When I use Indigo to draw compounds with amide (such as L-glutamine or L-asparagine) using InChI as the input, the double bond is between the C=N instead of C=O.
For example the InChI for L-glutamine is:
InChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)/t3-/m0/s1
and the resulting image is:

When I use Indigo to draw compounds with amide (such as L-glutamine or L-asparagine) using InChI as the input, the double bond is between the C=N instead of C=O.
For example the InChI for L-glutamine is:

InChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)/t3-/m0/s1
and the resulting image is: