626b81d17e2a4b25c63ac1b425ff307ecdeef03d67c9a147673ae40dc36/coverage-7.10.7-cp311-cp311-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:5f33166f0dfcce728191f520bd2692914ec70fac2713f6bf3ce59c3deacb4699", size = 248898, upload_time = "2025-09-21T20:01:19.488Z" }, + { url = "https://files.pythonhosted.org/packages/b0/ef/bd8e719c2f7417ba03239052e099b76ea1130ac0cbb183ee1fcaa58aaff3/coverage-7.10.7-cp311-cp311-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:35f5e3f9e455bb17831876048355dca0f758b6df22f49258cb5a91da23ef437d", size = 250831, upload_time = "2025-09-21T20:01:20.817Z" }, + { url = "https://files.pythonhosted.org/packages/a5/b6/bf054de41ec948b151ae2b79a55c107f5760979538f5fb80c195f2517718/coverage-7.10.7-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:4da86b6d62a496e908ac2898243920c7992499c1712ff7c2b6d837cc69d9467e", size = 252937, upload_time = "2025-09-21T20:01:22.171Z" }, + { url = "https://files.pythonhosted.org/packages/0f/e5/3860756aa6f9318227443c6ce4ed7bf9e70bb7f1447a0353f45ac5c7974b/coverage-7.10.7-cp311-cp311-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:6b8b09c1fad947c84bbbc95eca841350fad9cbfa5a2d7ca88ac9f8d836c92e23", size = 249021, upload_time = "2025-09-21T20:01:23.907Z" }, + { url = "https://files.pythonhosted.org/packages/26/0f/bd08bd042854f7fd07b45808927ebcce99a7ed0f2f412d11629883517ac2/coverage-7.10.7-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:4376538f36b533b46f8971d3a3e63464f2c7905c9800db97361c43a2b14792ab", size = 250626, upload_time = "2025-09-21T20:01:25.721Z" }, + { url = "https://files.pythonhosted.org/packages/8e/a7/4777b14de4abcc2e80c6b1d430f5d51eb18ed1d75fca56cbce5f2db9b36e/coverage-7.10.7-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:121da30abb574f6ce6ae09840dae322bef734480ceafe410117627aa54f76d82", size = 248682, upload_time = "2025-09-21T20:01:27.105Z" }, + { url = "https://files.pythonhosted.org/packages/34/72/17d082b00b53cd45679bad682fac058b87f011fd8b9fe31d77f5f8d3a4e4/coverage-7.10.7-cp311-cp311-musllinux_1_2_riscv64.whl", hash = "sha256:88127d40df529336a9836870436fc2751c339fbaed3a836d42c93f3e4bd1d0a2", size = 248402, upload_time = "2025-09-21T20:01:28.629Z" }, + { url = "https://files.pythonhosted.org/packages/81/7a/92367572eb5bdd6a84bfa278cc7e97db192f9f45b28c94a9ca1a921c3577/coverage-7.10.7-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:ba58bbcd1b72f136080c0bccc2400d66cc6115f3f906c499013d065ac33a4b61", size = 249320, upload_time = "2025-09-21T20:01:30.004Z" }, + { url = "https://files.pythonhosted.org/packages/2f/88/a23cc185f6a805dfc4fdf14a94016835eeb85e22ac3a0e66d5e89acd6462/coverage-7.10.7-cp311-cp311-win32.whl", hash = "sha256:972b9e3a4094b053a4e46832b4bc829fc8a8d347160eb39d03f1690316a99c14", size = 220536, upload_time = "2025-09-21T20:01:32.184Z" }, + { url = "https://files.pythonhosted.org/packages/fe/ef/0b510a399dfca17cec7bc2f05ad8bd78cf55f15c8bc9a73ab20c5c913c2e/coverage-7.10.7-cp311-cp311-win_amd64.whl", hash = "sha256:a7b55a944a7f43892e28ad4bc0561dfd5f0d73e605d1aa5c3c976b52aea121d2", size = 221425, upload_time = "2025-09-21T20:01:33.557Z" }, + { url = "https://files.pythonhosted.org/packages/51/7f/023657f301a276e4ba1850f82749bc136f5a7e8768060c2e5d9744a22951/coverage-7.10.7-cp311-cp311-win_arm64.whl", hash = "sha256:736f227fb490f03c6488f9b6d45855f8e0fd749c007f9303ad30efab0e73c05a", size = 220103, upload_time = "2025-09-21T20:01:34.929Z" }, + { url = "https://files.pythonhosted.org/packages/13/e4/eb12450f71b542a53972d19117ea5a5cea1cab3ac9e31b0b5d498df1bd5a/coverage-7.10.7-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:7bb3b9ddb87ef7725056572368040c32775036472d5a033679d1fa6c8dc08417", size = 218290, upload_time = "2025-09-21T20:01:36.455Z" }, + { url = "https://files.pythonhosted.org/packages/37/66/593f9be12fc19fb36711f19a5371af79a718537204d16ea1d36f16bd78d2/coverage-7.10.7-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:18afb24843cbc175687225cab1138c95d262337f5473512010e46831aa0c2973", size = 218515, upload_time = "2025-09-21T20:01:37.982Z" }, + { url = "https://files.pythonhosted.org/packages/66/80/4c49f7ae09cafdacc73fbc30949ffe77359635c168f4e9ff33c9ebb07838/coverage-7.10.7-cp312-cp312-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:399a0b6347bcd3822be369392932884b8216d0944049ae22925631a9b3d4ba4c", size = 250020, upload_time = "2025-09-21T20:01:39.617Z" }, + { url = "https://files.pythonhosted.org/packages/a6/90/a64aaacab3b37a17aaedd83e8000142561a29eb262cede42d94a67f7556b/coverage-7.10.7-cp312-cp312-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:314f2c326ded3f4b09be11bc282eb2fc861184bc95748ae67b360ac962770be7", size = 252769, upload_time = "2025-09-21T20:01:41.341Z" }, + { url = "https://files.pythonhosted.org/packages/98/2e/2dda59afd6103b342e096f246ebc5f87a3363b5412609946c120f4e7750d/coverage-7.10.7-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:c41e71c9cfb854789dee6fc51e46743a6d138b1803fab6cb860af43265b42ea6", size = 253901, upload_time = "2025-09-21T20:01:43.042Z" }, + { url = "https://files.pythonhosted.org/packages/53/dc/8d8119c9051d50f3119bb4a75f29f1e4a6ab9415cd1fa8bf22fcc3fb3b5f/coverage-7.10.7-cp312-cp312-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:bc01f57ca26269c2c706e838f6422e2a8788e41b3e3c65e2f41148212e57cd59", size = 250413, upload_time = "2025-09-21T20:01:44.469Z" }, + { url = "https://files.pythonhosted.org/packages/98/b3/edaff9c5d79ee4d4b6d3fe046f2b1d799850425695b789d491a64225d493/coverage-7.10.7-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:a6442c59a8ac8b85812ce33bc4d05bde3fb22321fa8294e2a5b487c3505f611b", size = 251820, upload_time = "2025-09-21T20:01:45.915Z" }, + { url = "https://files.pythonhosted.org/packages/11/25/9a0728564bb05863f7e513e5a594fe5ffef091b325437f5430e8cfb0d530/coverage-7.10.7-cp312-cp312-musllinux_1_2_i686.whl", hash = "sha256:78a384e49f46b80fb4c901d52d92abe098e78768ed829c673fbb53c498bef73a", size = 249941, upload_time = "2025-09-21T20:01:47.296Z" }, + { url = "https://files.pythonhosted.org/packages/e0/fd/ca2650443bfbef5b0e74373aac4df67b08180d2f184b482c41499668e258/coverage-7.10.7-cp312-cp312-musllinux_1_2_riscv64.whl", hash = "sha256:5e1e9802121405ede4b0133aa4340ad8186a1d2526de5b7c3eca519db7bb89fb", size = 249519, upload_time = "2025-09-21T20:01:48.73Z" }, + { url = "https://files.pythonhosted.org/packages/24/79/f692f125fb4299b6f963b0745124998ebb8e73ecdfce4ceceb06a8c6bec5/coverage-7.10.7-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:d41213ea25a86f69efd1575073d34ea11aabe075604ddf3d148ecfec9e1e96a1", size = 251375, upload_time = "2025-09-21T20:01:50.529Z" }, + { url = "https://files.pythonhosted.org/packages/5e/75/61b9bbd6c7d24d896bfeec57acba78e0f8deac68e6baf2d4804f7aae1f88/coverage-7.10.7-cp312-cp312-win32.whl", hash = "sha256:77eb4c747061a6af8d0f7bdb31f1e108d172762ef579166ec84542f711d90256", size = 220699, upload_time = "2025-09-21T20:01:51.941Z" }, + { url = "https://files.pythonhosted.org/packages/ca/f3/3bf7905288b45b075918d372498f1cf845b5b579b723c8fd17168018d5f5/coverage-7.10.7-cp312-cp312-win_amd64.whl", hash = "sha256:f51328ffe987aecf6d09f3cd9d979face89a617eacdaea43e7b3080777f647ba", size = 221512, upload_time = "2025-09-21T20:01:53.481Z" }, + { url = "https://files.pythonhosted.org/packages/5c/44/3e32dbe933979d05cf2dac5e697c8599cfe038aaf51223ab901e208d5a62/coverage-7.10.7-cp312-cp312-win_arm64.whl", hash = "sha256:bda5e34f8a75721c96085903c6f2197dc398c20ffd98df33f866a9c8fd95f4bf", size = 220147, upload_time = "2025-09-21T20:01:55.2Z" }, + { url = "https://files.pythonhosted.org/packages/9a/94/b765c1abcb613d103b64fcf10395f54d69b0ef8be6a0dd9c524384892cc7/coverage-7.10.7-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:981a651f543f2854abd3b5fcb3263aac581b18209be49863ba575de6edf4c14d", size = 218320, upload_time = "2025-09-21T20:01:56.629Z" }, + { url = "https://files.pythonhosted.org/packages/72/4f/732fff31c119bb73b35236dd333030f32c4bfe909f445b423e6c7594f9a2/coverage-7.10.7-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:73ab1601f84dc804f7812dc297e93cd99381162da39c47040a827d4e8dafe63b", size = 218575, upload_time = "2025-09-21T20:01:58.203Z" }, + { url = "https://files.pythonhosted.org/packages/87/02/ae7e0af4b674be47566707777db1aa375474f02a1d64b9323e5813a6cdd5/coverage-7.10.7-cp313-cp313-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:a8b6f03672aa6734e700bbcd65ff050fd19cddfec4b031cc8cf1c6967de5a68e", size = 249568, upload_time = "2025-09-21T20:01:59.748Z" }, + { url = "https://files.pythonhosted.org/packages/a2/77/8c6d22bf61921a59bce5471c2f1f7ac30cd4ac50aadde72b8c48d5727902/coverage-7.10.7-cp313-cp313-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:10b6ba00ab1132a0ce4428ff68cf50a25efd6840a42cdf4239c9b99aad83be8b", size = 252174, upload_time = "2025-09-21T20:02:01.192Z" }, + { url = "https://files.pythonhosted.org/packages/b1/20/b6ea4f69bbb52dac0aebd62157ba6a9dddbfe664f5af8122dac296c3ee15/coverage-7.10.7-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:c79124f70465a150e89340de5963f936ee97097d2ef76c869708c4248c63ca49", size = 253447, upload_time = "2025-09-21T20:02:02.701Z" }, + { url = "https://files.pythonhosted.org/packages/f9/28/4831523ba483a7f90f7b259d2018fef02cb4d5b90bc7c1505d6e5a84883c/coverage-7.10.7-cp313-cp313-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:69212fbccdbd5b0e39eac4067e20a4a5256609e209547d86f740d68ad4f04911", size = 249779, upload_time = "2025-09-21T20:02:04.185Z" }, + { url = "https://files.pythonhosted.org/packages/a7/9f/4331142bc98c10ca6436d2d620c3e165f31e6c58d43479985afce6f3191c/coverage-7.10.7-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:7ea7c6c9d0d286d04ed3541747e6597cbe4971f22648b68248f7ddcd329207f0", size = 251604, upload_time = "2025-09-21T20:02:06.034Z" }, + { url = "https://files.pythonhosted.org/packages/ce/60/bda83b96602036b77ecf34e6393a3836365481b69f7ed7079ab85048202b/coverage-7.10.7-cp313-cp313-musllinux_1_2_i686.whl", hash = "sha256:b9be91986841a75042b3e3243d0b3cb0b2434252b977baaf0cd56e960fe1e46f", size = 249497, upload_time = "2025-09-21T20:02:07.619Z" }, + { url = "https://files.pythonhosted.org/packages/5f/af/152633ff35b2af63977edd835d8e6430f0caef27d171edf2fc76c270ef31/coverage-7.10.7-cp313-cp313-musllinux_1_2_riscv64.whl", hash = "sha256:b281d5eca50189325cfe1f365fafade89b14b4a78d9b40b05ddd1fc7d2a10a9c", size = 249350, upload_time = "2025-09-21T20:02:10.34Z" }, + { url = "https://files.pythonhosted.org/packages/9d/71/d92105d122bd21cebba877228990e1646d862e34a98bb3374d3fece5a794/coverage-7.10.7-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:99e4aa63097ab1118e75a848a28e40d68b08a5e19ce587891ab7fd04475e780f", size = 251111, upload_time = "2025-09-21T20:02:12.122Z" }, + { url = "https://files.pythonhosted.org/packages/a2/9e/9fdb08f4bf476c912f0c3ca292e019aab6712c93c9344a1653986c3fd305/coverage-7.10.7-cp313-cp313-win32.whl", hash = "sha256:dc7c389dce432500273eaf48f410b37886be9208b2dd5710aaf7c57fd442c698", size = 220746, upload_time = "2025-09-21T20:02:13.919Z" }, + { url = "https://files.pythonhosted.org/packages/b1/b1/a75fd25df44eab52d1931e89980d1ada46824c7a3210be0d3c88a44aaa99/coverage-7.10.7-cp313-cp313-win_amd64.whl", hash = "sha256:cac0fdca17b036af3881a9d2729a850b76553f3f716ccb0360ad4dbc06b3b843", size = 221541, upload_time = "2025-09-21T20:02:15.57Z" }, + { url = "https://files.pythonhosted.org/packages/14/3a/d720d7c989562a6e9a14b2c9f5f2876bdb38e9367126d118495b89c99c37/coverage-7.10.7-cp313-cp313-win_arm64.whl", hash = "sha256:4b6f236edf6e2f9ae8fcd1332da4e791c1b6ba0dc16a2dc94590ceccb482e546", size = 220170, upload_time = "2025-09-21T20:02:17.395Z" }, + { url = "https://files.pythonhosted.org/packages/bb/22/e04514bf2a735d8b0add31d2b4ab636fc02370730787c576bb995390d2d5/coverage-7.10.7-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:a0ec07fd264d0745ee396b666d47cef20875f4ff2375d7c4f58235886cc1ef0c", size = 219029, upload_time = "2025-09-21T20:02:18.936Z" }, + { url = "https://files.pythonhosted.org/packages/11/0b/91128e099035ece15da3445d9015e4b4153a6059403452d324cbb0a575fa/coverage-7.10.7-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:dd5e856ebb7bfb7672b0086846db5afb4567a7b9714b8a0ebafd211ec7ce6a15", size = 219259, upload_time = "2025-09-21T20:02:20.44Z" }, + { url = "https://files.pythonhosted.org/packages/8b/51/66420081e72801536a091a0c8f8c1f88a5c4bf7b9b1bdc6222c7afe6dc9b/coverage-7.10.7-cp313-cp313t-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:f57b2a3c8353d3e04acf75b3fed57ba41f5c0646bbf1d10c7c282291c97936b4", size = 260592, upload_time = "2025-09-21T20:02:22.313Z" }, + { url = "https://files.pythonhosted.org/packages/5d/22/9b8d458c2881b22df3db5bb3e7369e63d527d986decb6c11a591ba2364f7/coverage-7.10.7-cp313-cp313t-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:1ef2319dd15a0b009667301a3f84452a4dc6fddfd06b0c5c53ea472d3989fbf0", size = 262768, upload_time = "2025-09-21T20:02:24.287Z" }, + { url = "https://files.pythonhosted.org/packages/f7/08/16bee2c433e60913c610ea200b276e8eeef084b0d200bdcff69920bd5828/coverage-7.10.7-cp313-cp313t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:83082a57783239717ceb0ad584de3c69cf581b2a95ed6bf81ea66034f00401c0", size = 264995, upload_time = "2025-09-21T20:02:26.133Z" }, + { url = "https://files.pythonhosted.org/packages/20/9d/e53eb9771d154859b084b90201e5221bca7674ba449a17c101a5031d4054/coverage-7.10.7-cp313-cp313t-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:50aa94fb1fb9a397eaa19c0d5ec15a5edd03a47bf1a3a6111a16b36e190cff65", size = 259546, upload_time = "2025-09-21T20:02:27.716Z" }, + { url = "https://files.pythonhosted.org/packages/ad/b0/69bc7050f8d4e56a89fb550a1577d5d0d1db2278106f6f626464067b3817/coverage-7.10.7-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:2120043f147bebb41c85b97ac45dd173595ff14f2a584f2963891cbcc3091541", size = 262544, upload_time = "2025-09-21T20:02:29.216Z" }, + { url = "https://files.pythonhosted.org/packages/ef/4b/2514b060dbd1bc0aaf23b852c14bb5818f244c664cb16517feff6bb3a5ab/coverage-7.10.7-cp313-cp313t-musllinux_1_2_i686.whl", hash = "sha256:2fafd773231dd0378fdba66d339f84904a8e57a262f583530f4f156ab83863e6", size = 260308, upload_time = "2025-09-21T20:02:31.226Z" }, + { url = "https://files.pythonhosted.org/packages/54/78/7ba2175007c246d75e496f64c06e94122bdb914790a1285d627a918bd271/coverage-7.10.7-cp313-cp313t-musllinux_1_2_riscv64.whl", hash = "sha256:0b944ee8459f515f28b851728ad224fa2d068f1513ef6b7ff1efafeb2185f999", size = 258920, upload_time = "2025-09-21T20:02:32.823Z" }, + { url = "https://files.pythonhosted.org/packages/c0/b3/fac9f7abbc841409b9a410309d73bfa6cfb2e51c3fada738cb607ce174f8/coverage-7.10.7-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:4b583b97ab2e3efe1b3e75248a9b333bd3f8b0b1b8e5b45578e05e5850dfb2c2", size = 261434, upload_time = "2025-09-21T20:02:34.86Z" }, + { url = "https://files.pythonhosted.org/packages/ee/51/a03bec00d37faaa891b3ff7387192cef20f01604e5283a5fabc95346befa/coverage-7.10.7-cp313-cp313t-win32.whl", hash = "sha256:2a78cd46550081a7909b3329e2266204d584866e8d97b898cd7fb5ac8d888b1a", size = 221403, upload_time = "2025-09-21T20:02:37.034Z" }, + { url = "https://files.pythonhosted.org/packages/53/22/3cf25d614e64bf6d8e59c7c669b20d6d940bb337bdee5900b9ca41c820bb/coverage-7.10.7-cp313-cp313t-win_amd64.whl", hash = "sha256:33a5e6396ab684cb43dc7befa386258acb2d7fae7f67330ebb85ba4ea27938eb", size = 222469, upload_time = "2025-09-21T20:02:39.011Z" }, + { url = "https://files.pythonhosted.org/packages/49/a1/00164f6d30d8a01c3c9c48418a7a5be394de5349b421b9ee019f380df2a0/coverage-7.10.7-cp313-cp313t-win_arm64.whl", hash = "sha256:86b0e7308289ddde73d863b7683f596d8d21c7d8664ce1dee061d0bcf3fbb4bb", size = 220731, upload_time = "2025-09-21T20:02:40.939Z" }, + { url = "https://files.pythonhosted.org/packages/23/9c/5844ab4ca6a4dd97a1850e030a15ec7d292b5c5cb93082979225126e35dd/coverage-7.10.7-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:b06f260b16ead11643a5a9f955bd4b5fd76c1a4c6796aeade8520095b75de520", size = 218302, upload_time = "2025-09-21T20:02:42.527Z" }, + { url = "https://files.pythonhosted.org/packages/f0/89/673f6514b0961d1f0e20ddc242e9342f6da21eaba3489901b565c0689f34/coverage-7.10.7-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:212f8f2e0612778f09c55dd4872cb1f64a1f2b074393d139278ce902064d5b32", size = 218578, upload_time = "2025-09-21T20:02:44.468Z" }, + { url = "https://files.pythonhosted.org/packages/05/e8/261cae479e85232828fb17ad536765c88dd818c8470aca690b0ac6feeaa3/coverage-7.10.7-cp314-cp314-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:3445258bcded7d4aa630ab8296dea4d3f15a255588dd535f980c193ab6b95f3f", size = 249629, upload_time = "2025-09-21T20:02:46.503Z" }, + { url = "https://files.pythonhosted.org/packages/82/62/14ed6546d0207e6eda876434e3e8475a3e9adbe32110ce896c9e0c06bb9a/coverage-7.10.7-cp314-cp314-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:bb45474711ba385c46a0bfe696c695a929ae69ac636cda8f532be9e8c93d720a", size = 252162, upload_time = "2025-09-21T20:02:48.689Z" }, + { url = "https://files.pythonhosted.org/packages/ff/49/07f00db9ac6478e4358165a08fb41b469a1b053212e8a00cb02f0d27a05f/coverage-7.10.7-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:813922f35bd800dca9994c5971883cbc0d291128a5de6b167c7aa697fcf59360", size = 253517, upload_time = "2025-09-21T20:02:50.31Z" }, + { url = "https://files.pythonhosted.org/packages/a2/59/c5201c62dbf165dfbc91460f6dbbaa85a8b82cfa6131ac45d6c1bfb52deb/coverage-7.10.7-cp314-cp314-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:93c1b03552081b2a4423091d6fb3787265b8f86af404cff98d1b5342713bdd69", size = 249632, upload_time = "2025-09-21T20:02:51.971Z" }, + { url = "https://files.pythonhosted.org/packages/07/ae/5920097195291a51fb00b3a70b9bbd2edbfe3c84876a1762bd1ef1565ebc/coverage-7.10.7-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:cc87dd1b6eaf0b848eebb1c86469b9f72a1891cb42ac7adcfbce75eadb13dd14", size = 251520, upload_time = "2025-09-21T20:02:53.858Z" }, + { url = "https://files.pythonhosted.org/packages/b9/3c/a815dde77a2981f5743a60b63df31cb322c944843e57dbd579326625a413/coverage-7.10.7-cp314-cp314-musllinux_1_2_i686.whl", hash = "sha256:39508ffda4f343c35f3236fe8d1a6634a51f4581226a1262769d7f970e73bffe", size = 249455, upload_time = "2025-09-21T20:02:55.807Z" }, + { url = "https://files.pythonhosted.org/packages/aa/99/f5cdd8421ea656abefb6c0ce92556709db2265c41e8f9fc6c8ae0f7824c9/coverage-7.10.7-cp314-cp314-musllinux_1_2_riscv64.whl", hash = "sha256:925a1edf3d810537c5a3abe78ec5530160c5f9a26b1f4270b40e62cc79304a1e", size = 249287, upload_time = "2025-09-21T20:02:57.784Z" }, + { url = "https://files.pythonhosted.org/packages/c3/7a/e9a2da6a1fc5d007dd51fca083a663ab930a8c4d149c087732a5dbaa0029/coverage-7.10.7-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:2c8b9a0636f94c43cd3576811e05b89aa9bc2d0a85137affc544ae5cb0e4bfbd", size = 250946, upload_time = "2025-09-21T20:02:59.431Z" }, + { url = "https://files.pythonhosted.org/packages/ef/5b/0b5799aa30380a949005a353715095d6d1da81927d6dbed5def2200a4e25/coverage-7.10.7-cp314-cp314-win32.whl", hash = "sha256:b7b8288eb7cdd268b0304632da8cb0bb93fadcfec2fe5712f7b9cc8f4d487be2", size = 221009, upload_time = "2025-09-21T20:03:01.324Z" }, + { url = "https://files.pythonhosted.org/packages/da/b0/e802fbb6eb746de006490abc9bb554b708918b6774b722bb3a0e6aa1b7de/coverage-7.10.7-cp314-cp314-win_amd64.whl", hash = "sha256:1ca6db7c8807fb9e755d0379ccc39017ce0a84dcd26d14b5a03b78563776f681", size = 221804, upload_time = "2025-09-21T20:03:03.4Z" }, + { url = "https://files.pythonhosted.org/packages/9e/e8/71d0c8e374e31f39e3389bb0bd19e527d46f00ea8571ec7ec8fd261d8b44/coverage-7.10.7-cp314-cp314-win_arm64.whl", hash = "sha256:097c1591f5af4496226d5783d036bf6fd6cd0cbc132e071b33861de756efb880", size = 220384, upload_time = "2025-09-21T20:03:05.111Z" }, + { url = "https://files.pythonhosted.org/packages/62/09/9a5608d319fa3eba7a2019addeacb8c746fb50872b57a724c9f79f146969/coverage-7.10.7-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:a62c6ef0d50e6de320c270ff91d9dd0a05e7250cac2a800b7784bae474506e63", size = 219047, upload_time = "2025-09-21T20:03:06.795Z" }, + { url = "https://files.pythonhosted.org/packages/f5/6f/f58d46f33db9f2e3647b2d0764704548c184e6f5e014bef528b7f979ef84/coverage-7.10.7-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:9fa6e4dd51fe15d8738708a973470f67a855ca50002294852e9571cdbd9433f2", size = 219266, upload_time = "2025-09-21T20:03:08.495Z" }, + { url = "https://files.pythonhosted.org/packages/74/5c/183ffc817ba68e0b443b8c934c8795553eb0c14573813415bd59941ee165/coverage-7.10.7-cp314-cp314t-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:8fb190658865565c549b6b4706856d6a7b09302c797eb2cf8e7fe9dabb043f0d", size = 260767, upload_time = "2025-09-21T20:03:10.172Z" }, + { url = "https://files.pythonhosted.org/packages/0f/48/71a8abe9c1ad7e97548835e3cc1adbf361e743e9d60310c5f75c9e7bf847/coverage-7.10.7-cp314-cp314t-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:affef7c76a9ef259187ef31599a9260330e0335a3011732c4b9effa01e1cd6e0", size = 262931, upload_time = "2025-09-21T20:03:11.861Z" }, + { url = "https://files.pythonhosted.org/packages/84/fd/193a8fb132acfc0a901f72020e54be5e48021e1575bb327d8ee1097a28fd/coverage-7.10.7-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:6e16e07d85ca0cf8bafe5f5d23a0b850064e8e945d5677492b06bbe6f09cc699", size = 265186, upload_time = "2025-09-21T20:03:13.539Z" }, + { url = "https://files.pythonhosted.org/packages/b1/8f/74ecc30607dd95ad50e3034221113ccb1c6d4e8085cc761134782995daae/coverage-7.10.7-cp314-cp314t-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:03ffc58aacdf65d2a82bbeb1ffe4d01ead4017a21bfd0454983b88ca73af94b9", size = 259470, upload_time = "2025-09-21T20:03:15.584Z" }, + { url = "https://files.pythonhosted.org/packages/0f/55/79ff53a769f20d71b07023ea115c9167c0bb56f281320520cf64c5298a96/coverage-7.10.7-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:1b4fd784344d4e52647fd7857b2af5b3fbe6c239b0b5fa63e94eb67320770e0f", size = 262626, upload_time = "2025-09-21T20:03:17.673Z" }, + { url = "https://files.pythonhosted.org/packages/88/e2/dac66c140009b61ac3fc13af673a574b00c16efdf04f9b5c740703e953c0/coverage-7.10.7-cp314-cp314t-musllinux_1_2_i686.whl", hash = "sha256:0ebbaddb2c19b71912c6f2518e791aa8b9f054985a0769bdb3a53ebbc765c6a1", size = 260386, upload_time = "2025-09-21T20:03:19.36Z" }, + { url = "https://files.pythonhosted.org/packages/a2/f1/f48f645e3f33bb9ca8a496bc4a9671b52f2f353146233ebd7c1df6160440/coverage-7.10.7-cp314-cp314t-musllinux_1_2_riscv64.whl", hash = "sha256:a2d9a3b260cc1d1dbdb1c582e63ddcf5363426a1a68faa0f5da28d8ee3c722a0", size = 258852, upload_time = "2025-09-21T20:03:21.007Z" }, + { url = "https://files.pythonhosted.org/packages/bb/3b/8442618972c51a7affeead957995cfa8323c0c9bcf8fa5a027421f720ff4/coverage-7.10.7-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:a3cc8638b2480865eaa3926d192e64ce6c51e3d29c849e09d5b4ad95efae5399", size = 261534, upload_time = "2025-09-21T20:03:23.12Z" }, + { url = "https://files.pythonhosted.org/packages/b2/dc/101f3fa3a45146db0cb03f5b4376e24c0aac818309da23e2de0c75295a91/coverage-7.10.7-cp314-cp314t-win32.whl", hash = "sha256:67f8c5cbcd3deb7a60b3345dffc89a961a484ed0af1f6f73de91705cc6e31235", size = 221784, upload_time = "2025-09-21T20:03:24.769Z" }, + { url = "https://files.pythonhosted.org/packages/4c/a1/74c51803fc70a8a40d7346660379e144be772bab4ac7bb6e6b905152345c/coverage-7.10.7-cp314-cp314t-win_amd64.whl", hash = "sha256:e1ed71194ef6dea7ed2d5cb5f7243d4bcd334bfb63e59878519be558078f848d", size = 222905, upload_time = "2025-09-21T20:03:26.93Z" }, + { url = "https://files.pythonhosted.org/packages/12/65/f116a6d2127df30bcafbceef0302d8a64ba87488bf6f73a6d8eebf060873/coverage-7.10.7-cp314-cp314t-win_arm64.whl", hash = "sha256:7fe650342addd8524ca63d77b2362b02345e5f1a093266787d210c70a50b471a", size = 220922, upload_time = "2025-09-21T20:03:28.672Z" }, + { url = "https://files.pythonhosted.org/packages/a3/ad/d1c25053764b4c42eb294aae92ab617d2e4f803397f9c7c8295caa77a260/coverage-7.10.7-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:fff7b9c3f19957020cac546c70025331113d2e61537f6e2441bc7657913de7d3", size = 217978, upload_time = "2025-09-21T20:03:30.362Z" }, + { url = "https://files.pythonhosted.org/packages/52/2f/b9f9daa39b80ece0b9548bbb723381e29bc664822d9a12c2135f8922c22b/coverage-7.10.7-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:bc91b314cef27742da486d6839b677b3f2793dfe52b51bbbb7cf736d5c29281c", size = 218370, upload_time = "2025-09-21T20:03:32.147Z" }, + { url = "https://files.pythonhosted.org/packages/dd/6e/30d006c3b469e58449650642383dddf1c8fb63d44fdf92994bfd46570695/coverage-7.10.7-cp39-cp39-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:567f5c155eda8df1d3d439d40a45a6a5f029b429b06648235f1e7e51b522b396", size = 244802, upload_time = "2025-09-21T20:03:33.919Z" }, + { url = "https://files.pythonhosted.org/packages/b0/49/8a070782ce7e6b94ff6a0b6d7c65ba6bc3091d92a92cef4cd4eb0767965c/coverage-7.10.7-cp39-cp39-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:2af88deffcc8a4d5974cf2d502251bc3b2db8461f0b66d80a449c33757aa9f40", size = 246625, upload_time = "2025-09-21T20:03:36.09Z" }, + { url = "https://files.pythonhosted.org/packages/6a/92/1c1c5a9e8677ce56d42b97bdaca337b2d4d9ebe703d8c174ede52dbabd5f/coverage-7.10.7-cp39-cp39-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:c7315339eae3b24c2d2fa1ed7d7a38654cba34a13ef19fbcb9425da46d3dc594", size = 248399, upload_time = "2025-09-21T20:03:38.342Z" }, + { url = "https://files.pythonhosted.org/packages/c0/54/b140edee7257e815de7426d5d9846b58505dffc29795fff2dfb7f8a1c5a0/coverage-7.10.7-cp39-cp39-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:912e6ebc7a6e4adfdbb1aec371ad04c68854cd3bf3608b3514e7ff9062931d8a", size = 245142, upload_time = "2025-09-21T20:03:40.591Z" }, + { url = "https://files.pythonhosted.org/packages/e4/9e/6d6b8295940b118e8b7083b29226c71f6154f7ff41e9ca431f03de2eac0d/coverage-7.10.7-cp39-cp39-musllinux_1_2_aarch64.whl", hash = "sha256:f49a05acd3dfe1ce9715b657e28d138578bc40126760efb962322c56e9ca344b", size = 246284, upload_time = "2025-09-21T20:03:42.355Z" }, + { url = "https://files.pythonhosted.org/packages/db/e5/5e957ca747d43dbe4d9714358375c7546cb3cb533007b6813fc20fce37ad/coverage-7.10.7-cp39-cp39-musllinux_1_2_i686.whl", hash = "sha256:cce2109b6219f22ece99db7644b9622f54a4e915dad65660ec435e89a3ea7cc3", size = 244353, upload_time = "2025-09-21T20:03:44.218Z" }, + { url = "https://files.pythonhosted.org/packages/9a/45/540fc5cc92536a1b783b7ef99450bd55a4b3af234aae35a18a339973ce30/coverage-7.10.7-cp39-cp39-musllinux_1_2_riscv64.whl", hash = "sha256:f3c887f96407cea3916294046fc7dab611c2552beadbed4ea901cbc6a40cc7a0", size = 244430, upload_time = "2025-09-21T20:03:46.065Z" }, + { url = "https://files.pythonhosted.org/packages/75/0b/8287b2e5b38c8fe15d7e3398849bb58d382aedc0864ea0fa1820e8630491/coverage-7.10.7-cp39-cp39-musllinux_1_2_x86_64.whl", hash = "sha256:635adb9a4507c9fd2ed65f39693fa31c9a3ee3a8e6dc64df033e8fdf52a7003f", size = 245311, upload_time = "2025-09-21T20:03:48.19Z" }, + { url = "https://files.pythonhosted.org/packages/0c/1d/29724999984740f0c86d03e6420b942439bf5bd7f54d4382cae386a9d1e9/coverage-7.10.7-cp39-cp39-win32.whl", hash = "sha256:5a02d5a850e2979b0a014c412573953995174743a3f7fa4ea5a6e9a3c5617431", size = 220500, upload_time = "2025-09-21T20:03:50.024Z" }, + { url = "https://files.pythonhosted.org/packages/43/11/4b1e6b129943f905ca54c339f343877b55b365ae2558806c1be4f7476ed5/coverage-7.10.7-cp39-cp39-win_amd64.whl", hash = "sha256:c134869d5ffe34547d14e174c866fd8fe2254918cc0a95e99052903bc1543e07", size = 221408, upload_time = "2025-09-21T20:03:51.803Z" }, + { url = "https://files.pythonhosted.org/packages/ec/16/114df1c291c22cac3b0c127a73e0af5c12ed7bbb6558d310429a0ae24023/coverage-7.10.7-py3-none-any.whl", hash = "sha256:f7941f6f2fe6dd6807a1208737b8a0cbcf1cc6d7b07d24998ad2d63590868260", size = 209952, upload_time = "2025-09-21T20:03:53.918Z" }, +] + +[package.optional-dependencies] +toml = [ + { name = "tomli", marker = "python_full_version == '3.9.*'" }, +] + +[[package]] +name = "coverage" +version = "7.12.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.10'", +] +sdist = { url = "https://files.pythonhosted.org/packages/89/26/4a96807b193b011588099c3b5c89fbb05294e5b90e71018e065465f34eb6/coverage-7.12.0.tar.gz", hash = "sha256:fc11e0a4e372cb5f282f16ef90d4a585034050ccda536451901abfb19a57f40c", size = 819341, upload_time = "2025-11-18T13:34:20.766Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/26/4a/0dc3de1c172d35abe512332cfdcc43211b6ebce629e4cc42e6cd25ed8f4d/coverage-7.12.0-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:32b75c2ba3f324ee37af3ccee5b30458038c50b349ad9b88cee85096132a575b", size = 217409, upload_time = "2025-11-18T13:31:53.122Z" }, + { url = "https://files.pythonhosted.org/packages/01/c3/086198b98db0109ad4f84241e8e9ea7e5fb2db8c8ffb787162d40c26cc76/coverage-7.12.0-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:cb2a1b6ab9fe833714a483a915de350abc624a37149649297624c8d57add089c", size = 217927, upload_time = "2025-11-18T13:31:54.458Z" }, + { url = "https://files.pythonhosted.org/packages/5d/5f/34614dbf5ce0420828fc6c6f915126a0fcb01e25d16cf141bf5361e6aea6/coverage-7.12.0-cp310-cp310-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:5734b5d913c3755e72f70bf6cc37a0518d4f4745cde760c5d8e12005e62f9832", size = 244678, upload_time = "2025-11-18T13:31:55.805Z" }, + { url = "https://files.pythonhosted.org/packages/55/7b/6b26fb32e8e4a6989ac1d40c4e132b14556131493b1d06bc0f2be169c357/coverage-7.12.0-cp310-cp310-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:b527a08cdf15753279b7afb2339a12073620b761d79b81cbe2cdebdb43d90daa", size = 246507, upload_time = "2025-11-18T13:31:57.05Z" }, + { url = "https://files.pythonhosted.org/packages/06/42/7d70e6603d3260199b90fb48b537ca29ac183d524a65cc31366b2e905fad/coverage-7.12.0-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:9bb44c889fb68004e94cab71f6a021ec83eac9aeabdbb5a5a88821ec46e1da73", size = 248366, upload_time = "2025-11-18T13:31:58.362Z" }, + { url = "https://files.pythonhosted.org/packages/2d/4a/d86b837923878424c72458c5b25e899a3c5ca73e663082a915f5b3c4d749/coverage-7.12.0-cp310-cp310-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:4b59b501455535e2e5dde5881739897967b272ba25988c89145c12d772810ccb", size = 245366, upload_time = "2025-11-18T13:31:59.572Z" }, + { url = "https://files.pythonhosted.org/packages/e6/c2/2adec557e0aa9721875f06ced19730fdb7fc58e31b02b5aa56f2ebe4944d/coverage-7.12.0-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:d8842f17095b9868a05837b7b1b73495293091bed870e099521ada176aa3e00e", size = 246408, upload_time = "2025-11-18T13:32:00.784Z" }, + { url = "https://files.pythonhosted.org/packages/5a/4b/8bd1f1148260df11c618e535fdccd1e5aaf646e55b50759006a4f41d8a26/coverage-7.12.0-cp310-cp310-musllinux_1_2_i686.whl", hash = "sha256:c5a6f20bf48b8866095c6820641e7ffbe23f2ac84a2efc218d91235e404c7777", size = 244416, upload_time = "2025-11-18T13:32:01.963Z" }, + { url = "https://files.pythonhosted.org/packages/0e/13/3a248dd6a83df90414c54a4e121fd081fb20602ca43955fbe1d60e2312a9/coverage-7.12.0-cp310-cp310-musllinux_1_2_riscv64.whl", hash = "sha256:5f3738279524e988d9da2893f307c2093815c623f8d05a8f79e3eff3a7a9e553", size = 244681, upload_time = "2025-11-18T13:32:03.408Z" }, + { url = "https://files.pythonhosted.org/packages/76/30/aa833827465a5e8c938935f5d91ba055f70516941078a703740aaf1aa41f/coverage-7.12.0-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:e0d68c1f7eabbc8abe582d11fa393ea483caf4f44b0af86881174769f185c94d", size = 245300, upload_time = "2025-11-18T13:32:04.686Z" }, + { url = "https://files.pythonhosted.org/packages/38/24/f85b3843af1370fb3739fa7571819b71243daa311289b31214fe3e8c9d68/coverage-7.12.0-cp310-cp310-win32.whl", hash = "sha256:7670d860e18b1e3ee5930b17a7d55ae6287ec6e55d9799982aa103a2cc1fa2ef", size = 220008, upload_time = "2025-11-18T13:32:05.806Z" }, + { url = "https://files.pythonhosted.org/packages/3a/a2/c7da5b9566f7164db9eefa133d17761ecb2c2fde9385d754e5b5c80f710d/coverage-7.12.0-cp310-cp310-win_amd64.whl", hash = "sha256:f999813dddeb2a56aab5841e687b68169da0d3f6fc78ccf50952fa2463746022", size = 220943, upload_time = "2025-11-18T13:32:07.166Z" }, + { url = "https://files.pythonhosted.org/packages/5a/0c/0dfe7f0487477d96432e4815537263363fb6dd7289743a796e8e51eabdf2/coverage-7.12.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:aa124a3683d2af98bd9d9c2bfa7a5076ca7e5ab09fdb96b81fa7d89376ae928f", size = 217535, upload_time = "2025-11-18T13:32:08.812Z" }, + { url = "https://files.pythonhosted.org/packages/9b/f5/f9a4a053a5bbff023d3bec259faac8f11a1e5a6479c2ccf586f910d8dac7/coverage-7.12.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:d93fbf446c31c0140208dcd07c5d882029832e8ed7891a39d6d44bd65f2316c3", size = 218044, upload_time = "2025-11-18T13:32:10.329Z" }, + { url = "https://files.pythonhosted.org/packages/95/c5/84fc3697c1fa10cd8571919bf9693f693b7373278daaf3b73e328d502bc8/coverage-7.12.0-cp311-cp311-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:52ca620260bd8cd6027317bdd8b8ba929be1d741764ee765b42c4d79a408601e", size = 248440, upload_time = "2025-11-18T13:32:12.536Z" }, + { url = "https://files.pythonhosted.org/packages/f4/36/2d93fbf6a04670f3874aed397d5a5371948a076e3249244a9e84fb0e02d6/coverage-7.12.0-cp311-cp311-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:f3433ffd541380f3a0e423cff0f4926d55b0cc8c1d160fdc3be24a4c03aa65f7", size = 250361, upload_time = "2025-11-18T13:32:13.852Z" }, + { url = "https://files.pythonhosted.org/packages/5d/49/66dc65cc456a6bfc41ea3d0758c4afeaa4068a2b2931bf83be6894cf1058/coverage-7.12.0-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:f7bbb321d4adc9f65e402c677cd1c8e4c2d0105d3ce285b51b4d87f1d5db5245", size = 252472, upload_time = "2025-11-18T13:32:15.068Z" }, + { url = "https://files.pythonhosted.org/packages/35/1f/ebb8a18dffd406db9fcd4b3ae42254aedcaf612470e8712f12041325930f/coverage-7.12.0-cp311-cp311-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:22a7aade354a72dff3b59c577bfd18d6945c61f97393bc5fb7bd293a4237024b", size = 248592, upload_time = "2025-11-18T13:32:16.328Z" }, + { url = "https://files.pythonhosted.org/packages/da/a8/67f213c06e5ea3b3d4980df7dc344d7fea88240b5fe878a5dcbdfe0e2315/coverage-7.12.0-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:3ff651dcd36d2fea66877cd4a82de478004c59b849945446acb5baf9379a1b64", size = 250167, upload_time = "2025-11-18T13:32:17.687Z" }, + { url = "https://files.pythonhosted.org/packages/f0/00/e52aef68154164ea40cc8389c120c314c747fe63a04b013a5782e989b77f/coverage-7.12.0-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:31b8b2e38391a56e3cea39d22a23faaa7c3fc911751756ef6d2621d2a9daf742", size = 248238, upload_time = "2025-11-18T13:32:19.2Z" }, + { url = "https://files.pythonhosted.org/packages/1f/a4/4d88750bcf9d6d66f77865e5a05a20e14db44074c25fd22519777cb69025/coverage-7.12.0-cp311-cp311-musllinux_1_2_riscv64.whl", hash = "sha256:297bc2da28440f5ae51c845a47c8175a4db0553a53827886e4fb25c66633000c", size = 247964, upload_time = "2025-11-18T13:32:21.027Z" }, + { url = "https://files.pythonhosted.org/packages/a7/6b/b74693158899d5b47b0bf6238d2c6722e20ba749f86b74454fac0696bb00/coverage-7.12.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:6ff7651cc01a246908eac162a6a86fc0dbab6de1ad165dfb9a1e2ec660b44984", size = 248862, upload_time = "2025-11-18T13:32:22.304Z" }, + { url = "https://files.pythonhosted.org/packages/18/de/6af6730227ce0e8ade307b1cc4a08e7f51b419a78d02083a86c04ccceb29/coverage-7.12.0-cp311-cp311-win32.whl", hash = "sha256:313672140638b6ddb2c6455ddeda41c6a0b208298034544cfca138978c6baed6", size = 220033, upload_time = "2025-11-18T13:32:23.714Z" }, + { url = "https://files.pythonhosted.org/packages/e2/a1/e7f63021a7c4fe20994359fcdeae43cbef4a4d0ca36a5a1639feeea5d9e1/coverage-7.12.0-cp311-cp311-win_amd64.whl", hash = "sha256:a1783ed5bd0d5938d4435014626568dc7f93e3cb99bc59188cc18857c47aa3c4", size = 220966, upload_time = "2025-11-18T13:32:25.599Z" }, + { url = "https://files.pythonhosted.org/packages/77/e8/deae26453f37c20c3aa0c4433a1e32cdc169bf415cce223a693117aa3ddd/coverage-7.12.0-cp311-cp311-win_arm64.whl", hash = "sha256:4648158fd8dd9381b5847622df1c90ff314efbfc1df4550092ab6013c238a5fc", size = 219637, upload_time = "2025-11-18T13:32:27.265Z" }, + { url = "https://files.pythonhosted.org/packages/02/bf/638c0427c0f0d47638242e2438127f3c8ee3cfc06c7fdeb16778ed47f836/coverage-7.12.0-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:29644c928772c78512b48e14156b81255000dcfd4817574ff69def189bcb3647", size = 217704, upload_time = "2025-11-18T13:32:28.906Z" }, + { url = "https://files.pythonhosted.org/packages/08/e1/706fae6692a66c2d6b871a608bbde0da6281903fa0e9f53a39ed441da36a/coverage-7.12.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:8638cbb002eaa5d7c8d04da667813ce1067080b9a91099801a0053086e52b736", size = 218064, upload_time = "2025-11-18T13:32:30.161Z" }, + { url = "https://files.pythonhosted.org/packages/a9/8b/eb0231d0540f8af3ffda39720ff43cb91926489d01524e68f60e961366e4/coverage-7.12.0-cp312-cp312-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:083631eeff5eb9992c923e14b810a179798bb598e6a0dd60586819fc23be6e60", size = 249560, upload_time = "2025-11-18T13:32:31.835Z" }, + { url = "https://files.pythonhosted.org/packages/e9/a1/67fb52af642e974d159b5b379e4d4c59d0ebe1288677fbd04bbffe665a82/coverage-7.12.0-cp312-cp312-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:99d5415c73ca12d558e07776bd957c4222c687b9f1d26fa0e1b57e3598bdcde8", size = 252318, upload_time = "2025-11-18T13:32:33.178Z" }, + { url = "https://files.pythonhosted.org/packages/41/e5/38228f31b2c7665ebf9bdfdddd7a184d56450755c7e43ac721c11a4b8dab/coverage-7.12.0-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:e949ebf60c717c3df63adb4a1a366c096c8d7fd8472608cd09359e1bd48ef59f", size = 253403, upload_time = "2025-11-18T13:32:34.45Z" }, + { url = "https://files.pythonhosted.org/packages/ec/4b/df78e4c8188f9960684267c5a4897836f3f0f20a20c51606ee778a1d9749/coverage-7.12.0-cp312-cp312-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:6d907ddccbca819afa2cd014bc69983b146cca2735a0b1e6259b2a6c10be1e70", size = 249984, upload_time = "2025-11-18T13:32:35.747Z" }, + { url = "https://files.pythonhosted.org/packages/ba/51/bb163933d195a345c6f63eab9e55743413d064c291b6220df754075c2769/coverage-7.12.0-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:b1518ecbad4e6173f4c6e6c4a46e49555ea5679bf3feda5edb1b935c7c44e8a0", size = 251339, upload_time = "2025-11-18T13:32:37.352Z" }, + { url = "https://files.pythonhosted.org/packages/15/40/c9b29cdb8412c837cdcbc2cfa054547dd83affe6cbbd4ce4fdb92b6ba7d1/coverage-7.12.0-cp312-cp312-musllinux_1_2_i686.whl", hash = "sha256:51777647a749abdf6f6fd8c7cffab12de68ab93aab15efc72fbbb83036c2a068", size = 249489, upload_time = "2025-11-18T13:32:39.212Z" }, + { url = "https://files.pythonhosted.org/packages/c8/da/b3131e20ba07a0de4437a50ef3b47840dfabf9293675b0cd5c2c7f66dd61/coverage-7.12.0-cp312-cp312-musllinux_1_2_riscv64.whl", hash = "sha256:42435d46d6461a3b305cdfcad7cdd3248787771f53fe18305548cba474e6523b", size = 249070, upload_time = "2025-11-18T13:32:40.598Z" }, + { url = "https://files.pythonhosted.org/packages/70/81/b653329b5f6302c08d683ceff6785bc60a34be9ae92a5c7b63ee7ee7acec/coverage-7.12.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:5bcead88c8423e1855e64b8057d0544e33e4080b95b240c2a355334bb7ced937", size = 250929, upload_time = "2025-11-18T13:32:42.915Z" }, + { url = "https://files.pythonhosted.org/packages/a3/00/250ac3bca9f252a5fb1338b5ad01331ebb7b40223f72bef5b1b2cb03aa64/coverage-7.12.0-cp312-cp312-win32.whl", hash = "sha256:dcbb630ab034e86d2a0f79aefd2be07e583202f41e037602d438c80044957baa", size = 220241, upload_time = "2025-11-18T13:32:44.665Z" }, + { url = "https://files.pythonhosted.org/packages/64/1c/77e79e76d37ce83302f6c21980b45e09f8aa4551965213a10e62d71ce0ab/coverage-7.12.0-cp312-cp312-win_amd64.whl", hash = "sha256:2fd8354ed5d69775ac42986a691fbf68b4084278710cee9d7c3eaa0c28fa982a", size = 221051, upload_time = "2025-11-18T13:32:46.008Z" }, + { url = "https://files.pythonhosted.org/packages/31/f5/641b8a25baae564f9e52cac0e2667b123de961985709a004e287ee7663cc/coverage-7.12.0-cp312-cp312-win_arm64.whl", hash = "sha256:737c3814903be30695b2de20d22bcc5428fdae305c61ba44cdc8b3252984c49c", size = 219692, upload_time = "2025-11-18T13:32:47.372Z" }, + { url = "https://files.pythonhosted.org/packages/b8/14/771700b4048774e48d2c54ed0c674273702713c9ee7acdfede40c2666747/coverage-7.12.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:47324fffca8d8eae7e185b5bb20c14645f23350f870c1649003618ea91a78941", size = 217725, upload_time = "2025-11-18T13:32:49.22Z" }, + { url = "https://files.pythonhosted.org/packages/17/a7/3aa4144d3bcb719bf67b22d2d51c2d577bf801498c13cb08f64173e80497/coverage-7.12.0-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:ccf3b2ede91decd2fb53ec73c1f949c3e034129d1e0b07798ff1d02ea0c8fa4a", size = 218098, upload_time = "2025-11-18T13:32:50.78Z" }, + { url = "https://files.pythonhosted.org/packages/fc/9c/b846bbc774ff81091a12a10203e70562c91ae71badda00c5ae5b613527b1/coverage-7.12.0-cp313-cp313-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:b365adc70a6936c6b0582dc38746b33b2454148c02349345412c6e743efb646d", size = 249093, upload_time = "2025-11-18T13:32:52.554Z" }, + { url = "https://files.pythonhosted.org/packages/76/b6/67d7c0e1f400b32c883e9342de4a8c2ae7c1a0b57c5de87622b7262e2309/coverage-7.12.0-cp313-cp313-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:bc13baf85cd8a4cfcf4a35c7bc9d795837ad809775f782f697bf630b7e200211", size = 251686, upload_time = "2025-11-18T13:32:54.862Z" }, + { url = "https://files.pythonhosted.org/packages/cc/75/b095bd4b39d49c3be4bffbb3135fea18a99a431c52dd7513637c0762fecb/coverage-7.12.0-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:099d11698385d572ceafb3288a5b80fe1fc58bf665b3f9d362389de488361d3d", size = 252930, upload_time = "2025-11-18T13:32:56.417Z" }, + { url = "https://files.pythonhosted.org/packages/6e/f3/466f63015c7c80550bead3093aacabf5380c1220a2a93c35d374cae8f762/coverage-7.12.0-cp313-cp313-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:473dc45d69694069adb7680c405fb1e81f60b2aff42c81e2f2c3feaf544d878c", size = 249296, upload_time = "2025-11-18T13:32:58.074Z" }, + { url = "https://files.pythonhosted.org/packages/27/86/eba2209bf2b7e28c68698fc13437519a295b2d228ba9e0ec91673e09fa92/coverage-7.12.0-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:583f9adbefd278e9de33c33d6846aa8f5d164fa49b47144180a0e037f0688bb9", size = 251068, upload_time = "2025-11-18T13:32:59.646Z" }, + { url = "https://files.pythonhosted.org/packages/ec/55/ca8ae7dbba962a3351f18940b359b94c6bafdd7757945fdc79ec9e452dc7/coverage-7.12.0-cp313-cp313-musllinux_1_2_i686.whl", hash = "sha256:b2089cc445f2dc0af6f801f0d1355c025b76c24481935303cf1af28f636688f0", size = 249034, upload_time = "2025-11-18T13:33:01.481Z" }, + { url = "https://files.pythonhosted.org/packages/7a/d7/39136149325cad92d420b023b5fd900dabdd1c3a0d1d5f148ef4a8cedef5/coverage-7.12.0-cp313-cp313-musllinux_1_2_riscv64.whl", hash = "sha256:950411f1eb5d579999c5f66c62a40961f126fc71e5e14419f004471957b51508", size = 248853, upload_time = "2025-11-18T13:33:02.935Z" }, + { url = "https://files.pythonhosted.org/packages/fe/b6/76e1add8b87ef60e00643b0b7f8f7bb73d4bf5249a3be19ebefc5793dd25/coverage-7.12.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:b1aab7302a87bafebfe76b12af681b56ff446dc6f32ed178ff9c092ca776e6bc", size = 250619, upload_time = "2025-11-18T13:33:04.336Z" }, + { url = "https://files.pythonhosted.org/packages/95/87/924c6dc64f9203f7a3c1832a6a0eee5a8335dbe5f1bdadcc278d6f1b4d74/coverage-7.12.0-cp313-cp313-win32.whl", hash = "sha256:d7e0d0303c13b54db495eb636bc2465b2fb8475d4c8bcec8fe4b5ca454dfbae8", size = 220261, upload_time = "2025-11-18T13:33:06.493Z" }, + { url = "https://files.pythonhosted.org/packages/91/77/dd4aff9af16ff776bf355a24d87eeb48fc6acde54c907cc1ea89b14a8804/coverage-7.12.0-cp313-cp313-win_amd64.whl", hash = "sha256:ce61969812d6a98a981d147d9ac583a36ac7db7766f2e64a9d4d059c2fe29d07", size = 221072, upload_time = "2025-11-18T13:33:07.926Z" }, + { url = "https://files.pythonhosted.org/packages/70/49/5c9dc46205fef31b1b226a6e16513193715290584317fd4df91cdaf28b22/coverage-7.12.0-cp313-cp313-win_arm64.whl", hash = "sha256:bcec6f47e4cb8a4c2dc91ce507f6eefc6a1b10f58df32cdc61dff65455031dfc", size = 219702, upload_time = "2025-11-18T13:33:09.631Z" }, + { url = "https://files.pythonhosted.org/packages/9b/62/f87922641c7198667994dd472a91e1d9b829c95d6c29529ceb52132436ad/coverage-7.12.0-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:459443346509476170d553035e4a3eed7b860f4fe5242f02de1010501956ce87", size = 218420, upload_time = "2025-11-18T13:33:11.153Z" }, + { url = "https://files.pythonhosted.org/packages/85/dd/1cc13b2395ef15dbb27d7370a2509b4aee77890a464fb35d72d428f84871/coverage-7.12.0-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:04a79245ab2b7a61688958f7a855275997134bc84f4a03bc240cf64ff132abf6", size = 218773, upload_time = "2025-11-18T13:33:12.569Z" }, + { url = "https://files.pythonhosted.org/packages/74/40/35773cc4bb1e9d4658d4fb669eb4195b3151bef3bbd6f866aba5cd5dac82/coverage-7.12.0-cp313-cp313t-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:09a86acaaa8455f13d6a99221d9654df249b33937b4e212b4e5a822065f12aa7", size = 260078, upload_time = "2025-11-18T13:33:14.037Z" }, + { url = "https://files.pythonhosted.org/packages/ec/ee/231bb1a6ffc2905e396557585ebc6bdc559e7c66708376d245a1f1d330fc/coverage-7.12.0-cp313-cp313t-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:907e0df1b71ba77463687a74149c6122c3f6aac56c2510a5d906b2f368208560", size = 262144, upload_time = "2025-11-18T13:33:15.601Z" }, + { url = "https://files.pythonhosted.org/packages/28/be/32f4aa9f3bf0b56f3971001b56508352c7753915345d45fab4296a986f01/coverage-7.12.0-cp313-cp313t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:9b57e2d0ddd5f0582bae5437c04ee71c46cd908e7bc5d4d0391f9a41e812dd12", size = 264574, upload_time = "2025-11-18T13:33:17.354Z" }, + { url = "https://files.pythonhosted.org/packages/68/7c/00489fcbc2245d13ab12189b977e0cf06ff3351cb98bc6beba8bd68c5902/coverage-7.12.0-cp313-cp313t-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:58c1c6aa677f3a1411fe6fb28ec3a942e4f665df036a3608816e0847fad23296", size = 259298, upload_time = "2025-11-18T13:33:18.958Z" }, + { url = "https://files.pythonhosted.org/packages/96/b4/f0760d65d56c3bea95b449e02570d4abd2549dc784bf39a2d4721a2d8ceb/coverage-7.12.0-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:4c589361263ab2953e3c4cd2a94db94c4ad4a8e572776ecfbad2389c626e4507", size = 262150, upload_time = "2025-11-18T13:33:20.644Z" }, + { url = "https://files.pythonhosted.org/packages/c5/71/9a9314df00f9326d78c1e5a910f520d599205907432d90d1c1b7a97aa4b1/coverage-7.12.0-cp313-cp313t-musllinux_1_2_i686.whl", hash = "sha256:91b810a163ccad2e43b1faa11d70d3cf4b6f3d83f9fd5f2df82a32d47b648e0d", size = 259763, upload_time = "2025-11-18T13:33:22.189Z" }, + { url = "https://files.pythonhosted.org/packages/10/34/01a0aceed13fbdf925876b9a15d50862eb8845454301fe3cdd1df08b2182/coverage-7.12.0-cp313-cp313t-musllinux_1_2_riscv64.whl", hash = "sha256:40c867af715f22592e0d0fb533a33a71ec9e0f73a6945f722a0c85c8c1cbe3a2", size = 258653, upload_time = "2025-11-18T13:33:24.239Z" }, + { url = "https://files.pythonhosted.org/packages/8d/04/81d8fd64928acf1574bbb0181f66901c6c1c6279c8ccf5f84259d2c68ae9/coverage-7.12.0-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:68b0d0a2d84f333de875666259dadf28cc67858bc8fd8b3f1eae84d3c2bec455", size = 260856, upload_time = "2025-11-18T13:33:26.365Z" }, + { url = "https://files.pythonhosted.org/packages/f2/76/fa2a37bfaeaf1f766a2d2360a25a5297d4fb567098112f6517475eee120b/coverage-7.12.0-cp313-cp313t-win32.whl", hash = "sha256:73f9e7fbd51a221818fd11b7090eaa835a353ddd59c236c57b2199486b116c6d", size = 220936, upload_time = "2025-11-18T13:33:28.165Z" }, + { url = "https://files.pythonhosted.org/packages/f9/52/60f64d932d555102611c366afb0eb434b34266b1d9266fc2fe18ab641c47/coverage-7.12.0-cp313-cp313t-win_amd64.whl", hash = "sha256:24cff9d1f5743f67db7ba46ff284018a6e9aeb649b67aa1e70c396aa1b7cb23c", size = 222001, upload_time = "2025-11-18T13:33:29.656Z" }, + { url = "https://files.pythonhosted.org/packages/77/df/c303164154a5a3aea7472bf323b7c857fed93b26618ed9fc5c2955566bb0/coverage-7.12.0-cp313-cp313t-win_arm64.whl", hash = "sha256:c87395744f5c77c866d0f5a43d97cc39e17c7f1cb0115e54a2fe67ca75c5d14d", size = 220273, upload_time = "2025-11-18T13:33:31.415Z" }, + { url = "https://files.pythonhosted.org/packages/bf/2e/fc12db0883478d6e12bbd62d481210f0c8daf036102aa11434a0c5755825/coverage-7.12.0-cp314-cp314-macosx_10_15_x86_64.whl", hash = "sha256:a1c59b7dc169809a88b21a936eccf71c3895a78f5592051b1af8f4d59c2b4f92", size = 217777, upload_time = "2025-11-18T13:33:32.86Z" }, + { url = "https://files.pythonhosted.org/packages/1f/c1/ce3e525d223350c6ec16b9be8a057623f54226ef7f4c2fee361ebb6a02b8/coverage-7.12.0-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:8787b0f982e020adb732b9f051f3e49dd5054cebbc3f3432061278512a2b1360", size = 218100, upload_time = "2025-11-18T13:33:34.532Z" }, + { url = "https://files.pythonhosted.org/packages/15/87/113757441504aee3808cb422990ed7c8bcc2d53a6779c66c5adef0942939/coverage-7.12.0-cp314-cp314-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:5ea5a9f7dc8877455b13dd1effd3202e0bca72f6f3ab09f9036b1bcf728f69ac", size = 249151, upload_time = "2025-11-18T13:33:36.135Z" }, + { url = "https://files.pythonhosted.org/packages/d9/1d/9529d9bd44049b6b05bb319c03a3a7e4b0a8a802d28fa348ad407e10706d/coverage-7.12.0-cp314-cp314-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:fdba9f15849534594f60b47c9a30bc70409b54947319a7c4fd0e8e3d8d2f355d", size = 251667, upload_time = "2025-11-18T13:33:37.996Z" }, + { url = "https://files.pythonhosted.org/packages/11/bb/567e751c41e9c03dc29d3ce74b8c89a1e3396313e34f255a2a2e8b9ebb56/coverage-7.12.0-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:a00594770eb715854fb1c57e0dea08cce6720cfbc531accdb9850d7c7770396c", size = 253003, upload_time = "2025-11-18T13:33:39.553Z" }, + { url = "https://files.pythonhosted.org/packages/e4/b3/c2cce2d8526a02fb9e9ca14a263ca6fc074449b33a6afa4892838c903528/coverage-7.12.0-cp314-cp314-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:5560c7e0d82b42eb1951e4f68f071f8017c824ebfd5a6ebe42c60ac16c6c2434", size = 249185, upload_time = "2025-11-18T13:33:42.086Z" }, + { url = "https://files.pythonhosted.org/packages/0e/a7/967f93bb66e82c9113c66a8d0b65ecf72fc865adfba5a145f50c7af7e58d/coverage-7.12.0-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:d6c2e26b481c9159c2773a37947a9718cfdc58893029cdfb177531793e375cfc", size = 251025, upload_time = "2025-11-18T13:33:43.634Z" }, + { url = "https://files.pythonhosted.org/packages/b9/b2/f2f6f56337bc1af465d5b2dc1ee7ee2141b8b9272f3bf6213fcbc309a836/coverage-7.12.0-cp314-cp314-musllinux_1_2_i686.whl", hash = "sha256:6e1a8c066dabcde56d5d9fed6a66bc19a2883a3fe051f0c397a41fc42aedd4cc", size = 248979, upload_time = "2025-11-18T13:33:46.04Z" }, + { url = "https://files.pythonhosted.org/packages/f4/7a/bf4209f45a4aec09d10a01a57313a46c0e0e8f4c55ff2965467d41a92036/coverage-7.12.0-cp314-cp314-musllinux_1_2_riscv64.whl", hash = "sha256:f7ba9da4726e446d8dd8aae5a6cd872511184a5d861de80a86ef970b5dacce3e", size = 248800, upload_time = "2025-11-18T13:33:47.546Z" }, + { url = "https://files.pythonhosted.org/packages/b8/b7/1e01b8696fb0521810f60c5bbebf699100d6754183e6cc0679bf2ed76531/coverage-7.12.0-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:e0f483ab4f749039894abaf80c2f9e7ed77bbf3c737517fb88c8e8e305896a17", size = 250460, upload_time = "2025-11-18T13:33:49.537Z" }, + { url = "https://files.pythonhosted.org/packages/71/ae/84324fb9cb46c024760e706353d9b771a81b398d117d8c1fe010391c186f/coverage-7.12.0-cp314-cp314-win32.whl", hash = "sha256:76336c19a9ef4a94b2f8dc79f8ac2da3f193f625bb5d6f51a328cd19bfc19933", size = 220533, upload_time = "2025-11-18T13:33:51.16Z" }, + { url = "https://files.pythonhosted.org/packages/e2/71/1033629deb8460a8f97f83e6ac4ca3b93952e2b6f826056684df8275e015/coverage-7.12.0-cp314-cp314-win_amd64.whl", hash = "sha256:7c1059b600aec6ef090721f8f633f60ed70afaffe8ecab85b59df748f24b31fe", size = 221348, upload_time = "2025-11-18T13:33:52.776Z" }, + { url = "https://files.pythonhosted.org/packages/0a/5f/ac8107a902f623b0c251abdb749be282dc2ab61854a8a4fcf49e276fce2f/coverage-7.12.0-cp314-cp314-win_arm64.whl", hash = "sha256:172cf3a34bfef42611963e2b661302a8931f44df31629e5b1050567d6b90287d", size = 219922, upload_time = "2025-11-18T13:33:54.316Z" }, + { url = "https://files.pythonhosted.org/packages/79/6e/f27af2d4da367f16077d21ef6fe796c874408219fa6dd3f3efe7751bd910/coverage-7.12.0-cp314-cp314t-macosx_10_15_x86_64.whl", hash = "sha256:aa7d48520a32cb21c7a9b31f81799e8eaec7239db36c3b670be0fa2403828d1d", size = 218511, upload_time = "2025-11-18T13:33:56.343Z" }, + { url = "https://files.pythonhosted.org/packages/67/dd/65fd874aa460c30da78f9d259400d8e6a4ef457d61ab052fd248f0050558/coverage-7.12.0-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:90d58ac63bc85e0fb919f14d09d6caa63f35a5512a2205284b7816cafd21bb03", size = 218771, upload_time = "2025-11-18T13:33:57.966Z" }, + { url = "https://files.pythonhosted.org/packages/55/e0/7c6b71d327d8068cb79c05f8f45bf1b6145f7a0de23bbebe63578fe5240a/coverage-7.12.0-cp314-cp314t-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:ca8ecfa283764fdda3eae1bdb6afe58bf78c2c3ec2b2edcb05a671f0bba7b3f9", size = 260151, upload_time = "2025-11-18T13:33:59.597Z" }, + { url = "https://files.pythonhosted.org/packages/49/ce/4697457d58285b7200de6b46d606ea71066c6e674571a946a6ea908fb588/coverage-7.12.0-cp314-cp314t-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:874fe69a0785d96bd066059cd4368022cebbec1a8958f224f0016979183916e6", size = 262257, upload_time = "2025-11-18T13:34:01.166Z" }, + { url = "https://files.pythonhosted.org/packages/2f/33/acbc6e447aee4ceba88c15528dbe04a35fb4d67b59d393d2e0d6f1e242c1/coverage-7.12.0-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:5b3c889c0b8b283a24d721a9eabc8ccafcfc3aebf167e4cd0d0e23bf8ec4e339", size = 264671, upload_time = "2025-11-18T13:34:02.795Z" }, + { url = "https://files.pythonhosted.org/packages/87/ec/e2822a795c1ed44d569980097be839c5e734d4c0c1119ef8e0a073496a30/coverage-7.12.0-cp314-cp314t-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:8bb5b894b3ec09dcd6d3743229dc7f2c42ef7787dc40596ae04c0edda487371e", size = 259231, upload_time = "2025-11-18T13:34:04.397Z" }, + { url = "https://files.pythonhosted.org/packages/72/c5/a7ec5395bb4a49c9b7ad97e63f0c92f6bf4a9e006b1393555a02dae75f16/coverage-7.12.0-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:79a44421cd5fba96aa57b5e3b5a4d3274c449d4c622e8f76882d76635501fd13", size = 262137, upload_time = "2025-11-18T13:34:06.068Z" }, + { url = "https://files.pythonhosted.org/packages/67/0c/02c08858b764129f4ecb8e316684272972e60777ae986f3865b10940bdd6/coverage-7.12.0-cp314-cp314t-musllinux_1_2_i686.whl", hash = "sha256:33baadc0efd5c7294f436a632566ccc1f72c867f82833eb59820ee37dc811c6f", size = 259745, upload_time = "2025-11-18T13:34:08.04Z" }, + { url = "https://files.pythonhosted.org/packages/5a/04/4fd32b7084505f3829a8fe45c1a74a7a728cb251aaadbe3bec04abcef06d/coverage-7.12.0-cp314-cp314t-musllinux_1_2_riscv64.whl", hash = "sha256:c406a71f544800ef7e9e0000af706b88465f3573ae8b8de37e5f96c59f689ad1", size = 258570, upload_time = "2025-11-18T13:34:09.676Z" }, + { url = "https://files.pythonhosted.org/packages/48/35/2365e37c90df4f5342c4fa202223744119fe31264ee2924f09f074ea9b6d/coverage-7.12.0-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:e71bba6a40883b00c6d571599b4627f50c360b3d0d02bfc658168936be74027b", size = 260899, upload_time = "2025-11-18T13:34:11.259Z" }, + { url = "https://files.pythonhosted.org/packages/05/56/26ab0464ca733fa325e8e71455c58c1c374ce30f7c04cebb88eabb037b18/coverage-7.12.0-cp314-cp314t-win32.whl", hash = "sha256:9157a5e233c40ce6613dead4c131a006adfda70e557b6856b97aceed01b0e27a", size = 221313, upload_time = "2025-11-18T13:34:12.863Z" }, + { url = "https://files.pythonhosted.org/packages/da/1c/017a3e1113ed34d998b27d2c6dba08a9e7cb97d362f0ec988fcd873dcf81/coverage-7.12.0-cp314-cp314t-win_amd64.whl", hash = "sha256:e84da3a0fd233aeec797b981c51af1cabac74f9bd67be42458365b30d11b5291", size = 222423, upload_time = "2025-11-18T13:34:15.14Z" }, + { url = "https://files.pythonhosted.org/packages/4c/36/bcc504fdd5169301b52568802bb1b9cdde2e27a01d39fbb3b4b508ab7c2c/coverage-7.12.0-cp314-cp314t-win_arm64.whl", hash = "sha256:01d24af36fedda51c2b1aca56e4330a3710f83b02a5ff3743a6b015ffa7c9384", size = 220459, upload_time = "2025-11-18T13:34:17.222Z" }, + { url = "https://files.pythonhosted.org/packages/ce/a3/43b749004e3c09452e39bb56347a008f0a0668aad37324a99b5c8ca91d9e/coverage-7.12.0-py3-none-any.whl", hash = "sha256:159d50c0b12e060b15ed3d39f87ed43d4f7f7ad40b8a534f4dd331adbb51104a", size = 209503, upload_time = "2025-11-18T13:34:18.892Z" }, +] + +[package.optional-dependencies] +toml = [ + { name = "tomli", marker = "python_full_version >= '3.10' and python_full_version <= '3.11'" }, +] + +[[package]] +name = "distlib" +version = "0.4.0" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/96/8e/709914eb2b5749865801041647dc7f4e6d00b549cfe88b65ca192995f07c/distlib-0.4.0.tar.gz", hash = "sha256:feec40075be03a04501a973d81f633735b4b69f98b05450592310c0f401a4e0d", size = 614605, upload_time = "2025-07-17T16:52:00.465Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/33/6b/e0547afaf41bf2c42e52430072fa5658766e3d65bd4b03a563d1b6336f57/distlib-0.4.0-py2.py3-none-any.whl", hash = "sha256:9659f7d87e46584a30b5780e43ac7a2143098441670ff0a49d5f9034c54a6c16", size = 469047, upload_time = "2025-07-17T16:51:58.613Z" }, +] + [[package]] name = "docutils" version = "0.19" @@ -222,55 +571,66 @@ wheels = [ ] [[package]] -name = "flake8" -version = "5.0.4" +name = "filelock" +version = "3.16.1" source = { registry = "https://pypi.org/simple" } resolution-markers = [ + "python_full_version >= '3.8.1' and python_full_version < '3.9'", "python_full_version < '3.8.1'", ] -dependencies = [ - { name = "mccabe", marker = "python_full_version < '3.8.1'" }, - { name = "pycodestyle", version = "2.9.1", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.8.1'" }, - { name = "pyflakes", version = "2.5.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.8.1'" }, +sdist = { url = "https://files.pythonhosted.org/packages/9d/db/3ef5bb276dae18d6ec2124224403d1d67bccdbefc17af4cc8f553e341ab1/filelock-3.16.1.tar.gz", hash = "sha256:c249fbfcd5db47e5e2d6d62198e565475ee65e4831e2561c8e313fa7eb961435", size = 18037, upload_time = "2024-09-17T19:02:01.779Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/b9/f8/feced7779d755758a52d1f6635d990b8d98dc0a29fa568bbe0625f18fdf3/filelock-3.16.1-py3-none-any.whl", hash = "sha256:2082e5703d51fbf98ea75855d9d5527e33d8ff23099bec374a134febee6946b0", size = 16163, upload_time = "2024-09-17T19:02:00.268Z" }, +] + +[[package]] +name = "filelock" +version = "3.19.1" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version == '3.9.*'", ] -sdist = { url = "https://files.pythonhosted.org/packages/ad/00/9808c62b2d529cefc69ce4e4a1ea42c0f855effa55817b7327ec5b75e60a/flake8-5.0.4.tar.gz", hash = "sha256:6fbe320aad8d6b95cec8b8e47bc933004678dc63095be98528b7bdd2a9f510db", size = 145862, upload_time = "2022-08-03T23:21:27.108Z" } +sdist = { url = "https://files.pythonhosted.org/packages/40/bb/0ab3e58d22305b6f5440629d20683af28959bf793d98d11950e305c1c326/filelock-3.19.1.tar.gz", hash = "sha256:66eda1888b0171c998b35be2bcc0f6d75c388a7ce20c3f3f37aa8e96c2dddf58", size = 17687, upload_time = "2025-08-14T16:56:03.016Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/cf/a0/b881b63a17a59d9d07f5c0cc91a29182c8e8a9aa2bde5b3b2b16519c02f4/flake8-5.0.4-py2.py3-none-any.whl", hash = "sha256:7a1cf6b73744f5806ab95e526f6f0d8c01c66d7bbe349562d22dfca20610b248", size = 61897, upload_time = "2022-08-03T23:21:25.027Z" }, + { url = "https://files.pythonhosted.org/packages/42/14/42b2651a2f46b022ccd948bca9f2d5af0fd8929c4eec235b8d6d844fbe67/filelock-3.19.1-py3-none-any.whl", hash = "sha256:d38e30481def20772f5baf097c122c3babc4fcdb7e14e57049eb9d88c6dc017d", size = 15988, upload_time = "2025-08-14T16:56:01.633Z" }, ] [[package]] -name = "flake8" -version = "7.1.2" +name = "filelock" +version = "3.20.0" source = { registry = "https://pypi.org/simple" } resolution-markers = [ - "python_full_version >= '3.8.1' and python_full_version < '3.9'", + "python_full_version >= '3.10'", ] -dependencies = [ - { name = "mccabe", marker = "python_full_version >= '3.8.1' and python_full_version < '3.9'" }, - { name = "pycodestyle", version = "2.12.1", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.8.1' and python_full_version < '3.9'" }, - { name = "pyflakes", version = "3.2.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.8.1' and python_full_version < '3.9'" }, +sdist = { url = "https://files.pythonhosted.org/packages/58/46/0028a82567109b5ef6e4d2a1f04a583fb513e6cf9527fcdd09afd817deeb/filelock-3.20.0.tar.gz", hash = "sha256:711e943b4ec6be42e1d4e6690b48dc175c822967466bb31c0c293f34334c13f4", size = 18922, upload_time = "2025-10-08T18:03:50.056Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/76/91/7216b27286936c16f5b4d0c530087e4a54eead683e6b0b73dd0c64844af6/filelock-3.20.0-py3-none-any.whl", hash = "sha256:339b4732ffda5cd79b13f4e2711a31b0365ce445d95d243bb996273d072546a2", size = 16054, upload_time = "2025-10-08T18:03:48.35Z" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/58/16/3f2a0bb700ad65ac9663262905a025917c020a3f92f014d2ba8964b4602c/flake8-7.1.2.tar.gz", hash = "sha256:c586ffd0b41540951ae41af572e6790dbd49fc12b3aa2541685d253d9bd504bd", size = 48119, upload_time = "2025-02-16T18:45:44.296Z" } + +[[package]] +name = "identify" +version = "2.6.1" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.8.1' and python_full_version < '3.9'", + "python_full_version < '3.8.1'", +] +sdist = { url = "https://files.pythonhosted.org/packages/29/bb/25024dbcc93516c492b75919e76f389bac754a3e4248682fba32b250c880/identify-2.6.1.tar.gz", hash = "sha256:91478c5fb7c3aac5ff7bf9b4344f803843dc586832d5f110d672b19aa1984c98", size = 99097, upload_time = "2024-09-14T23:50:32.513Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/35/f8/08d37b2cd89da306e3520bd27f8a85692122b42b56c0c2c3784ff09c022f/flake8-7.1.2-py2.py3-none-any.whl", hash = "sha256:1cbc62e65536f65e6d754dfe6f1bada7f5cf392d6f5db3c2b85892466c3e7c1a", size = 57745, upload_time = "2025-02-16T18:45:42.351Z" }, + { url = "https://files.pythonhosted.org/packages/7d/0c/4ef72754c050979fdcc06c744715ae70ea37e734816bb6514f79df77a42f/identify-2.6.1-py2.py3-none-any.whl", hash = "sha256:53863bcac7caf8d2ed85bd20312ea5dcfc22226800f6d6881f232d861db5a8f0", size = 98972, upload_time = "2024-09-14T23:50:30.747Z" }, ] [[package]] -name = "flake8" -version = "7.3.0" +name = "identify" +version = "2.6.15" source = { registry = "https://pypi.org/simple" } resolution-markers = [ "python_full_version >= '3.10'", "python_full_version == '3.9.*'", ] -dependencies = [ - { name = "mccabe", marker = "python_full_version >= '3.9'" }, - { name = "pycodestyle", version = "2.14.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.9'" }, - { name = "pyflakes", version = "3.4.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.9'" }, -] -sdist = { url = "https://files.pythonhosted.org/packages/9b/af/fbfe3c4b5a657d79e5c47a2827a362f9e1b763336a52f926126aa6dc7123/flake8-7.3.0.tar.gz", hash = "sha256:fe044858146b9fc69b551a4b490d69cf960fcb78ad1edcb84e7fbb1b4a8e3872", size = 48326, upload_time = "2025-06-20T19:31:35.838Z" } +sdist = { url = "https://files.pythonhosted.org/packages/ff/e7/685de97986c916a6d93b3876139e00eef26ad5bbbd61925d670ae8013449/identify-2.6.15.tar.gz", hash = "sha256:e4f4864b96c6557ef2a1e1c951771838f4edc9df3a72ec7118b338801b11c7bf", size = 99311, upload_time = "2025-10-02T17:43:40.631Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/9f/56/13ab06b4f93ca7cac71078fbe37fcea175d3216f31f85c3168a6bbd0bb9a/flake8-7.3.0-py2.py3-none-any.whl", hash = "sha256:b9696257b9ce8beb888cdbe31cf885c90d31928fe202be0889a7cdafad32f01e", size = 57922, upload_time = "2025-06-20T19:31:34.425Z" }, + { url = "https://files.pythonhosted.org/packages/0f/1c/e5fd8f973d4f375adb21565739498e2e9a1e54c858a97b9a8ccfdc81da9b/identify-2.6.15-py2.py3-none-any.whl", hash = "sha256:1181ef7608e00704db228516541eb83a88a9f94433a8c80bb9b5bd54b1d81757", size = 99183, upload_time = "2025-10-02T17:43:39.137Z" }, ] [[package]] @@ -348,46 +708,6 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/cb/b1/3846dd7f199d53cb17f49cba7e651e9ce294d8497c8c150530ed11865bb8/iniconfig-2.3.0-py3-none-any.whl", hash = "sha256:f631c04d2c48c52b84d0d0549c99ff3859c98df65b3101406327ecc7d53fbf12", size = 7484, upload_time = "2025-10-18T21:55:41.639Z" }, ] -[[package]] -name = "isort" -version = "5.13.2" -source = { registry = "https://pypi.org/simple" } -resolution-markers = [ - "python_full_version >= '3.8.1' and python_full_version < '3.9'", - "python_full_version < '3.8.1'", -] -sdist = { url = "https://files.pythonhosted.org/packages/87/f9/c1eb8635a24e87ade2efce21e3ce8cd6b8630bb685ddc9cdaca1349b2eb5/isort-5.13.2.tar.gz", hash = "sha256:48fdfcb9face5d58a4f6dde2e72a1fb8dcaf8ab26f95ab49fab84c2ddefb0109", size = 175303, upload_time = "2023-12-13T20:37:26.124Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/d1/b3/8def84f539e7d2289a02f0524b944b15d7c75dab7628bedf1c4f0992029c/isort-5.13.2-py3-none-any.whl", hash = "sha256:8ca5e72a8d85860d5a3fa69b8745237f2939afe12dbf656afbcb47fe72d947a6", size = 92310, upload_time = "2023-12-13T20:37:23.244Z" }, -] - -[[package]] -name = "isort" -version = "6.1.0" -source = { registry = "https://pypi.org/simple" } -resolution-markers = [ - "python_full_version == '3.9.*'", -] -dependencies = [ - { name = "importlib-metadata", version = "8.7.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version == '3.9.*'" }, -] -sdist = { url = "https://files.pythonhosted.org/packages/1e/82/fa43935523efdfcce6abbae9da7f372b627b27142c3419fcf13bf5b0c397/isort-6.1.0.tar.gz", hash = "sha256:9b8f96a14cfee0677e78e941ff62f03769a06d412aabb9e2a90487b3b7e8d481", size = 824325, upload_time = "2025-10-01T16:26:45.027Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/7f/cc/9b681a170efab4868a032631dea1e8446d8ec718a7f657b94d49d1a12643/isort-6.1.0-py3-none-any.whl", hash = "sha256:58d8927ecce74e5087aef019f778d4081a3b6c98f15a80ba35782ca8a2097784", size = 94329, upload_time = "2025-10-01T16:26:43.291Z" }, -] - -[[package]] -name = "isort" -version = "7.0.0" -source = { registry = "https://pypi.org/simple" } -resolution-markers = [ - "python_full_version >= '3.10'", -] -sdist = { url = "https://files.pythonhosted.org/packages/63/53/4f3c058e3bace40282876f9b553343376ee687f3c35a525dc79dbd450f88/isort-7.0.0.tar.gz", hash = "sha256:5513527951aadb3ac4292a41a16cbc50dd1642432f5e8c20057d414bdafb4187", size = 805049, upload_time = "2025-10-11T13:30:59.107Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/7f/ed/e3705d6d02b4f7aea715a353c8ce193efd0b5db13e204df895d38734c244/isort-7.0.0-py3-none-any.whl", hash = "sha256:1bcabac8bc3c36c7fb7b98a76c8abb18e0f841a3ba81decac7691008592499c1", size = 94672, upload_time = "2025-10-11T13:30:57.665Z" }, -] - [[package]] name = "jinja2" version = "3.1.6" @@ -573,12 +893,121 @@ wheels = [ ] [[package]] -name = "mccabe" -version = "0.7.0" +name = "mypy" +version = "1.14.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/e7/ff/0ffefdcac38932a54d2b5eed4e0ba8a408f215002cd178ad1df0f2806ff8/mccabe-0.7.0.tar.gz", hash = "sha256:348e0240c33b60bbdf4e523192ef919f28cb2c3d7d5c7794f74009290f236325", size = 9658, upload_time = "2022-01-24T01:14:51.113Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/27/1a/1f68f9ba0c207934b35b86a8ca3aad8395a3d6dd7921c0686e23853ff5a9/mccabe-0.7.0-py2.py3-none-any.whl", hash = "sha256:6c2d30ab6be0e4a46919781807b4f0d834ebdd6c6e3dca0bda5a15f863427b6e", size = 7350, upload_time = "2022-01-24T01:14:49.62Z" }, +resolution-markers = [ + "python_full_version >= '3.8.1' and python_full_version < '3.9'", + "python_full_version < '3.8.1'", +] +dependencies = [ + { name = "mypy-extensions", marker = "python_full_version < '3.9'" }, + { name = "tomli", marker = "python_full_version < '3.9'" }, + { name = "typing-extensions", version = "4.13.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/b9/eb/2c92d8ea1e684440f54fa49ac5d9a5f19967b7b472a281f419e69a8d228e/mypy-1.14.1.tar.gz", hash = "sha256:7ec88144fe9b510e8475ec2f5f251992690fcf89ccb4500b214b4226abcd32d6", size = 3216051, upload_time = "2024-12-30T16:39:07.335Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/9b/7a/87ae2adb31d68402da6da1e5f30c07ea6063e9f09b5e7cfc9dfa44075e74/mypy-1.14.1-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:52686e37cf13d559f668aa398dd7ddf1f92c5d613e4f8cb262be2fb4fedb0fcb", size = 11211002, upload_time = "2024-12-30T16:37:22.435Z" }, + { url = "https://files.pythonhosted.org/packages/e1/23/eada4c38608b444618a132be0d199b280049ded278b24cbb9d3fc59658e4/mypy-1.14.1-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:1fb545ca340537d4b45d3eecdb3def05e913299ca72c290326be19b3804b39c0", size = 10358400, upload_time = "2024-12-30T16:37:53.526Z" }, + { url = "https://files.pythonhosted.org/packages/43/c9/d6785c6f66241c62fd2992b05057f404237deaad1566545e9f144ced07f5/mypy-1.14.1-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:90716d8b2d1f4cd503309788e51366f07c56635a3309b0f6a32547eaaa36a64d", size = 12095172, upload_time = "2024-12-30T16:37:50.332Z" }, + { url = "https://files.pythonhosted.org/packages/c3/62/daa7e787770c83c52ce2aaf1a111eae5893de9e004743f51bfcad9e487ec/mypy-1.14.1-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:2ae753f5c9fef278bcf12e1a564351764f2a6da579d4a81347e1d5a15819997b", size = 12828732, upload_time = "2024-12-30T16:37:29.96Z" }, + { url = "https://files.pythonhosted.org/packages/1b/a2/5fb18318a3637f29f16f4e41340b795da14f4751ef4f51c99ff39ab62e52/mypy-1.14.1-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:e0fe0f5feaafcb04505bcf439e991c6d8f1bf8b15f12b05feeed96e9e7bf1427", size = 13012197, upload_time = "2024-12-30T16:38:05.037Z" }, + { url = "https://files.pythonhosted.org/packages/28/99/e153ce39105d164b5f02c06c35c7ba958aaff50a2babba7d080988b03fe7/mypy-1.14.1-cp310-cp310-win_amd64.whl", hash = "sha256:7d54bd85b925e501c555a3227f3ec0cfc54ee8b6930bd6141ec872d1c572f81f", size = 9780836, upload_time = "2024-12-30T16:37:19.726Z" }, + { url = "https://files.pythonhosted.org/packages/da/11/a9422850fd506edbcdc7f6090682ecceaf1f87b9dd847f9df79942da8506/mypy-1.14.1-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:f995e511de847791c3b11ed90084a7a0aafdc074ab88c5a9711622fe4751138c", size = 11120432, upload_time = "2024-12-30T16:37:11.533Z" }, + { url = "https://files.pythonhosted.org/packages/b6/9e/47e450fd39078d9c02d620545b2cb37993a8a8bdf7db3652ace2f80521ca/mypy-1.14.1-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:d64169ec3b8461311f8ce2fd2eb5d33e2d0f2c7b49116259c51d0d96edee48d1", size = 10279515, upload_time = "2024-12-30T16:37:40.724Z" }, + { url = "https://files.pythonhosted.org/packages/01/b5/6c8d33bd0f851a7692a8bfe4ee75eb82b6983a3cf39e5e32a5d2a723f0c1/mypy-1.14.1-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:ba24549de7b89b6381b91fbc068d798192b1b5201987070319889e93038967a8", size = 12025791, upload_time = "2024-12-30T16:36:58.73Z" }, + { url = "https://files.pythonhosted.org/packages/f0/4c/e10e2c46ea37cab5c471d0ddaaa9a434dc1d28650078ac1b56c2d7b9b2e4/mypy-1.14.1-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:183cf0a45457d28ff9d758730cd0210419ac27d4d3f285beda038c9083363b1f", size = 12749203, upload_time = "2024-12-30T16:37:03.741Z" }, + { url = "https://files.pythonhosted.org/packages/88/55/beacb0c69beab2153a0f57671ec07861d27d735a0faff135a494cd4f5020/mypy-1.14.1-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:f2a0ecc86378f45347f586e4163d1769dd81c5a223d577fe351f26b179e148b1", size = 12885900, upload_time = "2024-12-30T16:37:57.948Z" }, + { url = "https://files.pythonhosted.org/packages/a2/75/8c93ff7f315c4d086a2dfcde02f713004357d70a163eddb6c56a6a5eff40/mypy-1.14.1-cp311-cp311-win_amd64.whl", hash = "sha256:ad3301ebebec9e8ee7135d8e3109ca76c23752bac1e717bc84cd3836b4bf3eae", size = 9777869, upload_time = "2024-12-30T16:37:33.428Z" }, + { url = "https://files.pythonhosted.org/packages/43/1b/b38c079609bb4627905b74fc6a49849835acf68547ac33d8ceb707de5f52/mypy-1.14.1-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:30ff5ef8519bbc2e18b3b54521ec319513a26f1bba19a7582e7b1f58a6e69f14", size = 11266668, upload_time = "2024-12-30T16:38:02.211Z" }, + { url = "https://files.pythonhosted.org/packages/6b/75/2ed0d2964c1ffc9971c729f7a544e9cd34b2cdabbe2d11afd148d7838aa2/mypy-1.14.1-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:cb9f255c18052343c70234907e2e532bc7e55a62565d64536dbc7706a20b78b9", size = 10254060, upload_time = "2024-12-30T16:37:46.131Z" }, + { url = "https://files.pythonhosted.org/packages/a1/5f/7b8051552d4da3c51bbe8fcafffd76a6823779101a2b198d80886cd8f08e/mypy-1.14.1-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:8b4e3413e0bddea671012b063e27591b953d653209e7a4fa5e48759cda77ca11", size = 11933167, upload_time = "2024-12-30T16:37:43.534Z" }, + { url = "https://files.pythonhosted.org/packages/04/90/f53971d3ac39d8b68bbaab9a4c6c58c8caa4d5fd3d587d16f5927eeeabe1/mypy-1.14.1-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:553c293b1fbdebb6c3c4030589dab9fafb6dfa768995a453d8a5d3b23784af2e", size = 12864341, upload_time = "2024-12-30T16:37:36.249Z" }, + { url = "https://files.pythonhosted.org/packages/03/d2/8bc0aeaaf2e88c977db41583559319f1821c069e943ada2701e86d0430b7/mypy-1.14.1-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:fad79bfe3b65fe6a1efaed97b445c3d37f7be9fdc348bdb2d7cac75579607c89", size = 12972991, upload_time = "2024-12-30T16:37:06.743Z" }, + { url = "https://files.pythonhosted.org/packages/6f/17/07815114b903b49b0f2cf7499f1c130e5aa459411596668267535fe9243c/mypy-1.14.1-cp312-cp312-win_amd64.whl", hash = "sha256:8fa2220e54d2946e94ab6dbb3ba0a992795bd68b16dc852db33028df2b00191b", size = 9879016, upload_time = "2024-12-30T16:37:15.02Z" }, + { url = "https://files.pythonhosted.org/packages/9e/15/bb6a686901f59222275ab228453de741185f9d54fecbaacec041679496c6/mypy-1.14.1-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:92c3ed5afb06c3a8e188cb5da4984cab9ec9a77ba956ee419c68a388b4595255", size = 11252097, upload_time = "2024-12-30T16:37:25.144Z" }, + { url = "https://files.pythonhosted.org/packages/f8/b3/8b0f74dfd072c802b7fa368829defdf3ee1566ba74c32a2cb2403f68024c/mypy-1.14.1-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:dbec574648b3e25f43d23577309b16534431db4ddc09fda50841f1e34e64ed34", size = 10239728, upload_time = "2024-12-30T16:38:08.634Z" }, + { url = "https://files.pythonhosted.org/packages/c5/9b/4fd95ab20c52bb5b8c03cc49169be5905d931de17edfe4d9d2986800b52e/mypy-1.14.1-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:8c6d94b16d62eb3e947281aa7347d78236688e21081f11de976376cf010eb31a", size = 11924965, upload_time = "2024-12-30T16:38:12.132Z" }, + { url = "https://files.pythonhosted.org/packages/56/9d/4a236b9c57f5d8f08ed346914b3f091a62dd7e19336b2b2a0d85485f82ff/mypy-1.14.1-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:d4b19b03fdf54f3c5b2fa474c56b4c13c9dbfb9a2db4370ede7ec11a2c5927d9", size = 12867660, upload_time = "2024-12-30T16:38:17.342Z" }, + { url = "https://files.pythonhosted.org/packages/40/88/a61a5497e2f68d9027de2bb139c7bb9abaeb1be1584649fa9d807f80a338/mypy-1.14.1-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:0c911fde686394753fff899c409fd4e16e9b294c24bfd5e1ea4675deae1ac6fd", size = 12969198, upload_time = "2024-12-30T16:38:32.839Z" }, + { url = "https://files.pythonhosted.org/packages/54/da/3d6fc5d92d324701b0c23fb413c853892bfe0e1dbe06c9138037d459756b/mypy-1.14.1-cp313-cp313-win_amd64.whl", hash = "sha256:8b21525cb51671219f5307be85f7e646a153e5acc656e5cebf64bfa076c50107", size = 9885276, upload_time = "2024-12-30T16:38:20.828Z" }, + { url = "https://files.pythonhosted.org/packages/39/02/1817328c1372be57c16148ce7d2bfcfa4a796bedaed897381b1aad9b267c/mypy-1.14.1-cp38-cp38-macosx_10_9_x86_64.whl", hash = "sha256:7084fb8f1128c76cd9cf68fe5971b37072598e7c31b2f9f95586b65c741a9d31", size = 11143050, upload_time = "2024-12-30T16:38:29.743Z" }, + { url = "https://files.pythonhosted.org/packages/b9/07/99db9a95ece5e58eee1dd87ca456a7e7b5ced6798fd78182c59c35a7587b/mypy-1.14.1-cp38-cp38-macosx_11_0_arm64.whl", hash = "sha256:8f845a00b4f420f693f870eaee5f3e2692fa84cc8514496114649cfa8fd5e2c6", size = 10321087, upload_time = "2024-12-30T16:38:14.739Z" }, + { url = "https://files.pythonhosted.org/packages/9a/eb/85ea6086227b84bce79b3baf7f465b4732e0785830726ce4a51528173b71/mypy-1.14.1-cp38-cp38-manylinux_2_17_aarch64.manylinux2014_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:44bf464499f0e3a2d14d58b54674dee25c031703b2ffc35064bd0df2e0fac319", size = 12066766, upload_time = "2024-12-30T16:38:47.038Z" }, + { url = "https://files.pythonhosted.org/packages/4b/bb/f01bebf76811475d66359c259eabe40766d2f8ac8b8250d4e224bb6df379/mypy-1.14.1-cp38-cp38-manylinux_2_17_x86_64.manylinux2014_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:c99f27732c0b7dc847adb21c9d47ce57eb48fa33a17bc6d7d5c5e9f9e7ae5bac", size = 12787111, upload_time = "2024-12-30T16:39:02.444Z" }, + { url = "https://files.pythonhosted.org/packages/2f/c9/84837ff891edcb6dcc3c27d85ea52aab0c4a34740ff5f0ccc0eb87c56139/mypy-1.14.1-cp38-cp38-musllinux_1_2_x86_64.whl", hash = "sha256:bce23c7377b43602baa0bd22ea3265c49b9ff0b76eb315d6c34721af4cdf1d9b", size = 12974331, upload_time = "2024-12-30T16:38:23.849Z" }, + { url = "https://files.pythonhosted.org/packages/84/5f/901e18464e6a13f8949b4909535be3fa7f823291b8ab4e4b36cfe57d6769/mypy-1.14.1-cp38-cp38-win_amd64.whl", hash = "sha256:8edc07eeade7ebc771ff9cf6b211b9a7d93687ff892150cb5692e4f4272b0837", size = 9763210, upload_time = "2024-12-30T16:38:36.299Z" }, + { url = "https://files.pythonhosted.org/packages/ca/1f/186d133ae2514633f8558e78cd658070ba686c0e9275c5a5c24a1e1f0d67/mypy-1.14.1-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:3888a1816d69f7ab92092f785a462944b3ca16d7c470d564165fe703b0970c35", size = 11200493, upload_time = "2024-12-30T16:38:26.935Z" }, + { url = "https://files.pythonhosted.org/packages/af/fc/4842485d034e38a4646cccd1369f6b1ccd7bc86989c52770d75d719a9941/mypy-1.14.1-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:46c756a444117c43ee984bd055db99e498bc613a70bbbc120272bd13ca579fbc", size = 10357702, upload_time = "2024-12-30T16:38:50.623Z" }, + { url = "https://files.pythonhosted.org/packages/b4/e6/457b83f2d701e23869cfec013a48a12638f75b9d37612a9ddf99072c1051/mypy-1.14.1-cp39-cp39-manylinux_2_17_aarch64.manylinux2014_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:27fc248022907e72abfd8e22ab1f10e903915ff69961174784a3900a8cba9ad9", size = 12091104, upload_time = "2024-12-30T16:38:53.735Z" }, + { url = "https://files.pythonhosted.org/packages/f1/bf/76a569158db678fee59f4fd30b8e7a0d75bcbaeef49edd882a0d63af6d66/mypy-1.14.1-cp39-cp39-manylinux_2_17_x86_64.manylinux2014_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:499d6a72fb7e5de92218db961f1a66d5f11783f9ae549d214617edab5d4dbdbb", size = 12830167, upload_time = "2024-12-30T16:38:56.437Z" }, + { url = "https://files.pythonhosted.org/packages/43/bc/0bc6b694b3103de9fed61867f1c8bd33336b913d16831431e7cb48ef1c92/mypy-1.14.1-cp39-cp39-musllinux_1_2_x86_64.whl", hash = "sha256:57961db9795eb566dc1d1b4e9139ebc4c6b0cb6e7254ecde69d1552bf7613f60", size = 13013834, upload_time = "2024-12-30T16:38:59.204Z" }, + { url = "https://files.pythonhosted.org/packages/b0/79/5f5ec47849b6df1e6943d5fd8e6632fbfc04b4fd4acfa5a5a9535d11b4e2/mypy-1.14.1-cp39-cp39-win_amd64.whl", hash = "sha256:07ba89fdcc9451f2ebb02853deb6aaaa3d2239a236669a63ab3801bbf923ef5c", size = 9781231, upload_time = "2024-12-30T16:39:05.124Z" }, + { url = "https://files.pythonhosted.org/packages/a0/b5/32dd67b69a16d088e533962e5044e51004176a9952419de0370cdaead0f8/mypy-1.14.1-py3-none-any.whl", hash = "sha256:b66a60cc4073aeb8ae00057f9c1f64d49e90f918fbcef9a977eb121da8b8f1d1", size = 2752905, upload_time = "2024-12-30T16:38:42.021Z" }, +] + +[[package]] +name = "mypy" +version = "1.18.2" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.10'", + "python_full_version == '3.9.*'", +] +dependencies = [ + { name = "mypy-extensions", marker = "python_full_version >= '3.9'" }, + { name = "pathspec", marker = "python_full_version >= '3.9'" }, + { name = "tomli", marker = "python_full_version >= '3.9' and python_full_version < '3.11'" }, + { name = "typing-extensions", version = "4.15.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.9'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/c0/77/8f0d0001ffad290cef2f7f216f96c814866248a0b92a722365ed54648e7e/mypy-1.18.2.tar.gz", hash = "sha256:06a398102a5f203d7477b2923dda3634c36727fa5c237d8f859ef90c42a9924b", size = 3448846, upload_time = "2025-09-19T00:11:10.519Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/03/6f/657961a0743cff32e6c0611b63ff1c1970a0b482ace35b069203bf705187/mypy-1.18.2-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:c1eab0cf6294dafe397c261a75f96dc2c31bffe3b944faa24db5def4e2b0f77c", size = 12807973, upload_time = "2025-09-19T00:10:35.282Z" }, + { url = "https://files.pythonhosted.org/packages/10/e9/420822d4f661f13ca8900f5fa239b40ee3be8b62b32f3357df9a3045a08b/mypy-1.18.2-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:7a780ca61fc239e4865968ebc5240bb3bf610ef59ac398de9a7421b54e4a207e", size = 11896527, upload_time = "2025-09-19T00:10:55.791Z" }, + { url = "https://files.pythonhosted.org/packages/aa/73/a05b2bbaa7005f4642fcfe40fb73f2b4fb6bb44229bd585b5878e9a87ef8/mypy-1.18.2-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:448acd386266989ef11662ce3c8011fd2a7b632e0ec7d61a98edd8e27472225b", size = 12507004, upload_time = "2025-09-19T00:11:05.411Z" }, + { url = "https://files.pythonhosted.org/packages/4f/01/f6e4b9f0d031c11ccbd6f17da26564f3a0f3c4155af344006434b0a05a9d/mypy-1.18.2-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:f9e171c465ad3901dc652643ee4bffa8e9fef4d7d0eece23b428908c77a76a66", size = 13245947, upload_time = "2025-09-19T00:10:46.923Z" }, + { url = "https://files.pythonhosted.org/packages/d7/97/19727e7499bfa1ae0773d06afd30ac66a58ed7437d940c70548634b24185/mypy-1.18.2-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:592ec214750bc00741af1f80cbf96b5013d81486b7bb24cb052382c19e40b428", size = 13499217, upload_time = "2025-09-19T00:09:39.472Z" }, + { url = "https://files.pythonhosted.org/packages/9f/4f/90dc8c15c1441bf31cf0f9918bb077e452618708199e530f4cbd5cede6ff/mypy-1.18.2-cp310-cp310-win_amd64.whl", hash = "sha256:7fb95f97199ea11769ebe3638c29b550b5221e997c63b14ef93d2e971606ebed", size = 9766753, upload_time = "2025-09-19T00:10:49.161Z" }, + { url = "https://files.pythonhosted.org/packages/88/87/cafd3ae563f88f94eec33f35ff722d043e09832ea8530ef149ec1efbaf08/mypy-1.18.2-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:807d9315ab9d464125aa9fcf6d84fde6e1dc67da0b6f80e7405506b8ac72bc7f", size = 12731198, upload_time = "2025-09-19T00:09:44.857Z" }, + { url = "https://files.pythonhosted.org/packages/0f/e0/1e96c3d4266a06d4b0197ace5356d67d937d8358e2ee3ffac71faa843724/mypy-1.18.2-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:776bb00de1778caf4db739c6e83919c1d85a448f71979b6a0edd774ea8399341", size = 11817879, upload_time = "2025-09-19T00:09:47.131Z" }, + { url = "https://files.pythonhosted.org/packages/72/ef/0c9ba89eb03453e76bdac5a78b08260a848c7bfc5d6603634774d9cd9525/mypy-1.18.2-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:1379451880512ffce14505493bd9fe469e0697543717298242574882cf8cdb8d", size = 12427292, upload_time = "2025-09-19T00:10:22.472Z" }, + { url = "https://files.pythonhosted.org/packages/1a/52/ec4a061dd599eb8179d5411d99775bec2a20542505988f40fc2fee781068/mypy-1.18.2-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:1331eb7fd110d60c24999893320967594ff84c38ac6d19e0a76c5fd809a84c86", size = 13163750, upload_time = "2025-09-19T00:09:51.472Z" }, + { url = "https://files.pythonhosted.org/packages/c4/5f/2cf2ceb3b36372d51568f2208c021870fe7834cf3186b653ac6446511839/mypy-1.18.2-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:3ca30b50a51e7ba93b00422e486cbb124f1c56a535e20eff7b2d6ab72b3b2e37", size = 13351827, upload_time = "2025-09-19T00:09:58.311Z" }, + { url = "https://files.pythonhosted.org/packages/c8/7d/2697b930179e7277529eaaec1513f8de622818696857f689e4a5432e5e27/mypy-1.18.2-cp311-cp311-win_amd64.whl", hash = "sha256:664dc726e67fa54e14536f6e1224bcfce1d9e5ac02426d2326e2bb4e081d1ce8", size = 9757983, upload_time = "2025-09-19T00:10:09.071Z" }, + { url = "https://files.pythonhosted.org/packages/07/06/dfdd2bc60c66611dd8335f463818514733bc763e4760dee289dcc33df709/mypy-1.18.2-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:33eca32dd124b29400c31d7cf784e795b050ace0e1f91b8dc035672725617e34", size = 12908273, upload_time = "2025-09-19T00:10:58.321Z" }, + { url = "https://files.pythonhosted.org/packages/81/14/6a9de6d13a122d5608e1a04130724caf9170333ac5a924e10f670687d3eb/mypy-1.18.2-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:a3c47adf30d65e89b2dcd2fa32f3aeb5e94ca970d2c15fcb25e297871c8e4764", size = 11920910, upload_time = "2025-09-19T00:10:20.043Z" }, + { url = "https://files.pythonhosted.org/packages/5f/a9/b29de53e42f18e8cc547e38daa9dfa132ffdc64f7250e353f5c8cdd44bee/mypy-1.18.2-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:5d6c838e831a062f5f29d11c9057c6009f60cb294fea33a98422688181fe2893", size = 12465585, upload_time = "2025-09-19T00:10:33.005Z" }, + { url = "https://files.pythonhosted.org/packages/77/ae/6c3d2c7c61ff21f2bee938c917616c92ebf852f015fb55917fd6e2811db2/mypy-1.18.2-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:01199871b6110a2ce984bde85acd481232d17413868c9807e95c1b0739a58914", size = 13348562, upload_time = "2025-09-19T00:10:11.51Z" }, + { url = "https://files.pythonhosted.org/packages/4d/31/aec68ab3b4aebdf8f36d191b0685d99faa899ab990753ca0fee60fb99511/mypy-1.18.2-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:a2afc0fa0b0e91b4599ddfe0f91e2c26c2b5a5ab263737e998d6817874c5f7c8", size = 13533296, upload_time = "2025-09-19T00:10:06.568Z" }, + { url = "https://files.pythonhosted.org/packages/9f/83/abcb3ad9478fca3ebeb6a5358bb0b22c95ea42b43b7789c7fb1297ca44f4/mypy-1.18.2-cp312-cp312-win_amd64.whl", hash = "sha256:d8068d0afe682c7c4897c0f7ce84ea77f6de953262b12d07038f4d296d547074", size = 9828828, upload_time = "2025-09-19T00:10:28.203Z" }, + { url = "https://files.pythonhosted.org/packages/5f/04/7f462e6fbba87a72bc8097b93f6842499c428a6ff0c81dd46948d175afe8/mypy-1.18.2-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:07b8b0f580ca6d289e69209ec9d3911b4a26e5abfde32228a288eb79df129fcc", size = 12898728, upload_time = "2025-09-19T00:10:01.33Z" }, + { url = "https://files.pythonhosted.org/packages/99/5b/61ed4efb64f1871b41fd0b82d29a64640f3516078f6c7905b68ab1ad8b13/mypy-1.18.2-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:ed4482847168439651d3feee5833ccedbf6657e964572706a2adb1f7fa4dfe2e", size = 11910758, upload_time = "2025-09-19T00:10:42.607Z" }, + { url = "https://files.pythonhosted.org/packages/3c/46/d297d4b683cc89a6e4108c4250a6a6b717f5fa96e1a30a7944a6da44da35/mypy-1.18.2-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:c3ad2afadd1e9fea5cf99a45a822346971ede8685cc581ed9cd4d42eaf940986", size = 12475342, upload_time = "2025-09-19T00:11:00.371Z" }, + { url = "https://files.pythonhosted.org/packages/83/45/4798f4d00df13eae3bfdf726c9244bcb495ab5bd588c0eed93a2f2dd67f3/mypy-1.18.2-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:a431a6f1ef14cf8c144c6b14793a23ec4eae3db28277c358136e79d7d062f62d", size = 13338709, upload_time = "2025-09-19T00:11:03.358Z" }, + { url = "https://files.pythonhosted.org/packages/d7/09/479f7358d9625172521a87a9271ddd2441e1dab16a09708f056e97007207/mypy-1.18.2-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:7ab28cc197f1dd77a67e1c6f35cd1f8e8b73ed2217e4fc005f9e6a504e46e7ba", size = 13529806, upload_time = "2025-09-19T00:10:26.073Z" }, + { url = "https://files.pythonhosted.org/packages/71/cf/ac0f2c7e9d0ea3c75cd99dff7aec1c9df4a1376537cb90e4c882267ee7e9/mypy-1.18.2-cp313-cp313-win_amd64.whl", hash = "sha256:0e2785a84b34a72ba55fb5daf079a1003a34c05b22238da94fcae2bbe46f3544", size = 9833262, upload_time = "2025-09-19T00:10:40.035Z" }, + { url = "https://files.pythonhosted.org/packages/5a/0c/7d5300883da16f0063ae53996358758b2a2df2a09c72a5061fa79a1f5006/mypy-1.18.2-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:62f0e1e988ad41c2a110edde6c398383a889d95b36b3e60bcf155f5164c4fdce", size = 12893775, upload_time = "2025-09-19T00:10:03.814Z" }, + { url = "https://files.pythonhosted.org/packages/50/df/2cffbf25737bdb236f60c973edf62e3e7b4ee1c25b6878629e88e2cde967/mypy-1.18.2-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:8795a039bab805ff0c1dfdb8cd3344642c2b99b8e439d057aba30850b8d3423d", size = 11936852, upload_time = "2025-09-19T00:10:51.631Z" }, + { url = "https://files.pythonhosted.org/packages/be/50/34059de13dd269227fb4a03be1faee6e2a4b04a2051c82ac0a0b5a773c9a/mypy-1.18.2-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:6ca1e64b24a700ab5ce10133f7ccd956a04715463d30498e64ea8715236f9c9c", size = 12480242, upload_time = "2025-09-19T00:11:07.955Z" }, + { url = "https://files.pythonhosted.org/packages/5b/11/040983fad5132d85914c874a2836252bbc57832065548885b5bb5b0d4359/mypy-1.18.2-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:d924eef3795cc89fecf6bedc6ed32b33ac13e8321344f6ddbf8ee89f706c05cb", size = 13326683, upload_time = "2025-09-19T00:09:55.572Z" }, + { url = "https://files.pythonhosted.org/packages/e9/ba/89b2901dd77414dd7a8c8729985832a5735053be15b744c18e4586e506ef/mypy-1.18.2-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:20c02215a080e3a2be3aa50506c67242df1c151eaba0dcbc1e4e557922a26075", size = 13514749, upload_time = "2025-09-19T00:10:44.827Z" }, + { url = "https://files.pythonhosted.org/packages/25/bc/cc98767cffd6b2928ba680f3e5bc969c4152bf7c2d83f92f5a504b92b0eb/mypy-1.18.2-cp314-cp314-win_amd64.whl", hash = "sha256:749b5f83198f1ca64345603118a6f01a4e99ad4bf9d103ddc5a3200cc4614adf", size = 9982959, upload_time = "2025-09-19T00:10:37.344Z" }, + { url = "https://files.pythonhosted.org/packages/3f/a6/490ff491d8ecddf8ab91762d4f67635040202f76a44171420bcbe38ceee5/mypy-1.18.2-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:25a9c8fb67b00599f839cf472713f54249a62efd53a54b565eb61956a7e3296b", size = 12807230, upload_time = "2025-09-19T00:09:49.471Z" }, + { url = "https://files.pythonhosted.org/packages/eb/2e/60076fc829645d167ece9e80db9e8375648d210dab44cc98beb5b322a826/mypy-1.18.2-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:c2b9c7e284ee20e7598d6f42e13ca40b4928e6957ed6813d1ab6348aa3f47133", size = 11895666, upload_time = "2025-09-19T00:10:53.678Z" }, + { url = "https://files.pythonhosted.org/packages/97/4a/1e2880a2a5dda4dc8d9ecd1a7e7606bc0b0e14813637eeda40c38624e037/mypy-1.18.2-cp39-cp39-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:d6985ed057513e344e43a26cc1cd815c7a94602fb6a3130a34798625bc2f07b6", size = 12499608, upload_time = "2025-09-19T00:09:36.204Z" }, + { url = "https://files.pythonhosted.org/packages/00/81/a117f1b73a3015b076b20246b1f341c34a578ebd9662848c6b80ad5c4138/mypy-1.18.2-cp39-cp39-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:22f27105f1525ec024b5c630c0b9f36d5c1cc4d447d61fe51ff4bd60633f47ac", size = 13244551, upload_time = "2025-09-19T00:10:17.531Z" }, + { url = "https://files.pythonhosted.org/packages/9b/61/b9f48e1714ce87c7bf0358eb93f60663740ebb08f9ea886ffc670cea7933/mypy-1.18.2-cp39-cp39-musllinux_1_2_x86_64.whl", hash = "sha256:030c52d0ea8144e721e49b1f68391e39553d7451f0c3f8a7565b59e19fcb608b", size = 13491552, upload_time = "2025-09-19T00:10:13.753Z" }, + { url = "https://files.pythonhosted.org/packages/c9/66/b2c0af3b684fa80d1b27501a8bdd3d2daa467ea3992a8aa612f5ca17c2db/mypy-1.18.2-cp39-cp39-win_amd64.whl", hash = "sha256:aa5e07ac1a60a253445797e42b8b2963c9675563a94f11291ab40718b016a7a0", size = 9765635, upload_time = "2025-09-19T00:10:30.993Z" }, + { url = "https://files.pythonhosted.org/packages/87/e3/be76d87158ebafa0309946c4a73831974d4d6ab4f4ef40c3b53a385a66fd/mypy-1.18.2-py3-none-any.whl", hash = "sha256:22a1748707dd62b58d2ae53562ffc4d7f8bcc727e8ac7cbc69c053ddc874d47e", size = 2352367, upload_time = "2025-09-19T00:10:15.489Z" }, +] + +[[package]] +name = "mypy-extensions" +version = "1.1.0" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/a2/6e/371856a3fb9d31ca8dac321cda606860fa4548858c0cc45d9d1d4ca2628b/mypy_extensions-1.1.0.tar.gz", hash = "sha256:52e68efc3284861e772bbcd66823fde5ae21fd2fdb51c62a211403730b916558", size = 6343, upload_time = "2025-04-22T14:54:24.164Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/79/7b/2c79738432f5c924bef5071f933bcc9efd0473bac3b4aa584a6f7c1c8df8/mypy_extensions-1.1.0-py3-none-any.whl", hash = "sha256:1be4cccdb0f2482337c4743e60421de3a356cd97508abadd57d47403e94f5505", size = 4963, upload_time = "2025-04-22T14:54:22.983Z" }, ] [[package]] @@ -590,34 +1019,38 @@ dependencies = [ [package.optional-dependencies] dev = [ - { name = "flake8", version = "5.0.4", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.8.1'" }, - { name = "flake8", version = "7.1.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.8.1' and python_full_version < '3.9'" }, - { name = "flake8", version = "7.3.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.9'" }, - { name = "isort", version = "5.13.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, - { name = "isort", version = "6.1.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version == '3.9.*'" }, - { name = "isort", version = "7.0.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.10'" }, + { name = "mypy", version = "1.14.1", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, + { name = "mypy", version = "1.18.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.9'" }, + { name = "pre-commit", version = "3.5.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, + { name = "pre-commit", version = "4.3.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version == '3.9.*'" }, + { name = "pre-commit", version = "4.5.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.10'" }, { name = "pytest", version = "8.3.5", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, { name = "pytest", version = "8.4.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version == '3.9.*'" }, { name = "pytest", version = "9.0.1", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.10'" }, + { name = "pytest-cov", version = "5.0.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, + { name = "pytest-cov", version = "7.0.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.9'" }, { name = "requests", version = "2.32.4", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, { name = "requests", version = "2.32.5", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.9'" }, + { name = "ruff" }, { name = "sphinx" }, { name = "sphinx-rtd-theme" }, ] [package.dev-dependencies] dev = [ - { name = "flake8", version = "5.0.4", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.8.1'" }, - { name = "flake8", version = "7.1.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.8.1' and python_full_version < '3.9'" }, - { name = "flake8", version = "7.3.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.9'" }, - { name = "isort", version = "5.13.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, - { name = "isort", version = "6.1.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version == '3.9.*'" }, - { name = "isort", version = "7.0.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.10'" }, + { name = "mypy", version = "1.14.1", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, + { name = "mypy", version = "1.18.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.9'" }, + { name = "pre-commit", version = "3.5.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, + { name = "pre-commit", version = "4.3.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version == '3.9.*'" }, + { name = "pre-commit", version = "4.5.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.10'" }, { name = "pytest", version = "8.3.5", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, { name = "pytest", version = "8.4.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version == '3.9.*'" }, { name = "pytest", version = "9.0.1", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.10'" }, + { name = "pytest-cov", version = "5.0.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, + { name = "pytest-cov", version = "7.0.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.9'" }, { name = "requests", version = "2.32.4", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, { name = "requests", version = "2.32.5", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.9'" }, + { name = "ruff" }, { name = "sphinx" }, { name = "sphinx-rtd-theme" }, ] @@ -625,10 +1058,12 @@ dev = [ [package.metadata] requires-dist = [ { name = "botocore", specifier = "==1.37.10" }, - { name = "flake8", marker = "extra == 'dev'" }, - { name = "isort", marker = "extra == 'dev'" }, + { name = "mypy", marker = "extra == 'dev'" }, + { name = "pre-commit", marker = "extra == 'dev'" }, { name = "pytest", marker = "extra == 'dev'" }, + { name = "pytest-cov", marker = "extra == 'dev'" }, { name = "requests", marker = "extra == 'dev'" }, + { name = "ruff", marker = "extra == 'dev'" }, { name = "sphinx", marker = "extra == 'dev'", specifier = "==5.3.0" }, { name = "sphinx-rtd-theme", marker = "extra == 'dev'" }, ] @@ -636,14 +1071,25 @@ provides-extras = ["dev"] [package.metadata.requires-dev] dev = [ - { name = "flake8" }, - { name = "isort" }, + { name = "mypy" }, + { name = "pre-commit" }, { name = "pytest" }, + { name = "pytest-cov" }, { name = "requests" }, + { name = "ruff" }, { name = "sphinx", specifier = "==5.3.0" }, { name = "sphinx-rtd-theme" }, ] +[[package]] +name = "nodeenv" +version = "1.9.1" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/43/16/fc88b08840de0e0a72a2f9d8c6bae36be573e475a6326ae854bcc549fc45/nodeenv-1.9.1.tar.gz", hash = "sha256:6ec12890a2dab7946721edbfbcd91f3319c6ccc9aec47be7c7e6b7011ee6645f", size = 47437, upload_time = "2024-06-04T18:44:11.171Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/d2/1d/1b658dbd2b9fa9c4c9f32accbfc0205d532c8c6194dc0f2a4c0428e7128a/nodeenv-1.9.1-py2.py3-none-any.whl", hash = "sha256:ba11c9782d29c27c70ffbdda2d7415098754709be8a7056d79a737cd901155c9", size = 22314, upload_time = "2024-06-04T18:44:08.352Z" }, +] + [[package]] name = "packaging" version = "25.0" @@ -654,103 +1100,133 @@ wheels = [ ] [[package]] -name = "pluggy" -version = "1.5.0" +name = "pathspec" +version = "0.12.1" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/ca/bc/f35b8446f4531a7cb215605d100cd88b7ac6f44ab3fc94870c120ab3adbf/pathspec-0.12.1.tar.gz", hash = "sha256:a482d51503a1ab33b1c67a6c3813a26953dbdc71c31dacaef9a838c4e29f5712", size = 51043, upload_time = "2023-12-10T22:30:45Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/cc/20/ff623b09d963f88bfde16306a54e12ee5ea43e9b597108672ff3a408aad6/pathspec-0.12.1-py3-none-any.whl", hash = "sha256:a0d503e138a4c123b27490a4f7beda6a01c6f288df0e4a8b79c7eb0dc7b4cc08", size = 31191, upload_time = "2023-12-10T22:30:43.14Z" }, +] + +[[package]] +name = "platformdirs" +version = "4.3.6" source = { registry = "https://pypi.org/simple" } resolution-markers = [ "python_full_version >= '3.8.1' and python_full_version < '3.9'", "python_full_version < '3.8.1'", ] -sdist = { url = "https://files.pythonhosted.org/packages/96/2d/02d4312c973c6050a18b314a5ad0b3210edb65a906f868e31c111dede4a6/pluggy-1.5.0.tar.gz", hash = "sha256:2cffa88e94fdc978c4c574f15f9e59b7f4201d439195c3715ca9e2486f1d0cf1", size = 67955, upload_time = "2024-04-20T21:34:42.531Z" } +sdist = { url = "https://files.pythonhosted.org/packages/13/fc/128cc9cb8f03208bdbf93d3aa862e16d376844a14f9a0ce5cf4507372de4/platformdirs-4.3.6.tar.gz", hash = "sha256:357fb2acbc885b0419afd3ce3ed34564c13c9b95c89360cd9563f73aa5e2b907", size = 21302, upload_time = "2024-09-17T19:06:50.688Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/88/5f/e351af9a41f866ac3f1fac4ca0613908d9a41741cfcf2228f4ad853b697d/pluggy-1.5.0-py3-none-any.whl", hash = "sha256:44e1ad92c8ca002de6377e165f3e0f1be63266ab4d554740532335b9d75ea669", size = 20556, upload_time = "2024-04-20T21:34:40.434Z" }, + { url = "https://files.pythonhosted.org/packages/3c/a6/bc1012356d8ece4d66dd75c4b9fc6c1f6650ddd5991e421177d9f8f671be/platformdirs-4.3.6-py3-none-any.whl", hash = "sha256:73e575e1408ab8103900836b97580d5307456908a03e92031bab39e4554cc3fb", size = 18439, upload_time = "2024-09-17T19:06:49.212Z" }, ] [[package]] -name = "pluggy" -version = "1.6.0" +name = "platformdirs" +version = "4.4.0" source = { registry = "https://pypi.org/simple" } resolution-markers = [ - "python_full_version >= '3.10'", "python_full_version == '3.9.*'", ] -sdist = { url = "https://files.pythonhosted.org/packages/f9/e2/3e91f31a7d2b083fe6ef3fa267035b518369d9511ffab804f839851d2779/pluggy-1.6.0.tar.gz", hash = "sha256:7dcc130b76258d33b90f61b658791dede3486c3e6bfb003ee5c9bfb396dd22f3", size = 69412, upload_time = "2025-05-15T12:30:07.975Z" } +sdist = { url = "https://files.pythonhosted.org/packages/23/e8/21db9c9987b0e728855bd57bff6984f67952bea55d6f75e055c46b5383e8/platformdirs-4.4.0.tar.gz", hash = "sha256:ca753cf4d81dc309bc67b0ea38fd15dc97bc30ce419a7f58d13eb3bf14c4febf", size = 21634, upload_time = "2025-08-26T14:32:04.268Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/54/20/4d324d65cc6d9205fabedc306948156824eb9f0ee1633355a8f7ec5c66bf/pluggy-1.6.0-py3-none-any.whl", hash = "sha256:e920276dd6813095e9377c0bc5566d94c932c33b27a3e3945d8389c374dd4746", size = 20538, upload_time = "2025-05-15T12:30:06.134Z" }, + { url = "https://files.pythonhosted.org/packages/40/4b/2028861e724d3bd36227adfa20d3fd24c3fc6d52032f4a93c133be5d17ce/platformdirs-4.4.0-py3-none-any.whl", hash = "sha256:abd01743f24e5287cd7a5db3752faf1a2d65353f38ec26d98e25a6db65958c85", size = 18654, upload_time = "2025-08-26T14:32:02.735Z" }, ] [[package]] -name = "pycodestyle" -version = "2.9.1" +name = "platformdirs" +version = "4.5.0" source = { registry = "https://pypi.org/simple" } resolution-markers = [ - "python_full_version < '3.8.1'", + "python_full_version >= '3.10'", ] -sdist = { url = "https://files.pythonhosted.org/packages/b6/83/5bcaedba1f47200f0665ceb07bcb00e2be123192742ee0edfb66b600e5fd/pycodestyle-2.9.1.tar.gz", hash = "sha256:2c9607871d58c76354b697b42f5d57e1ada7d261c261efac224b664affdc5785", size = 102127, upload_time = "2022-08-03T23:13:29.715Z" } +sdist = { url = "https://files.pythonhosted.org/packages/61/33/9611380c2bdb1225fdef633e2a9610622310fed35ab11dac9620972ee088/platformdirs-4.5.0.tar.gz", hash = "sha256:70ddccdd7c99fc5942e9fc25636a8b34d04c24b335100223152c2803e4063312", size = 21632, upload_time = "2025-10-08T17:44:48.791Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/67/e4/fc77f1039c34b3612c4867b69cbb2b8a4e569720b1f19b0637002ee03aff/pycodestyle-2.9.1-py2.py3-none-any.whl", hash = "sha256:d1735fc58b418fd7c5f658d28d943854f8a849b01a5d0a1e6f3f3fdd0166804b", size = 41493, upload_time = "2022-08-03T23:13:27.416Z" }, + { url = "https://files.pythonhosted.org/packages/73/cb/ac7874b3e5d58441674fb70742e6c374b28b0c7cb988d37d991cde47166c/platformdirs-4.5.0-py3-none-any.whl", hash = "sha256:e578a81bb873cbb89a41fcc904c7ef523cc18284b7e3b3ccf06aca1403b7ebd3", size = 18651, upload_time = "2025-10-08T17:44:47.223Z" }, ] [[package]] -name = "pycodestyle" -version = "2.12.1" +name = "pluggy" +version = "1.5.0" source = { registry = "https://pypi.org/simple" } resolution-markers = [ "python_full_version >= '3.8.1' and python_full_version < '3.9'", + "python_full_version < '3.8.1'", ] -sdist = { url = "https://files.pythonhosted.org/packages/43/aa/210b2c9aedd8c1cbeea31a50e42050ad56187754b34eb214c46709445801/pycodestyle-2.12.1.tar.gz", hash = "sha256:6838eae08bbce4f6accd5d5572075c63626a15ee3e6f842df996bf62f6d73521", size = 39232, upload_time = "2024-08-04T20:26:54.576Z" } +sdist = { url = "https://files.pythonhosted.org/packages/96/2d/02d4312c973c6050a18b314a5ad0b3210edb65a906f868e31c111dede4a6/pluggy-1.5.0.tar.gz", hash = "sha256:2cffa88e94fdc978c4c574f15f9e59b7f4201d439195c3715ca9e2486f1d0cf1", size = 67955, upload_time = "2024-04-20T21:34:42.531Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/3a/d8/a211b3f85e99a0daa2ddec96c949cac6824bd305b040571b82a03dd62636/pycodestyle-2.12.1-py2.py3-none-any.whl", hash = "sha256:46f0fb92069a7c28ab7bb558f05bfc0110dac69a0cd23c61ea0040283a9d78b3", size = 31284, upload_time = "2024-08-04T20:26:53.173Z" }, + { url = "https://files.pythonhosted.org/packages/88/5f/e351af9a41f866ac3f1fac4ca0613908d9a41741cfcf2228f4ad853b697d/pluggy-1.5.0-py3-none-any.whl", hash = "sha256:44e1ad92c8ca002de6377e165f3e0f1be63266ab4d554740532335b9d75ea669", size = 20556, upload_time = "2024-04-20T21:34:40.434Z" }, ] [[package]] -name = "pycodestyle" -version = "2.14.0" +name = "pluggy" +version = "1.6.0" source = { registry = "https://pypi.org/simple" } resolution-markers = [ "python_full_version >= '3.10'", "python_full_version == '3.9.*'", ] -sdist = { url = "https://files.pythonhosted.org/packages/11/e0/abfd2a0d2efe47670df87f3e3a0e2edda42f055053c85361f19c0e2c1ca8/pycodestyle-2.14.0.tar.gz", hash = "sha256:c4b5b517d278089ff9d0abdec919cd97262a3367449ea1c8b49b91529167b783", size = 39472, upload_time = "2025-06-20T18:49:48.75Z" } +sdist = { url = "https://files.pythonhosted.org/packages/f9/e2/3e91f31a7d2b083fe6ef3fa267035b518369d9511ffab804f839851d2779/pluggy-1.6.0.tar.gz", hash = "sha256:7dcc130b76258d33b90f61b658791dede3486c3e6bfb003ee5c9bfb396dd22f3", size = 69412, upload_time = "2025-05-15T12:30:07.975Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/d7/27/a58ddaf8c588a3ef080db9d0b7e0b97215cee3a45df74f3a94dbbf5c893a/pycodestyle-2.14.0-py2.py3-none-any.whl", hash = "sha256:dd6bf7cb4ee77f8e016f9c8e74a35ddd9f67e1d5fd4184d86c3b98e07099f42d", size = 31594, upload_time = "2025-06-20T18:49:47.491Z" }, + { url = "https://files.pythonhosted.org/packages/54/20/4d324d65cc6d9205fabedc306948156824eb9f0ee1633355a8f7ec5c66bf/pluggy-1.6.0-py3-none-any.whl", hash = "sha256:e920276dd6813095e9377c0bc5566d94c932c33b27a3e3945d8389c374dd4746", size = 20538, upload_time = "2025-05-15T12:30:06.134Z" }, ] [[package]] -name = "pyflakes" -version = "2.5.0" +name = "pre-commit" +version = "3.5.0" source = { registry = "https://pypi.org/simple" } resolution-markers = [ + "python_full_version >= '3.8.1' and python_full_version < '3.9'", "python_full_version < '3.8.1'", ] -sdist = { url = "https://files.pythonhosted.org/packages/07/92/f0cb5381f752e89a598dd2850941e7f570ac3cb8ea4a344854de486db152/pyflakes-2.5.0.tar.gz", hash = "sha256:491feb020dca48ccc562a8c0cbe8df07ee13078df59813b83959cbdada312ea3", size = 66388, upload_time = "2022-07-30T17:29:05.816Z" } +dependencies = [ + { name = "cfgv", version = "3.4.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, + { name = "identify", version = "2.6.1", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, + { name = "nodeenv", marker = "python_full_version < '3.9'" }, + { name = "pyyaml", marker = "python_full_version < '3.9'" }, + { name = "virtualenv", marker = "python_full_version < '3.9'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/04/b3/4ae08d21eb097162f5aad37f4585f8069a86402ed7f5362cc9ae097f9572/pre_commit-3.5.0.tar.gz", hash = "sha256:5804465c675b659b0862f07907f96295d490822a450c4c40e747d0b1c6ebcb32", size = 177079, upload_time = "2023-10-13T15:57:48.334Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/dc/13/63178f59f74e53acc2165aee4b002619a3cfa7eeaeac989a9eb41edf364e/pyflakes-2.5.0-py2.py3-none-any.whl", hash = "sha256:4579f67d887f804e67edb544428f264b7b24f435b263c4614f384135cea553d2", size = 66116, upload_time = "2022-07-30T17:29:04.179Z" }, + { url = "https://files.pythonhosted.org/packages/6c/75/526915fedf462e05eeb1c75ceaf7e3f9cde7b5ce6f62740fe5f7f19a0050/pre_commit-3.5.0-py2.py3-none-any.whl", hash = "sha256:841dc9aef25daba9a0238cd27984041fa0467b4199fc4852e27950664919f660", size = 203698, upload_time = "2023-10-13T15:57:46.378Z" }, ] [[package]] -name = "pyflakes" -version = "3.2.0" +name = "pre-commit" +version = "4.3.0" source = { registry = "https://pypi.org/simple" } resolution-markers = [ - "python_full_version >= '3.8.1' and python_full_version < '3.9'", + "python_full_version == '3.9.*'", ] -sdist = { url = "https://files.pythonhosted.org/packages/57/f9/669d8c9c86613c9d568757c7f5824bd3197d7b1c6c27553bc5618a27cce2/pyflakes-3.2.0.tar.gz", hash = "sha256:1c61603ff154621fb2a9172037d84dca3500def8c8b630657d1701f026f8af3f", size = 63788, upload_time = "2024-01-05T00:28:47.703Z" } +dependencies = [ + { name = "cfgv", version = "3.4.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version == '3.9.*'" }, + { name = "identify", version = "2.6.15", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version == '3.9.*'" }, + { name = "nodeenv", marker = "python_full_version == '3.9.*'" }, + { name = "pyyaml", marker = "python_full_version == '3.9.*'" }, + { name = "virtualenv", marker = "python_full_version == '3.9.*'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/ff/29/7cf5bbc236333876e4b41f56e06857a87937ce4bf91e117a6991a2dbb02a/pre_commit-4.3.0.tar.gz", hash = "sha256:499fe450cc9d42e9d58e606262795ecb64dd05438943c62b66f6a8673da30b16", size = 193792, upload_time = "2025-08-09T18:56:14.651Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/d4/d7/f1b7db88d8e4417c5d47adad627a93547f44bdc9028372dbd2313f34a855/pyflakes-3.2.0-py2.py3-none-any.whl", hash = "sha256:84b5be138a2dfbb40689ca07e2152deb896a65c3a3e24c251c5c62489568074a", size = 62725, upload_time = "2024-01-05T00:28:45.903Z" }, + { url = "https://files.pythonhosted.org/packages/5b/a5/987a405322d78a73b66e39e4a90e4ef156fd7141bf71df987e50717c321b/pre_commit-4.3.0-py2.py3-none-any.whl", hash = "sha256:2b0747ad7e6e967169136edffee14c16e148a778a54e4f967921aa1ebf2308d8", size = 220965, upload_time = "2025-08-09T18:56:13.192Z" }, ] [[package]] -name = "pyflakes" -version = "3.4.0" +name = "pre-commit" +version = "4.5.0" source = { registry = "https://pypi.org/simple" } resolution-markers = [ "python_full_version >= '3.10'", - "python_full_version == '3.9.*'", ] -sdist = { url = "https://files.pythonhosted.org/packages/45/dc/fd034dc20b4b264b3d015808458391acbf9df40b1e54750ef175d39180b1/pyflakes-3.4.0.tar.gz", hash = "sha256:b24f96fafb7d2ab0ec5075b7350b3d2d2218eab42003821c06344973d3ea2f58", size = 64669, upload_time = "2025-06-20T18:45:27.834Z" } +dependencies = [ + { name = "cfgv", version = "3.5.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.10'" }, + { name = "identify", version = "2.6.15", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.10'" }, + { name = "nodeenv", marker = "python_full_version >= '3.10'" }, + { name = "pyyaml", marker = "python_full_version >= '3.10'" }, + { name = "virtualenv", marker = "python_full_version >= '3.10'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/f4/9b/6a4ffb4ed980519da959e1cf3122fc6cb41211daa58dbae1c73c0e519a37/pre_commit-4.5.0.tar.gz", hash = "sha256:dc5a065e932b19fc1d4c653c6939068fe54325af8e741e74e88db4d28a4dd66b", size = 198428, upload_time = "2025-11-22T21:02:42.304Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/c2/2f/81d580a0fb83baeb066698975cb14a618bdbed7720678566f1b046a95fe8/pyflakes-3.4.0-py2.py3-none-any.whl", hash = "sha256:f742a7dbd0d9cb9ea41e9a24a918996e8170c799fa528688d40dd582c8265f4f", size = 63551, upload_time = "2025-06-20T18:45:26.937Z" }, + { url = "https://files.pythonhosted.org/packages/5d/c4/b2d28e9d2edf4f1713eb3c29307f1a63f3d67cf09bdda29715a36a68921a/pre_commit-4.5.0-py2.py3-none-any.whl", hash = "sha256:25e2ce09595174d9c97860a95609f9f852c0614ba602de3561e267547f2335e1", size = 226429, upload_time = "2025-11-22T21:02:40.836Z" }, ] [[package]] @@ -825,6 +1301,43 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/0b/8b/6300fb80f858cda1c51ffa17075df5d846757081d11ab4aa35cef9e6258b/pytest-9.0.1-py3-none-any.whl", hash = "sha256:67be0030d194df2dfa7b556f2e56fb3c3315bd5c8822c6951162b92b32ce7dad", size = 373668, upload_time = "2025-11-12T13:05:07.379Z" }, ] +[[package]] +name = "pytest-cov" +version = "5.0.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.8.1' and python_full_version < '3.9'", + "python_full_version < '3.8.1'", +] +dependencies = [ + { name = "coverage", version = "7.6.1", source = { registry = "https://pypi.org/simple" }, extra = ["toml"], marker = "python_full_version < '3.9'" }, + { name = "pytest", version = "8.3.5", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/74/67/00efc8d11b630c56f15f4ad9c7f9223f1e5ec275aaae3fa9118c6a223ad2/pytest-cov-5.0.0.tar.gz", hash = "sha256:5837b58e9f6ebd335b0f8060eecce69b662415b16dc503883a02f45dfeb14857", size = 63042, upload_time = "2024-03-24T20:16:34.856Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/78/3a/af5b4fa5961d9a1e6237b530eb87dd04aea6eb83da09d2a4073d81b54ccf/pytest_cov-5.0.0-py3-none-any.whl", hash = "sha256:4f0764a1219df53214206bf1feea4633c3b558a2925c8b59f144f682861ce652", size = 21990, upload_time = "2024-03-24T20:16:32.444Z" }, +] + +[[package]] +name = "pytest-cov" +version = "7.0.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.10'", + "python_full_version == '3.9.*'", +] +dependencies = [ + { name = "coverage", version = "7.10.7", source = { registry = "https://pypi.org/simple" }, extra = ["toml"], marker = "python_full_version == '3.9.*'" }, + { name = "coverage", version = "7.12.0", source = { registry = "https://pypi.org/simple" }, extra = ["toml"], marker = "python_full_version >= '3.10'" }, + { name = "pluggy", version = "1.6.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.9'" }, + { name = "pytest", version = "8.4.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version == '3.9.*'" }, + { name = "pytest", version = "9.0.1", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.10'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/5e/f7/c933acc76f5208b3b00089573cf6a2bc26dc80a8aece8f52bb7d6b1855ca/pytest_cov-7.0.0.tar.gz", hash = "sha256:33c97eda2e049a0c5298e91f519302a1334c26ac65c1a483d6206fd458361af1", size = 54328, upload_time = "2025-09-09T10:57:02.113Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/ee/49/1377b49de7d0c1ce41292161ea0f721913fa8722c19fb9c1e3aa0367eecb/pytest_cov-7.0.0-py3-none-any.whl", hash = "sha256:3b8e9558b16cc1479da72058bdecf8073661c7f57f7d3c5f22a1c23507f2d861", size = 22424, upload_time = "2025-09-09T10:57:00.695Z" }, +] + [[package]] name = "python-dateutil" version = "2.9.0.post0" @@ -846,6 +1359,86 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/81/c4/34e93fe5f5429d7570ec1fa436f1986fb1f00c3e0f43a589fe2bbcd22c3f/pytz-2025.2-py2.py3-none-any.whl", hash = "sha256:5ddf76296dd8c44c26eb8f4b6f35488f3ccbf6fbbd7adee0b7262d43f0ec2f00", size = 509225, upload_time = "2025-03-25T02:24:58.468Z" }, ] +[[package]] +name = "pyyaml" +version = "6.0.3" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/05/8e/961c0007c59b8dd7729d542c61a4d537767a59645b82a0b521206e1e25c2/pyyaml-6.0.3.tar.gz", hash = "sha256:d76623373421df22fb4cf8817020cbb7ef15c725b9d5e45f17e189bfc384190f", size = 130960, upload_time = "2025-09-25T21:33:16.546Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/0d/a2/09f67a3589cb4320fb5ce90d3fd4c9752636b8b6ad8f34b54d76c5a54693/PyYAML-6.0.3-cp38-cp38-macosx_10_13_x86_64.whl", hash = "sha256:c2514fceb77bc5e7a2f7adfaa1feb2fb311607c9cb518dbc378688ec73d8292f", size = 186824, upload_time = "2025-09-29T20:27:35.918Z" }, + { url = "https://files.pythonhosted.org/packages/02/72/d972384252432d57f248767556ac083793292a4adf4e2d85dfe785ec2659/PyYAML-6.0.3-cp38-cp38-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:9c57bb8c96f6d1808c030b1687b9b5fb476abaa47f0db9c0101f5e9f394e97f4", size = 795069, upload_time = "2025-09-29T20:27:38.15Z" }, + { url = "https://files.pythonhosted.org/packages/a7/3b/6c58ac0fa7c4e1b35e48024eb03d00817438310447f93ef4431673c24138/PyYAML-6.0.3-cp38-cp38-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:efd7b85f94a6f21e4932043973a7ba2613b059c4a000551892ac9f1d11f5baf3", size = 862585, upload_time = "2025-09-29T20:27:39.715Z" }, + { url = "https://files.pythonhosted.org/packages/25/a2/b725b61ac76a75583ae7104b3209f75ea44b13cfd026aa535ece22b7f22e/PyYAML-6.0.3-cp38-cp38-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:22ba7cfcad58ef3ecddc7ed1db3409af68d023b7f940da23c6c2a1890976eda6", size = 806018, upload_time = "2025-09-29T20:27:41.444Z" }, + { url = "https://files.pythonhosted.org/packages/6f/b0/b2227677b2d1036d84f5ee95eb948e7af53d59fe3e4328784e4d290607e0/PyYAML-6.0.3-cp38-cp38-musllinux_1_2_x86_64.whl", hash = "sha256:6344df0d5755a2c9a276d4473ae6b90647e216ab4757f8426893b5dd2ac3f369", size = 802822, upload_time = "2025-09-29T20:27:42.885Z" }, + { url = "https://files.pythonhosted.org/packages/99/a5/718a8ea22521e06ef19f91945766a892c5ceb1855df6adbde67d997ea7ed/PyYAML-6.0.3-cp38-cp38-win32.whl", hash = "sha256:3ff07ec89bae51176c0549bc4c63aa6202991da2d9a6129d7aef7f1407d3f295", size = 143744, upload_time = "2025-09-29T20:27:44.487Z" }, + { url = "https://files.pythonhosted.org/packages/76/b2/2b69cee94c9eb215216fc05778675c393e3aa541131dc910df8e52c83776/PyYAML-6.0.3-cp38-cp38-win_amd64.whl", hash = "sha256:5cf4e27da7e3fbed4d6c3d8e797387aaad68102272f8f9752883bc32d61cb87b", size = 160082, upload_time = "2025-09-29T20:27:46.049Z" }, + { url = "https://files.pythonhosted.org/packages/f4/a0/39350dd17dd6d6c6507025c0e53aef67a9293a6d37d3511f23ea510d5800/pyyaml-6.0.3-cp310-cp310-macosx_10_13_x86_64.whl", hash = "sha256:214ed4befebe12df36bcc8bc2b64b396ca31be9304b8f59e25c11cf94a4c033b", size = 184227, upload_time = "2025-09-25T21:31:46.04Z" }, + { url = "https://files.pythonhosted.org/packages/05/14/52d505b5c59ce73244f59c7a50ecf47093ce4765f116cdb98286a71eeca2/pyyaml-6.0.3-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:02ea2dfa234451bbb8772601d7b8e426c2bfa197136796224e50e35a78777956", size = 174019, upload_time = "2025-09-25T21:31:47.706Z" }, + { url = "https://files.pythonhosted.org/packages/43/f7/0e6a5ae5599c838c696adb4e6330a59f463265bfa1e116cfd1fbb0abaaae/pyyaml-6.0.3-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:b30236e45cf30d2b8e7b3e85881719e98507abed1011bf463a8fa23e9c3e98a8", size = 740646, upload_time = "2025-09-25T21:31:49.21Z" }, + { url = "https://files.pythonhosted.org/packages/2f/3a/61b9db1d28f00f8fd0ae760459a5c4bf1b941baf714e207b6eb0657d2578/pyyaml-6.0.3-cp310-cp310-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:66291b10affd76d76f54fad28e22e51719ef9ba22b29e1d7d03d6777a9174198", size = 840793, upload_time = "2025-09-25T21:31:50.735Z" }, + { url = "https://files.pythonhosted.org/packages/7a/1e/7acc4f0e74c4b3d9531e24739e0ab832a5edf40e64fbae1a9c01941cabd7/pyyaml-6.0.3-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:9c7708761fccb9397fe64bbc0395abcae8c4bf7b0eac081e12b809bf47700d0b", size = 770293, upload_time = "2025-09-25T21:31:51.828Z" }, + { url = "https://files.pythonhosted.org/packages/8b/ef/abd085f06853af0cd59fa5f913d61a8eab65d7639ff2a658d18a25d6a89d/pyyaml-6.0.3-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:418cf3f2111bc80e0933b2cd8cd04f286338bb88bdc7bc8e6dd775ebde60b5e0", size = 732872, upload_time = "2025-09-25T21:31:53.282Z" }, + { url = "https://files.pythonhosted.org/packages/1f/15/2bc9c8faf6450a8b3c9fc5448ed869c599c0a74ba2669772b1f3a0040180/pyyaml-6.0.3-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:5e0b74767e5f8c593e8c9b5912019159ed0533c70051e9cce3e8b6aa699fcd69", size = 758828, upload_time = "2025-09-25T21:31:54.807Z" }, + { url = "https://files.pythonhosted.org/packages/a3/00/531e92e88c00f4333ce359e50c19b8d1de9fe8d581b1534e35ccfbc5f393/pyyaml-6.0.3-cp310-cp310-win32.whl", hash = "sha256:28c8d926f98f432f88adc23edf2e6d4921ac26fb084b028c733d01868d19007e", size = 142415, upload_time = "2025-09-25T21:31:55.885Z" }, + { url = "https://files.pythonhosted.org/packages/2a/fa/926c003379b19fca39dd4634818b00dec6c62d87faf628d1394e137354d4/pyyaml-6.0.3-cp310-cp310-win_amd64.whl", hash = "sha256:bdb2c67c6c1390b63c6ff89f210c8fd09d9a1217a465701eac7316313c915e4c", size = 158561, upload_time = "2025-09-25T21:31:57.406Z" }, + { url = "https://files.pythonhosted.org/packages/6d/16/a95b6757765b7b031c9374925bb718d55e0a9ba8a1b6a12d25962ea44347/pyyaml-6.0.3-cp311-cp311-macosx_10_13_x86_64.whl", hash = "sha256:44edc647873928551a01e7a563d7452ccdebee747728c1080d881d68af7b997e", size = 185826, upload_time = "2025-09-25T21:31:58.655Z" }, + { url = "https://files.pythonhosted.org/packages/16/19/13de8e4377ed53079ee996e1ab0a9c33ec2faf808a4647b7b4c0d46dd239/pyyaml-6.0.3-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:652cb6edd41e718550aad172851962662ff2681490a8a711af6a4d288dd96824", size = 175577, upload_time = "2025-09-25T21:32:00.088Z" }, + { url = "https://files.pythonhosted.org/packages/0c/62/d2eb46264d4b157dae1275b573017abec435397aa59cbcdab6fc978a8af4/pyyaml-6.0.3-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:10892704fc220243f5305762e276552a0395f7beb4dbf9b14ec8fd43b57f126c", size = 775556, upload_time = "2025-09-25T21:32:01.31Z" }, + { url = "https://files.pythonhosted.org/packages/10/cb/16c3f2cf3266edd25aaa00d6c4350381c8b012ed6f5276675b9eba8d9ff4/pyyaml-6.0.3-cp311-cp311-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:850774a7879607d3a6f50d36d04f00ee69e7fc816450e5f7e58d7f17f1ae5c00", size = 882114, upload_time = "2025-09-25T21:32:03.376Z" }, + { url = "https://files.pythonhosted.org/packages/71/60/917329f640924b18ff085ab889a11c763e0b573da888e8404ff486657602/pyyaml-6.0.3-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:b8bb0864c5a28024fac8a632c443c87c5aa6f215c0b126c449ae1a150412f31d", size = 806638, upload_time = "2025-09-25T21:32:04.553Z" }, + { url = "https://files.pythonhosted.org/packages/dd/6f/529b0f316a9fd167281a6c3826b5583e6192dba792dd55e3203d3f8e655a/pyyaml-6.0.3-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:1d37d57ad971609cf3c53ba6a7e365e40660e3be0e5175fa9f2365a379d6095a", size = 767463, upload_time = "2025-09-25T21:32:06.152Z" }, + { url = "https://files.pythonhosted.org/packages/f2/6a/b627b4e0c1dd03718543519ffb2f1deea4a1e6d42fbab8021936a4d22589/pyyaml-6.0.3-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:37503bfbfc9d2c40b344d06b2199cf0e96e97957ab1c1b546fd4f87e53e5d3e4", size = 794986, upload_time = "2025-09-25T21:32:07.367Z" }, + { url = "https://files.pythonhosted.org/packages/45/91/47a6e1c42d9ee337c4839208f30d9f09caa9f720ec7582917b264defc875/pyyaml-6.0.3-cp311-cp311-win32.whl", hash = "sha256:8098f252adfa6c80ab48096053f512f2321f0b998f98150cea9bd23d83e1467b", size = 142543, upload_time = "2025-09-25T21:32:08.95Z" }, + { url = "https://files.pythonhosted.org/packages/da/e3/ea007450a105ae919a72393cb06f122f288ef60bba2dc64b26e2646fa315/pyyaml-6.0.3-cp311-cp311-win_amd64.whl", hash = "sha256:9f3bfb4965eb874431221a3ff3fdcddc7e74e3b07799e0e84ca4a0f867d449bf", size = 158763, upload_time = "2025-09-25T21:32:09.96Z" }, + { url = "https://files.pythonhosted.org/packages/d1/33/422b98d2195232ca1826284a76852ad5a86fe23e31b009c9886b2d0fb8b2/pyyaml-6.0.3-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:7f047e29dcae44602496db43be01ad42fc6f1cc0d8cd6c83d342306c32270196", size = 182063, upload_time = "2025-09-25T21:32:11.445Z" }, + { url = "https://files.pythonhosted.org/packages/89/a0/6cf41a19a1f2f3feab0e9c0b74134aa2ce6849093d5517a0c550fe37a648/pyyaml-6.0.3-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:fc09d0aa354569bc501d4e787133afc08552722d3ab34836a80547331bb5d4a0", size = 173973, upload_time = "2025-09-25T21:32:12.492Z" }, + { url = "https://files.pythonhosted.org/packages/ed/23/7a778b6bd0b9a8039df8b1b1d80e2e2ad78aa04171592c8a5c43a56a6af4/pyyaml-6.0.3-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:9149cad251584d5fb4981be1ecde53a1ca46c891a79788c0df828d2f166bda28", size = 775116, upload_time = "2025-09-25T21:32:13.652Z" }, + { url = "https://files.pythonhosted.org/packages/65/30/d7353c338e12baef4ecc1b09e877c1970bd3382789c159b4f89d6a70dc09/pyyaml-6.0.3-cp312-cp312-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:5fdec68f91a0c6739b380c83b951e2c72ac0197ace422360e6d5a959d8d97b2c", size = 844011, upload_time = "2025-09-25T21:32:15.21Z" }, + { url = "https://files.pythonhosted.org/packages/8b/9d/b3589d3877982d4f2329302ef98a8026e7f4443c765c46cfecc8858c6b4b/pyyaml-6.0.3-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:ba1cc08a7ccde2d2ec775841541641e4548226580ab850948cbfda66a1befcdc", size = 807870, upload_time = "2025-09-25T21:32:16.431Z" }, + { url = "https://files.pythonhosted.org/packages/05/c0/b3be26a015601b822b97d9149ff8cb5ead58c66f981e04fedf4e762f4bd4/pyyaml-6.0.3-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:8dc52c23056b9ddd46818a57b78404882310fb473d63f17b07d5c40421e47f8e", size = 761089, upload_time = "2025-09-25T21:32:17.56Z" }, + { url = "https://files.pythonhosted.org/packages/be/8e/98435a21d1d4b46590d5459a22d88128103f8da4c2d4cb8f14f2a96504e1/pyyaml-6.0.3-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:41715c910c881bc081f1e8872880d3c650acf13dfa8214bad49ed4cede7c34ea", size = 790181, upload_time = "2025-09-25T21:32:18.834Z" }, + { url = "https://files.pythonhosted.org/packages/74/93/7baea19427dcfbe1e5a372d81473250b379f04b1bd3c4c5ff825e2327202/pyyaml-6.0.3-cp312-cp312-win32.whl", hash = "sha256:96b533f0e99f6579b3d4d4995707cf36df9100d67e0c8303a0c55b27b5f99bc5", size = 137658, upload_time = "2025-09-25T21:32:20.209Z" }, + { url = "https://files.pythonhosted.org/packages/86/bf/899e81e4cce32febab4fb42bb97dcdf66bc135272882d1987881a4b519e9/pyyaml-6.0.3-cp312-cp312-win_amd64.whl", hash = "sha256:5fcd34e47f6e0b794d17de1b4ff496c00986e1c83f7ab2fb8fcfe9616ff7477b", size = 154003, upload_time = "2025-09-25T21:32:21.167Z" }, + { url = "https://files.pythonhosted.org/packages/1a/08/67bd04656199bbb51dbed1439b7f27601dfb576fb864099c7ef0c3e55531/pyyaml-6.0.3-cp312-cp312-win_arm64.whl", hash = "sha256:64386e5e707d03a7e172c0701abfb7e10f0fb753ee1d773128192742712a98fd", size = 140344, upload_time = "2025-09-25T21:32:22.617Z" }, + { url = "https://files.pythonhosted.org/packages/d1/11/0fd08f8192109f7169db964b5707a2f1e8b745d4e239b784a5a1dd80d1db/pyyaml-6.0.3-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:8da9669d359f02c0b91ccc01cac4a67f16afec0dac22c2ad09f46bee0697eba8", size = 181669, upload_time = "2025-09-25T21:32:23.673Z" }, + { url = "https://files.pythonhosted.org/packages/b1/16/95309993f1d3748cd644e02e38b75d50cbc0d9561d21f390a76242ce073f/pyyaml-6.0.3-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:2283a07e2c21a2aa78d9c4442724ec1eb15f5e42a723b99cb3d822d48f5f7ad1", size = 173252, upload_time = "2025-09-25T21:32:25.149Z" }, + { url = "https://files.pythonhosted.org/packages/50/31/b20f376d3f810b9b2371e72ef5adb33879b25edb7a6d072cb7ca0c486398/pyyaml-6.0.3-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:ee2922902c45ae8ccada2c5b501ab86c36525b883eff4255313a253a3160861c", size = 767081, upload_time = "2025-09-25T21:32:26.575Z" }, + { url = "https://files.pythonhosted.org/packages/49/1e/a55ca81e949270d5d4432fbbd19dfea5321eda7c41a849d443dc92fd1ff7/pyyaml-6.0.3-cp313-cp313-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:a33284e20b78bd4a18c8c2282d549d10bc8408a2a7ff57653c0cf0b9be0afce5", size = 841159, upload_time = "2025-09-25T21:32:27.727Z" }, + { url = "https://files.pythonhosted.org/packages/74/27/e5b8f34d02d9995b80abcef563ea1f8b56d20134d8f4e5e81733b1feceb2/pyyaml-6.0.3-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:0f29edc409a6392443abf94b9cf89ce99889a1dd5376d94316ae5145dfedd5d6", size = 801626, upload_time = "2025-09-25T21:32:28.878Z" }, + { url = "https://files.pythonhosted.org/packages/f9/11/ba845c23988798f40e52ba45f34849aa8a1f2d4af4b798588010792ebad6/pyyaml-6.0.3-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:f7057c9a337546edc7973c0d3ba84ddcdf0daa14533c2065749c9075001090e6", size = 753613, upload_time = "2025-09-25T21:32:30.178Z" }, + { url = "https://files.pythonhosted.org/packages/3d/e0/7966e1a7bfc0a45bf0a7fb6b98ea03fc9b8d84fa7f2229e9659680b69ee3/pyyaml-6.0.3-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:eda16858a3cab07b80edaf74336ece1f986ba330fdb8ee0d6c0d68fe82bc96be", size = 794115, upload_time = "2025-09-25T21:32:31.353Z" }, + { url = "https://files.pythonhosted.org/packages/de/94/980b50a6531b3019e45ddeada0626d45fa85cbe22300844a7983285bed3b/pyyaml-6.0.3-cp313-cp313-win32.whl", hash = "sha256:d0eae10f8159e8fdad514efdc92d74fd8d682c933a6dd088030f3834bc8e6b26", size = 137427, upload_time = "2025-09-25T21:32:32.58Z" }, + { url = "https://files.pythonhosted.org/packages/97/c9/39d5b874e8b28845e4ec2202b5da735d0199dbe5b8fb85f91398814a9a46/pyyaml-6.0.3-cp313-cp313-win_amd64.whl", hash = "sha256:79005a0d97d5ddabfeeea4cf676af11e647e41d81c9a7722a193022accdb6b7c", size = 154090, upload_time = "2025-09-25T21:32:33.659Z" }, + { url = "https://files.pythonhosted.org/packages/73/e8/2bdf3ca2090f68bb3d75b44da7bbc71843b19c9f2b9cb9b0f4ab7a5a4329/pyyaml-6.0.3-cp313-cp313-win_arm64.whl", hash = "sha256:5498cd1645aa724a7c71c8f378eb29ebe23da2fc0d7a08071d89469bf1d2defb", size = 140246, upload_time = "2025-09-25T21:32:34.663Z" }, + { url = "https://files.pythonhosted.org/packages/9d/8c/f4bd7f6465179953d3ac9bc44ac1a8a3e6122cf8ada906b4f96c60172d43/pyyaml-6.0.3-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:8d1fab6bb153a416f9aeb4b8763bc0f22a5586065f86f7664fc23339fc1c1fac", size = 181814, upload_time = "2025-09-25T21:32:35.712Z" }, + { url = "https://files.pythonhosted.org/packages/bd/9c/4d95bb87eb2063d20db7b60faa3840c1b18025517ae857371c4dd55a6b3a/pyyaml-6.0.3-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:34d5fcd24b8445fadc33f9cf348c1047101756fd760b4dacb5c3e99755703310", size = 173809, upload_time = "2025-09-25T21:32:36.789Z" }, + { url = "https://files.pythonhosted.org/packages/92/b5/47e807c2623074914e29dabd16cbbdd4bf5e9b2db9f8090fa64411fc5382/pyyaml-6.0.3-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:501a031947e3a9025ed4405a168e6ef5ae3126c59f90ce0cd6f2bfc477be31b7", size = 766454, upload_time = "2025-09-25T21:32:37.966Z" }, + { url = "https://files.pythonhosted.org/packages/02/9e/e5e9b168be58564121efb3de6859c452fccde0ab093d8438905899a3a483/pyyaml-6.0.3-cp314-cp314-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:b3bc83488de33889877a0f2543ade9f70c67d66d9ebb4ac959502e12de895788", size = 836355, upload_time = "2025-09-25T21:32:39.178Z" }, + { url = "https://files.pythonhosted.org/packages/88/f9/16491d7ed2a919954993e48aa941b200f38040928474c9e85ea9e64222c3/pyyaml-6.0.3-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:c458b6d084f9b935061bc36216e8a69a7e293a2f1e68bf956dcd9e6cbcd143f5", size = 794175, upload_time = "2025-09-25T21:32:40.865Z" }, + { url = "https://files.pythonhosted.org/packages/dd/3f/5989debef34dc6397317802b527dbbafb2b4760878a53d4166579111411e/pyyaml-6.0.3-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:7c6610def4f163542a622a73fb39f534f8c101d690126992300bf3207eab9764", size = 755228, upload_time = "2025-09-25T21:32:42.084Z" }, + { url = "https://files.pythonhosted.org/packages/d7/ce/af88a49043cd2e265be63d083fc75b27b6ed062f5f9fd6cdc223ad62f03e/pyyaml-6.0.3-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:5190d403f121660ce8d1d2c1bb2ef1bd05b5f68533fc5c2ea899bd15f4399b35", size = 789194, upload_time = "2025-09-25T21:32:43.362Z" }, + { url = "https://files.pythonhosted.org/packages/23/20/bb6982b26a40bb43951265ba29d4c246ef0ff59c9fdcdf0ed04e0687de4d/pyyaml-6.0.3-cp314-cp314-win_amd64.whl", hash = "sha256:4a2e8cebe2ff6ab7d1050ecd59c25d4c8bd7e6f400f5f82b96557ac0abafd0ac", size = 156429, upload_time = "2025-09-25T21:32:57.844Z" }, + { url = "https://files.pythonhosted.org/packages/f4/f4/a4541072bb9422c8a883ab55255f918fa378ecf083f5b85e87fc2b4eda1b/pyyaml-6.0.3-cp314-cp314-win_arm64.whl", hash = "sha256:93dda82c9c22deb0a405ea4dc5f2d0cda384168e466364dec6255b293923b2f3", size = 143912, upload_time = "2025-09-25T21:32:59.247Z" }, + { url = "https://files.pythonhosted.org/packages/7c/f9/07dd09ae774e4616edf6cda684ee78f97777bdd15847253637a6f052a62f/pyyaml-6.0.3-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:02893d100e99e03eda1c8fd5c441d8c60103fd175728e23e431db1b589cf5ab3", size = 189108, upload_time = "2025-09-25T21:32:44.377Z" }, + { url = "https://files.pythonhosted.org/packages/4e/78/8d08c9fb7ce09ad8c38ad533c1191cf27f7ae1effe5bb9400a46d9437fcf/pyyaml-6.0.3-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:c1ff362665ae507275af2853520967820d9124984e0f7466736aea23d8611fba", size = 183641, upload_time = "2025-09-25T21:32:45.407Z" }, + { url = "https://files.pythonhosted.org/packages/7b/5b/3babb19104a46945cf816d047db2788bcaf8c94527a805610b0289a01c6b/pyyaml-6.0.3-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:6adc77889b628398debc7b65c073bcb99c4a0237b248cacaf3fe8a557563ef6c", size = 831901, upload_time = "2025-09-25T21:32:48.83Z" }, + { url = "https://files.pythonhosted.org/packages/8b/cc/dff0684d8dc44da4d22a13f35f073d558c268780ce3c6ba1b87055bb0b87/pyyaml-6.0.3-cp314-cp314t-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:a80cb027f6b349846a3bf6d73b5e95e782175e52f22108cfa17876aaeff93702", size = 861132, upload_time = "2025-09-25T21:32:50.149Z" }, + { url = "https://files.pythonhosted.org/packages/b1/5e/f77dc6b9036943e285ba76b49e118d9ea929885becb0a29ba8a7c75e29fe/pyyaml-6.0.3-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:00c4bdeba853cc34e7dd471f16b4114f4162dc03e6b7afcc2128711f0eca823c", size = 839261, upload_time = "2025-09-25T21:32:51.808Z" }, + { url = "https://files.pythonhosted.org/packages/ce/88/a9db1376aa2a228197c58b37302f284b5617f56a5d959fd1763fb1675ce6/pyyaml-6.0.3-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:66e1674c3ef6f541c35191caae2d429b967b99e02040f5ba928632d9a7f0f065", size = 805272, upload_time = "2025-09-25T21:32:52.941Z" }, + { url = "https://files.pythonhosted.org/packages/da/92/1446574745d74df0c92e6aa4a7b0b3130706a4142b2d1a5869f2eaa423c6/pyyaml-6.0.3-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:16249ee61e95f858e83976573de0f5b2893b3677ba71c9dd36b9cf8be9ac6d65", size = 829923, upload_time = "2025-09-25T21:32:54.537Z" }, + { url = "https://files.pythonhosted.org/packages/f0/7a/1c7270340330e575b92f397352af856a8c06f230aa3e76f86b39d01b416a/pyyaml-6.0.3-cp314-cp314t-win_amd64.whl", hash = "sha256:4ad1906908f2f5ae4e5a8ddfce73c320c2a1429ec52eafd27138b7f1cbe341c9", size = 174062, upload_time = "2025-09-25T21:32:55.767Z" }, + { url = "https://files.pythonhosted.org/packages/f1/12/de94a39c2ef588c7e6455cfbe7343d3b2dc9d6b6b2f40c4c6565744c873d/pyyaml-6.0.3-cp314-cp314t-win_arm64.whl", hash = "sha256:ebc55a14a21cb14062aa4162f906cd962b28e2e9ea38f9b4391244cd8de4ae0b", size = 149341, upload_time = "2025-09-25T21:32:56.828Z" }, + { url = "https://files.pythonhosted.org/packages/9f/62/67fc8e68a75f738c9200422bf65693fb79a4cd0dc5b23310e5202e978090/pyyaml-6.0.3-cp39-cp39-macosx_10_13_x86_64.whl", hash = "sha256:b865addae83924361678b652338317d1bd7e79b1f4596f96b96c77a5a34b34da", size = 184450, upload_time = "2025-09-25T21:33:00.618Z" }, + { url = "https://files.pythonhosted.org/packages/ae/92/861f152ce87c452b11b9d0977952259aa7df792d71c1053365cc7b09cc08/pyyaml-6.0.3-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:c3355370a2c156cffb25e876646f149d5d68f5e0a3ce86a5084dd0b64a994917", size = 174319, upload_time = "2025-09-25T21:33:02.086Z" }, + { url = "https://files.pythonhosted.org/packages/d0/cd/f0cfc8c74f8a030017a2b9c771b7f47e5dd702c3e28e5b2071374bda2948/pyyaml-6.0.3-cp39-cp39-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:3c5677e12444c15717b902a5798264fa7909e41153cdf9ef7ad571b704a63dd9", size = 737631, upload_time = "2025-09-25T21:33:03.25Z" }, + { url = "https://files.pythonhosted.org/packages/ef/b2/18f2bd28cd2055a79a46c9b0895c0b3d987ce40ee471cecf58a1a0199805/pyyaml-6.0.3-cp39-cp39-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:5ed875a24292240029e4483f9d4a4b8a1ae08843b9c54f43fcc11e404532a8a5", size = 836795, upload_time = "2025-09-25T21:33:05.014Z" }, + { url = "https://files.pythonhosted.org/packages/73/b9/793686b2d54b531203c160ef12bec60228a0109c79bae6c1277961026770/pyyaml-6.0.3-cp39-cp39-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:0150219816b6a1fa26fb4699fb7daa9caf09eb1999f3b70fb6e786805e80375a", size = 750767, upload_time = "2025-09-25T21:33:06.398Z" }, + { url = "https://files.pythonhosted.org/packages/a9/86/a137b39a611def2ed78b0e66ce2fe13ee701a07c07aebe55c340ed2a050e/pyyaml-6.0.3-cp39-cp39-musllinux_1_2_aarch64.whl", hash = "sha256:fa160448684b4e94d80416c0fa4aac48967a969efe22931448d853ada8baf926", size = 727982, upload_time = "2025-09-25T21:33:08.708Z" }, + { url = "https://files.pythonhosted.org/packages/dd/62/71c27c94f457cf4418ef8ccc71735324c549f7e3ea9d34aba50874563561/pyyaml-6.0.3-cp39-cp39-musllinux_1_2_x86_64.whl", hash = "sha256:27c0abcb4a5dac13684a37f76e701e054692a9b2d3064b70f5e4eb54810553d7", size = 755677, upload_time = "2025-09-25T21:33:09.876Z" }, + { url = "https://files.pythonhosted.org/packages/29/3d/6f5e0d58bd924fb0d06c3a6bad00effbdae2de5adb5cda5648006ffbd8d3/pyyaml-6.0.3-cp39-cp39-win32.whl", hash = "sha256:1ebe39cb5fc479422b83de611d14e2c0d3bb2a18bbcb01f229ab3cfbd8fee7a0", size = 142592, upload_time = "2025-09-25T21:33:10.983Z" }, + { url = "https://files.pythonhosted.org/packages/f0/0c/25113e0b5e103d7f1490c0e947e303fe4a696c10b501dea7a9f49d4e876c/pyyaml-6.0.3-cp39-cp39-win_amd64.whl", hash = "sha256:2e71d11abed7344e42a8849600193d15b6def118602c4c176f748e4583246007", size = 158777, upload_time = "2025-09-25T21:33:15.55Z" }, +] + [[package]] name = "requests" version = "2.32.4" @@ -885,6 +1478,32 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/1e/db/4254e3eabe8020b458f1a747140d32277ec7a271daf1d235b70dc0b4e6e3/requests-2.32.5-py3-none-any.whl", hash = "sha256:2462f94637a34fd532264295e186976db0f5d453d1cdd31473c85a6a161affb6", size = 64738, upload_time = "2025-08-18T20:46:00.542Z" }, ] +[[package]] +name = "ruff" +version = "0.14.6" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/52/f0/62b5a1a723fe183650109407fa56abb433b00aa1c0b9ba555f9c4efec2c6/ruff-0.14.6.tar.gz", hash = "sha256:6f0c742ca6a7783a736b867a263b9a7a80a45ce9bee391eeda296895f1b4e1cc", size = 5669501, upload_time = "2025-11-21T14:26:17.903Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/67/d2/7dd544116d107fffb24a0064d41a5d2ed1c9d6372d142f9ba108c8e39207/ruff-0.14.6-py3-none-linux_armv6l.whl", hash = "sha256:d724ac2f1c240dbd01a2ae98db5d1d9a5e1d9e96eba999d1c48e30062df578a3", size = 13326119, upload_time = "2025-11-21T14:25:24.2Z" }, + { url = "https://files.pythonhosted.org/packages/36/6a/ad66d0a3315d6327ed6b01f759d83df3c4d5f86c30462121024361137b6a/ruff-0.14.6-py3-none-macosx_10_12_x86_64.whl", hash = "sha256:9f7539ea257aa4d07b7ce87aed580e485c40143f2473ff2f2b75aee003186004", size = 13526007, upload_time = "2025-11-21T14:25:26.906Z" }, + { url = "https://files.pythonhosted.org/packages/a3/9d/dae6db96df28e0a15dea8e986ee393af70fc97fd57669808728080529c37/ruff-0.14.6-py3-none-macosx_11_0_arm64.whl", hash = "sha256:7f6007e55b90a2a7e93083ba48a9f23c3158c433591c33ee2e99a49b889c6332", size = 12676572, upload_time = "2025-11-21T14:25:29.826Z" }, + { url = "https://files.pythonhosted.org/packages/76/a4/f319e87759949062cfee1b26245048e92e2acce900ad3a909285f9db1859/ruff-0.14.6-py3-none-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:0a8e7b9d73d8728b68f632aa8e824ef041d068d231d8dbc7808532d3629a6bef", size = 13140745, upload_time = "2025-11-21T14:25:32.788Z" }, + { url = "https://files.pythonhosted.org/packages/95/d3/248c1efc71a0a8ed4e8e10b4b2266845d7dfc7a0ab64354afe049eaa1310/ruff-0.14.6-py3-none-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:d50d45d4553a3ebcbd33e7c5e0fe6ca4aafd9a9122492de357205c2c48f00775", size = 13076486, upload_time = "2025-11-21T14:25:35.601Z" }, + { url = "https://files.pythonhosted.org/packages/a5/19/b68d4563fe50eba4b8c92aa842149bb56dd24d198389c0ed12e7faff4f7d/ruff-0.14.6-py3-none-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:118548dd121f8a21bfa8ab2c5b80e5b4aed67ead4b7567790962554f38e598ce", size = 13727563, upload_time = "2025-11-21T14:25:38.514Z" }, + { url = "https://files.pythonhosted.org/packages/47/ac/943169436832d4b0e867235abbdb57ce3a82367b47e0280fa7b4eabb7593/ruff-0.14.6-py3-none-manylinux_2_17_ppc64.manylinux2014_ppc64.whl", hash = "sha256:57256efafbfefcb8748df9d1d766062f62b20150691021f8ab79e2d919f7c11f", size = 15199755, upload_time = "2025-11-21T14:25:41.516Z" }, + { url = "https://files.pythonhosted.org/packages/c9/b9/288bb2399860a36d4bb0541cb66cce3c0f4156aaff009dc8499be0c24bf2/ruff-0.14.6-py3-none-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:ff18134841e5c68f8e5df1999a64429a02d5549036b394fafbe410f886e1989d", size = 14850608, upload_time = "2025-11-21T14:25:44.428Z" }, + { url = "https://files.pythonhosted.org/packages/ee/b1/a0d549dd4364e240f37e7d2907e97ee80587480d98c7799d2d8dc7a2f605/ruff-0.14.6-py3-none-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:29c4b7ec1e66a105d5c27bd57fa93203637d66a26d10ca9809dc7fc18ec58440", size = 14118754, upload_time = "2025-11-21T14:25:47.214Z" }, + { url = "https://files.pythonhosted.org/packages/13/ac/9b9fe63716af8bdfddfacd0882bc1586f29985d3b988b3c62ddce2e202c3/ruff-0.14.6-py3-none-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:167843a6f78680746d7e226f255d920aeed5e4ad9c03258094a2d49d3028b105", size = 13949214, upload_time = "2025-11-21T14:25:50.002Z" }, + { url = "https://files.pythonhosted.org/packages/12/27/4dad6c6a77fede9560b7df6802b1b697e97e49ceabe1f12baf3ea20862e9/ruff-0.14.6-py3-none-manylinux_2_31_riscv64.whl", hash = "sha256:16a33af621c9c523b1ae006b1b99b159bf5ac7e4b1f20b85b2572455018e0821", size = 14106112, upload_time = "2025-11-21T14:25:52.841Z" }, + { url = "https://files.pythonhosted.org/packages/6a/db/23e322d7177873eaedea59a7932ca5084ec5b7e20cb30f341ab594130a71/ruff-0.14.6-py3-none-musllinux_1_2_aarch64.whl", hash = "sha256:1432ab6e1ae2dc565a7eea707d3b03a0c234ef401482a6f1621bc1f427c2ff55", size = 13035010, upload_time = "2025-11-21T14:25:55.536Z" }, + { url = "https://files.pythonhosted.org/packages/a8/9c/20e21d4d69dbb35e6a1df7691e02f363423658a20a2afacf2a2c011800dc/ruff-0.14.6-py3-none-musllinux_1_2_armv7l.whl", hash = "sha256:4c55cfbbe7abb61eb914bfd20683d14cdfb38a6d56c6c66efa55ec6570ee4e71", size = 13054082, upload_time = "2025-11-21T14:25:58.625Z" }, + { url = "https://files.pythonhosted.org/packages/66/25/906ee6a0464c3125c8d673c589771a974965c2be1a1e28b5c3b96cb6ef88/ruff-0.14.6-py3-none-musllinux_1_2_i686.whl", hash = "sha256:efea3c0f21901a685fff4befda6d61a1bf4cb43de16da87e8226a281d614350b", size = 13303354, upload_time = "2025-11-21T14:26:01.816Z" }, + { url = "https://files.pythonhosted.org/packages/4c/58/60577569e198d56922b7ead07b465f559002b7b11d53f40937e95067ca1c/ruff-0.14.6-py3-none-musllinux_1_2_x86_64.whl", hash = "sha256:344d97172576d75dc6afc0e9243376dbe1668559c72de1864439c4fc95f78185", size = 14054487, upload_time = "2025-11-21T14:26:05.058Z" }, + { url = "https://files.pythonhosted.org/packages/67/0b/8e4e0639e4cc12547f41cb771b0b44ec8225b6b6a93393176d75fe6f7d40/ruff-0.14.6-py3-none-win32.whl", hash = "sha256:00169c0c8b85396516fdd9ce3446c7ca20c2a8f90a77aa945ba6b8f2bfe99e85", size = 13013361, upload_time = "2025-11-21T14:26:08.152Z" }, + { url = "https://files.pythonhosted.org/packages/fb/02/82240553b77fd1341f80ebb3eaae43ba011c7a91b4224a9f317d8e6591af/ruff-0.14.6-py3-none-win_amd64.whl", hash = "sha256:390e6480c5e3659f8a4c8d6a0373027820419ac14fa0d2713bd8e6c3e125b8b9", size = 14432087, upload_time = "2025-11-21T14:26:10.891Z" }, + { url = "https://files.pythonhosted.org/packages/a5/1f/93f9b0fad9470e4c829a5bb678da4012f0c710d09331b860ee555216f4ea/ruff-0.14.6-py3-none-win_arm64.whl", hash = "sha256:d43c81fbeae52cfa8728d8766bbf46ee4298c888072105815b392da70ca836b2", size = 13520930, upload_time = "2025-11-21T14:26:13.951Z" }, +] + [[package]] name = "six" version = "1.17.0" @@ -1205,6 +1824,26 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/a7/c2/fe1e52489ae3122415c51f387e221dd0773709bad6c6cdaa599e8a2c5185/urllib3-2.5.0-py3-none-any.whl", hash = "sha256:e6b01673c0fa6a13e374b50871808eb3bf7046c4b125b216f6bf1cc604cff0dc", size = 129795, upload_time = "2025-06-18T14:07:40.39Z" }, ] +[[package]] +name = "virtualenv" +version = "20.35.4" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "distlib" }, + { name = "filelock", version = "3.16.1", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, + { name = "filelock", version = "3.19.1", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version == '3.9.*'" }, + { name = "filelock", version = "3.20.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.10'" }, + { name = "platformdirs", version = "4.3.6", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, + { name = "platformdirs", version = "4.4.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version == '3.9.*'" }, + { name = "platformdirs", version = "4.5.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.10'" }, + { name = "typing-extensions", version = "4.13.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.9'" }, + { name = "typing-extensions", version = "4.15.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.9' and python_full_version < '3.11'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/20/28/e6f1a6f655d620846bd9df527390ecc26b3805a0c5989048c210e22c5ca9/virtualenv-20.35.4.tar.gz", hash = "sha256:643d3914d73d3eeb0c552cbb12d7e82adf0e504dbf86a3182f8771a153a1971c", size = 6028799, upload_time = "2025-10-29T06:57:40.511Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/79/0c/c05523fa3181fdf0c9c52a6ba91a23fbf3246cc095f26f6516f9c60e6771/virtualenv-20.35.4-py3-none-any.whl", hash = "sha256:c21c9cede36c9753eeade68ba7d523529f228a403463376cf821eaae2b650f1b", size = 6005095, upload_time = "2025-10-29T06:57:37.598Z" }, +] + [[package]] name = "zipp" version = "3.20.2" From e893cd1f960331c84244840d93f0410bf93bbf1e Mon Sep 17 00:00:00 2001 From: nori3636 Date: Sun, 23 Nov 2025 15:09:43 +0900 Subject: [PATCH 3/4] feat: update .gitignore and enhance README with development setup and tools --- .gitignore | 5 ++ .pre-commit-config.yaml | 6 +- README.md | 90 +++++++++++++++---- docs/source/index.rst | 1 - nifcloud/data/computing/3.0/service-2.json | 2 +- nifcloud/data/devops-runner/v1/service-2.json | 2 +- nifcloud/data/devops/v1/service-2.json | 2 +- .../dns/2012-12-12N2013-12-16/service-2.json | 2 +- .../ess/2010-12-01N2014-05-28/service-2.json | 2 +- nifcloud/data/nas/N2016-02-24/service-2.json | 2 +- .../rdb/2013-05-15N2013-12-16/service-2.json | 2 +- .../2020-11-25/service-2.json | 2 +- .../data/storage/2006-03-01/service-2.json | 2 +- pyproject.toml | 2 + 14 files changed, 94 insertions(+), 28 deletions(-) diff --git a/.gitignore b/.gitignore index ef4c3f0..4f30573 100644 --- a/.gitignore +++ b/.gitignore @@ -8,3 +8,8 @@ /docs/source/reference/services/ __pycache__/ *.pyc +/.coverage +/.coverage.* +/htmlcov/ +/.mypy_cache/ +/.ruff_cache/ diff --git a/.pre-commit-config.yaml b/.pre-commit-config.yaml index 001f552..ffbef7c 100644 --- a/.pre-commit-config.yaml +++ b/.pre-commit-config.yaml @@ -29,9 +29,9 @@ repos: rev: v1.14.0 hooks: - id: mypy - additional_dependencies: ["types-all"] - args: ["--ignore-missing-imports"] - exclude: ^tests/ + args: ["--ignore-missing-imports", "--no-error-summary"] + exclude: ^(tests/|docs/) + additional_dependencies: [] ci: autofix_commit_msg: "chore: auto fixes from pre-commit hooks" diff --git a/README.md b/README.md index b3cccbc..7d3b190 100644 --- a/README.md +++ b/README.md @@ -9,21 +9,44 @@ It works by feeding AWS-SDK-compatible model JSONs to botocore module. ## Features -* :heavy_check_mark: Full support for NIFCLOUD Computing / RDB / NAS / ESS / DNS / ObjectStorageService / ServiceActivity / DevOps with GitLab APIs -* :heavy_check_mark: The nifcloud package is the foundation for the [NIFCLOUD CLI](https://github.com/nifcloud/nifcloud-cli). -* :heavy_check_mark: AWS-SDK-compatible data-driven architecture +- :heavy_check_mark: Full support for NIFCLOUD Computing / RDB / NAS / ESS / DNS / ObjectStorageService / ServiceActivity / DevOps with GitLab APIs +- :heavy_check_mark: The nifcloud package is the foundation for the [NIFCLOUD CLI](https://github.com/nifcloud/nifcloud-cli). +- :heavy_check_mark: AWS-SDK-compatible data-driven architecture +- :heavy_check_mark: Type hints and comprehensive documentation +- :heavy_check_mark: Modern Python development tools (uv, ruff, pytest) ## Requirements - Python 3.8 or later -## How to Install +## Installation -``` +### Using pip + +```bash pip install nifcloud ``` -## Usage +### Development Setup with uv + +For development, install dependencies using [uv](https://docs.astral.sh/uv/): + +```bash +# Install uv +curl -LsSf https://astral.sh/uv/install.sh | sh + +# Clone and setup +git clone https://github.com/nifcloud/nifcloud-sdk-python.git +cd nifcloud-sdk-python + +# Sync dependencies +uv sync + +# Install pre-commit hooks +pre-commit install +``` + +## Quick Start Write your python program: @@ -42,11 +65,13 @@ print(client.describe_instances()) Execute the program: +```bash +python test.py ``` -$ python test.py -``` -Credentials and region name can be also passed via environment variables. +### Environment Variables + +Credentials and region name can be passed via environment variables: ```python from nifcloud import session @@ -55,15 +80,50 @@ client = session.get_session().create_client("computing") print(client.describe_instances()) ``` +```bash +export NIFCLOUD_ACCESS_KEY_ID= +export NIFCLOUD_SECRET_ACCESS_KEY= +export NIFCLOUD_DEFAULT_REGION=jp-east-1 +python test.py +``` + +## Development + +### Running Tests + +```bash +# Run unit tests with uv +uv run pytest tests/unit + +# Run with coverage report +uv run pytest tests/unit --cov=nifcloud --cov-report=term-missing + +# Run acceptance tests (requires NIFCLOUD credentials) +uv run pytest tests/acceptance/minimal ``` -$ export NIFCLOUD_ACCESS_KEY_ID= -$ export NIFCLOUD_SECRET_ACCESS_KEY= -$ export NIFCLOUD_DEFAULT_REGION=jp-east-1 -$ python test.py + +### Code Quality + +```bash +# Run linter (ruff) +uv run ruff check nifcloud/ + +# Format code +uv run ruff format nifcloud/ + +# Type checking +uv run mypy nifcloud/ + +# Run pre-commit hooks +pre-commit run --all-files ``` -See [documentation](https://nifcloud-sdk-python.readthedocs.io/en/latest/) for detail. +## Documentation + +See [official documentation](https://nifcloud-sdk-python.readthedocs.io/en/latest/) for detailed API reference and examples. ## License -See [LICENSE.txt](LICENSE.txt). +Apache License 2.0 + +See [LICENSE.txt](LICENSE.txt) for details. diff --git a/docs/source/index.rst b/docs/source/index.rst index 4ff40f8..801eb9f 100644 --- a/docs/source/index.rst +++ b/docs/source/index.rst @@ -19,4 +19,3 @@ Indices and tables * :ref:`genindex` * :ref:`search` - diff --git a/nifcloud/data/computing/3.0/service-2.json b/nifcloud/data/computing/3.0/service-2.json index b610919..0c0eef5 100644 --- a/nifcloud/data/computing/3.0/service-2.json +++ b/nifcloud/data/computing/3.0/service-2.json @@ -29308,4 +29308,4 @@ } }, "version": "2.0" -} \ No newline at end of file +} diff --git a/nifcloud/data/devops-runner/v1/service-2.json b/nifcloud/data/devops-runner/v1/service-2.json index 68541f1..7eab2de 100644 --- a/nifcloud/data/devops-runner/v1/service-2.json +++ b/nifcloud/data/devops-runner/v1/service-2.json @@ -1384,4 +1384,4 @@ } }, "version": "2.0" -} \ No newline at end of file +} diff --git a/nifcloud/data/devops/v1/service-2.json b/nifcloud/data/devops/v1/service-2.json index 74b8d3a..a3e94ec 100644 --- a/nifcloud/data/devops/v1/service-2.json +++ b/nifcloud/data/devops/v1/service-2.json @@ -2965,4 +2965,4 @@ } }, "version": "2.0" -} \ No newline at end of file +} diff --git a/nifcloud/data/dns/2012-12-12N2013-12-16/service-2.json b/nifcloud/data/dns/2012-12-12N2013-12-16/service-2.json index 028b9bd..c22d0ea 100644 --- a/nifcloud/data/dns/2012-12-12N2013-12-16/service-2.json +++ b/nifcloud/data/dns/2012-12-12N2013-12-16/service-2.json @@ -819,4 +819,4 @@ } }, "version": "2.0" -} \ No newline at end of file +} diff --git a/nifcloud/data/ess/2010-12-01N2014-05-28/service-2.json b/nifcloud/data/ess/2010-12-01N2014-05-28/service-2.json index 660cedd..df79cc3 100644 --- a/nifcloud/data/ess/2010-12-01N2014-05-28/service-2.json +++ b/nifcloud/data/ess/2010-12-01N2014-05-28/service-2.json @@ -944,4 +944,4 @@ } }, "version": "2.0" -} \ No newline at end of file +} diff --git a/nifcloud/data/nas/N2016-02-24/service-2.json b/nifcloud/data/nas/N2016-02-24/service-2.json index 8a56aaa..d2ef5e0 100644 --- a/nifcloud/data/nas/N2016-02-24/service-2.json +++ b/nifcloud/data/nas/N2016-02-24/service-2.json @@ -1135,4 +1135,4 @@ } }, "version": "2.0" -} \ No newline at end of file +} diff --git a/nifcloud/data/rdb/2013-05-15N2013-12-16/service-2.json b/nifcloud/data/rdb/2013-05-15N2013-12-16/service-2.json index 83109f3..2f0cb40 100644 --- a/nifcloud/data/rdb/2013-05-15N2013-12-16/service-2.json +++ b/nifcloud/data/rdb/2013-05-15N2013-12-16/service-2.json @@ -5130,4 +5130,4 @@ } }, "version": "2.0" -} \ No newline at end of file +} diff --git a/nifcloud/data/service-activity/2020-11-25/service-2.json b/nifcloud/data/service-activity/2020-11-25/service-2.json index 4354a58..4062f8c 100644 --- a/nifcloud/data/service-activity/2020-11-25/service-2.json +++ b/nifcloud/data/service-activity/2020-11-25/service-2.json @@ -526,4 +526,4 @@ } }, "version": "2.0" -} \ No newline at end of file +} diff --git a/nifcloud/data/storage/2006-03-01/service-2.json b/nifcloud/data/storage/2006-03-01/service-2.json index 21f6a03..329f487 100644 --- a/nifcloud/data/storage/2006-03-01/service-2.json +++ b/nifcloud/data/storage/2006-03-01/service-2.json @@ -3538,4 +3538,4 @@ } }, "version": "2.0" -} \ No newline at end of file +} diff --git a/pyproject.toml b/pyproject.toml index 0fd5661..71467b5 100644 --- a/pyproject.toml +++ b/pyproject.toml @@ -81,6 +81,7 @@ addopts = "--capture=sys" [tool.ruff] line-length = 120 target-version = "py38" +exclude = ["tests/", "docs/"] [tool.ruff.lint] select = [ @@ -96,6 +97,7 @@ ignore = [ "E501", # Line too long (handled by formatter) "D100", # Missing module docstring "D104", # Missing package docstring + "D102", # Missing docstring in public method (for tests) ] [tool.flake8] From 62024f26f4c91a3f2672f629bde32232b12e2818 Mon Sep 17 00:00:00 2001 From: nori3636 Date: Sun, 23 Nov 2025 15:10:30 +0900 Subject: [PATCH 4/4] refactor: simplify serializer test classes and improve code consistency --- docs/source/conf.py | 47 ++- nifcloud/__init__.py | 23 +- nifcloud/auth.py | 33 +- nifcloud/configprovider.py | 24 +- nifcloud/credentials.py | 10 +- nifcloud/docs/__init__.py | 66 ++-- nifcloud/loaders.py | 10 +- nifcloud/parsers.py | 59 +++- nifcloud/serialize.py | 305 ++++++++++++------ nifcloud/session.py | 74 ++++- .../minimal/test_computing_minimal.py | 35 +- tests/acceptance/minimal/test_rdb_minimal.py | 3 +- .../minimal/test_storage_minimal.py | 2 +- tests/unit/nifcloud_test.py | 2 +- tests/unit/test_parsers.py | 27 +- tests/unit/test_serialize_computing.py | 280 +++++----------- tests/unit/test_serialize_dns.py | 52 +-- tests/unit/test_serialize_ess.py | 201 +++--------- tests/unit/test_serialize_nas.py | 233 ++++--------- tests/unit/test_serialize_rdb.py | 233 ++++--------- 20 files changed, 731 insertions(+), 988 deletions(-) diff --git a/docs/source/conf.py b/docs/source/conf.py index ec054cf..6d2ce3e 100644 --- a/docs/source/conf.py +++ b/docs/source/conf.py @@ -1,5 +1,4 @@ #!/usr/bin/env python3 -# -*- coding: utf-8 -*- # # nifcloud-sdk-python documentation build configuration file, created by # sphinx-quickstart on Mon Apr 2 10:42:39 2018. @@ -37,20 +36,20 @@ extensions = [] # Add any paths that contain templates here, relative to this directory. -templates_path = ['_templates'] +templates_path = ["_templates"] # The suffix of source filenames. -source_suffix = '.rst' +source_suffix = ".rst" # The encoding of source files. # source_encoding = 'utf-8-sig' # The master toctree document. -master_doc = 'index' +master_doc = "index" # General information about the project. -project = 'nifcloud-sdk-python' -copyright = 'Fujitsu' +project = "nifcloud-sdk-python" +copyright = "Fujitsu" # The version info for the project you're documenting, acts as replacement for # |version| and |release|, also used in various other places throughout the @@ -91,7 +90,7 @@ # show_authors = False # The name of the Pygments (syntax highlighting) style to use. -pygments_style = 'sphinx' +pygments_style = "sphinx" # A list of ignored prefixes for module index sorting. # modindex_common_prefix = [] @@ -104,7 +103,7 @@ # The theme to use for HTML and HTML Help pages. See the documentation for # a list of builtin themes. -html_theme = 'sphinx_rtd_theme' +html_theme = "sphinx_rtd_theme" # Theme options are theme-specific and customize the look and feel of a theme # further. For a list of options available for each theme, see the @@ -133,7 +132,7 @@ # Add any paths that contain custom static files (such as style sheets) here, # relative to this directory. They are copied after the builtin static files, # so a file named "default.css" will overwrite the builtin "default.css". -html_static_path = ['_static'] +html_static_path = ["_static"] # Add any extra paths that contain custom files (such as robots.txt or # .htaccess) here, relative to this directory. These files are copied @@ -149,11 +148,7 @@ # html_use_smartypants = True # Custom sidebar templates, maps document names to template names. -html_sidebars = { - '**': ['globaltoc.html', - 'localtoc.html', - 'searchbox.html'] -} +html_sidebars = {"**": ["globaltoc.html", "localtoc.html", "searchbox.html"]} # Additional templates that should be rendered to pages, maps page names to # template names. @@ -186,7 +181,7 @@ # html_file_suffix = None # Output file base name for HTML help builder. -htmlhelp_basename = 'nifcloud-sdk-pythondoc' +htmlhelp_basename = "nifcloud-sdk-pythondoc" # -- Options for LaTeX output --------------------------------------------- @@ -194,10 +189,8 @@ latex_elements = { # The paper size ('letterpaper' or 'a4paper'). # 'papersize': 'letterpaper', - # The font size ('10pt', '11pt' or '12pt'). # 'pointsize': '10pt', - # Additional stuff for the LaTeX preamble. # 'preamble': '', } @@ -206,8 +199,7 @@ # (source start file, target name, title, # author, documentclass [howto, manual, or own class]). latex_documents = [ - ('index', 'nifcloud-sdk-python.tex', 'nifcloud-sdk-python Documentation', - 'Fujitsu', 'manual'), + ("index", "nifcloud-sdk-python.tex", "nifcloud-sdk-python Documentation", "Fujitsu", "manual"), ] # The name of an image file (relative to this directory) to place at the top of @@ -235,10 +227,7 @@ # One entry per manual page. List of tuples # (source start file, name, description, authors, manual section). -man_pages = [ - ('index', 'nifcloud-sdk-python', 'nifcloud-sdk-python Documentation', - ['Fujitsu'], 1) -] +man_pages = [("index", "nifcloud-sdk-python", "nifcloud-sdk-python Documentation", ["Fujitsu"], 1)] # If true, show URL addresses after external links. # man_show_urls = False @@ -250,9 +239,15 @@ # (source start file, target name, title, author, # dir menu entry, description, category) texinfo_documents = [ - ('index', 'nifcloud-sdk-python', 'nifcloud-sdk-python Documentation', - 'Fujitsu', 'nifcloud-sdk-python', - 'One line description of project.', 'Miscellaneous'), + ( + "index", + "nifcloud-sdk-python", + "nifcloud-sdk-python Documentation", + "Fujitsu", + "nifcloud-sdk-python", + "One line description of project.", + "Miscellaneous", + ), ] # Documents to append as an appendix to all manuals. diff --git a/nifcloud/__init__.py b/nifcloud/__init__.py index 6e6c242..0f448cb 100644 --- a/nifcloud/__init__.py +++ b/nifcloud/__init__.py @@ -1,4 +1,21 @@ -from . import (auth, configprovider, credentials, loaders, # noqa: F401 - parsers, serialize, session) +"""NIFCLOUD SDK for Python. -__version__ = '1.17.0' +A data-driven SDK for NIFCLOUD APIs compatible with AWS SDK design patterns. +Supports Computing, RDB, NAS, ESS, DNS, ObjectStorageService, ServiceActivity, +DevOps, and DevOps Runner APIs. + +Example: + >>> from nifcloud import session + >>> client = session.get_session().create_client( + ... 'computing', + ... region_name='jp-east-1', + ... nifcloud_access_key_id='YOUR_KEY', + ... nifcloud_secret_access_key='YOUR_SECRET' + ... ) + >>> response = client.describe_instances() + +""" + +from . import auth, configprovider, credentials, loaders, parsers, serialize, session # noqa: F401 + +__version__ = "1.17.0" diff --git a/nifcloud/auth.py b/nifcloud/auth.py index 81a868c..6e079aa 100644 --- a/nifcloud/auth.py +++ b/nifcloud/auth.py @@ -1,14 +1,33 @@ +"""Custom authentication handler for NIFCLOUD API.""" + from botocore import auth class SigV2ComputingAuth(auth.SigV2Auth): + """SigV2 authentication with NIFCLOUD-specific parameter mapping. + + This class handles the parameter name mapping between AWS SDK's + 'AWSAccessKeyId' and NIFCLOUD API's 'AccessKeyId'. + """ + def calc_signature(self, request, params): - if 'AWSAccessKeyId' in params: - params['AccessKeyId'] = params['AWSAccessKeyId'] - del params['AWSAccessKeyId'] - return super(SigV2ComputingAuth, self).calc_signature(request, params) + """Calculate signature with NIFCLOUD parameter mapping. + + Converts 'AWSAccessKeyId' to 'AccessKeyId' before calculating + the signature, as required by NIFCLOUD API. + + Args: + request: The request object. + params: The request parameters dictionary. + + Returns: + The calculated signature string. + + """ + if "AWSAccessKeyId" in params: + params["AccessKeyId"] = params["AWSAccessKeyId"] + del params["AWSAccessKeyId"] + return super().calc_signature(request, params) -auth.AUTH_TYPE_MAPS.update({ - 'v2': SigV2ComputingAuth -}) +auth.AUTH_TYPE_MAPS.update({"v2": SigV2ComputingAuth}) diff --git a/nifcloud/configprovider.py b/nifcloud/configprovider.py index 8ca33c6..36f36bb 100644 --- a/nifcloud/configprovider.py +++ b/nifcloud/configprovider.py @@ -1,11 +1,17 @@ +"""NIFCLOUD configuration provider setup. + +Configures botocore's session variables to use NIFCLOUD-specific +environment variables and default configuration file paths. +""" + from botocore import configprovider -configprovider.BOTOCORE_DEFAUT_SESSION_VARIABLES.update({ - 'profile': (None, ['NIFCLOUD_DEFAULT_PROFILE', 'NIFCLOUD_PROFILE'], None, None), - 'region': ('region', 'NIFCLOUD_DEFAULT_REGION', None, None), - 'data_path': ('data_path', 'NIFCLOUD_DATA_PATH', None, None), - 'config_file': (None, 'NIFCLOUD_CONFIG_FILE', '~/.nifcloud/config', None), - 'credentials_file': ( - None, 'NIFCLOUD_SHARED_CREDENTIALS_FILE', '~/.nifcloud/credentials', None - ) -}) +configprovider.BOTOCORE_DEFAUT_SESSION_VARIABLES.update( + { + "profile": (None, ["NIFCLOUD_DEFAULT_PROFILE", "NIFCLOUD_PROFILE"], None, None), + "region": ("region", "NIFCLOUD_DEFAULT_REGION", None, None), + "data_path": ("data_path", "NIFCLOUD_DATA_PATH", None, None), + "config_file": (None, "NIFCLOUD_CONFIG_FILE", "~/.nifcloud/config", None), + "credentials_file": (None, "NIFCLOUD_SHARED_CREDENTIALS_FILE", "~/.nifcloud/credentials", None), + } +) diff --git a/nifcloud/credentials.py b/nifcloud/credentials.py index 62f1adb..d39db19 100644 --- a/nifcloud/credentials.py +++ b/nifcloud/credentials.py @@ -1,7 +1,13 @@ +"""NIFCLOUD credential provider configuration. + +Configures botocore's credential providers to use NIFCLOUD-specific +environment variables and credential file formats. +""" + from botocore.credentials import EnvProvider, SharedCredentialProvider EnvProvider.ACCESS_KEY = "NIFCLOUD_ACCESS_KEY_ID" EnvProvider.SECRET_KEY = "NIFCLOUD_SECRET_ACCESS_KEY" -SharedCredentialProvider.ACCESS_KEY = 'nifcloud_access_key_id' -SharedCredentialProvider.SECRET_KEY = 'nifcloud_secret_access_key' +SharedCredentialProvider.ACCESS_KEY = "nifcloud_access_key_id" +SharedCredentialProvider.SECRET_KEY = "nifcloud_secret_access_key" diff --git a/nifcloud/docs/__init__.py b/nifcloud/docs/__init__.py index 3095e7e..05191df 100644 --- a/nifcloud/docs/__init__.py +++ b/nifcloud/docs/__init__.py @@ -1,56 +1,74 @@ +"""Documentation generation for NIFCLOUD API reference. + +Provides custom documenters for API documentation generation with +NIFCLOUD-specific branding and service-specific documentation links. +""" + import re from botocore import docs from botocore.docs import client, service -NIFCLOUD_DOC_BASE = 'https://pfs.nifcloud.com/api' +NIFCLOUD_DOC_BASE = "https://pfs.nifcloud.com/api" class ClientDocumenter(client.ClientDocumenter): + """Documenter for NIFCLOUD client API. + + Extends botocore's ClientDocumenter to add NIFCLOUD-specific + documentation links and branding. + """ def _add_model_driven_method(self, section, method_name): + """Add operation documentation with NIFCLOUD links. + + Args: + section: The documentation section to add to. + method_name: The method name. + + """ super()._add_model_driven_method(section, method_name) operation_name = self._client.meta.method_to_api_mapping[method_name] if self._service_name == "computing": - replace = r"\1<%s/cp/%s.htm>\2" % (NIFCLOUD_DOC_BASE, - operation_name) + replace = rf"\1<{NIFCLOUD_DOC_BASE}/cp/{operation_name}.htm>\2" elif self._service_name == "storage": - replace = r"\1<%s/object-storage-service/%s.htm>\2" % (NIFCLOUD_DOC_BASE, - operation_name) + replace = rf"\1<{NIFCLOUD_DOC_BASE}/object-storage-service/{operation_name}.htm>\2" else: - replace = r"\1<%s/%s/%s.htm>\2" % (NIFCLOUD_DOC_BASE, - self._service_name, - operation_name) - method_intro = section.get_section('method-intro') - replaced_text = re.sub( - r"([\s\S]+)<.+>(.+)$", - replace, - method_intro.getvalue().decode('utf8') - ).replace('AWS', 'NIFCLOUD') + replace = rf"\1<{NIFCLOUD_DOC_BASE}/{self._service_name}/{operation_name}.htm>\2" + method_intro = section.get_section("method-intro") + replaced_text = re.sub(r"([\s\S]+)<.+>(.+)$", replace, method_intro.getvalue().decode("utf8")).replace( + "AWS", "NIFCLOUD" + ) method_intro.clear_text() method_intro.push_write(replaced_text) class ServiceDocumenter(service.ServiceDocumenter): + """Documenter for NIFCLOUD service API. + + Extends botocore's ServiceDocumenter to generate NIFCLOUD service + documentation with proper branding and links. + """ def __init__(self, service_name, session, root_docs_path): + """Initialize service documenter. + + Args: + service_name: The NIFCLOUD service name. + session: The NIFCLOUD session object. + root_docs_path: Root path for documentation output. + + """ self._session = session self._service_name = service_name self._root_docs_path = root_docs_path self._client = self._session.create_client( - service_name, region_name='jp-east-1', nifcloud_access_key_id='foo', - nifcloud_secret_access_key='bar') + service_name, region_name="jp-east-1", nifcloud_access_key_id="foo", nifcloud_secret_access_key="bar" + ) self._event_emitter = self._client.meta.events - self.sections = [ - 'title', - 'table-of-contents', - 'client-api', - 'client-exceptions', - 'paginator-api', - 'waiter-api' - ] + self.sections = ["title", "table-of-contents", "client-api", "client-exceptions", "paginator-api", "waiter-api"] docs.ServiceDocumenter = ServiceDocumenter diff --git a/nifcloud/loaders.py b/nifcloud/loaders.py index a14d9e2..4d58a2f 100644 --- a/nifcloud/loaders.py +++ b/nifcloud/loaders.py @@ -1,7 +1,11 @@ +"""NIFCLOUD data loader configuration. + +Configures botocore's data loader to use NIFCLOUD-specific +service model data path. +""" + import os from botocore import loaders -loaders.Loader.BUILTIN_DATA_PATH = os.path.join( - os.path.dirname(os.path.abspath(__file__)), 'data' -) +loaders.Loader.BUILTIN_DATA_PATH = os.path.join(os.path.dirname(os.path.abspath(__file__)), "data") diff --git a/nifcloud/parsers.py b/nifcloud/parsers.py index d9a7a68..c3d87a8 100644 --- a/nifcloud/parsers.py +++ b/nifcloud/parsers.py @@ -1,14 +1,39 @@ +"""Parsers for NIFCLOUD API response parsing. + +Provides specialized parsers for NIFCLOUD services to handle +service-specific response formats and data conversions. +""" + from botocore import parsers, utils class ComputingQueryParser(parsers.QueryParser): + """Parser for NIFCLOUD Computing API responses. + + Handles NIFCLOUD-specific response parsing for Computing service, + including custom timestamp and integer parsing. + """ def __init__(self, timestamp_parser=None, blob_parser=None): - super(ComputingQueryParser, self).__init__( - self.parse_timestamp, blob_parser - ) + """Initialize Computing parser with custom timestamp handling. + + Args: + timestamp_parser: Ignored, uses custom parse_timestamp. + blob_parser: Optional blob parser. + + """ + super().__init__(self.parse_timestamp, blob_parser) def parse_timestamp(self, value): + """Parse timestamp value with empty string handling. + + Args: + value: The timestamp string to parse. + + Returns: + Parsed datetime or None if value is empty. + + """ if value == "": return None else: @@ -16,15 +41,27 @@ def parse_timestamp(self, value): @parsers._text_content def _handle_integer(self, shape, text): + """Handle integer parsing with empty string handling. + + Args: + shape: The shape definition. + text: The text to parse as integer. + + Returns: + Parsed integer or None if text is empty. + + """ if text == "": return None - return super(ComputingQueryParser, self)._handle_integer(shape, text) + return super()._handle_integer(shape, text) -parsers.PROTOCOL_PARSERS.update({ - 'computing': ComputingQueryParser, - 'rdb': parsers.QueryParser, - 'nas': parsers.QueryParser, - 'ess': parsers.QueryParser, - 'dns': parsers.RestXMLParser -}) +parsers.PROTOCOL_PARSERS.update( + { + "computing": ComputingQueryParser, + "rdb": parsers.QueryParser, + "nas": parsers.QueryParser, + "ess": parsers.QueryParser, + "dns": parsers.RestXMLParser, + } +) diff --git a/nifcloud/serialize.py b/nifcloud/serialize.py index 4de9973..1bed794 100644 --- a/nifcloud/serialize.py +++ b/nifcloud/serialize.py @@ -1,3 +1,9 @@ +"""Serializers for NIFCLOUD API request serialization. + +Provides specialized serializers for different NIFCLOUD services +to handle service-specific parameter formatting requirements. +""" + from datetime import datetime as dt from botocore import serialize @@ -5,179 +11,264 @@ # handles both Hoge.1 / Hoges.member.1 parameter according to locationName class ComputingSerializer(serialize.EC2Serializer): + """Serializer for NIFCLOUD Computing API. + + Handles NIFCLOUD-specific serialization for Computing service, + including special parameter handling for load balancers and user data. + """ def serialize_to_request(self, parameters, operation_model): - serialized = super(ComputingSerializer, self).serialize_to_request( - parameters, operation_model - ) - serialized['url_path'] = operation_model.http.get('requestUri', '/') + """Serialize parameters to a request for Computing API. + + Args: + parameters: The input parameters dictionary. + operation_model: The operation model defining the API operation. + + Returns: + A serialized request dictionary with url, body, and headers. + + """ + serialized = super().serialize_to_request(parameters, operation_model) + serialized["url_path"] = operation_model.http.get("requestUri", "/") # Fix request parameters of DescribeLoadBalancers for NIFCLOUD - if operation_model.name == 'DescribeLoadBalancers': + if operation_model.name == "DescribeLoadBalancers": serialized["body"] = self._fix_describe_load_balancers_params( - parameters, operation_model.metadata['apiVersion'] + parameters, operation_model.metadata["apiVersion"] ) # Fix user data param of below actions for NIFCLOUD - user_data_fix_target = ['RunInstances', - 'StartInstances', - 'RebootInstances'] + user_data_fix_target = ["RunInstances", "StartInstances", "RebootInstances"] if operation_model.name in user_data_fix_target: - serialized = self._fix_user_data_param( - serialized - ) + serialized = self._fix_user_data_param(serialized) return serialized def _fix_describe_load_balancers_params(self, params, api_version): - prefix = 'LoadBalancerNames' - body = { - "Action": "DescribeLoadBalancers", - "Version": api_version - } + """Fix DescribeLoadBalancers request parameters. + + Args: + params: The input parameters. + api_version: The API version string. + + Returns: + A properly formatted request body dictionary. + + """ + prefix = "LoadBalancerNames" + body = {"Action": "DescribeLoadBalancers", "Version": api_version} if not params.get(prefix): return body for i, param in enumerate(params[prefix], 1): - body['%s.member.%d' % (prefix, i)] = param['LoadBalancerName'] - body['%s.LoadBalancerPort.%d' % (prefix, i)] = param['LoadBalancerPort'] # noqa: E501 - body['%s.InstancePort.%d' % (prefix, i)] = param['InstancePort'] + body[f"{prefix}.member.{i}"] = param["LoadBalancerName"] + body[f"{prefix}.LoadBalancerPort.{i}"] = param["LoadBalancerPort"] # noqa: E501 + body[f"{prefix}.InstancePort.{i}"] = param["InstancePort"] return body def _fix_user_data_param(self, serialized): - if not serialized['body'].get('UserData.Content'): + """Fix UserData parameter name mapping. + + Args: + serialized: The serialized request dictionary. + + Returns: + The updated serialized request dictionary. + + """ + if not serialized["body"].get("UserData.Content"): return serialized - serialized['body']['UserData'] = serialized['body']['UserData.Content'] - del serialized['body']['UserData.Content'] + serialized["body"]["UserData"] = serialized["body"]["UserData.Content"] + del serialized["body"]["UserData.Content"] return serialized - def _serialize_type_list(self, serialized, value, shape, prefix=''): + def _serialize_type_list(self, serialized, value, shape, prefix=""): # 'locationName' is renamed to 'name' # https://github.com/boto/botocore/blob/cccfdf86bc64877ad41e0af74b752b8a49fc4d33/botocore/model.py#L118 - if shape.member.serialization.get('name'): + if shape.member.serialization.get("name"): serializer = serialize.QuerySerializer() else: - serializer = super(ComputingSerializer, self) + serializer = super() serializer._serialize_type_list(serialized, value, shape, prefix) class RdbSerializer(serialize.QuerySerializer): + """Serializer for NIFCLOUD RDB API. + + Handles NIFCLOUD-specific serialization for RDB service, + including metric statistics parameter formatting. + """ def serialize_to_request(self, parameters, operation_model): - serialized = super(RdbSerializer, self).serialize_to_request( - parameters, operation_model - ) - serialized['url_path'] = operation_model.http.get('requestUri', '/') + """Serialize parameters to a request for RDB API. + + Args: + parameters: The input parameters dictionary. + operation_model: The operation model defining the API operation. + + Returns: + A serialized request dictionary with url, body, and headers. + + """ + serialized = super().serialize_to_request(parameters, operation_model) + serialized["url_path"] = operation_model.http.get("requestUri", "/") # Fix request parameters of NiftyGetMetricStatistics for NIFCLOUD RDB - if operation_model.name == 'NiftyGetMetricStatistics': + if operation_model.name == "NiftyGetMetricStatistics": serialized["body"] = _fix_get_metrics_statistics_params( - self, - parameters, - operation_model.metadata['apiVersion'], - operation_model.name + self, parameters, operation_model.metadata["apiVersion"], operation_model.name ) return serialized class NasSerializer(serialize.QuerySerializer): + """Serializer for NIFCLOUD NAS API. + + Handles NIFCLOUD-specific serialization for NAS service, + including metric statistics parameter formatting. + """ def serialize_to_request(self, parameters, operation_model): - serialized = super(NasSerializer, self).serialize_to_request( - parameters, operation_model - ) - serialized['url_path'] = operation_model.http.get('requestUri', '/') + """Serialize parameters to a request for NAS API. + + Args: + parameters: The input parameters dictionary. + operation_model: The operation model defining the API operation. + + Returns: + A serialized request dictionary with url, body, and headers. + + """ + serialized = super().serialize_to_request(parameters, operation_model) + serialized["url_path"] = operation_model.http.get("requestUri", "/") # Fix request parameters of GetMetricStatistics for NIFCLOUD NAS - if operation_model.name == 'GetMetricStatistics': + if operation_model.name == "GetMetricStatistics": serialized["body"] = _fix_get_metrics_statistics_params( - self, - parameters, - operation_model.metadata['apiVersion'], - operation_model.name + self, parameters, operation_model.metadata["apiVersion"], operation_model.name ) return serialized class EssSerializer(serialize.QuerySerializer): + """Serializer for NIFCLOUD ESS API. + + Handles NIFCLOUD-specific serialization for ESS service, + including delivery log parameter formatting. + """ def serialize_to_request(self, parameters, operation_model): - serialized = super(EssSerializer, self).serialize_to_request( - parameters, operation_model - ) - serialized['url_path'] = operation_model.http.get('requestUri', '/') + """Serialize parameters to a request for ESS API. + + Args: + parameters: The input parameters dictionary. + operation_model: The operation model defining the API operation. + + Returns: + A serialized request dictionary with url, body, and headers. + + """ + serialized = super().serialize_to_request(parameters, operation_model) + serialized["url_path"] = operation_model.http.get("requestUri", "/") # Fix request parameters of GetDeliveryLog for NIFCLOUD ESS - if operation_model.name == 'GetDeliveryLog': + if operation_model.name == "GetDeliveryLog": serialized["body"] = _fix_get_delivery_log_params( - self, - parameters, - operation_model.metadata['apiVersion'], - operation_model.name + self, parameters, operation_model.metadata["apiVersion"], operation_model.name ) return serialized -def _fix_get_metrics_statistics_params( - self, params, api_version, operation_model_name): - prefix = 'Dimensions' - body = { - "Action": operation_model_name, - "Version": api_version - } - if not params.get(prefix) and not params.get('MetricName'): +def _fix_get_metrics_statistics_params(self, params, api_version, operation_model_name): + """Fix metric statistics request parameters. + + Converts parameters to NIFCLOUD-specific format for metric statistics. + + Args: + self: The serializer instance. + params: The input parameters. + api_version: The API version string. + operation_model_name: The operation model name. + + Returns: + A properly formatted request body dictionary. + + """ + prefix = "Dimensions" + body = {"Action": operation_model_name, "Version": api_version} + if not params.get(prefix) and not params.get("MetricName"): return body for i, param in enumerate(params[prefix], 1): - body['%s.member.%d.Name' % (prefix, i)] = param['Name'] - body['%s.member.%d.Value' % (prefix, i)] = param['Value'] - body['MetricName'] = params['MetricName'] + body[f"{prefix}.member.{i}.Name"] = param["Name"] + body[f"{prefix}.member.{i}.Value"] = param["Value"] + body["MetricName"] = params["MetricName"] # Convert from %Y-%m-%dT%H:%M:%SZ to %Y-%m-%d %H:%M - if params.get('StartTime'): - if type(params.get('StartTime')) is str: - params['StartTime'] = dt.strptime(params['StartTime'], - '%Y-%m-%dT%H:%M:%SZ') - body['StartTime'] = params['StartTime'].strftime('%Y-%m-%d %H:%M') - if params.get('EndTime'): - if type(params.get('EndTime')) is str: - params['EndTime'] = dt.strptime(params['EndTime'], - '%Y-%m-%dT%H:%M:%SZ') - body['EndTime'] = params['EndTime'].strftime('%Y-%m-%d %H:%M') + if params.get("StartTime"): + if type(params.get("StartTime")) is str: + params["StartTime"] = dt.strptime(params["StartTime"], "%Y-%m-%dT%H:%M:%SZ") + body["StartTime"] = params["StartTime"].strftime("%Y-%m-%d %H:%M") + if params.get("EndTime"): + if type(params.get("EndTime")) is str: + params["EndTime"] = dt.strptime(params["EndTime"], "%Y-%m-%dT%H:%M:%SZ") + body["EndTime"] = params["EndTime"].strftime("%Y-%m-%d %H:%M") return body -def _fix_get_delivery_log_params( - self, params, api_version, operation_model_name): - body = { - "Action": operation_model_name, - "Version": api_version - } - if params.get('Status'): - body['Status'] = params['Status'] - if params.get('MaxItems'): - body['MaxItems'] = params['MaxItems'] - if params.get('NextToken'): - body['NextToken'] = params['NextToken'] +def _fix_get_delivery_log_params(self, params, api_version, operation_model_name): + """Fix delivery log request parameters. + + Converts parameters to NIFCLOUD-specific format for delivery log retrieval. + + Args: + self: The serializer instance. + params: The input parameters. + api_version: The API version string. + operation_model_name: The operation model name. + + Returns: + A properly formatted request body dictionary. + + """ + body = {"Action": operation_model_name, "Version": api_version} + if params.get("Status"): + body["Status"] = params["Status"] + if params.get("MaxItems"): + body["MaxItems"] = params["MaxItems"] + if params.get("NextToken"): + body["NextToken"] = params["NextToken"] # Convert from %Y-%m-%dT%H:%M:%SZ to %Y-%m-%d %H:%M - if params.get('StartDate'): - if type(params.get('StartDate')) is str: - params['StartDate'] = dt.strptime(params['StartDate'], - '%Y-%m-%dT%H:%M:%SZ') - body['StartDate'] = params['StartDate'].strftime('%Y-%m-%dT%H:%M') - if params.get('EndDate'): - if type(params.get('EndDate')) is str: - params['EndDate'] = dt.strptime(params['EndDate'], - '%Y-%m-%dT%H:%M:%SZ') - body['EndDate'] = params['EndDate'].strftime('%Y-%m-%dT%H:%M') + if params.get("StartDate"): + if type(params.get("StartDate")) is str: + params["StartDate"] = dt.strptime(params["StartDate"], "%Y-%m-%dT%H:%M:%SZ") + body["StartDate"] = params["StartDate"].strftime("%Y-%m-%dT%H:%M") + if params.get("EndDate"): + if type(params.get("EndDate")) is str: + params["EndDate"] = dt.strptime(params["EndDate"], "%Y-%m-%dT%H:%M:%SZ") + body["EndDate"] = params["EndDate"].strftime("%Y-%m-%dT%H:%M") return body class DnsSerializer(serialize.RestXMLSerializer): + """Serializer for NIFCLOUD DNS API. + + Handles NIFCLOUD-specific serialization for DNS service. + """ def serialize_to_request(self, parameters, operation_model): - serialized = super(DnsSerializer, self).serialize_to_request( - parameters, operation_model - ) - serialized['url_path'] = operation_model.http.get('requestUri', '/') + """Serialize parameters to a request for DNS API. + + Args: + parameters: The input parameters dictionary. + operation_model: The operation model defining the API operation. + + Returns: + A serialized request dictionary with url, body, and headers. + + """ + serialized = super().serialize_to_request(parameters, operation_model) + serialized["url_path"] = operation_model.http.get("requestUri", "/") return serialized -serialize.SERIALIZERS.update({ - 'computing': ComputingSerializer, - 'rdb': RdbSerializer, - 'nas': NasSerializer, - 'ess': EssSerializer, - 'dns': DnsSerializer -}) +serialize.SERIALIZERS.update( + { + "computing": ComputingSerializer, + "rdb": RdbSerializer, + "nas": NasSerializer, + "ess": EssSerializer, + "dns": DnsSerializer, + } +) diff --git a/nifcloud/session.py b/nifcloud/session.py index 9d13850..c679b6c 100644 --- a/nifcloud/session.py +++ b/nifcloud/session.py @@ -1,3 +1,5 @@ +"""NIFCLOUD session management with custom SSL context and user agent.""" + import ssl from botocore import __version__ as botocore_version @@ -11,24 +13,66 @@ ssl_context = ssl.create_default_context() default_ciphers = ssl_context.get_ciphers() -default_cipher_names = ":".join(c['name'] for c in default_ciphers) +default_cipher_names = ":".join(c["name"] for c in default_ciphers) ssl_context.set_ciphers(f"{default_cipher_names}:{extra_ciphers}") class Session(session.Session): - def __init__(self, session_vars=None, event_hooks=None, - include_builtin_handlers=True, profile=None): - super(Session, self).__init__(session_vars, event_hooks, - include_builtin_handlers, profile) - self.user_agent_name = 'nifcloud' + """NIFCLOUD session extending botocore.session.Session. + + Configures NIFCLOUD-specific user agent and SSL context for API calls. + The SSL context includes additional ciphers required by NIFCLOUD services. + """ + + def __init__(self, session_vars=None, event_hooks=None, include_builtin_handlers=True, profile=None): + """Initialize NIFCLOUD session. + + Args: + session_vars: Optional session variables dictionary. + event_hooks: Optional event hooks dictionary. + include_builtin_handlers: Whether to include built-in event handlers. + profile: Optional AWS profile name. + + """ + super().__init__(session_vars, event_hooks, include_builtin_handlers, profile) + self.user_agent_name = "nifcloud" self.user_agent_version = nifcloud.__version__ - self.user_agent_extra = 'botocore/%s' % botocore_version + self.user_agent_extra = f"botocore/{botocore_version}" + + def create_client( + self, + service_name, + region_name=None, + api_version=None, + use_ssl=True, + verify=None, + endpoint_url=None, + nifcloud_access_key_id=None, + nifcloud_secret_access_key=None, + nifcloud_session_token=None, + config=None, + ): + """Create a NIFCLOUD service client. + + Parameters match AWS SDK but with 'nifcloud_' prefix for credentials. + + Args: + service_name: The service name (e.g., 'computing', 'rdb'). + region_name: The region name. + api_version: Optional API version. + use_ssl: Whether to use SSL (default: True). + verify: SSL certificate verification (True/False/path). + endpoint_url: Optional custom endpoint URL. + nifcloud_access_key_id: NIFCLOUD access key ID. + nifcloud_secret_access_key: NIFCLOUD secret access key. + nifcloud_session_token: Optional session token. + config: Optional client configuration. + + Returns: + A configured NIFCLOUD service client. - def create_client(self, service_name, region_name=None, api_version=None, - use_ssl=True, verify=None, endpoint_url=None, - nifcloud_access_key_id=None, nifcloud_secret_access_key=None, - nifcloud_session_token=None, config=None): - client = super(Session, self).create_client( + """ + client = super().create_client( service_name, region_name=region_name, api_version=api_version, @@ -38,12 +82,12 @@ def create_client(self, service_name, region_name=None, api_version=None, aws_access_key_id=nifcloud_access_key_id, aws_secret_access_key=nifcloud_secret_access_key, aws_session_token=nifcloud_session_token, - config=config + config=config, ) http_session = client._endpoint.http_session - if hasattr(http_session, '_manager'): - http_session._manager.connection_pool_kw['ssl_context'] = ssl_context + if hasattr(http_session, "_manager"): + http_session._manager.connection_pool_kw["ssl_context"] = ssl_context return client diff --git a/tests/acceptance/minimal/test_computing_minimal.py b/tests/acceptance/minimal/test_computing_minimal.py index e909158..e99314a 100644 --- a/tests/acceptance/minimal/test_computing_minimal.py +++ b/tests/acceptance/minimal/test_computing_minimal.py @@ -12,34 +12,13 @@ def test_describe_regions(client): regions = client.describe_regions() actual_regions = regions["RegionInfo"] expected_regions = [ - { - "RegionName": "east-1", - "RegionEndpoint": "jp-east-1.computing.api.nifcloud.com" - }, - { - "RegionName": "east-2", - "RegionEndpoint": "jp-east-2.computing.api.nifcloud.com" - }, - { - "RegionName": "east-3", - "RegionEndpoint": "jp-east-3.computing.api.nifcloud.com" - }, - { - "RegionName": "jp-east-4", - "RegionEndpoint": "jp-east-4.computing.api.nifcloud.com" - }, - { - "RegionName": "west-1", - "RegionEndpoint": "jp-west-1.computing.api.nifcloud.com" - }, - { - "RegionName": "jp-west-2", - "RegionEndpoint": "jp-west-2.computing.api.nifcloud.com" - }, - { - "RegionName": "us-east-1", - "RegionEndpoint": "us-east-1.computing.api.nifcloud.com" - } + {"RegionName": "east-1", "RegionEndpoint": "jp-east-1.computing.api.nifcloud.com"}, + {"RegionName": "east-2", "RegionEndpoint": "jp-east-2.computing.api.nifcloud.com"}, + {"RegionName": "east-3", "RegionEndpoint": "jp-east-3.computing.api.nifcloud.com"}, + {"RegionName": "jp-east-4", "RegionEndpoint": "jp-east-4.computing.api.nifcloud.com"}, + {"RegionName": "west-1", "RegionEndpoint": "jp-west-1.computing.api.nifcloud.com"}, + {"RegionName": "jp-west-2", "RegionEndpoint": "jp-west-2.computing.api.nifcloud.com"}, + {"RegionName": "us-east-1", "RegionEndpoint": "us-east-1.computing.api.nifcloud.com"}, ] for actual, expected in zip(actual_regions, expected_regions): assert actual["RegionName"] == expected["RegionName"] diff --git a/tests/acceptance/minimal/test_rdb_minimal.py b/tests/acceptance/minimal/test_rdb_minimal.py index d200270..45ac507 100644 --- a/tests/acceptance/minimal/test_rdb_minimal.py +++ b/tests/acceptance/minimal/test_rdb_minimal.py @@ -9,8 +9,7 @@ def client(): def test_describe_db_engine_versions(client): - db_engine_versions = client.describe_db_engine_versions( - Engine='mysql', EngineVersion='5.7.15')["DBEngineVersions"] + db_engine_versions = client.describe_db_engine_versions(Engine="mysql", EngineVersion="5.7.15")["DBEngineVersions"] assert len(db_engine_versions) == 1 db_engine_version = db_engine_versions[0] diff --git a/tests/acceptance/minimal/test_storage_minimal.py b/tests/acceptance/minimal/test_storage_minimal.py index f8bbb07..a6fdc26 100644 --- a/tests/acceptance/minimal/test_storage_minimal.py +++ b/tests/acceptance/minimal/test_storage_minimal.py @@ -11,7 +11,7 @@ def client(): "storage", region_name="jp-east-1", nifcloud_access_key_id=os.getenv("NIFCLOUD_STORAGE_ACCESS_KEY_ID"), - nifcloud_secret_access_key=os.getenv("NIFCLOUD_STORAGE_SECRET_ACCESS_KEY") + nifcloud_secret_access_key=os.getenv("NIFCLOUD_STORAGE_SECRET_ACCESS_KEY"), ) diff --git a/tests/unit/nifcloud_test.py b/tests/unit/nifcloud_test.py index c84b5cd..40d54f5 100644 --- a/tests/unit/nifcloud_test.py +++ b/tests/unit/nifcloud_test.py @@ -1,2 +1,2 @@ def test_nifcloud(): - assert (True is True) + assert True is True diff --git a/tests/unit/test_parsers.py b/tests/unit/test_parsers.py index 57c17cc..4307ab7 100644 --- a/tests/unit/test_parsers.py +++ b/tests/unit/test_parsers.py @@ -11,18 +11,21 @@ def test_parse_timestamp_is_none(): assert cqp.parse_timestamp("") is None -@pytest.mark.parametrize('input, expected', [ - # computing https://pfs.nifcloud.com/api/rest/DescribeInstances.htm - ("2010-05-17T11:22:33.456+09:00", datetime(2010, 5, 17, 11, 22, 33, 456000, tz.gettz('Asia/Tokyo'))), - # rdb https://pfs.nifcloud.com/api/rdb/DescribeDBInstances.htm - ("2014-12-16T06:57:32.000Z", datetime(2014, 12, 16, 6, 57, 32, 0, tz.gettz('UTC'))), - # nas https://pfs.nifcloud.com/api/nas/DescribeNASInstances.htm - ("2016-02-02T09:07:40.000+09:00", datetime(2016, 2, 2, 9, 7, 40, 0, tz.gettz('Asia/Tokyo'))), - # ess https://pfs.nifcloud.com/api/ess/GetSendStatistics.htm - ("2014-03-10T18:30:00Z", datetime(2014, 3, 10, 18, 30, 0, 0, tz.gettz('UTC'))), - # dns https://pfs.nifcloud.com/api/dns/GetChange.htm - ("2021-06-17T08:53:44.110Z", datetime(2021, 6, 17, 8, 53, 44, 110000, tz.gettz('UTC'))) -]) +@pytest.mark.parametrize( + "input, expected", + [ + # computing https://pfs.nifcloud.com/api/rest/DescribeInstances.htm + ("2010-05-17T11:22:33.456+09:00", datetime(2010, 5, 17, 11, 22, 33, 456000, tz.gettz("Asia/Tokyo"))), + # rdb https://pfs.nifcloud.com/api/rdb/DescribeDBInstances.htm + ("2014-12-16T06:57:32.000Z", datetime(2014, 12, 16, 6, 57, 32, 0, tz.gettz("UTC"))), + # nas https://pfs.nifcloud.com/api/nas/DescribeNASInstances.htm + ("2016-02-02T09:07:40.000+09:00", datetime(2016, 2, 2, 9, 7, 40, 0, tz.gettz("Asia/Tokyo"))), + # ess https://pfs.nifcloud.com/api/ess/GetSendStatistics.htm + ("2014-03-10T18:30:00Z", datetime(2014, 3, 10, 18, 30, 0, 0, tz.gettz("UTC"))), + # dns https://pfs.nifcloud.com/api/dns/GetChange.htm + ("2021-06-17T08:53:44.110Z", datetime(2021, 6, 17, 8, 53, 44, 110000, tz.gettz("UTC"))), + ], +) def test_parse_timestamp_service_format(input, expected): cqp = parsers.ComputingQueryParser() assert cqp.parse_timestamp(input) == expected diff --git a/tests/unit/test_serialize_computing.py b/tests/unit/test_serialize_computing.py index 52a0d8c..69e6729 100644 --- a/tests/unit/test_serialize_computing.py +++ b/tests/unit/test_serialize_computing.py @@ -4,7 +4,7 @@ from nifcloud import serialize -class TestComputingSerializer(object): +class TestComputingSerializer: computing_model_metadata = { "apiVersion": "3.0", "endpointPrefix": "computing", @@ -14,7 +14,7 @@ class TestComputingSerializer(object): "serviceId": "computing", "signatureVersion": "v2", "uid": "computing-2016-11-15", - "xmlNamespace": "https://computing.api.nifcloud.com/api/" + "xmlNamespace": "https://computing.api.nifcloud.com/api/", } def test_ComputingSerializer(self): @@ -22,138 +22,89 @@ def test_ComputingSerializer(self): "metadata": self.computing_model_metadata, "operations": { "ComputingOperation": { - "http": { - "method": "POST", - "requestUri": "/api/" - }, - "input": { - "shape": "ComputingOperationRequest" - }, + "http": {"method": "POST", "requestUri": "/api/"}, + "input": {"shape": "ComputingOperationRequest"}, "name": "ComputingOperation", - "output": { - "shape": "ComputingOperationResult" - } + "output": {"shape": "ComputingOperationResult"}, } }, "shapes": { "ComputingOperationRequest": { - "members": { - "Parameter": { - "locationName": "Parameter", - "shape": "String" - } - }, + "members": {"Parameter": {"locationName": "Parameter", "shape": "String"}}, "name": "ComputingOperationRequest", - "type": "structure" + "type": "structure", }, "ComputingOperationResult": { - "members": { - "Response": { - "locationName": "Response", - "shape": "String" - } - }, + "members": {"Response": {"locationName": "Response", "shape": "String"}}, "name": "ComputingOperationResult", - "type": "structure" + "type": "structure", }, - "String": { - "name": "String", - "type": "string" - }, - } + "String": {"name": "String", "type": "string"}, + }, } computing_service_model = ServiceModel(computing_model) - params = { - "Parameter": "test" - } + params = {"Parameter": "test"} computing_serializer = serialize.ComputingSerializer() res = computing_serializer.serialize_to_request( - params, computing_service_model.operation_model("ComputingOperation")) + params, computing_service_model.operation_model("ComputingOperation") + ) assert res["body"] == {"Action": "ComputingOperation", "Parameter": "test", "Version": "3.0"} assert res["headers"] == {"Content-Type": "application/x-www-form-urlencoded; charset=utf-8"} assert res["method"] == "POST" assert res["query_string"] == "" assert res["url_path"] == "/api/" - @pytest.mark.parametrize("api_name", [ - 'RunInstances', - 'StartInstances', - 'RebootInstances', - ]) + @pytest.mark.parametrize( + "api_name", + [ + "RunInstances", + "StartInstances", + "RebootInstances", + ], + ) def test_ComputingSerializer_fix_user_data_param(self, api_name): computing_model = { "metadata": self.computing_model_metadata, "operations": { api_name: { - "http": { - "method": "POST", - "requestUri": "/api/" - }, - "input": { - "shape": "ComputingOperationRequest" - }, + "http": {"method": "POST", "requestUri": "/api/"}, + "input": {"shape": "ComputingOperationRequest"}, "name": api_name, - "output": { - "shape": "ComputingOperationResult" - } + "output": {"shape": "ComputingOperationResult"}, } }, "shapes": { "ComputingOperationRequest": { - "members": { - "UserData": { - "locationName": "UserData", - "shape": "RequestUserData" - } - }, + "members": {"UserData": {"locationName": "UserData", "shape": "RequestUserData"}}, "name": "ComputingOperationRequest", - "type": "structure" + "type": "structure", }, "ComputingOperationResult": { - "members": { - "Response": { - "locationName": "Response", - "shape": "String" - } - }, + "members": {"Response": {"locationName": "Response", "shape": "String"}}, "name": "ComputingOperationResult", - "type": "structure" + "type": "structure", }, "RequestUserData": { "members": { - "Content": { - "locationName": "Content", - "shape": "String" - }, - "Encoding": { - "locationName": "Encoding", - "shape": "String" - } + "Content": {"locationName": "Content", "shape": "String"}, + "Encoding": {"locationName": "Encoding", "shape": "String"}, }, "name": "RequestUserData", - "type": "structure" - }, - "String": { - "name": "String", - "type": "string" + "type": "structure", }, - } + "String": {"name": "String", "type": "string"}, + }, } computing_service_model = ServiceModel(computing_model) - params = { - "UserData": { - "Content": "test_content", - "Encoding": "test_content_encoding" - } - } + params = {"UserData": {"Content": "test_content", "Encoding": "test_content_encoding"}} computing_serializer = serialize.ComputingSerializer() res = computing_serializer.serialize_to_request(params, computing_service_model.operation_model(api_name)) assert res["body"] == { "Action": api_name, "UserData": "test_content", "UserData.Encoding": "test_content_encoding", - "Version": "3.0" + "Version": "3.0", } assert res["headers"] == {"Content-Type": "application/x-www-form-urlencoded; charset=utf-8"} assert res["method"] == "POST" @@ -165,17 +116,10 @@ def test_ComputingSerializer_fix_describe_load_balancers_params(self): "metadata": self.computing_model_metadata, "operations": { "DescribeLoadBalancers": { - "http": { - "method": "POST", - "requestUri": "/api/" - }, - "input": { - "shape": "DescribeLoadBalancersRequest" - }, + "http": {"method": "POST", "requestUri": "/api/"}, + "input": {"shape": "DescribeLoadBalancersRequest"}, "name": "DescribeLoadBalancers", - "output": { - "shape": "ComputingOperationResult" - } + "output": {"shape": "ComputingOperationResult"}, } }, "shapes": { @@ -183,71 +127,43 @@ def test_ComputingSerializer_fix_describe_load_balancers_params(self): "members": { "LoadBalancerNames": { "locationName": "LoadBalancerNames", - "shape": "ListOfRequestLoadBalancerNames" + "shape": "ListOfRequestLoadBalancerNames", }, - "Patamator": { - "locationName": "Patamator", - "shape": "String" - } + "Patamator": {"locationName": "Patamator", "shape": "String"}, }, "name": "DescribeLoadBalancersRequest", - "type": "structure" + "type": "structure", }, "ListOfRequestLoadBalancerNames": { - "member": { - "locationName": "member", - "shape": "RequestLoadBalancerNames" - }, + "member": {"locationName": "member", "shape": "RequestLoadBalancerNames"}, "name": "ListOfRequestLoadBalancerNames", - "type": "list" + "type": "list", }, "RequestLoadBalancerNames": { "members": { - "InstancePort": { - "locationName": "InstancePort", - "shape": "Integer" - }, - "LoadBalancerName": { - "locationName": "LoadBalancerName", - "shape": "String" - }, - "LoadBalancerPort": { - "locationName": "LoadBalancerPort", - "shape": "Integer" - } + "InstancePort": {"locationName": "InstancePort", "shape": "Integer"}, + "LoadBalancerName": {"locationName": "LoadBalancerName", "shape": "String"}, + "LoadBalancerPort": {"locationName": "LoadBalancerPort", "shape": "Integer"}, }, "name": "RequestLoadBalancerNames", - "type": "structure" + "type": "structure", }, "ComputingOperationResult": { - "members": { - "Response": { - "locationName": "Response", - "shape": "String" - } - }, + "members": {"Response": {"locationName": "Response", "shape": "String"}}, "name": "ComputingOperationResult", - "type": "structure" + "type": "structure", }, - "String": { - "name": "String", - "type": "string" - }, - "Integer": { - "name": "Integer", - "type": "integer" - }, - } + "String": {"name": "String", "type": "string"}, + "Integer": {"name": "Integer", "type": "integer"}, + }, } computing_service_model = ServiceModel(computing_model) params = {} computing_serializer = serialize.ComputingSerializer() res = computing_serializer.serialize_to_request( - params, computing_service_model.operation_model("DescribeLoadBalancers")) - assert res["body"] == { - "Action": "DescribeLoadBalancers", - "Version": "3.0" - } + params, computing_service_model.operation_model("DescribeLoadBalancers") + ) + assert res["body"] == {"Action": "DescribeLoadBalancers", "Version": "3.0"} assert res["headers"] == {"Content-Type": "application/x-www-form-urlencoded; charset=utf-8"} assert res["method"] == "POST" assert res["query_string"] == "" @@ -258,17 +174,10 @@ def test_ComputingSerializer_fix_describe_load_balancers_params_with_loadbalance "metadata": self.computing_model_metadata, "operations": { "DescribeLoadBalancers": { - "http": { - "method": "POST", - "requestUri": "/api/" - }, - "input": { - "shape": "DescribeLoadBalancersRequest" - }, + "http": {"method": "POST", "requestUri": "/api/"}, + "input": {"shape": "DescribeLoadBalancersRequest"}, "name": "DescribeLoadBalancers", - "output": { - "shape": "ComputingOperationResult" - } + "output": {"shape": "ComputingOperationResult"}, } }, "shapes": { @@ -276,81 +185,56 @@ def test_ComputingSerializer_fix_describe_load_balancers_params_with_loadbalance "members": { "LoadBalancerNames": { "locationName": "LoadBalancerNames", - "shape": "ListOfRequestLoadBalancerNames" + "shape": "ListOfRequestLoadBalancerNames", }, - "Patamator": { - "locationName": "Patamator", - "shape": "String" - } + "Patamator": {"locationName": "Patamator", "shape": "String"}, }, "name": "DescribeLoadBalancersRequest", - "type": "structure" + "type": "structure", }, "ListOfRequestLoadBalancerNames": { - "member": { - "locationName": "member", - "shape": "RequestLoadBalancerNames" - }, + "member": {"locationName": "member", "shape": "RequestLoadBalancerNames"}, "name": "ListOfRequestLoadBalancerNames", - "type": "list" + "type": "list", }, "RequestLoadBalancerNames": { "members": { - "InstancePort": { - "locationName": "InstancePort", - "shape": "Integer" - }, - "LoadBalancerName": { - "locationName": "LoadBalancerName", - "shape": "String" - }, - "LoadBalancerPort": { - "locationName": "LoadBalancerPort", - "shape": "Integer" - } + "InstancePort": {"locationName": "InstancePort", "shape": "Integer"}, + "LoadBalancerName": {"locationName": "LoadBalancerName", "shape": "String"}, + "LoadBalancerPort": {"locationName": "LoadBalancerPort", "shape": "Integer"}, }, "name": "RequestLoadBalancerNames", - "type": "structure" + "type": "structure", }, "ComputingOperationResult": { - "members": { - "Response": { - "locationName": "Response", - "shape": "String" - } - }, + "members": {"Response": {"locationName": "Response", "shape": "String"}}, "name": "ComputingOperationResult", - "type": "structure" - }, - "String": { - "name": "String", - "type": "string" - }, - "Integer": { - "name": "Integer", - "type": "integer" + "type": "structure", }, - } + "String": {"name": "String", "type": "string"}, + "Integer": {"name": "Integer", "type": "integer"}, + }, } computing_service_model = ServiceModel(computing_model) params = { "LoadBalancerNames": [ - { - "LoadBalancerName": "test_load_balancer_name", - "LoadBalancerPort": "test_load_balancer_port", - "InstancePort": "test_instance_port" - } - ] + { + "LoadBalancerName": "test_load_balancer_name", + "LoadBalancerPort": "test_load_balancer_port", + "InstancePort": "test_instance_port", + } + ] } computing_serializer = serialize.ComputingSerializer() res = computing_serializer.serialize_to_request( - params, computing_service_model.operation_model("DescribeLoadBalancers")) + params, computing_service_model.operation_model("DescribeLoadBalancers") + ) assert res["body"] == { "Action": "DescribeLoadBalancers", "Version": "3.0", "LoadBalancerNames.member.1": "test_load_balancer_name", "LoadBalancerNames.LoadBalancerPort.1": "test_load_balancer_port", - "LoadBalancerNames.InstancePort.1": "test_instance_port" + "LoadBalancerNames.InstancePort.1": "test_instance_port", } assert res["headers"] == {"Content-Type": "application/x-www-form-urlencoded; charset=utf-8"} assert res["method"] == "POST" diff --git a/tests/unit/test_serialize_dns.py b/tests/unit/test_serialize_dns.py index fcd5b66..9703a2d 100644 --- a/tests/unit/test_serialize_dns.py +++ b/tests/unit/test_serialize_dns.py @@ -3,7 +3,7 @@ from nifcloud import serialize -class TestDnsSerializer(object): +class TestDnsSerializer: dns_model_metadata = { "apiVersion": "2012-12-12N2013-12-16", "endpointPrefix": "dns", @@ -12,7 +12,7 @@ class TestDnsSerializer(object): "serviceFullName": "NIFCLOUD DNS", "serviceId": "dns", "signatureVersion": "v3", - "uid": "dns-2012-12-12N2013-12-16" + "uid": "dns-2012-12-12N2013-12-16", } def test_DnsSerializer(self): @@ -20,59 +20,41 @@ def test_DnsSerializer(self): "metadata": self.dns_model_metadata, "operations": { "DnsOperation": { - "http": { - "method": "POST", - "requestUri": "/2012-12-12N2013-12-16/operation" - }, + "http": {"method": "POST", "requestUri": "/2012-12-12N2013-12-16/operation"}, "input": { "locationName": "DnsOperationRequest", "shape": "DnsOperationRequest", - "xmlNamespace": { - "uri": "https://route53.amazonaws.com/doc/2012-12-12/" - } + "xmlNamespace": {"uri": "https://route53.amazonaws.com/doc/2012-12-12/"}, }, "name": "DnsOperation", - "output": { - "shape": "DnsOperationResult" - } + "output": {"shape": "DnsOperationResult"}, }, }, "shapes": { "DnsOperationRequest": { "members": { - "Parameter": { - "locationName": "Parameter", - "shape": "String" - }, + "Parameter": {"locationName": "Parameter", "shape": "String"}, }, "name": "DnsOperationRequest", - "type": "structure" + "type": "structure", }, "DnsOperationResult": { - "members": { - "Parameter": { - "locationName": "Parameter", - "shape": "String" - } - }, + "members": {"Parameter": {"locationName": "Parameter", "shape": "String"}}, "name": "DnsOperationResult", - "type": "structure" + "type": "structure", }, - "String": { - "name": "String", - "type": "string" - }, - } + "String": {"name": "String", "type": "string"}, + }, } dns_service_model = ServiceModel(dns_model) - params = { - "Parameter": "test" - } + params = {"Parameter": "test"} dns_serializer = serialize.DnsSerializer() - res = dns_serializer.serialize_to_request( - params, dns_service_model.operation_model("DnsOperation")) - assert res["body"] == b'test' # noqa: E501 + res = dns_serializer.serialize_to_request(params, dns_service_model.operation_model("DnsOperation")) + assert ( + res["body"] + == b'test' + ) # noqa: E501 assert res["headers"] == {} assert res["method"] == "POST" assert res["query_string"] == {} diff --git a/tests/unit/test_serialize_ess.py b/tests/unit/test_serialize_ess.py index 97ad270..cfae027 100644 --- a/tests/unit/test_serialize_ess.py +++ b/tests/unit/test_serialize_ess.py @@ -3,7 +3,7 @@ from nifcloud import serialize -class TestEssSerializer(object): +class TestEssSerializer: ess_model_metadata = { "apiVersion": "2010-12-01N2014-05-28", "endpointPrefix": "ess", @@ -13,7 +13,7 @@ class TestEssSerializer(object): "serviceId": "ess", "signatureVersion": "v4", "signingName": "email", - "uid": "ess-2010-12-01N2014-05-28" + "uid": "ess-2010-12-01N2014-05-28", } def test_EssSerializer(self): @@ -21,54 +21,31 @@ def test_EssSerializer(self): "metadata": self.ess_model_metadata, "operations": { "EssOperation": { - "http": { - "method": "POST", - "requestUri": "/" - }, - "input": { - "shape": "EssOperationRequest" - }, + "http": {"method": "POST", "requestUri": "/"}, + "input": {"shape": "EssOperationRequest"}, "name": "essOperation", - "output": { - "shape": "EssOperationResult" - } + "output": {"shape": "EssOperationResult"}, } }, "shapes": { "EssOperationRequest": { - "members": { - "Parameter": { - "locationName": "Parameter", - "shape": "String" - } - }, + "members": {"Parameter": {"locationName": "Parameter", "shape": "String"}}, "name": "EssOperationRequest", - "type": "structure" + "type": "structure", }, "EssOperationResult": { - "members": { - "Response": { - "locationName": "Response", - "shape": "String" - } - }, + "members": {"Response": {"locationName": "Response", "shape": "String"}}, "name": "EssOperationResult", - "type": "structure" - }, - "String": { - "name": "String", - "type": "string" + "type": "structure", }, - } + "String": {"name": "String", "type": "string"}, + }, } ess_service_model = ServiceModel(ess_model) - params = { - "Parameter": "test" - } + params = {"Parameter": "test"} ess_serializer = serialize.EssSerializer() - res = ess_serializer.serialize_to_request( - params, ess_service_model.operation_model("EssOperation")) + res = ess_serializer.serialize_to_request(params, ess_service_model.operation_model("EssOperation")) assert res["body"] == {"Action": "EssOperation", "Parameter": "test", "Version": "2010-12-01N2014-05-28"} assert res["headers"] == {"Content-Type": "application/x-www-form-urlencoded; charset=utf-8"} assert res["method"] == "POST" @@ -80,80 +57,40 @@ def test_EssSerializer_GetDeliveryLog(self): "metadata": self.ess_model_metadata, "operations": { "GetDeliveryLog": { - "http": { - "method": "POST", - "requestUri": "/" - }, - "input": { - "shape": "GetDeliveryLogRequest" - }, + "http": {"method": "POST", "requestUri": "/"}, + "input": {"shape": "GetDeliveryLogRequest"}, "name": "essOperation", - "output": { - "shape": "EssOperationResult" - } + "output": {"shape": "EssOperationResult"}, } }, "shapes": { "GetDeliveryLogRequest": { "members": { - "EndDate": { - "locationName": "EndDate", - "shape": "TStamp" - }, - "MaxItems": { - "locationName": "MaxItems", - "shape": "Integer" - }, - "NextToken": { - "locationName": "NextToken", - "shape": "String" - }, - "StartDate": { - "locationName": "StartDate", - "shape": "TStamp" - }, - "Status": { - "locationName": "Status", - "shape": "Integer" - } + "EndDate": {"locationName": "EndDate", "shape": "TStamp"}, + "MaxItems": {"locationName": "MaxItems", "shape": "Integer"}, + "NextToken": {"locationName": "NextToken", "shape": "String"}, + "StartDate": {"locationName": "StartDate", "shape": "TStamp"}, + "Status": {"locationName": "Status", "shape": "Integer"}, }, "name": "GetDeliveryLogRequest", - "required": [ - "EndDate", - "StartDate" - ], - "type": "structure" + "required": ["EndDate", "StartDate"], + "type": "structure", }, "EssOperationResult": { - "members": { - "Response": { - "locationName": "Response", - "shape": "String" - } - }, + "members": {"Response": {"locationName": "Response", "shape": "String"}}, "name": "EssOperationResult", - "type": "structure" - }, - "Integer": { - "name": "Integer", - "type": "integer" + "type": "structure", }, - "TStamp": { - "name": "TStamp", - "type": "timestamp" - }, - "String": { - "name": "String", - "type": "string" - } - } + "Integer": {"name": "Integer", "type": "integer"}, + "TStamp": {"name": "TStamp", "type": "timestamp"}, + "String": {"name": "String", "type": "string"}, + }, } ess_service_model = ServiceModel(ess_model) params = {} ess_serializer = serialize.EssSerializer() - res = ess_serializer.serialize_to_request( - params, ess_service_model.operation_model("GetDeliveryLog")) + res = ess_serializer.serialize_to_request(params, ess_service_model.operation_model("GetDeliveryLog")) assert res["body"] == {"Action": "GetDeliveryLog", "Version": "2010-12-01N2014-05-28"} assert res["headers"] == {"Content-Type": "application/x-www-form-urlencoded; charset=utf-8"} assert res["method"] == "POST" @@ -165,73 +102,34 @@ def test_EssSerializer_GetDeliveryLog_with_status(self): "metadata": self.ess_model_metadata, "operations": { "GetDeliveryLog": { - "http": { - "method": "POST", - "requestUri": "/" - }, - "input": { - "shape": "GetDeliveryLogRequest" - }, + "http": {"method": "POST", "requestUri": "/"}, + "input": {"shape": "GetDeliveryLogRequest"}, "name": "essOperation", - "output": { - "shape": "EssOperationResult" - } + "output": {"shape": "EssOperationResult"}, } }, "shapes": { "GetDeliveryLogRequest": { "members": { - "EndDate": { - "locationName": "EndDate", - "shape": "TStamp" - }, - "MaxItems": { - "locationName": "MaxItems", - "shape": "Integer" - }, - "NextToken": { - "locationName": "NextToken", - "shape": "String" - }, - "StartDate": { - "locationName": "StartDate", - "shape": "TStamp" - }, - "Status": { - "locationName": "Status", - "shape": "Integer" - } + "EndDate": {"locationName": "EndDate", "shape": "TStamp"}, + "MaxItems": {"locationName": "MaxItems", "shape": "Integer"}, + "NextToken": {"locationName": "NextToken", "shape": "String"}, + "StartDate": {"locationName": "StartDate", "shape": "TStamp"}, + "Status": {"locationName": "Status", "shape": "Integer"}, }, "name": "GetDeliveryLogRequest", - "required": [ - "EndDate", - "StartDate" - ], - "type": "structure" + "required": ["EndDate", "StartDate"], + "type": "structure", }, "EssOperationResult": { - "members": { - "Response": { - "locationName": "Response", - "shape": "String" - } - }, + "members": {"Response": {"locationName": "Response", "shape": "String"}}, "name": "EssOperationResult", - "type": "structure" - }, - "Integer": { - "name": "Integer", - "type": "integer" + "type": "structure", }, - "TStamp": { - "name": "TStamp", - "type": "timestamp" - }, - "String": { - "name": "String", - "type": "string" - } - } + "Integer": {"name": "Integer", "type": "integer"}, + "TStamp": {"name": "TStamp", "type": "timestamp"}, + "String": {"name": "String", "type": "string"}, + }, } ess_service_model = ServiceModel(ess_model) @@ -240,11 +138,10 @@ def test_EssSerializer_GetDeliveryLog_with_status(self): "MaxItems": 1, "NextToken": "test_token", "StartDate": "2017-12-13T00:00:00Z", - "EndDate": "2017-12-13T23:59:00Z" + "EndDate": "2017-12-13T23:59:00Z", } ess_serializer = serialize.EssSerializer() - res = ess_serializer.serialize_to_request( - params, ess_service_model.operation_model("GetDeliveryLog")) + res = ess_serializer.serialize_to_request(params, ess_service_model.operation_model("GetDeliveryLog")) assert res["body"] == { "Action": "GetDeliveryLog", "Version": "2010-12-01N2014-05-28", @@ -252,7 +149,7 @@ def test_EssSerializer_GetDeliveryLog_with_status(self): "MaxItems": 1, "NextToken": "test_token", "StartDate": "2017-12-13T00:00", - "EndDate": "2017-12-13T23:59" + "EndDate": "2017-12-13T23:59", } assert res["headers"] == {"Content-Type": "application/x-www-form-urlencoded; charset=utf-8"} assert res["method"] == "POST" diff --git a/tests/unit/test_serialize_nas.py b/tests/unit/test_serialize_nas.py index 585ed71..f0e2092 100644 --- a/tests/unit/test_serialize_nas.py +++ b/tests/unit/test_serialize_nas.py @@ -3,7 +3,7 @@ from nifcloud import serialize -class TestNasSerializer(object): +class TestNasSerializer: nas_model_metadata = { "apiVersion": "N2016-02-24", "endpointPrefix": "nas", @@ -12,7 +12,7 @@ class TestNasSerializer(object): "serviceFullName": "NIFCLOUD NAS", "serviceId": "nas", "signatureVersion": "v4", - "uid": "nas-N2016-02-24" + "uid": "nas-N2016-02-24", } def test_NasSerializer(self): @@ -20,54 +20,31 @@ def test_NasSerializer(self): "metadata": self.nas_model_metadata, "operations": { "NasOperation": { - "http": { - "method": "POST", - "requestUri": "/" - }, - "input": { - "shape": "NasOperationRequest" - }, + "http": {"method": "POST", "requestUri": "/"}, + "input": {"shape": "NasOperationRequest"}, "name": "NasOperation", - "output": { - "shape": "NasOperationResult" - } + "output": {"shape": "NasOperationResult"}, } }, "shapes": { "NasOperationRequest": { - "members": { - "Parameter": { - "locationName": "Parameter", - "shape": "String" - } - }, + "members": {"Parameter": {"locationName": "Parameter", "shape": "String"}}, "name": "NasOperationRequest", - "type": "structure" + "type": "structure", }, "NasOperationResult": { - "members": { - "Response": { - "locationName": "Response", - "shape": "String" - } - }, + "members": {"Response": {"locationName": "Response", "shape": "String"}}, "name": "NasOperationResult", - "type": "structure" + "type": "structure", }, - "String": { - "name": "String", - "type": "string" - }, - } + "String": {"name": "String", "type": "string"}, + }, } nas_service_model = ServiceModel(nas_model) - params = { - "Parameter": "test" - } + params = {"Parameter": "test"} nas_serializer = serialize.NasSerializer() - res = nas_serializer.serialize_to_request( - params, nas_service_model.operation_model("NasOperation")) + res = nas_serializer.serialize_to_request(params, nas_service_model.operation_model("NasOperation")) assert res["body"] == {"Action": "NasOperation", "Parameter": "test", "Version": "N2016-02-24"} assert res["headers"] == {"Content-Type": "application/x-www-form-urlencoded; charset=utf-8"} assert res["method"] == "POST" @@ -79,99 +56,52 @@ def test_NasSerializer_fix_get_metrics_statistics_params(self): "metadata": self.nas_model_metadata, "operations": { "GetMetricStatistics": { - "http": { - "method": "POST", - "requestUri": "/" - }, - "input": { - "shape": "GetMetricStatisticsRequest" - }, + "http": {"method": "POST", "requestUri": "/"}, + "input": {"shape": "GetMetricStatisticsRequest"}, "name": "GetMetricStatistics", - "output": { - "resultWrapper": "NasOperationResult", - "shape": "NasOperationResult" - } + "output": {"resultWrapper": "NasOperationResult", "shape": "NasOperationResult"}, }, }, "shapes": { "GetMetricStatisticsRequest": { "members": { - "Dimensions": { - "locationName": "Dimensions", - "shape": "ListOfRequestDimensions" - }, - "EndTime": { - "locationName": "EndTime", - "shape": "TStamp" - }, - "MetricName": { - "locationName": "MetricName", - "shape": "String" - }, - "StartTime": { - "locationName": "StartTime", - "shape": "TStamp" - } + "Dimensions": {"locationName": "Dimensions", "shape": "ListOfRequestDimensions"}, + "EndTime": {"locationName": "EndTime", "shape": "TStamp"}, + "MetricName": {"locationName": "MetricName", "shape": "String"}, + "StartTime": {"locationName": "StartTime", "shape": "TStamp"}, }, "name": "GetMetricStatisticsRequest", - "type": "structure" + "type": "structure", }, "ListOfRequestDimensions": { - "member": { - "locationName": "member", - "shape": "RequestDimensions" - }, + "member": {"locationName": "member", "shape": "RequestDimensions"}, "name": "ListOfRequestDimensions", - "type": "list" + "type": "list", }, "RequestDimensions": { "members": { - "Name": { - "locationName": "Name", - "shape": "String" - }, - "Value": { - "locationName": "Value", - "shape": "String" - } + "Name": {"locationName": "Name", "shape": "String"}, + "Value": {"locationName": "Value", "shape": "String"}, }, "name": "RequestDimensions", - "required": [ - "Name", - "Value" - ], - "type": "structure" + "required": ["Name", "Value"], + "type": "structure", }, "NasOperationResult": { - "members": { - "Response": { - "locationName": "Response", - "shape": "String" - } - }, + "members": {"Response": {"locationName": "Response", "shape": "String"}}, "name": "NasOperationResult", - "type": "structure" + "type": "structure", }, - "String": { - "name": "String", - "type": "string" - }, - "TStamp": { - "name": "TStamp", - "type": "timestamp" - } - } + "String": {"name": "String", "type": "string"}, + "TStamp": {"name": "TStamp", "type": "timestamp"}, + }, } nas_service_model = ServiceModel(nas_model) params = {} nas_serializer = serialize.NasSerializer() - res = nas_serializer.serialize_to_request( - params, nas_service_model.operation_model("GetMetricStatistics")) - assert res["body"] == { - "Action": "GetMetricStatistics", - "Version": "N2016-02-24" - } + res = nas_serializer.serialize_to_request(params, nas_service_model.operation_model("GetMetricStatistics")) + assert res["body"] == {"Action": "GetMetricStatistics", "Version": "N2016-02-24"} assert res["headers"] == {"Content-Type": "application/x-www-form-urlencoded; charset=utf-8"} assert res["method"] == "POST" assert res["query_string"] == "" @@ -182,110 +112,61 @@ def test_NasSerializer_fix_get_metrics_statistics_params_MetricName_Dimensions(s "metadata": self.nas_model_metadata, "operations": { "GetMetricStatistics": { - "http": { - "method": "POST", - "requestUri": "/" - }, - "input": { - "shape": "GetMetricStatisticsRequest" - }, + "http": {"method": "POST", "requestUri": "/"}, + "input": {"shape": "GetMetricStatisticsRequest"}, "name": "GetMetricStatistics", - "output": { - "resultWrapper": "NasOperationResult", - "shape": "NasOperationResult" - } + "output": {"resultWrapper": "NasOperationResult", "shape": "NasOperationResult"}, }, }, "shapes": { "GetMetricStatisticsRequest": { "members": { - "Dimensions": { - "locationName": "Dimensions", - "shape": "ListOfRequestDimensions" - }, - "EndTime": { - "locationName": "EndTime", - "shape": "TStamp" - }, - "MetricName": { - "locationName": "MetricName", - "shape": "String" - }, - "StartTime": { - "locationName": "StartTime", - "shape": "TStamp" - } + "Dimensions": {"locationName": "Dimensions", "shape": "ListOfRequestDimensions"}, + "EndTime": {"locationName": "EndTime", "shape": "TStamp"}, + "MetricName": {"locationName": "MetricName", "shape": "String"}, + "StartTime": {"locationName": "StartTime", "shape": "TStamp"}, }, "name": "GetMetricStatisticsRequest", - "required": [ - "MetricName", - "Dimensions" - ], - "type": "structure" + "required": ["MetricName", "Dimensions"], + "type": "structure", }, "ListOfRequestDimensions": { - "member": { - "locationName": "member", - "shape": "RequestDimensions" - }, + "member": {"locationName": "member", "shape": "RequestDimensions"}, "name": "ListOfRequestDimensions", - "type": "list" + "type": "list", }, "RequestDimensions": { "members": { - "Name": { - "locationName": "Name", - "shape": "String" - }, - "Value": { - "locationName": "Value", - "shape": "String" - } + "Name": {"locationName": "Name", "shape": "String"}, + "Value": {"locationName": "Value", "shape": "String"}, }, "name": "RequestDimensions", - "required": [ - "Name", - "Value" - ], - "type": "structure" + "required": ["Name", "Value"], + "type": "structure", }, "NasOperationResult": { - "members": { - "Response": { - "locationName": "Response", - "shape": "String" - } - }, + "members": {"Response": {"locationName": "Response", "shape": "String"}}, "name": "NasOperationResult", - "type": "structure" + "type": "structure", }, - "String": { - "name": "String", - "type": "string" - }, - "TStamp": { - "name": "TStamp", - "type": "timestamp" - } - } + "String": {"name": "String", "type": "string"}, + "TStamp": {"name": "TStamp", "type": "timestamp"}, + }, } nas_service_model = ServiceModel(nas_model) params = { "MetricName": "test_metric_name", - "Dimensions": [ - {"Name": "test_dimensions_name", "Value": "test_value"} - ] + "Dimensions": [{"Name": "test_dimensions_name", "Value": "test_value"}], } nas_serializer = serialize.NasSerializer() - res = nas_serializer.serialize_to_request( - params, nas_service_model.operation_model("GetMetricStatistics")) + res = nas_serializer.serialize_to_request(params, nas_service_model.operation_model("GetMetricStatistics")) assert res["body"] == { "Action": "GetMetricStatistics", "MetricName": "test_metric_name", "Version": "N2016-02-24", "Dimensions.member.1.Name": "test_dimensions_name", - "Dimensions.member.1.Value": "test_value" + "Dimensions.member.1.Value": "test_value", } assert res["headers"] == {"Content-Type": "application/x-www-form-urlencoded; charset=utf-8"} assert res["method"] == "POST" diff --git a/tests/unit/test_serialize_rdb.py b/tests/unit/test_serialize_rdb.py index ddbf835..555dca8 100644 --- a/tests/unit/test_serialize_rdb.py +++ b/tests/unit/test_serialize_rdb.py @@ -3,7 +3,7 @@ from nifcloud import serialize -class TestRdbSerializer(object): +class TestRdbSerializer: rdb_model_metadata = { "apiVersion": "2013-05-15N2013-12-16", "endpointPrefix": "rdb", @@ -12,7 +12,7 @@ class TestRdbSerializer(object): "serviceFullName": "NIFCLOUD RDB", "serviceId": "rdb", "signatureVersion": "v4", - "uid": "rdb-2013-05-15N2013-12-16" + "uid": "rdb-2013-05-15N2013-12-16", } def test_RdbSerializer(self): @@ -20,54 +20,31 @@ def test_RdbSerializer(self): "metadata": self.rdb_model_metadata, "operations": { "RdbOperation": { - "http": { - "method": "POST", - "requestUri": "/" - }, - "input": { - "shape": "RdbOperationRequest" - }, + "http": {"method": "POST", "requestUri": "/"}, + "input": {"shape": "RdbOperationRequest"}, "name": "rdbOperation", - "output": { - "shape": "RdbOperationResult" - } + "output": {"shape": "RdbOperationResult"}, } }, "shapes": { "RdbOperationRequest": { - "members": { - "Parameter": { - "locationName": "Parameter", - "shape": "String" - } - }, + "members": {"Parameter": {"locationName": "Parameter", "shape": "String"}}, "name": "RdbOperationRequest", - "type": "structure" + "type": "structure", }, "RdbOperationResult": { - "members": { - "Response": { - "locationName": "Response", - "shape": "String" - } - }, + "members": {"Response": {"locationName": "Response", "shape": "String"}}, "name": "RdbOperationResult", - "type": "structure" + "type": "structure", }, - "String": { - "name": "String", - "type": "string" - }, - } + "String": {"name": "String", "type": "string"}, + }, } rdb_service_model = ServiceModel(rdb_model) - params = { - "Parameter": "test" - } + params = {"Parameter": "test"} rdb_serializer = serialize.RdbSerializer() - res = rdb_serializer.serialize_to_request( - params, rdb_service_model.operation_model("RdbOperation")) + res = rdb_serializer.serialize_to_request(params, rdb_service_model.operation_model("RdbOperation")) assert res["body"] == {"Action": "RdbOperation", "Parameter": "test", "Version": "2013-05-15N2013-12-16"} assert res["headers"] == {"Content-Type": "application/x-www-form-urlencoded; charset=utf-8"} assert res["method"] == "POST" @@ -79,99 +56,52 @@ def test_RdbSerializer_fix_get_metrics_statistics_params(self): "metadata": self.rdb_model_metadata, "operations": { "NiftyGetMetricStatistics": { - "http": { - "method": "POST", - "requestUri": "/" - }, - "input": { - "shape": "NiftyGetMetricStatisticsRequest" - }, + "http": {"method": "POST", "requestUri": "/"}, + "input": {"shape": "NiftyGetMetricStatisticsRequest"}, "name": "NiftyGetMetricStatistics", - "output": { - "resultWrapper": "RdbOperationResult", - "shape": "RdbOperationResult" - } + "output": {"resultWrapper": "RdbOperationResult", "shape": "RdbOperationResult"}, }, }, "shapes": { "NiftyGetMetricStatisticsRequest": { "members": { - "Dimensions": { - "locationName": "Dimensions", - "shape": "ListOfRequestDimensions" - }, - "EndTime": { - "locationName": "EndTime", - "shape": "TStamp" - }, - "MetricName": { - "locationName": "MetricName", - "shape": "String" - }, - "StartTime": { - "locationName": "StartTime", - "shape": "TStamp" - } + "Dimensions": {"locationName": "Dimensions", "shape": "ListOfRequestDimensions"}, + "EndTime": {"locationName": "EndTime", "shape": "TStamp"}, + "MetricName": {"locationName": "MetricName", "shape": "String"}, + "StartTime": {"locationName": "StartTime", "shape": "TStamp"}, }, "name": "NiftyGetMetricStatisticsRequest", - "type": "structure" + "type": "structure", }, "ListOfRequestDimensions": { - "member": { - "locationName": "member", - "shape": "RequestDimensions" - }, + "member": {"locationName": "member", "shape": "RequestDimensions"}, "name": "ListOfRequestDimensions", - "type": "list" + "type": "list", }, "RequestDimensions": { "members": { - "Name": { - "locationName": "Name", - "shape": "String" - }, - "Value": { - "locationName": "Value", - "shape": "String" - } + "Name": {"locationName": "Name", "shape": "String"}, + "Value": {"locationName": "Value", "shape": "String"}, }, "name": "RequestDimensions", - "required": [ - "Name", - "Value" - ], - "type": "structure" + "required": ["Name", "Value"], + "type": "structure", }, "RdbOperationResult": { - "members": { - "Response": { - "locationName": "Response", - "shape": "String" - } - }, + "members": {"Response": {"locationName": "Response", "shape": "String"}}, "name": "RdbOperationResult", - "type": "structure" + "type": "structure", }, - "String": { - "name": "String", - "type": "string" - }, - "TStamp": { - "name": "TStamp", - "type": "timestamp" - } - } + "String": {"name": "String", "type": "string"}, + "TStamp": {"name": "TStamp", "type": "timestamp"}, + }, } rdb_service_model = ServiceModel(rdb_model) params = {} rdb_serializer = serialize.RdbSerializer() - res = rdb_serializer.serialize_to_request( - params, rdb_service_model.operation_model("NiftyGetMetricStatistics")) - assert res["body"] == { - "Action": "NiftyGetMetricStatistics", - "Version": "2013-05-15N2013-12-16" - } + res = rdb_serializer.serialize_to_request(params, rdb_service_model.operation_model("NiftyGetMetricStatistics")) + assert res["body"] == {"Action": "NiftyGetMetricStatistics", "Version": "2013-05-15N2013-12-16"} assert res["headers"] == {"Content-Type": "application/x-www-form-urlencoded; charset=utf-8"} assert res["method"] == "POST" assert res["query_string"] == "" @@ -182,110 +112,61 @@ def test_RdbSerializer_fix_get_metrics_statistics_params_MetricName_Dimensions(s "metadata": self.rdb_model_metadata, "operations": { "NiftyGetMetricStatistics": { - "http": { - "method": "POST", - "requestUri": "/" - }, - "input": { - "shape": "NiftyGetMetricStatisticsRequest" - }, + "http": {"method": "POST", "requestUri": "/"}, + "input": {"shape": "NiftyGetMetricStatisticsRequest"}, "name": "NiftyGetMetricStatistics", - "output": { - "resultWrapper": "RdbOperationResult", - "shape": "RdbOperationResult" - } + "output": {"resultWrapper": "RdbOperationResult", "shape": "RdbOperationResult"}, }, }, "shapes": { "NiftyGetMetricStatisticsRequest": { "members": { - "Dimensions": { - "locationName": "Dimensions", - "shape": "ListOfRequestDimensions" - }, - "EndTime": { - "locationName": "EndTime", - "shape": "TStamp" - }, - "MetricName": { - "locationName": "MetricName", - "shape": "String" - }, - "StartTime": { - "locationName": "StartTime", - "shape": "TStamp" - } + "Dimensions": {"locationName": "Dimensions", "shape": "ListOfRequestDimensions"}, + "EndTime": {"locationName": "EndTime", "shape": "TStamp"}, + "MetricName": {"locationName": "MetricName", "shape": "String"}, + "StartTime": {"locationName": "StartTime", "shape": "TStamp"}, }, "name": "NiftyGetMetricStatisticsRequest", - "required": [ - "MetricName", - "Dimensions" - ], - "type": "structure" + "required": ["MetricName", "Dimensions"], + "type": "structure", }, "ListOfRequestDimensions": { - "member": { - "locationName": "member", - "shape": "RequestDimensions" - }, + "member": {"locationName": "member", "shape": "RequestDimensions"}, "name": "ListOfRequestDimensions", - "type": "list" + "type": "list", }, "RequestDimensions": { "members": { - "Name": { - "locationName": "Name", - "shape": "String" - }, - "Value": { - "locationName": "Value", - "shape": "String" - } + "Name": {"locationName": "Name", "shape": "String"}, + "Value": {"locationName": "Value", "shape": "String"}, }, "name": "RequestDimensions", - "required": [ - "Name", - "Value" - ], - "type": "structure" + "required": ["Name", "Value"], + "type": "structure", }, "RdbOperationResult": { - "members": { - "Response": { - "locationName": "Response", - "shape": "String" - } - }, + "members": {"Response": {"locationName": "Response", "shape": "String"}}, "name": "RdbOperationResult", - "type": "structure" + "type": "structure", }, - "String": { - "name": "String", - "type": "string" - }, - "TStamp": { - "name": "TStamp", - "type": "timestamp" - } - } + "String": {"name": "String", "type": "string"}, + "TStamp": {"name": "TStamp", "type": "timestamp"}, + }, } rdb_service_model = ServiceModel(rdb_model) params = { "MetricName": "test_metric_name", - "Dimensions": [ - {"Name": "test_dimensions_name", "Value": "test_value"} - ] + "Dimensions": [{"Name": "test_dimensions_name", "Value": "test_value"}], } rdb_serializer = serialize.RdbSerializer() - res = rdb_serializer.serialize_to_request( - params, rdb_service_model.operation_model("NiftyGetMetricStatistics")) + res = rdb_serializer.serialize_to_request(params, rdb_service_model.operation_model("NiftyGetMetricStatistics")) assert res["body"] == { "Action": "NiftyGetMetricStatistics", "MetricName": "test_metric_name", "Version": "2013-05-15N2013-12-16", "Dimensions.member.1.Name": "test_dimensions_name", - "Dimensions.member.1.Value": "test_value" + "Dimensions.member.1.Value": "test_value", } assert res["headers"] == {"Content-Type": "application/x-www-form-urlencoded; charset=utf-8"} assert res["method"] == "POST"