From cbfac0b142489561d7d1ec5d0a4489ec60a663ba Mon Sep 17 00:00:00 2001 From: "copilot-swe-agent[bot]" <198982749+Copilot@users.noreply.github.com> Date: Fri, 20 Feb 2026 14:42:10 +0000 Subject: [PATCH 1/3] Initial plan From dd4cf19da60d1c2c2b6c25fc6da61aabcd8bc066 Mon Sep 17 00:00:00 2001 From: "copilot-swe-agent[bot]" <198982749+Copilot@users.noreply.github.com> Date: Fri, 20 Feb 2026 14:47:12 +0000 Subject: [PATCH 2/3] Replace wildcard imports with explicit imports in 100 test files Replace `from env_indigo import *` with explicit named imports in all files listed in the issue. Standard library modules (os, sys, etc.) that are already directly imported are not redundantly imported from env_indigo. Co-authored-by: AlexeyGirin <26869421+AlexeyGirin@users.noreply.github.com> --- api/tests/integration/tests/aam/aam_access.py | 3 +- api/tests/integration/tests/aam/aam_basic.py | 3 +- api/tests/integration/tests/aam/aam_hard.py | 3 +- .../integration/tests/arom/arom_d_orbital.py | 57 +- .../integration/tests/arom/arom_merge.py | 3 +- api/tests/integration/tests/arom/basic.py | 7 +- api/tests/integration/tests/arom/elements.py | 7 +- api/tests/integration/tests/arom/extended.py | 7 +- .../tests/arom/partial_arom_cano.py | 3 +- .../integration/tests/arom/query_dearom.py | 3 +- api/tests/integration/tests/basic/allenes.py | 217 +++--- .../tests/basic/atom_bond_indicies.py | 3 +- .../tests/basic/attachment_points.py | 2 +- .../integration/tests/basic/badval_smiles.py | 3 +- api/tests/integration/tests/basic/basic.py | 7 +- .../integration/tests/basic/basic_check.py | 7 +- .../integration/tests/basic/basic_load.py | 10 +- .../tests/basic/buffer_string_load_iterate.py | 9 +- .../integration/tests/basic/check_query.py | 3 +- .../integration/tests/basic/chiral_test.py | 2 +- .../integration/tests/basic/cis_trans.py | 2 +- .../integration/tests/basic/components.py | 3 +- .../integration/tests/basic/create_query.py | 222 +++--- api/tests/integration/tests/basic/debug.py | 3 +- .../integration/tests/basic/exceptions.py | 3 +- .../integration/tests/basic/fischer_proj.py | 2 +- .../tests/basic/fold_then_smiles.py | 2 +- .../integration/tests/basic/fold_unfold.py | 2 +- .../tests/basic/get_original_format.py | 2 +- api/tests/integration/tests/basic/hash.py | 2 +- .../integration/tests/basic/highlighting.py | 2 +- .../integration/tests/basic/hybridization.py | 2 +- .../integration/tests/basic/imp_h_test.py | 2 +- .../integration/tests/basic/imp_h_test_ket.py | 2 +- .../tests/basic/ketfile_stereo_desc.py | 8 +- api/tests/integration/tests/basic/leak.py | 2 +- api/tests/integration/tests/basic/load.py | 93 +-- .../tests/basic/load_dearom_save.py | 149 ++-- .../integration/tests/basic/load_structure.py | 8 +- .../tests/basic/molfile_stereo_desc.py | 7 +- .../tests/basic/molfile_stereoparity.py | 2 +- .../tests/basic/multiple_instances.py | 81 +- api/tests/integration/tests/basic/murcko.py | 2 +- api/tests/integration/tests/basic/options.py | 3 +- .../integration/tests/basic/properties.py | 3 +- .../integration/tests/basic/pseudoatoms.py | 2 +- .../tests/basic/query_instrumentation.py | 2 +- api/tests/integration/tests/basic/radicals.py | 3 +- .../tests/basic/reaction_instrumentation.py | 3 +- .../tests/basic/reaction_saveload.py | 102 +-- api/tests/integration/tests/basic/rings.py | 180 ++--- api/tests/integration/tests/basic/rsite.py | 2 +- api/tests/integration/tests/basic/savers.py | 8 +- .../integration/tests/basic/scsr_basic.py | 3 +- .../tests/basic/scsr_instrumentation.py | 3 +- .../integration/tests/basic/set_charge.py | 3 +- api/tests/integration/tests/basic/sssr.py | 72 +- .../integration/tests/basic/stereo_test.py | 2 +- .../integration/tests/basic/stereocenters.py | 2 +- .../integration/tests/basic/test_smiles.py | 3 +- api/tests/integration/tests/basic/threads.py | 120 +-- .../tests/basic/unfold_layout_hydrogens.py | 2 +- api/tests/integration/tests/basic/valence.py | 114 +-- api/tests/integration/tests/basic/validate.py | 7 +- api/tests/integration/tests/basic/version.py | 3 +- api/tests/integration/tests/basic/zbo_load.py | 2 +- api/tests/integration/tests/bingo/append.py | 9 +- api/tests/integration/tests/bingo/basic.py | 11 +- .../integration/tests/bingo/bingo_settings.py | 8 +- api/tests/integration/tests/bingo/ext_fp.py | 10 +- .../integration/tests/bingo/gross_test.py | 156 ++-- .../integration/tests/bingo/sim_value_test.py | 8 +- .../tests/bingo/similarity_matrix.py | 9 +- .../tests/bingo/similarity_types.py | 11 +- .../integration/tests/bingo/threads_test.py | 733 +++++++++--------- api/tests/integration/tests/bingo/triple.py | 10 +- api/tests/integration/tests/calc/crippen.py | 2 +- api/tests/integration/tests/calc/lipinski.py | 2 +- .../tests/calc/mass_and_gross_fmla.py | 7 +- .../tests/calc/molecular_formula.py | 3 +- api/tests/integration/tests/calc/pka_basic.py | 8 +- .../calc/reaction_mass_and_gross_fmla.py | 7 +- .../integration/tests/calc/tpsa_basic.py | 2 +- api/tests/integration/tests/cano/cano_all.py | 8 +- .../integration/tests/cano/cano_as_se.py | 3 +- api/tests/integration/tests/cano/cano_hard.py | 7 +- .../integration/tests/cano/e-z-isomerism.py | 8 +- .../integration/tests/cano/permutations.py | 8 +- .../integration/tests/cano/ring_cis_trans.py | 8 +- .../tests/cano/stereo_cis_trans.py | 241 +++--- .../tests/cano/symmetry_classes.py | 2 +- .../integration/tests/check/check-issue731.py | 3 +- api/tests/integration/tests/check/check.py | 3 +- .../integration/tests/composition/basic.py | 3 +- .../integration/tests/deco/deco_arom_query.py | 5 +- api/tests/integration/tests/deco/deco_iter.py | 2 +- .../integration/tests/deco/deco_matches.py | 5 +- .../tests/deco/deco_recursive_smarts.py | 3 +- api/tests/integration/tests/deco/deco_sdf.py | 7 +- .../tests/deco/decompose_molecules.py | 5 +- 100 files changed, 1554 insertions(+), 1369 deletions(-) diff --git a/api/tests/integration/tests/aam/aam_access.py b/api/tests/integration/tests/aam/aam_access.py index b3d2dffdd1..0a773bc1ab 100644 --- a/api/tests/integration/tests/aam/aam_access.py +++ b/api/tests/integration/tests/aam/aam_access.py @@ -6,8 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * - +from env_indigo import Indigo indigo = Indigo() reactions = [ "CC1=CSC(C=C(N=[N+]=[N-])C(OCC)=O)=C1>>CC1=CSC2=C1NC(C(OCC)=O)=C2", diff --git a/api/tests/integration/tests/aam/aam_basic.py b/api/tests/integration/tests/aam/aam_basic.py index d2a92dd267..2e087aed6c 100644 --- a/api/tests/integration/tests/aam/aam_basic.py +++ b/api/tests/integration/tests/aam/aam_basic.py @@ -6,8 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * - +from env_indigo import Indigo indigo = Indigo() diff --git a/api/tests/integration/tests/aam/aam_hard.py b/api/tests/integration/tests/aam/aam_hard.py index a01b598009..e8f9a4d40d 100644 --- a/api/tests/integration/tests/aam/aam_hard.py +++ b/api/tests/integration/tests/aam/aam_hard.py @@ -6,8 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * - +from env_indigo import Indigo, IndigoException indigo = Indigo() indigo.setOption("timeout", 1000) diff --git a/api/tests/integration/tests/arom/arom_d_orbital.py b/api/tests/integration/tests/arom/arom_d_orbital.py index d212fef876..99d30b44b7 100644 --- a/api/tests/integration/tests/arom/arom_d_orbital.py +++ b/api/tests/integration/tests/arom/arom_d_orbital.py @@ -1,26 +1,31 @@ -import os -import sys - -sys.path.append( - os.path.normpath( - os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") - ) -) -from env_indigo import * # noqa - -indigo = Indigo() -for idx, m in enumerate( - indigo.iterateSDFile(joinPathPy("molecules/mols.sdf", __file__)) -): - print("*** %d ***" % (idx)) - try: - print(m.smiles()) - print(m.canonicalSmiles()) - except IndigoException as e: - print(getIndigoExceptionText(e)) - try: - m.dearomatize() - print(m.smiles()) - print(m.canonicalSmiles()) - except IndigoException as e: - print(getIndigoExceptionText(e)) +import os +import sys + +sys.path.append( + os.path.normpath( + os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") + ) +) +from env_indigo import ( + Indigo, + IndigoException, + getIndigoExceptionText, + joinPathPy, +) + +indigo = Indigo() +for idx, m in enumerate( + indigo.iterateSDFile(joinPathPy("molecules/mols.sdf", __file__)) +): + print("*** %d ***" % (idx)) + try: + print(m.smiles()) + print(m.canonicalSmiles()) + except IndigoException as e: + print(getIndigoExceptionText(e)) + try: + m.dearomatize() + print(m.smiles()) + print(m.canonicalSmiles()) + except IndigoException as e: + print(getIndigoExceptionText(e)) diff --git a/api/tests/integration/tests/arom/arom_merge.py b/api/tests/integration/tests/arom/arom_merge.py index a81c16b9d2..8e37af4316 100644 --- a/api/tests/integration/tests/arom/arom_merge.py +++ b/api/tests/integration/tests/arom/arom_merge.py @@ -6,8 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * - +from env_indigo import Indigo print("**** Merge aromatized and dearomatized structures") indigo = Indigo() diff --git a/api/tests/integration/tests/arom/basic.py b/api/tests/integration/tests/arom/basic.py index 7c979b2ed8..63d267b23f 100644 --- a/api/tests/integration/tests/arom/basic.py +++ b/api/tests/integration/tests/arom/basic.py @@ -6,7 +6,12 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import ( + Indigo, + IndigoException, + getIndigoExceptionText, + joinPathPy, +) indigo = Indigo() diff --git a/api/tests/integration/tests/arom/elements.py b/api/tests/integration/tests/arom/elements.py index ff5bac8130..c7f1218588 100644 --- a/api/tests/integration/tests/arom/elements.py +++ b/api/tests/integration/tests/arom/elements.py @@ -6,7 +6,12 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import ( + Indigo, + IndigoException, + getIndigoExceptionText, + joinPathPy, +) indigo = Indigo() diff --git a/api/tests/integration/tests/arom/extended.py b/api/tests/integration/tests/arom/extended.py index 4de7c6fd40..3c95285fa0 100644 --- a/api/tests/integration/tests/arom/extended.py +++ b/api/tests/integration/tests/arom/extended.py @@ -7,7 +7,12 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import ( + Indigo, + IndigoException, + getIndigoExceptionText, + joinPathPy, +) indigo = Indigo() indigo.setOption("ignore-noncritical-query-features", "true") diff --git a/api/tests/integration/tests/arom/partial_arom_cano.py b/api/tests/integration/tests/arom/partial_arom_cano.py index beca51dc50..a28040c100 100644 --- a/api/tests/integration/tests/arom/partial_arom_cano.py +++ b/api/tests/integration/tests/arom/partial_arom_cano.py @@ -6,8 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * - +from env_indigo import Indigo, joinPathPy indigo = Indigo() for m in indigo.iterateSDFile( joinPathPy("molecules/partial_arom.sdf", __file__) diff --git a/api/tests/integration/tests/arom/query_dearom.py b/api/tests/integration/tests/arom/query_dearom.py index e54da685b4..3cb88dddd1 100644 --- a/api/tests/integration/tests/arom/query_dearom.py +++ b/api/tests/integration/tests/arom/query_dearom.py @@ -6,8 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * - +from env_indigo import Indigo print("**** Dearomatize query molecules") indigo = Indigo() diff --git a/api/tests/integration/tests/basic/allenes.py b/api/tests/integration/tests/basic/allenes.py index e64c0f71c5..3adf08da10 100644 --- a/api/tests/integration/tests/basic/allenes.py +++ b/api/tests/integration/tests/basic/allenes.py @@ -1,105 +1,112 @@ -import errno -import os -import sys - -sys.path.append( - os.path.normpath( - os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") - ) -) -from env_indigo import * # noqa - -indigo = Indigo() -indigo.setOption("molfile-saving-skip-date", "1") - -if not os.path.exists(joinPathPy("out", __file__)): - try: - os.makedirs(joinPathPy("out", __file__)) - except OSError as e: - if e.errno != errno.EEXIST: - raise - -saver = indigo.createFileSaver( - joinPathPy("out/allenes_out.sdf", __file__), "sdf" -) - -allenes_sets = [ - ( - joinPathPy("molecules/allenes/allenes.smi", __file__), - indigo.iterateSmilesFile, - ), - ( - joinPathPy( - "../../../../../data/molecules/allenes/all-allenes.sdf", __file__ - ), - indigo.iterateSDFile, - ), - ( - joinPathPy("molecules/allenes/two-allenes.mol", __file__), - indigo.iterateSDFile, - ), - ( - joinPathPy("molecules/allenes/allenes-angle.mol", __file__), - indigo.iterateSDFile, - ), - ( - joinPathPy("molecules/allenes/no-coord.mol", __file__), - indigo.iterateSDFile, - ), -] - - -def testSingle(m): - print(" countAlleneCenters = %d" % (m.countAlleneCenters())) - - print(" Smiles: " + m.canonicalSmiles()) - print(" Cano Smiles: " + m.canonicalSmiles()) - m.layout() - print(" Molfile: " + m.molfile()) - saver.append(m) - - mh = m.clone() - mh.foldHydrogens() - print(" Fold: " + mh.smiles()) - mh.unfoldHydrogens() - print(" Unfold: " + mh.smiles()) - print(" Cano Unfold: " + mh.canonicalSmiles()) - - print(" Removing atoms:") - mr = m.clone() - while mr.countAtoms() != 0: - a = mr.iterateAtoms().next() - a.remove() - print(" %s" % (mr.smiles())) - - -mols = [] - -idx = 1 -for file, func in allenes_sets: - print("Molecules set: %s" % (relativePath(file))) - it = func(file) - for m in it: - print("%d" % idx) - try: - testSingle(m.clone()) - mols.append((idx, m.clone())) - except IndigoException as e: - print(" Error: %s" % (getIndigoExceptionText(e))) - idx += 1 - -print("Substructure matching") -qmols = [(idx, indigo.loadQueryMolecule(mq.smiles()), []) for idx, mq in mols] - -for ti, t in mols: - matcher = indigo.substructureMatcher(t) - for qi, q, matched in qmols: - match = matcher.match(q) - if match != None: - matched.append(ti) - -for qi, q, matched in qmols: - matched_str = "" - for ti in matched: - matched_str += " %d" % (ti) - print("%d: %s" % (qi, matched_str)) +import errno +import os +import sys + +sys.path.append( + os.path.normpath( + os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") + ) +) +from env_indigo import ( + Indigo, + IndigoException, + getIndigoExceptionText, + joinPathPy, + makedirs, + relativePath, +) + +indigo = Indigo() +indigo.setOption("molfile-saving-skip-date", "1") + +if not os.path.exists(joinPathPy("out", __file__)): + try: + os.makedirs(joinPathPy("out", __file__)) + except OSError as e: + if e.errno != errno.EEXIST: + raise + +saver = indigo.createFileSaver( + joinPathPy("out/allenes_out.sdf", __file__), "sdf" +) + +allenes_sets = [ + ( + joinPathPy("molecules/allenes/allenes.smi", __file__), + indigo.iterateSmilesFile, + ), + ( + joinPathPy( + "../../../../../data/molecules/allenes/all-allenes.sdf", __file__ + ), + indigo.iterateSDFile, + ), + ( + joinPathPy("molecules/allenes/two-allenes.mol", __file__), + indigo.iterateSDFile, + ), + ( + joinPathPy("molecules/allenes/allenes-angle.mol", __file__), + indigo.iterateSDFile, + ), + ( + joinPathPy("molecules/allenes/no-coord.mol", __file__), + indigo.iterateSDFile, + ), +] + + +def testSingle(m): + print(" countAlleneCenters = %d" % (m.countAlleneCenters())) + + print(" Smiles: " + m.canonicalSmiles()) + print(" Cano Smiles: " + m.canonicalSmiles()) + m.layout() + print(" Molfile: " + m.molfile()) + saver.append(m) + + mh = m.clone() + mh.foldHydrogens() + print(" Fold: " + mh.smiles()) + mh.unfoldHydrogens() + print(" Unfold: " + mh.smiles()) + print(" Cano Unfold: " + mh.canonicalSmiles()) + + print(" Removing atoms:") + mr = m.clone() + while mr.countAtoms() != 0: + a = mr.iterateAtoms().next() + a.remove() + print(" %s" % (mr.smiles())) + + +mols = [] + +idx = 1 +for file, func in allenes_sets: + print("Molecules set: %s" % (relativePath(file))) + it = func(file) + for m in it: + print("%d" % idx) + try: + testSingle(m.clone()) + mols.append((idx, m.clone())) + except IndigoException as e: + print(" Error: %s" % (getIndigoExceptionText(e))) + idx += 1 + +print("Substructure matching") +qmols = [(idx, indigo.loadQueryMolecule(mq.smiles()), []) for idx, mq in mols] + +for ti, t in mols: + matcher = indigo.substructureMatcher(t) + for qi, q, matched in qmols: + match = matcher.match(q) + if match != None: + matched.append(ti) + +for qi, q, matched in qmols: + matched_str = "" + for ti in matched: + matched_str += " %d" % (ti) + print("%d: %s" % (qi, matched_str)) diff --git a/api/tests/integration/tests/basic/atom_bond_indicies.py b/api/tests/integration/tests/basic/atom_bond_indicies.py index b46c96f316..9189f15b7d 100644 --- a/api/tests/integration/tests/basic/atom_bond_indicies.py +++ b/api/tests/integration/tests/basic/atom_bond_indicies.py @@ -6,8 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * - +from env_indigo import Indigo indigo = Indigo() print("issue 2952 expand c api for cip labels") diff --git a/api/tests/integration/tests/basic/attachment_points.py b/api/tests/integration/tests/basic/attachment_points.py index 75cd535f69..eadbb51c9b 100644 --- a/api/tests/integration/tests/basic/attachment_points.py +++ b/api/tests/integration/tests/basic/attachment_points.py @@ -7,7 +7,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import Indigo, joinPathPy, makedirs indigo = Indigo() indigo.setOption("molfile-saving-skip-date", "1") diff --git a/api/tests/integration/tests/basic/badval_smiles.py b/api/tests/integration/tests/basic/badval_smiles.py index a337af870b..1d04b3e6ae 100644 --- a/api/tests/integration/tests/basic/badval_smiles.py +++ b/api/tests/integration/tests/basic/badval_smiles.py @@ -9,8 +9,7 @@ "common", ) ) -from env_indigo import * - +from env_indigo import Indigo, joinPathPy indigo = Indigo() indigo.setOption("molfile-saving-skip-date", True) diff --git a/api/tests/integration/tests/basic/basic.py b/api/tests/integration/tests/basic/basic.py index 317a5c1c81..4e17e11924 100644 --- a/api/tests/integration/tests/basic/basic.py +++ b/api/tests/integration/tests/basic/basic.py @@ -6,7 +6,12 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import ( + Indigo, + IndigoException, + getIndigoExceptionText, + joinPathPy, +) indigo = Indigo() indigo.setOption("molfile-saving-skip-date", "1") diff --git a/api/tests/integration/tests/basic/basic_check.py b/api/tests/integration/tests/basic/basic_check.py index 5a4411ce9f..f137aa2db6 100644 --- a/api/tests/integration/tests/basic/basic_check.py +++ b/api/tests/integration/tests/basic/basic_check.py @@ -7,7 +7,12 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import ( + Indigo, + IndigoException, + getIndigoExceptionText, + joinPathPy, +) indigo = Indigo() diff --git a/api/tests/integration/tests/basic/basic_load.py b/api/tests/integration/tests/basic/basic_load.py index 4997a4a4c4..e1da7784c5 100644 --- a/api/tests/integration/tests/basic/basic_load.py +++ b/api/tests/integration/tests/basic/basic_load.py @@ -6,7 +6,15 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import ( + Indigo, + IndigoException, + System, + dataPath, + getIndigoExceptionText, + isIronPython, + joinPathPy, +) indigo = Indigo() indigo.setOption("molfile-saving-skip-date", "1") diff --git a/api/tests/integration/tests/basic/buffer_string_load_iterate.py b/api/tests/integration/tests/basic/buffer_string_load_iterate.py index 6ce4e1c7cd..3b7ae7495b 100644 --- a/api/tests/integration/tests/basic/buffer_string_load_iterate.py +++ b/api/tests/integration/tests/basic/buffer_string_load_iterate.py @@ -6,7 +6,14 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import ( + Indigo, + IndigoException, + System, + getIndigoExceptionText, + isIronPython, + joinPathPy, +) indigo = Indigo() diff --git a/api/tests/integration/tests/basic/check_query.py b/api/tests/integration/tests/basic/check_query.py index ff1fad755a..e41cdef9c2 100644 --- a/api/tests/integration/tests/basic/check_query.py +++ b/api/tests/integration/tests/basic/check_query.py @@ -6,8 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * - +from env_indigo import Indigo, joinPathPy indigo = Indigo() indigo.setOption("molfile-saving-skip-date", True) diff --git a/api/tests/integration/tests/basic/chiral_test.py b/api/tests/integration/tests/basic/chiral_test.py index 26fb8c5437..8b04683660 100644 --- a/api/tests/integration/tests/basic/chiral_test.py +++ b/api/tests/integration/tests/basic/chiral_test.py @@ -7,7 +7,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import Indigo, joinPathPy, makedirs indigo = Indigo() set = [ diff --git a/api/tests/integration/tests/basic/cis_trans.py b/api/tests/integration/tests/basic/cis_trans.py index dcb28e1f8f..c6a249e859 100644 --- a/api/tests/integration/tests/basic/cis_trans.py +++ b/api/tests/integration/tests/basic/cis_trans.py @@ -7,7 +7,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import Indigo, joinPathPy, makedirs if not os.path.exists(joinPathPy("out", __file__)): try: diff --git a/api/tests/integration/tests/basic/components.py b/api/tests/integration/tests/basic/components.py index c11b00de91..c0a198d69e 100644 --- a/api/tests/integration/tests/basic/components.py +++ b/api/tests/integration/tests/basic/components.py @@ -6,8 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * - +from env_indigo import Indigo, IndigoException, getIndigoExceptionText indigo = Indigo() print("'Na' molecule loading..") diff --git a/api/tests/integration/tests/basic/create_query.py b/api/tests/integration/tests/basic/create_query.py index f3dcbe6e7c..9f34411c91 100644 --- a/api/tests/integration/tests/basic/create_query.py +++ b/api/tests/integration/tests/basic/create_query.py @@ -1,108 +1,114 @@ -import errno -import os -import sys - -sys.path.append( - os.path.normpath( - os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") - ) -) -from env_indigo import * # noqa - -indigo = Indigo() -indigo.setOption("molfile-saving-skip-date", "1") - -if not os.path.exists(joinPathPy("out", __file__)): - try: - os.makedirs(joinPathPy("out", __file__)) - except OSError as e: - if e.errno != errno.EEXIST: - raise - -original = indigo.createFileSaver( - joinPathPy("out/original.sdf", __file__), "sdf" -) -saver = indigo.createFileSaver( - joinPathPy("out/create_query.sdf", __file__), "sdf" -) -saverRxn = indigo.createFileSaver( - joinPathPy("out/create_query.rdf", __file__), "rdf" -) - - -def infrange(start): - cur = start - while True: - yield cur - cur += 1 - - -def makeQueryMol(m): - qm = indigo.loadQueryMolecule(m.molfile()) - qa = qm.getAtom(0) - qa.removeConstraints("atomic-number") - return qm - - -def makeReaction(m): - r = indigo.createReaction() - r.addReactant(m) - r.addProduct(m) - return r - - -def makeQueryReaction(qm): - r = indigo.createQueryReaction() - r.addReactant(qm) - r.addProduct(qm) - return r - - -mols = [] -print("*** Loading molecules *** ") -for i, m in zip( - infrange(1), - indigo.iterateCMLFile( - joinPathPy( - "../../../../../data/molecules/basic/tetrahedral-all.cml", __file__ - ) - ), -): - try: - mols.append((i, m.clone())) - original.append(m) - except IndigoException as e: - print("%d: %s" % (i, getIndigoExceptionText(e))) - -print("*** Molecule canonical smiles *** ") -for i, m in mols: - try: - print("%d: %s" % (i, m.canonicalSmiles())) - except IndigoException as e: - print("%d: %s" % (i, getIndigoExceptionText(e))) - -print("*** Query molecule molfiles *** ") -for i, m in mols: - try: - qm = makeQueryMol(m) - print("%d: %s" % (i, qm.molfile())) - saver.append(qm) - except IndigoException as e: - print("%d: %s" % (i, getIndigoExceptionText(e))) -print("*** Reaction smiles *** ") -for i, m in mols: - try: - r = makeReaction(m) - print("%d: %s" % (i, r.smiles())) - except IndigoException as e: - print("%d: %s" % (i, getIndigoExceptionText(e))) - -print("*** Query reaction rxnfiles *** ") -for i, m in mols: - try: - qm = makeQueryMol(m) - qr = makeQueryReaction(qm) - print("%d: %s" % (i, qr.rxnfile())) - saverRxn.append(qr) - except IndigoException as e: - print("%d: %s" % (i, getIndigoExceptionText(e))) +import errno +import os +import sys + +sys.path.append( + os.path.normpath( + os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") + ) +) +from env_indigo import ( + Indigo, + IndigoException, + getIndigoExceptionText, + joinPathPy, + makedirs, +) + +indigo = Indigo() +indigo.setOption("molfile-saving-skip-date", "1") + +if not os.path.exists(joinPathPy("out", __file__)): + try: + os.makedirs(joinPathPy("out", __file__)) + except OSError as e: + if e.errno != errno.EEXIST: + raise + +original = indigo.createFileSaver( + joinPathPy("out/original.sdf", __file__), "sdf" +) +saver = indigo.createFileSaver( + joinPathPy("out/create_query.sdf", __file__), "sdf" +) +saverRxn = indigo.createFileSaver( + joinPathPy("out/create_query.rdf", __file__), "rdf" +) + + +def infrange(start): + cur = start + while True: + yield cur + cur += 1 + + +def makeQueryMol(m): + qm = indigo.loadQueryMolecule(m.molfile()) + qa = qm.getAtom(0) + qa.removeConstraints("atomic-number") + return qm + + +def makeReaction(m): + r = indigo.createReaction() + r.addReactant(m) + r.addProduct(m) + return r + + +def makeQueryReaction(qm): + r = indigo.createQueryReaction() + r.addReactant(qm) + r.addProduct(qm) + return r + + +mols = [] +print("*** Loading molecules *** ") +for i, m in zip( + infrange(1), + indigo.iterateCMLFile( + joinPathPy( + "../../../../../data/molecules/basic/tetrahedral-all.cml", __file__ + ) + ), +): + try: + mols.append((i, m.clone())) + original.append(m) + except IndigoException as e: + print("%d: %s" % (i, getIndigoExceptionText(e))) + +print("*** Molecule canonical smiles *** ") +for i, m in mols: + try: + print("%d: %s" % (i, m.canonicalSmiles())) + except IndigoException as e: + print("%d: %s" % (i, getIndigoExceptionText(e))) + +print("*** Query molecule molfiles *** ") +for i, m in mols: + try: + qm = makeQueryMol(m) + print("%d: %s" % (i, qm.molfile())) + saver.append(qm) + except IndigoException as e: + print("%d: %s" % (i, getIndigoExceptionText(e))) +print("*** Reaction smiles *** ") +for i, m in mols: + try: + r = makeReaction(m) + print("%d: %s" % (i, r.smiles())) + except IndigoException as e: + print("%d: %s" % (i, getIndigoExceptionText(e))) + +print("*** Query reaction rxnfiles *** ") +for i, m in mols: + try: + qm = makeQueryMol(m) + qr = makeQueryReaction(qm) + print("%d: %s" % (i, qr.rxnfile())) + saverRxn.append(qr) + except IndigoException as e: + print("%d: %s" % (i, getIndigoExceptionText(e))) diff --git a/api/tests/integration/tests/basic/debug.py b/api/tests/integration/tests/basic/debug.py index 1899106c8c..9a6359a925 100644 --- a/api/tests/integration/tests/basic/debug.py +++ b/api/tests/integration/tests/basic/debug.py @@ -6,8 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * - +from env_indigo import Indigo indigo = Indigo() print("*** Molecule ***") diff --git a/api/tests/integration/tests/basic/exceptions.py b/api/tests/integration/tests/basic/exceptions.py index 018937c88c..97a23b8905 100644 --- a/api/tests/integration/tests/basic/exceptions.py +++ b/api/tests/integration/tests/basic/exceptions.py @@ -6,8 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * - +from env_indigo import Indigo, IndigoException, getIndigoExceptionText indigo = Indigo() # indigo::SmilesLoader::Error diff --git a/api/tests/integration/tests/basic/fischer_proj.py b/api/tests/integration/tests/basic/fischer_proj.py index b956c0c3c8..b3dc3c2439 100644 --- a/api/tests/integration/tests/basic/fischer_proj.py +++ b/api/tests/integration/tests/basic/fischer_proj.py @@ -6,7 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import Indigo, joinPathPy indigo = Indigo() indigo.setOption("molfile-saving-skip-date", "1") diff --git a/api/tests/integration/tests/basic/fold_then_smiles.py b/api/tests/integration/tests/basic/fold_then_smiles.py index e39a47d114..d695c03e7e 100644 --- a/api/tests/integration/tests/basic/fold_then_smiles.py +++ b/api/tests/integration/tests/basic/fold_then_smiles.py @@ -6,7 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import Indigo, joinPathPy, relativePath indigo = Indigo() diff --git a/api/tests/integration/tests/basic/fold_unfold.py b/api/tests/integration/tests/basic/fold_unfold.py index 844010e805..7e0c62f382 100644 --- a/api/tests/integration/tests/basic/fold_unfold.py +++ b/api/tests/integration/tests/basic/fold_unfold.py @@ -8,7 +8,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import Indigo, joinPathPy, relativePath indigo = Indigo() diff --git a/api/tests/integration/tests/basic/get_original_format.py b/api/tests/integration/tests/basic/get_original_format.py index c8652de5fc..677692ec39 100644 --- a/api/tests/integration/tests/basic/get_original_format.py +++ b/api/tests/integration/tests/basic/get_original_format.py @@ -6,7 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import Indigo indigo = Indigo() diff --git a/api/tests/integration/tests/basic/hash.py b/api/tests/integration/tests/basic/hash.py index e7cc1e7cab..7b8fbc2008 100644 --- a/api/tests/integration/tests/basic/hash.py +++ b/api/tests/integration/tests/basic/hash.py @@ -6,7 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import Indigo, dataPath indigo = Indigo() diff --git a/api/tests/integration/tests/basic/highlighting.py b/api/tests/integration/tests/basic/highlighting.py index 55d50eaf30..5c97f437ac 100644 --- a/api/tests/integration/tests/basic/highlighting.py +++ b/api/tests/integration/tests/basic/highlighting.py @@ -7,7 +7,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import Indigo, joinPathPy, makedirs indigo = Indigo() mol = indigo.loadMolecule("C1C=NC=CN=1") diff --git a/api/tests/integration/tests/basic/hybridization.py b/api/tests/integration/tests/basic/hybridization.py index 8b460cac42..881a2d858c 100644 --- a/api/tests/integration/tests/basic/hybridization.py +++ b/api/tests/integration/tests/basic/hybridization.py @@ -6,7 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import Indigo indigo = Indigo() diff --git a/api/tests/integration/tests/basic/imp_h_test.py b/api/tests/integration/tests/basic/imp_h_test.py index acf3d02695..50f33a82a8 100644 --- a/api/tests/integration/tests/basic/imp_h_test.py +++ b/api/tests/integration/tests/basic/imp_h_test.py @@ -7,7 +7,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import Indigo indigo = Indigo() indigo.setOption("ignore-bad-valence", "true") diff --git a/api/tests/integration/tests/basic/imp_h_test_ket.py b/api/tests/integration/tests/basic/imp_h_test_ket.py index 16e8dac8f3..b33e81f2f9 100644 --- a/api/tests/integration/tests/basic/imp_h_test_ket.py +++ b/api/tests/integration/tests/basic/imp_h_test_ket.py @@ -7,7 +7,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import Indigo indigo = Indigo() mol = indigo.loadMolecule( diff --git a/api/tests/integration/tests/basic/ketfile_stereo_desc.py b/api/tests/integration/tests/basic/ketfile_stereo_desc.py index 039769b3e5..b63b3e333c 100644 --- a/api/tests/integration/tests/basic/ketfile_stereo_desc.py +++ b/api/tests/integration/tests/basic/ketfile_stereo_desc.py @@ -13,8 +13,12 @@ def find_diff(a, b): ) ) -from env_indigo import * - +from env_indigo import ( + Indigo, + isJython, + joinPathPy, + threading, +) threading.stack_size(2 * 1024 * 1024) diff --git a/api/tests/integration/tests/basic/leak.py b/api/tests/integration/tests/basic/leak.py index ee60add100..f9fb9adc88 100644 --- a/api/tests/integration/tests/basic/leak.py +++ b/api/tests/integration/tests/basic/leak.py @@ -6,7 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import Indigo, IndigoException, joinPathPy indigo = Indigo() diff --git a/api/tests/integration/tests/basic/load.py b/api/tests/integration/tests/basic/load.py index 72a2274966..d3d5881522 100644 --- a/api/tests/integration/tests/basic/load.py +++ b/api/tests/integration/tests/basic/load.py @@ -1,44 +1,49 @@ -import os -import sys - -sys.path.append( - os.path.normpath( - os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") - ) -) -from env_indigo import * # noqa - -indigo = Indigo() - -for root, dirnames, filenames in os.walk( - joinPathPy("molecules/set1", __file__) -): - filenames.sort() - for filename in filenames: - sys.stdout.write("%s: " % filename) - try: - mol = indigo.loadMoleculeFromFile(os.path.join(root, filename)) - print(" OK") - except IndigoException as e: - print(" %s" % (getIndigoExceptionText(e))) - -print("****Invalid structures****") - - -def getIndigo(): - indigo = Indigo() - indigo.setOption("ignore-stereochemistry-errors", "true") - indigo.setOption("ignore-noncritical-query-features", "true") - return indigo - - -with open(joinPathPy("molecules/invalid.csv", __file__)) as f: - cells = f.read().split(",") - for idx, c in enumerate(cells): - print("** %d **" % idx) - try: - indigo = getIndigo() - m = indigo.loadMolecule(c) - print(m.smiles()) - except IndigoException as e: - print(getIndigoExceptionText(e)) +import os +import sys + +sys.path.append( + os.path.normpath( + os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") + ) +) +from env_indigo import ( + Indigo, + IndigoException, + getIndigoExceptionText, + joinPathPy, +) + +indigo = Indigo() + +for root, dirnames, filenames in os.walk( + joinPathPy("molecules/set1", __file__) +): + filenames.sort() + for filename in filenames: + sys.stdout.write("%s: " % filename) + try: + mol = indigo.loadMoleculeFromFile(os.path.join(root, filename)) + print(" OK") + except IndigoException as e: + print(" %s" % (getIndigoExceptionText(e))) + +print("****Invalid structures****") + + +def getIndigo(): + indigo = Indigo() + indigo.setOption("ignore-stereochemistry-errors", "true") + indigo.setOption("ignore-noncritical-query-features", "true") + return indigo + + +with open(joinPathPy("molecules/invalid.csv", __file__)) as f: + cells = f.read().split(",") + for idx, c in enumerate(cells): + print("** %d **" % idx) + try: + indigo = getIndigo() + m = indigo.loadMolecule(c) + print(m.smiles()) + except IndigoException as e: + print(getIndigoExceptionText(e)) diff --git a/api/tests/integration/tests/basic/load_dearom_save.py b/api/tests/integration/tests/basic/load_dearom_save.py index 1405e6b2e2..a516afdb9e 100644 --- a/api/tests/integration/tests/basic/load_dearom_save.py +++ b/api/tests/integration/tests/basic/load_dearom_save.py @@ -1,71 +1,78 @@ -import errno -import os -import sys - -sys.path.append( - os.path.normpath( - os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") - ) -) -from env_indigo import * # noqa - -indigo = Indigo() -indigo.setOption("treat-x-as-pseudoatom", "1") -mol_db_names = [ - ( - joinPathPy( - "../../../../../data/molecules/basic/tetrahedral-all.cml", __file__ - ), - indigo.iterateCMLFile, - ), - (joinPathPy("molecules/helma.smi", __file__), indigo.iterateSmilesFile), - (joinPathPy("molecules/arom.sdf", __file__), indigo.iterateSDFile), - (joinPathPy("molecules/empty.sdf", __file__), indigo.iterateSDFile), - (joinPathPy("molecules/empty1.sdf", __file__), indigo.iterateSDFile), -] - -if not os.path.exists(joinPathPy("out", __file__)): - try: - os.makedirs(joinPathPy("out", __file__)) - except OSError as e: - if e.errno != errno.EEXIST: - raise - -f = indigo.writeFile(joinPathPy("out/out.sdf", __file__)) -f2 = open(joinPathPy("out/cano_out.smi", __file__), "w") - -for db_name, load_fund in mol_db_names: - print("Database: {0}".format(relativePath(db_name))) - idx = 1 - for item in load_fund(db_name): - try: - name = item.name() - except IndigoException as e: - name = getIndigoExceptionText(e) - try: - cansm = item.canonicalSmiles() - except IndigoException as e: - cansm = getIndigoExceptionText(e) - print("%s (#%s): %s" % (name, idx, cansm)) - try: - m2 = item.clone() - m2.clearProperties() - m2.dearomatize() - f.sdfAppend(m2) - f2.write("%s\n" % m2.canonicalSmiles()) - except IndigoException as e: - print("save error: %s" % (getIndigoExceptionText(e))) - idx += 1 - -f.close() -f2.close() -print("*** Processing result molecules ***") - -idx = 1 -for item in indigo.iterateSDFile(joinPathPy("out/out.sdf", __file__)): - try: - cansm = item.canonicalSmiles() - except IndigoException as e: - cansm = getIndigoExceptionText(e) - print("#%s: %s" % (idx, cansm)) - idx += 1 +import errno +import os +import sys + +sys.path.append( + os.path.normpath( + os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") + ) +) +from env_indigo import ( + Indigo, + IndigoException, + getIndigoExceptionText, + joinPathPy, + makedirs, + relativePath, +) + +indigo = Indigo() +indigo.setOption("treat-x-as-pseudoatom", "1") +mol_db_names = [ + ( + joinPathPy( + "../../../../../data/molecules/basic/tetrahedral-all.cml", __file__ + ), + indigo.iterateCMLFile, + ), + (joinPathPy("molecules/helma.smi", __file__), indigo.iterateSmilesFile), + (joinPathPy("molecules/arom.sdf", __file__), indigo.iterateSDFile), + (joinPathPy("molecules/empty.sdf", __file__), indigo.iterateSDFile), + (joinPathPy("molecules/empty1.sdf", __file__), indigo.iterateSDFile), +] + +if not os.path.exists(joinPathPy("out", __file__)): + try: + os.makedirs(joinPathPy("out", __file__)) + except OSError as e: + if e.errno != errno.EEXIST: + raise + +f = indigo.writeFile(joinPathPy("out/out.sdf", __file__)) +f2 = open(joinPathPy("out/cano_out.smi", __file__), "w") + +for db_name, load_fund in mol_db_names: + print("Database: {0}".format(relativePath(db_name))) + idx = 1 + for item in load_fund(db_name): + try: + name = item.name() + except IndigoException as e: + name = getIndigoExceptionText(e) + try: + cansm = item.canonicalSmiles() + except IndigoException as e: + cansm = getIndigoExceptionText(e) + print("%s (#%s): %s" % (name, idx, cansm)) + try: + m2 = item.clone() + m2.clearProperties() + m2.dearomatize() + f.sdfAppend(m2) + f2.write("%s\n" % m2.canonicalSmiles()) + except IndigoException as e: + print("save error: %s" % (getIndigoExceptionText(e))) + idx += 1 + +f.close() +f2.close() +print("*** Processing result molecules ***") + +idx = 1 +for item in indigo.iterateSDFile(joinPathPy("out/out.sdf", __file__)): + try: + cansm = item.canonicalSmiles() + except IndigoException as e: + cansm = getIndigoExceptionText(e) + print("#%s: %s" % (idx, cansm)) + idx += 1 diff --git a/api/tests/integration/tests/basic/load_structure.py b/api/tests/integration/tests/basic/load_structure.py index e6dd617374..3d796d5e10 100644 --- a/api/tests/integration/tests/basic/load_structure.py +++ b/api/tests/integration/tests/basic/load_structure.py @@ -6,7 +6,13 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import ( + Indigo, + IndigoException, + System, + isIronPython, + joinPathPy, +) testName = "Load Molecule Structure" print("****** Test: (" + testName + ") ***") diff --git a/api/tests/integration/tests/basic/molfile_stereo_desc.py b/api/tests/integration/tests/basic/molfile_stereo_desc.py index 87441cccf9..5308dcec6c 100644 --- a/api/tests/integration/tests/basic/molfile_stereo_desc.py +++ b/api/tests/integration/tests/basic/molfile_stereo_desc.py @@ -6,7 +6,12 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import ( + Indigo, + isJython, + joinPathPy, + threading, +) threading.stack_size(2 * 1024 * 1024) diff --git a/api/tests/integration/tests/basic/molfile_stereoparity.py b/api/tests/integration/tests/basic/molfile_stereoparity.py index 7384e81272..bb4f284a59 100644 --- a/api/tests/integration/tests/basic/molfile_stereoparity.py +++ b/api/tests/integration/tests/basic/molfile_stereoparity.py @@ -6,7 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import Indigo, joinPathPy indigo = Indigo() indigo.setOption("molfile-saving-skip-date", "1") diff --git a/api/tests/integration/tests/basic/multiple_instances.py b/api/tests/integration/tests/basic/multiple_instances.py index c3994d71bd..62ddc94a04 100644 --- a/api/tests/integration/tests/basic/multiple_instances.py +++ b/api/tests/integration/tests/basic/multiple_instances.py @@ -1,38 +1,43 @@ -import os -import sys - -sys.path.append( - os.path.normpath( - os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") - ) -) -from env_indigo import * # noqa - -indigo = Indigo() -indigo2 = Indigo() -mol1 = indigo.loadMolecule("C mol1") -mol2 = indigo2.loadMolecule("N mol2") -c1 = mol1.canonicalSmiles() -c2 = mol2.canonicalSmiles() -print(c1) -print(c2) -if c1 != "C": - sys.stderr.write("%s != C\n" % c1) -if c2 != "N": - sys.stderr.write("%s != N\n" % c1) -for m1, m2 in zip( - indigo.iterateSmilesFile(joinPathPy("molecules/helma.smi", __file__)), - indigo2.iterateSmilesFile(joinPathPy("molecules/helma.smi", __file__)), -): - try: - c1 = m1.canonicalSmiles() - except IndigoException as e: - c1 = getIndigoExceptionText(e) - - try: - c2 = m2.canonicalSmiles() - except IndigoException as e: - c2 = getIndigoExceptionText(e) - print("%s, %s" % (c1, c2)) - if c1 != c2: - sys.stderr.write("Error: %s != %s" % (c1, c2)) +import os +import sys + +sys.path.append( + os.path.normpath( + os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") + ) +) +from env_indigo import ( + Indigo, + IndigoException, + getIndigoExceptionText, + joinPathPy, +) + +indigo = Indigo() +indigo2 = Indigo() +mol1 = indigo.loadMolecule("C mol1") +mol2 = indigo2.loadMolecule("N mol2") +c1 = mol1.canonicalSmiles() +c2 = mol2.canonicalSmiles() +print(c1) +print(c2) +if c1 != "C": + sys.stderr.write("%s != C\n" % c1) +if c2 != "N": + sys.stderr.write("%s != N\n" % c1) +for m1, m2 in zip( + indigo.iterateSmilesFile(joinPathPy("molecules/helma.smi", __file__)), + indigo2.iterateSmilesFile(joinPathPy("molecules/helma.smi", __file__)), +): + try: + c1 = m1.canonicalSmiles() + except IndigoException as e: + c1 = getIndigoExceptionText(e) + + try: + c2 = m2.canonicalSmiles() + except IndigoException as e: + c2 = getIndigoExceptionText(e) + print("%s, %s" % (c1, c2)) + if c1 != c2: + sys.stderr.write("Error: %s != %s" % (c1, c2)) diff --git a/api/tests/integration/tests/basic/murcko.py b/api/tests/integration/tests/basic/murcko.py index 1427740d4e..e6509ecfbc 100644 --- a/api/tests/integration/tests/basic/murcko.py +++ b/api/tests/integration/tests/basic/murcko.py @@ -7,7 +7,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import Indigo, joinPathPy, makedirs indigo = Indigo() indigo.setOption("molfile-saving-skip-date", "1") diff --git a/api/tests/integration/tests/basic/options.py b/api/tests/integration/tests/basic/options.py index 2a9f54bcfb..8616df732d 100644 --- a/api/tests/integration/tests/basic/options.py +++ b/api/tests/integration/tests/basic/options.py @@ -6,8 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * - +from env_indigo import Indigo, System, isIronPython print("***** Get options check *****") indigo = Indigo() diff --git a/api/tests/integration/tests/basic/properties.py b/api/tests/integration/tests/basic/properties.py index 24efda819a..90d4eec47e 100644 --- a/api/tests/integration/tests/basic/properties.py +++ b/api/tests/integration/tests/basic/properties.py @@ -6,8 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * - +from env_indigo import Indigo, joinPathPy indigo = Indigo() print("*** Molecule ***") diff --git a/api/tests/integration/tests/basic/pseudoatoms.py b/api/tests/integration/tests/basic/pseudoatoms.py index bc70be9b3b..f0cfba80f0 100644 --- a/api/tests/integration/tests/basic/pseudoatoms.py +++ b/api/tests/integration/tests/basic/pseudoatoms.py @@ -6,7 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import Indigo, joinPathPy indigo = Indigo() indigo.setOption("molfile-saving-skip-date", "1") diff --git a/api/tests/integration/tests/basic/query_instrumentation.py b/api/tests/integration/tests/basic/query_instrumentation.py index 7ba3ddf4b8..ac91964fc9 100644 --- a/api/tests/integration/tests/basic/query_instrumentation.py +++ b/api/tests/integration/tests/basic/query_instrumentation.py @@ -7,7 +7,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import Indigo, joinPathPy, makedirs indigo = Indigo() indigo.setOption("molfile-saving-skip-date", "1") diff --git a/api/tests/integration/tests/basic/radicals.py b/api/tests/integration/tests/basic/radicals.py index 6074fbfd41..377915ddc6 100644 --- a/api/tests/integration/tests/basic/radicals.py +++ b/api/tests/integration/tests/basic/radicals.py @@ -6,8 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * - +from env_indigo import Indigo, joinPathPy indigo = Indigo() indigo.setOption("molfile-saving-skip-date", "1") diff --git a/api/tests/integration/tests/basic/reaction_instrumentation.py b/api/tests/integration/tests/basic/reaction_instrumentation.py index 14338211ad..f7522e02fa 100644 --- a/api/tests/integration/tests/basic/reaction_instrumentation.py +++ b/api/tests/integration/tests/basic/reaction_instrumentation.py @@ -6,8 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * - +from env_indigo import Indigo indigo = Indigo() indigo.setOption("molfile-saving-skip-date", "1") diff --git a/api/tests/integration/tests/basic/reaction_saveload.py b/api/tests/integration/tests/basic/reaction_saveload.py index ae77445d67..24beb3bc99 100644 --- a/api/tests/integration/tests/basic/reaction_saveload.py +++ b/api/tests/integration/tests/basic/reaction_saveload.py @@ -1,51 +1,51 @@ -import os -import sys - -sys.path.append( - os.path.normpath( - os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") - ) -) -from env_indigo import * # noqa - -indigo = Indigo() - - -def testReactionSaveLoad(filename): - print("Loading " + relativePath(filename)) - rxn = indigo.loadReactionFromFile(filename) - print(rxn.smiles()) - rxn2 = indigo.loadReaction(rxn.smiles()) - print(rxn2.smiles()) - if rxn.countMolecules() != rxn2.countMolecules(): - print("ERROR: rxn != rxn2") - rxn3 = indigo.loadReaction(rxn.rxnfile()) - print(rxn3.smiles()) - if not indigo.exactMatch(rxn, rxn3): - print("ERROR: rxn != rxn3") - - -def testQueryReactionSaveLoad(filename): - print("Loading " + filename) - rxn = indigo.loadQueryReactionFromFile(filename) - print(rxn.smiles()) - rxn2 = indigo.loadQueryReaction(rxn.smiles()) - print(rxn2.smiles()) - if rxn.countMolecules() != rxn2.countMolecules(): - print("ERROR: rxn != rxn2") - rxn3 = indigo.loadQueryReaction(rxn.rxnfile()) - print(rxn3.smiles()) - if rxn.countMolecules() != rxn3.countMolecules(): - print("ERROR: rxn != rxn3") - - -testReactionSaveLoad( - joinPathPy("reactions/disconnected_w_stereo.rxn", __file__) -) -testReactionSaveLoad(joinPathPy("reactions/disconnected.rxn", __file__)) -testReactionSaveLoad(joinPathPy("reactions/catalysts3000.rxn", __file__)) -testReactionSaveLoad(joinPathPy("reactions/catalysts2000.rxn", __file__)) -testReactionSaveLoad(joinPathPy("reactions/amiderxn2.rxn", __file__)) -testReactionSaveLoad(joinPathPy("reactions/test_hi.rxn", __file__)) -testReactionSaveLoad(joinPathPy("reactions/pseudoatoms/psd-pol.rxn", __file__)) -# testQueryReactionSaveLoad("reactions/pseudoatoms/x-o.rxn") +import os +import sys + +sys.path.append( + os.path.normpath( + os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") + ) +) +from env_indigo import Indigo, joinPathPy, relativePath + +indigo = Indigo() + + +def testReactionSaveLoad(filename): + print("Loading " + relativePath(filename)) + rxn = indigo.loadReactionFromFile(filename) + print(rxn.smiles()) + rxn2 = indigo.loadReaction(rxn.smiles()) + print(rxn2.smiles()) + if rxn.countMolecules() != rxn2.countMolecules(): + print("ERROR: rxn != rxn2") + rxn3 = indigo.loadReaction(rxn.rxnfile()) + print(rxn3.smiles()) + if not indigo.exactMatch(rxn, rxn3): + print("ERROR: rxn != rxn3") + + +def testQueryReactionSaveLoad(filename): + print("Loading " + filename) + rxn = indigo.loadQueryReactionFromFile(filename) + print(rxn.smiles()) + rxn2 = indigo.loadQueryReaction(rxn.smiles()) + print(rxn2.smiles()) + if rxn.countMolecules() != rxn2.countMolecules(): + print("ERROR: rxn != rxn2") + rxn3 = indigo.loadQueryReaction(rxn.rxnfile()) + print(rxn3.smiles()) + if rxn.countMolecules() != rxn3.countMolecules(): + print("ERROR: rxn != rxn3") + + +testReactionSaveLoad( + joinPathPy("reactions/disconnected_w_stereo.rxn", __file__) +) +testReactionSaveLoad(joinPathPy("reactions/disconnected.rxn", __file__)) +testReactionSaveLoad(joinPathPy("reactions/catalysts3000.rxn", __file__)) +testReactionSaveLoad(joinPathPy("reactions/catalysts2000.rxn", __file__)) +testReactionSaveLoad(joinPathPy("reactions/amiderxn2.rxn", __file__)) +testReactionSaveLoad(joinPathPy("reactions/test_hi.rxn", __file__)) +testReactionSaveLoad(joinPathPy("reactions/pseudoatoms/psd-pol.rxn", __file__)) +# testQueryReactionSaveLoad("reactions/pseudoatoms/x-o.rxn") diff --git a/api/tests/integration/tests/basic/rings.py b/api/tests/integration/tests/basic/rings.py index a7a218f5e0..8ad68132f5 100644 --- a/api/tests/integration/tests/basic/rings.py +++ b/api/tests/integration/tests/basic/rings.py @@ -1,90 +1,90 @@ -import os -import random -import sys - -sys.path.append( - os.path.normpath( - os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") - ) -) -from env_indigo import * # noqa - -indigo = Indigo() - - -def iterateLoopIterator(it, output): - cnt = 0 - rings = set() - for loop in it: - vset = tuple([v.index() for v in loop.iterateAtoms()]) - if vset in rings: - sys.stderr.write( - "Ring %s has already been enumerated\n" % (str(vset)) - ) - rings.add(vset) - output.write(" %s\n" % (str(vset))) - cnt += 1 - return cnt - - -def iterateLoops(m, output): - output.write(" Rings 3, 10:\n") - cnt = iterateLoopIterator(m.iterateRings(3, 10), output) - output.write(" Total rings: %d\n" % (cnt)) - - output.write(" Rings 4, 8:\n") - cnt2 = iterateLoopIterator(m.iterateRings(4, 8), output) - output.write(" Total rings: %d\n" % (cnt2)) - - output.write(" SSSR:\n") - sssrcnt = iterateLoopIterator(m.iterateSSSR(), output) - output.write(" Total SSSR rings: %d\n" % (sssrcnt)) - - return cnt, sssrcnt, cnt2 - - -def iterateLoopsSmiles(smiles, output): - print("Testing: " + smiles) - return iterateLoops(indigo.loadMolecule(smiles), output) - - -def random_permutation(iterable, r=None): - """Random selection from itertools.permutations(iterable, r)""" - pool = tuple(iterable) - if r is None: - r = len(pool) - return list(random.sample(pool, r)) - - -def getPermutatedMolecule(m): - indices = [x.index() for x in m.iterateAtoms()] - perm = random_permutation(indices, len(indices)) - perm_mol = m.createSubmolecule(perm) - return perm_mol, perm - - -cnt1 = iterateLoopsSmiles("c1c2CC(C)Cc2ccc1", sys.stdout) -cnt2 = iterateLoopsSmiles("c1cccc2c1CC(C2)C", sys.stdout) -if cnt1 != cnt2: - sys.stderr.write("Loop count is different: %s and %s" % (cnt1, cnt2)) - - -class NullOuput: - def write(self, s): - pass - - -print("Testing set of molecules") -idx = 1 -for item in indigo.iterateSDFile(joinPathPy("molecules/rings.sdf", __file__)): - print("#%d: " % (idx)) - rings = iterateLoops(item, sys.stdout) - for pc in range(5): - permmol, perm = getPermutatedMolecule(item) - rings2 = iterateLoops(permmol, NullOuput()) - if rings != rings2: - sys.stderr.write( - "Loop count is different: %s and %s\n" % (rings, rings2) - ) - sys.stderr.write("Permutation: %s\n" % (str(perm))) - idx += 1 +import os +import random +import sys + +sys.path.append( + os.path.normpath( + os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") + ) +) +from env_indigo import Indigo, joinPathPy + +indigo = Indigo() + + +def iterateLoopIterator(it, output): + cnt = 0 + rings = set() + for loop in it: + vset = tuple([v.index() for v in loop.iterateAtoms()]) + if vset in rings: + sys.stderr.write( + "Ring %s has already been enumerated\n" % (str(vset)) + ) + rings.add(vset) + output.write(" %s\n" % (str(vset))) + cnt += 1 + return cnt + + +def iterateLoops(m, output): + output.write(" Rings 3, 10:\n") + cnt = iterateLoopIterator(m.iterateRings(3, 10), output) + output.write(" Total rings: %d\n" % (cnt)) + + output.write(" Rings 4, 8:\n") + cnt2 = iterateLoopIterator(m.iterateRings(4, 8), output) + output.write(" Total rings: %d\n" % (cnt2)) + + output.write(" SSSR:\n") + sssrcnt = iterateLoopIterator(m.iterateSSSR(), output) + output.write(" Total SSSR rings: %d\n" % (sssrcnt)) + + return cnt, sssrcnt, cnt2 + + +def iterateLoopsSmiles(smiles, output): + print("Testing: " + smiles) + return iterateLoops(indigo.loadMolecule(smiles), output) + + +def random_permutation(iterable, r=None): + """Random selection from itertools.permutations(iterable, r)""" + pool = tuple(iterable) + if r is None: + r = len(pool) + return list(random.sample(pool, r)) + + +def getPermutatedMolecule(m): + indices = [x.index() for x in m.iterateAtoms()] + perm = random_permutation(indices, len(indices)) + perm_mol = m.createSubmolecule(perm) + return perm_mol, perm + + +cnt1 = iterateLoopsSmiles("c1c2CC(C)Cc2ccc1", sys.stdout) +cnt2 = iterateLoopsSmiles("c1cccc2c1CC(C2)C", sys.stdout) +if cnt1 != cnt2: + sys.stderr.write("Loop count is different: %s and %s" % (cnt1, cnt2)) + + +class NullOuput: + def write(self, s): + pass + + +print("Testing set of molecules") +idx = 1 +for item in indigo.iterateSDFile(joinPathPy("molecules/rings.sdf", __file__)): + print("#%d: " % (idx)) + rings = iterateLoops(item, sys.stdout) + for pc in range(5): + permmol, perm = getPermutatedMolecule(item) + rings2 = iterateLoops(permmol, NullOuput()) + if rings != rings2: + sys.stderr.write( + "Loop count is different: %s and %s\n" % (rings, rings2) + ) + sys.stderr.write("Permutation: %s\n" % (str(perm))) + idx += 1 diff --git a/api/tests/integration/tests/basic/rsite.py b/api/tests/integration/tests/basic/rsite.py index 8fc4e485af..64c093d62e 100644 --- a/api/tests/integration/tests/basic/rsite.py +++ b/api/tests/integration/tests/basic/rsite.py @@ -7,7 +7,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import Indigo, joinPathPy, makedirs indigo = Indigo() indigo.setOption("molfile-saving-skip-date", "1") diff --git a/api/tests/integration/tests/basic/savers.py b/api/tests/integration/tests/basic/savers.py index e12f836356..b3ef5f3a85 100644 --- a/api/tests/integration/tests/basic/savers.py +++ b/api/tests/integration/tests/basic/savers.py @@ -7,7 +7,13 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import ( + Indigo, + IndigoException, + getIndigoExceptionText, + joinPathPy, + relativePath, +) indigo = Indigo() indigo.setOption("molfile-saving-skip-date", "1") diff --git a/api/tests/integration/tests/basic/scsr_basic.py b/api/tests/integration/tests/basic/scsr_basic.py index c8ed6beb59..02a7774e09 100644 --- a/api/tests/integration/tests/basic/scsr_basic.py +++ b/api/tests/integration/tests/basic/scsr_basic.py @@ -6,8 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * - +from env_indigo import Indigo, joinPathPy indigo = Indigo() indigo.setOption("molfile-saving-skip-date", "1") indigo.setOption("molfile-saving-mode", "3000") diff --git a/api/tests/integration/tests/basic/scsr_instrumentation.py b/api/tests/integration/tests/basic/scsr_instrumentation.py index 0c96d0d912..6b28a835c0 100644 --- a/api/tests/integration/tests/basic/scsr_instrumentation.py +++ b/api/tests/integration/tests/basic/scsr_instrumentation.py @@ -6,8 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * - +from env_indigo import Indigo, joinPathPy indigo = Indigo() indigo.setOption("molfile-saving-skip-date", "1") indigo.setOption("molfile-saving-mode", "3000") diff --git a/api/tests/integration/tests/basic/set_charge.py b/api/tests/integration/tests/basic/set_charge.py index 8b0367f858..ad1e48f41f 100644 --- a/api/tests/integration/tests/basic/set_charge.py +++ b/api/tests/integration/tests/basic/set_charge.py @@ -6,8 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * - +from env_indigo import Indigo indigo = Indigo() mol = indigo.loadMolecule("N1C=CC=CC=1") print( diff --git a/api/tests/integration/tests/basic/sssr.py b/api/tests/integration/tests/basic/sssr.py index 7dafca344b..f8561b3cd0 100644 --- a/api/tests/integration/tests/basic/sssr.py +++ b/api/tests/integration/tests/basic/sssr.py @@ -1,36 +1,36 @@ -import os -import sys - -sys.path.append( - os.path.normpath( - os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") - ) -) -from env_indigo import * # noqa - -indigo = Indigo() - - -def sssrInfo(mol): - print("SSSR count = {0}".format(mol.countSSSR())) - for submol in mol.iterateSSSR(): - sys.stdout.write(" ") - for atom in submol.iterateAtoms(): - sys.stdout.write(str(atom.index()) + " ") - sys.stdout.write("\n") - - -def testSSSR(): - indigo.setOption("skip-3d-chirality", True) - chebi_dir = joinPathPy("../../../../../data/molecules/chebi", __file__) - files = os.listdir(chebi_dir) - files.sort() - for filename in files: - print(filename) - mol = indigo.loadMoleculeFromFile(os.path.join(chebi_dir, filename)) - sssrInfo(mol) - newmol = indigo.loadMolecule(mol.smiles()) - sssrInfo(newmol) - - -testSSSR() +import os +import sys + +sys.path.append( + os.path.normpath( + os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") + ) +) +from env_indigo import Indigo, joinPathPy + +indigo = Indigo() + + +def sssrInfo(mol): + print("SSSR count = {0}".format(mol.countSSSR())) + for submol in mol.iterateSSSR(): + sys.stdout.write(" ") + for atom in submol.iterateAtoms(): + sys.stdout.write(str(atom.index()) + " ") + sys.stdout.write("\n") + + +def testSSSR(): + indigo.setOption("skip-3d-chirality", True) + chebi_dir = joinPathPy("../../../../../data/molecules/chebi", __file__) + files = os.listdir(chebi_dir) + files.sort() + for filename in files: + print(filename) + mol = indigo.loadMoleculeFromFile(os.path.join(chebi_dir, filename)) + sssrInfo(mol) + newmol = indigo.loadMolecule(mol.smiles()) + sssrInfo(newmol) + + +testSSSR() diff --git a/api/tests/integration/tests/basic/stereo_test.py b/api/tests/integration/tests/basic/stereo_test.py index 8b2379785b..74c000e519 100644 --- a/api/tests/integration/tests/basic/stereo_test.py +++ b/api/tests/integration/tests/basic/stereo_test.py @@ -7,7 +7,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import Indigo, joinPathPy indigo = Indigo() diff --git a/api/tests/integration/tests/basic/stereocenters.py b/api/tests/integration/tests/basic/stereocenters.py index fea1e8d07a..e2db73d084 100644 --- a/api/tests/integration/tests/basic/stereocenters.py +++ b/api/tests/integration/tests/basic/stereocenters.py @@ -7,7 +7,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import Indigo, joinPathPy, makedirs indigo = Indigo() indigo.setOption("molfile-saving-skip-date", "1") diff --git a/api/tests/integration/tests/basic/test_smiles.py b/api/tests/integration/tests/basic/test_smiles.py index 6f9a138357..255e62fd1e 100644 --- a/api/tests/integration/tests/basic/test_smiles.py +++ b/api/tests/integration/tests/basic/test_smiles.py @@ -6,8 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * - +from env_indigo import Indigo indigo = Indigo() indigo.setOption("molfile-saving-skip-date", "1") diff --git a/api/tests/integration/tests/basic/threads.py b/api/tests/integration/tests/basic/threads.py index edd49833cb..868ee426af 100644 --- a/api/tests/integration/tests/basic/threads.py +++ b/api/tests/integration/tests/basic/threads.py @@ -1,60 +1,60 @@ -import os -import sys -from threading import Thread - -sys.path.append( - os.path.normpath( - os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") - ) -) -from env_indigo import * # noqa - - -class testThread(Thread): - def __init__(self, id, indigo): - Thread.__init__(self) - self.id = id - self.indigo = indigo - - def run(self): - indigo = self.indigo - self.result = "???" # indigo._sid - id = 0 - - for item in indigo.iterateSmilesFile( - joinPathPy("molecules/helma.smi", __file__) - ): - c1 = "" - c2 = "" - try: - c1 = str(item.canonicalSmiles()) - c2 = str(item.canonicalSmiles()) - except IndigoException as e: - pass - if c1 != c2: - sys.stderr.write("Thread %d: %s != %s\n" % (self.id, c1, c2)) - if id == self.id: - self.result = (c1, c2) - id += 1 - - -print("*** Testing separate Indigo in each thread ***") -threads = [] -for i in range(100): - current = testThread(i, Indigo()) - threads.append(current) - current.start() -for thread in threads: - thread.join() - print("Result from thread %s is %s" % (thread.id, str(thread.result))) - -print("*** Testing same Indigo in each thread ***") -threads = [] -indigo = Indigo() -for i in range(100): - current = testThread(i, indigo) - threads.append(current) - current.start() -for thread in threads: - thread.join() - print("Result from thread %s is %s" % (thread.id, str(thread.result))) +import os +import sys +from threading import Thread + +sys.path.append( + os.path.normpath( + os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") + ) +) +from env_indigo import Indigo, IndigoException, joinPathPy + + +class testThread(Thread): + def __init__(self, id, indigo): + Thread.__init__(self) + self.id = id + self.indigo = indigo + + def run(self): + indigo = self.indigo + self.result = "???" # indigo._sid + id = 0 + + for item in indigo.iterateSmilesFile( + joinPathPy("molecules/helma.smi", __file__) + ): + c1 = "" + c2 = "" + try: + c1 = str(item.canonicalSmiles()) + c2 = str(item.canonicalSmiles()) + except IndigoException as e: + pass + if c1 != c2: + sys.stderr.write("Thread %d: %s != %s\n" % (self.id, c1, c2)) + if id == self.id: + self.result = (c1, c2) + id += 1 + + +print("*** Testing separate Indigo in each thread ***") +threads = [] +for i in range(100): + current = testThread(i, Indigo()) + threads.append(current) + current.start() +for thread in threads: + thread.join() + print("Result from thread %s is %s" % (thread.id, str(thread.result))) + +print("*** Testing same Indigo in each thread ***") +threads = [] +indigo = Indigo() +for i in range(100): + current = testThread(i, indigo) + threads.append(current) + current.start() +for thread in threads: + thread.join() + print("Result from thread %s is %s" % (thread.id, str(thread.result))) diff --git a/api/tests/integration/tests/basic/unfold_layout_hydrogens.py b/api/tests/integration/tests/basic/unfold_layout_hydrogens.py index 167424b0ef..b2a3a6d1c7 100644 --- a/api/tests/integration/tests/basic/unfold_layout_hydrogens.py +++ b/api/tests/integration/tests/basic/unfold_layout_hydrogens.py @@ -9,7 +9,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import Indigo indigo = Indigo() indigo.setOption("molfile-saving-skip-date", "1") diff --git a/api/tests/integration/tests/basic/valence.py b/api/tests/integration/tests/basic/valence.py index b9cc765e6d..9d94fe1082 100644 --- a/api/tests/integration/tests/basic/valence.py +++ b/api/tests/integration/tests/basic/valence.py @@ -1,57 +1,57 @@ -import os -import sys - -sys.path.append( - os.path.normpath( - os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") - ) -) -from env_indigo import * # noqa - -indigo = Indigo() -indigo.setOption("molfile-saving-skip-date", True) - -print("****** Get valence ********") - - -def getMoleculesValence(iter): - for num, mol in enumerate(iter): - print("molecule #%d: " % (num)) - for atom in mol.iterateAtoms(): - msg = atom.checkBadValence() - if len(msg) > 0: - print( - "Atom index %d has bad valence: %s" % (atom.index(), msg) - ) - msg = mol.checkBadValence() - if len(msg) > 0: - print(msg) - msg = mol.checkAmbiguousH() - if len(msg) > 0: - print(msg) - - -getMoleculesValence( - indigo.iterateSDFile(joinPathPy("molecules/valence_test1.sdf", __file__)) -) - - -print("****** Set explicit valence ********") -m = indigo.loadMolecule("CP(C)C") -print(m.smiles()) -a = m.getAtom(1) -print(a.valence()) -a.setExplicitValence(6) -print(a.valence()) -print(m.smiles()) -print(m.molfile()) - -print("****** Explicit unusual valence ********") -getMoleculesValence( - indigo.iterateSDFile( - joinPathPy( - "../../../../../data/molecules/basic/explicit_valence.sdf", - __file__, - ) - ) -) +import os +import sys + +sys.path.append( + os.path.normpath( + os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") + ) +) +from env_indigo import Indigo, joinPathPy + +indigo = Indigo() +indigo.setOption("molfile-saving-skip-date", True) + +print("****** Get valence ********") + + +def getMoleculesValence(iter): + for num, mol in enumerate(iter): + print("molecule #%d: " % (num)) + for atom in mol.iterateAtoms(): + msg = atom.checkBadValence() + if len(msg) > 0: + print( + "Atom index %d has bad valence: %s" % (atom.index(), msg) + ) + msg = mol.checkBadValence() + if len(msg) > 0: + print(msg) + msg = mol.checkAmbiguousH() + if len(msg) > 0: + print(msg) + + +getMoleculesValence( + indigo.iterateSDFile(joinPathPy("molecules/valence_test1.sdf", __file__)) +) + + +print("****** Set explicit valence ********") +m = indigo.loadMolecule("CP(C)C") +print(m.smiles()) +a = m.getAtom(1) +print(a.valence()) +a.setExplicitValence(6) +print(a.valence()) +print(m.smiles()) +print(m.molfile()) + +print("****** Explicit unusual valence ********") +getMoleculesValence( + indigo.iterateSDFile( + joinPathPy( + "../../../../../data/molecules/basic/explicit_valence.sdf", + __file__, + ) + ) +) diff --git a/api/tests/integration/tests/basic/validate.py b/api/tests/integration/tests/basic/validate.py index ad8ac811e4..c316cd2480 100644 --- a/api/tests/integration/tests/basic/validate.py +++ b/api/tests/integration/tests/basic/validate.py @@ -8,7 +8,12 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import ( + Indigo, + IndigoException, + getIndigoExceptionText, + joinPathPy, +) indigo = Indigo() diff --git a/api/tests/integration/tests/basic/version.py b/api/tests/integration/tests/basic/version.py index e92d516dfe..7f5e5ac65b 100644 --- a/api/tests/integration/tests/basic/version.py +++ b/api/tests/integration/tests/basic/version.py @@ -7,8 +7,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * - +from env_indigo import Indigo indigo = Indigo() diff --git a/api/tests/integration/tests/basic/zbo_load.py b/api/tests/integration/tests/basic/zbo_load.py index 8c89c516da..62fd181abc 100644 --- a/api/tests/integration/tests/basic/zbo_load.py +++ b/api/tests/integration/tests/basic/zbo_load.py @@ -6,7 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import Indigo, joinPathPy indigo = Indigo() indigo.setOption("molfile-saving-skip-date", "true") diff --git a/api/tests/integration/tests/bingo/append.py b/api/tests/integration/tests/bingo/append.py index fbf285a89d..95c18e9241 100644 --- a/api/tests/integration/tests/bingo/append.py +++ b/api/tests/integration/tests/bingo/append.py @@ -6,7 +6,14 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import ( + Bingo, + Indigo, + dir_exists, + joinPathPy, + makedirs, + rmdir, +) if dir_exists(joinPathPy("out/append", __file__)): rmdir(joinPathPy("out/append", __file__)) diff --git a/api/tests/integration/tests/bingo/basic.py b/api/tests/integration/tests/bingo/basic.py index f528f929bb..6c1c6e60a1 100644 --- a/api/tests/integration/tests/bingo/basic.py +++ b/api/tests/integration/tests/bingo/basic.py @@ -6,7 +6,16 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import ( + Bingo, + BingoException, + Indigo, + dir_exists, + getIndigoExceptionText, + joinPathPy, + makedirs, + rmdir, +) def searchSub(bingo, q, options=""): diff --git a/api/tests/integration/tests/bingo/bingo_settings.py b/api/tests/integration/tests/bingo/bingo_settings.py index d0a3c2341a..dba8d29565 100644 --- a/api/tests/integration/tests/bingo/bingo_settings.py +++ b/api/tests/integration/tests/bingo/bingo_settings.py @@ -7,7 +7,13 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import ( + Bingo, + Indigo, + System, + isIronPython, + joinPathPy, +) print( "*** Test if Indigo and Bingo use the same settings for fingerprints ***" diff --git a/api/tests/integration/tests/bingo/ext_fp.py b/api/tests/integration/tests/bingo/ext_fp.py index 9fef983d82..4de81c2927 100644 --- a/api/tests/integration/tests/bingo/ext_fp.py +++ b/api/tests/integration/tests/bingo/ext_fp.py @@ -7,7 +7,15 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import ( + Bingo, + BingoException, + Indigo, + System, + getIndigoExceptionText, + isIronPython, + joinPathPy, +) def searchSimExt(bingo, q, minSim, maxSim, ext_fp, metric=None): diff --git a/api/tests/integration/tests/bingo/gross_test.py b/api/tests/integration/tests/bingo/gross_test.py index cc6ec59b5d..062c25ca08 100644 --- a/api/tests/integration/tests/bingo/gross_test.py +++ b/api/tests/integration/tests/bingo/gross_test.py @@ -1,75 +1,81 @@ -import os -import sys - -sys.path.append( - os.path.normpath( - os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") - ) -) -from env_indigo import * # noqa - -indigo = Indigo() -bingo = Bingo.createDatabaseFile( - indigo, joinPathPy("out/db_gross_mol", __file__), "molecule", "" -) - -for idx, mol in enumerate( - indigo.iterateSmilesFile(joinPathPy("molecules/gross_200.smi", __file__)) -): - bingo.insert(mol, idx) - - -def searchGross(bingo, q, requiredId=None, options=""): - info = "" - if requiredId is not None: - info = ", requiredId={0}".format(requiredId) - - print("** searchMolFormula({0}, {1}{2}) **".format(q, repr(options), info)) - result = bingo.searchMolFormula(q, options) - rm = result.getIndigoObject() - requiredIdFound = False - while result.next(): - try: - id = result.getCurrentId() - if id == requiredId: - requiredIdFound = True - - mol = bingo.getRecordById(id) - print( - "\t{0} {1} {2}. {3}".format( - result.getCurrentId(), - rm.smiles(), - mol.smiles(), - mol.grossFormula(), - ) - ) - except BingoException as e: - print("\tBingoException: {0}".format(getIndigoExceptionText(e))) - result.close() - - if requiredId is not None and not requiredIdFound: - print( - "Error: cannot find molecule by the same molFormula: {0} by id={1}".format( - q, requiredId - ) - ) - - -print("**** Basic test ****") -searchGross(bingo, "C5H11N1") -searchGross(bingo, "C5 H11 N1") -searchGross(bingo, "C3 C2 H11 N1") -searchGross(bingo, "Cl3") -try: - print("Wrong MolFormula:") - searchGross(bingo, "AnyText3") -except BingoException as e: - print("BingoException: {0}".format(getIndigoExceptionText(e))) - -print("*** Search ***") -for idx, mol in enumerate( - indigo.iterateSmilesFile(joinPathPy("molecules/gross_200.smi", __file__)) -): - searchGross(bingo, mol.grossFormula(), requiredId=idx) - -bingo.close() +import os +import sys + +sys.path.append( + os.path.normpath( + os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") + ) +) +from env_indigo import ( + Bingo, + BingoException, + Indigo, + getIndigoExceptionText, + joinPathPy, +) + +indigo = Indigo() +bingo = Bingo.createDatabaseFile( + indigo, joinPathPy("out/db_gross_mol", __file__), "molecule", "" +) + +for idx, mol in enumerate( + indigo.iterateSmilesFile(joinPathPy("molecules/gross_200.smi", __file__)) +): + bingo.insert(mol, idx) + + +def searchGross(bingo, q, requiredId=None, options=""): + info = "" + if requiredId is not None: + info = ", requiredId={0}".format(requiredId) + + print("** searchMolFormula({0}, {1}{2}) **".format(q, repr(options), info)) + result = bingo.searchMolFormula(q, options) + rm = result.getIndigoObject() + requiredIdFound = False + while result.next(): + try: + id = result.getCurrentId() + if id == requiredId: + requiredIdFound = True + + mol = bingo.getRecordById(id) + print( + "\t{0} {1} {2}. {3}".format( + result.getCurrentId(), + rm.smiles(), + mol.smiles(), + mol.grossFormula(), + ) + ) + except BingoException as e: + print("\tBingoException: {0}".format(getIndigoExceptionText(e))) + result.close() + + if requiredId is not None and not requiredIdFound: + print( + "Error: cannot find molecule by the same molFormula: {0} by id={1}".format( + q, requiredId + ) + ) + + +print("**** Basic test ****") +searchGross(bingo, "C5H11N1") +searchGross(bingo, "C5 H11 N1") +searchGross(bingo, "C3 C2 H11 N1") +searchGross(bingo, "Cl3") +try: + print("Wrong MolFormula:") + searchGross(bingo, "AnyText3") +except BingoException as e: + print("BingoException: {0}".format(getIndigoExceptionText(e))) + +print("*** Search ***") +for idx, mol in enumerate( + indigo.iterateSmilesFile(joinPathPy("molecules/gross_200.smi", __file__)) +): + searchGross(bingo, mol.grossFormula(), requiredId=idx) + +bingo.close() diff --git a/api/tests/integration/tests/bingo/sim_value_test.py b/api/tests/integration/tests/bingo/sim_value_test.py index d260560d3c..772e4f068a 100644 --- a/api/tests/integration/tests/bingo/sim_value_test.py +++ b/api/tests/integration/tests/bingo/sim_value_test.py @@ -6,8 +6,12 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * - +from env_indigo import ( + Bingo, + Indigo, + joinPathPy, + makedirs, +) if not os.path.exists(joinPathPy("out/sim_value_test", __file__)): makedirs(joinPathPy("out/sim_value_test", __file__)) diff --git a/api/tests/integration/tests/bingo/similarity_matrix.py b/api/tests/integration/tests/bingo/similarity_matrix.py index 7d3877891b..3995c25f77 100644 --- a/api/tests/integration/tests/bingo/similarity_matrix.py +++ b/api/tests/integration/tests/bingo/similarity_matrix.py @@ -6,7 +6,14 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import ( + Bingo, + BingoException, + Indigo, + getIndigoExceptionText, + joinPathPy, + makedirs, +) if not os.access(joinPathPy("out", __file__), os.F_OK): os.makedirs(joinPathPy("out", __file__)) diff --git a/api/tests/integration/tests/bingo/similarity_types.py b/api/tests/integration/tests/bingo/similarity_types.py index 7255499fe7..b6166bf3b9 100644 --- a/api/tests/integration/tests/bingo/similarity_types.py +++ b/api/tests/integration/tests/bingo/similarity_types.py @@ -6,9 +6,14 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * - - +from env_indigo import ( + Bingo, + Indigo, + dir_exists, + joinPathPy, + makedirs, + rmdir, +) def searchSim(bingo, q, minSim, maxSim, metric="tanimoto"): print("\n **** \n") result = bingo.searchSim(q, minSim, maxSim, metric) diff --git a/api/tests/integration/tests/bingo/threads_test.py b/api/tests/integration/tests/bingo/threads_test.py index 21feeace0c..c2dada591c 100644 --- a/api/tests/integration/tests/bingo/threads_test.py +++ b/api/tests/integration/tests/bingo/threads_test.py @@ -1,363 +1,370 @@ -import os -import sys - -sys.path.append( - os.path.normpath( - os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") - ) -) -from env_indigo import * # noqa - -db_dir1 = joinPathPy("out/mol_test_db1", __file__) -db_dir2 = joinPathPy("out/mol_test_db2", __file__) - - -def outPrint(s, pid, output): - # output = None - if output == None: - print(s) - else: - old_out = output[pid] - output[pid] = "{0}\n{1}".format(old_out, s) - - -def insertProc(db, pid, input_smi, output=None): - index = 0 - wrongStructures = 0 - # outPrint('Inserting molecules from:{1}'.format(pid, input_smi), pid, output) - - smi_path = joinPathPy(os.path.join("molecules", input_smi), __file__) - for mol in indigo.iterateSmilesFile(smi_path): - try: - db.insert(mol) - except BingoException as e: - outPrint( - "Structure {0} excluded: {1}".format( - index, getIndigoExceptionText(e) - ), - pid, - output, - ) - wrongStructures += 1 - index += 1 - - outPrint( - "Finished indexing {1} structures. {2} wrong structures excluded".format( - pid, index, wrongStructures - ), - pid, - output, - ) - - -def makeSearchSim(db, pid, query, min, max, options, output=None): - outPrint("\n\nSimSearch with metric {0}".format(options), pid, output) - - search = db.searchSim(query, min, max, options) - cnt = 0 - while search.next(): - # outPrint('Mol #{0} with sim value {1}'.format(search.getCurrentId(), round(search.getCurrentSimilarityValue(), 4)), pid, output) - cnt += 1 - # outPrint('{0} results'.format(cnt)) - # f1=open('sim_out.txt', 'a+') - # f1.write('PID {0}) Total count in db #{1} {2}\n'.format(pid, db, cnt)) - outPrint("PID {0}) Total count {1}\n\n".format(pid, cnt), pid, output) - - -def makeSearchSub(db, pid, query, options, output=None): - outPrint("\n\nSubSearch:".format(db), pid, output) - search = db.searchSub(query, options) - cnt = 0 - while search.next(): - # outPrint('Mol #{0}'.format(search.getCurrentId()), pid, output) - cnt = cnt + 1 - # f1=open('sub_out.txt', 'a+') - # f1.write('PID {0}) Total count in db #{1} {2}\n'.format(pid, db, cnt)) - outPrint("PID {0}) Total count {1}\n".format(pid, cnt), pid, output) - - -def makeSearchExact(db, pid, query, options, output=None): - outPrint("ExactSearch:".format(db), pid, output) - search = db.searchExact(query, options) - cnt = 0 - while search.next(): - # outPrint('Mol #{0}'.format(search.getCurrentId()), pid, output) - cnt = cnt + 1 - # f1=open('./exact_out.txt', 'a+') - # f1.write('PID {0}) Total count in db #{1} {2}\n'.format(pid, db, cnt)) - outPrint("PID {0}) Total count {1}\n".format(pid, cnt), pid, output) - - -indigo = Indigo() -indigo1 = Indigo() - - -def consTest(): - bingo1 = Bingo.createDatabaseFile(indigo, db_dir1, "molecule", "") - bingo2 = Bingo.createDatabaseFile(indigo, db_dir2, "molecule", "") - - insertProc(bingo1, 0, "sample_2000_2.smi") - insertProc(bingo1, 0, "sample_2000_2.smi") - insertProc(bingo1, 0, "sample_2000_3.smi") - - insertProc(bingo2, 0, "sample_2000_1.smi") - insertProc(bingo2, 0, "sample_2000_2.smi") - insertProc(bingo2, 0, "sample_2000_4.smi") - insertProc(bingo2, 0, "sample_2000_5.smi") - - query = indigo.loadMoleculeFromFile( - joinPathPy("molecules/query_382.smi", __file__) - ) - q_query = indigo.loadQueryMoleculeFromFile( - joinPathPy("molecules/query_382.smi", __file__) - ) - - cnt = 1 - for bingo in [bingo1, bingo2]: - print("Database #{0}".format(cnt)) - makeSearchSim(bingo, 0, query, 0.7, 1, "tanimoto") - makeSearchSim(bingo, 0, query, 0.7, 1, "tversky 0.5 0.5") - makeSearchSim(bingo, 0, query, 0.7, 1, "euclid-sub") - makeSearchSub(bingo, 0, q_query, "") - makeSearchExact(bingo, 0, query, "") - cnt = cnt + 1 - - bingo1.close() - bingo2.close() - - -def insertThr(db, pid, samples, output=None): - for i in samples: - name = "sample_2000_" + str(i) - insertProc(db, pid, name + ".smi", output) - - -def paralSameTest(): - bingo1 = Bingo.createDatabaseFile(indigo, db_dir1, "molecule", "") - - thrs = [] - - for i in range(1, 51): - thrs.insert( - i - 1, - threading.Thread( - target=insertThr, args=(bingo1, [(i - 1) % 5 + 1]) - ), - ) - - for t in thrs: - t.start() - - for t in thrs: - t.join() - - query = indigo.loadMoleculeFromFile( - joinPathPy("molecules/query_2_182.smi", __file__) - ) - q_query = indigo.loadQueryMoleculeFromFile( - joinPathPy("molecules/query_2_182.smi", __file__) - ) - - makeSearchSim(bingo1, 0, query, 0.3, 1, "tanimoto") - - makeSearchSub(bingo1, 0, q_query, "") - - makeSearchExact(bingo1, 0, query, "") - - bingo1.close() - - -def paralBigTest(): - bingo1 = Bingo.createDatabaseFile( - indigo, - db_dir1, - "molecule", - "read_only:false", - ) - bingo2 = Bingo.createDatabaseFile( - indigo, - db_dir2, - "molecule", - "read_only:false", - ) - - thrs = [] - - query = indigo.loadMoleculeFromFile( - joinPathPy("molecules/query_382.smi", __file__) - ) - q_query = indigo.loadQueryMoleculeFromFile( - joinPathPy("molecules/query_382.smi", __file__) - ) - - outp = ["" for x in range(70)] - for i in range(0, 5): - thrs.append( - threading.Thread( - target=insertThr, args=(bingo1, i, [i % 5 + 1], outp) - ) - ) - for i in range(5, 10): - thrs.append( - threading.Thread( - target=insertThr, args=(bingo2, i, [i % 5 + 1], outp) - ) - ) - - for i in range(10, 20): - thrs.append( - threading.Thread( - target=makeSearchSim, - args=(bingo1, i, query, 0.7, 1, "tanimoto", outp), - ) - ) - for i in range(20, 30): - thrs.append( - threading.Thread( - target=makeSearchSub, args=(bingo1, i, q_query, "", outp) - ) - ) - for i in range(30, 40): - thrs.append( - threading.Thread( - target=makeSearchExact, args=(bingo1, i, query, "", outp) - ) - ) - - for i in range(40, 50): - thrs.append( - threading.Thread( - target=makeSearchSim, - args=(bingo2, i, query, 0.7, 1, "tanimoto", outp), - ) - ) - for i in range(50, 60): - thrs.append( - threading.Thread( - target=makeSearchSub, args=(bingo2, i, q_query, "", outp) - ) - ) - for i in range(60, 70): - thrs.append( - threading.Thread( - target=makeSearchExact, args=(bingo2, i, query, "", outp) - ) - ) - - for t in thrs: - t.start() - - for t in thrs: - t.join() - - for i in range(0, 10): - sys.stdout.write(outp[i]) - - print("\n\ncheck..") - - del thrs[:] - thr_outputs = ["" for x in range(10)] - cnt = 1 - for bingo in [bingo1, bingo2]: - print("Database #{0}".format(cnt)) - off = (cnt - 1) * 5 - thrs.append( - threading.Thread( - target=makeSearchSim, - args=(bingo, 0 + off, query, 0.7, 1, "tanimoto", thr_outputs), - ) - ) - thrs.append( - threading.Thread( - target=makeSearchSim, - args=( - bingo, - 1 + off, - query, - 0.7, - 1, - "tversky 0.2 0.8", - thr_outputs, - ), - ) - ) - thrs.append( - threading.Thread( - target=makeSearchSim, - args=( - bingo, - 2 + off, - query, - 0.7, - 1, - "euclid-sub", - thr_outputs, - ), - ) - ) - thrs.append( - threading.Thread( - target=makeSearchSub, - args=(bingo, 3 + off, q_query, "", thr_outputs), - ) - ) - thrs.append( - threading.Thread( - target=makeSearchExact, - args=(bingo, 4 + off, query, "", thr_outputs), - ) - ) - cnt = cnt + 1 - - for t in thrs: - t.start() - - for t in thrs: - t.join() - - for output in thr_outputs: - print(output) - - bingo1.close() - bingo2.close() - - -def difIndigoTest(): - indigo1 = Indigo() - indigo2 = Indigo() - bingo1 = Bingo.createDatabaseFile(indigo1, db_dir1, "molecule", "") - bingo2 = Bingo.createDatabaseFile(indigo2, db_dir2, "molecule", "") - - t1 = threading.Thread(target=insertThr, args=(bingo1, [2, 3])) - t2 = threading.Thread(target=insertThr, args=(bingo2, [1, 4, 5])) - - t1.start() - t2.start() - - t1.join() - t2.join() - - query = indigo.loadMoleculeFromFile( - joinPathPy("molecules/query_382.smi", __file__) - ) - q_query = indigo.loadQueryMoleculeFromFile( - joinPathPy("molecules/query_382.smi", __file__) - ) - - makeSearchSim(bingo1, 0, query, 0.3, 1, "tanimoto") - makeSearchSim(bingo2, 0, query, 0.3, 1, "tanimoto") - - makeSearchSub(bingo1, 0, q_query, "") - makeSearchSub(bingo2, 0, q_query, "") - - makeSearchExact(bingo1, 0, query, "") - makeSearchExact(bingo2, 0, query, "") - - bingo1.close() - bingo2.close() - - -print("\n2 BINGO WITH SAME INDIGO\n") -consTest() -print("\nMULTITHREADING TEST\n") -paralBigTest() +import os +import sys + +sys.path.append( + os.path.normpath( + os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") + ) +) +from env_indigo import ( + Bingo, + BingoException, + Indigo, + getIndigoExceptionText, + joinPathPy, + threading, +) + +db_dir1 = joinPathPy("out/mol_test_db1", __file__) +db_dir2 = joinPathPy("out/mol_test_db2", __file__) + + +def outPrint(s, pid, output): + # output = None + if output == None: + print(s) + else: + old_out = output[pid] + output[pid] = "{0}\n{1}".format(old_out, s) + + +def insertProc(db, pid, input_smi, output=None): + index = 0 + wrongStructures = 0 + # outPrint('Inserting molecules from:{1}'.format(pid, input_smi), pid, output) + + smi_path = joinPathPy(os.path.join("molecules", input_smi), __file__) + for mol in indigo.iterateSmilesFile(smi_path): + try: + db.insert(mol) + except BingoException as e: + outPrint( + "Structure {0} excluded: {1}".format( + index, getIndigoExceptionText(e) + ), + pid, + output, + ) + wrongStructures += 1 + index += 1 + + outPrint( + "Finished indexing {1} structures. {2} wrong structures excluded".format( + pid, index, wrongStructures + ), + pid, + output, + ) + + +def makeSearchSim(db, pid, query, min, max, options, output=None): + outPrint("\n\nSimSearch with metric {0}".format(options), pid, output) + + search = db.searchSim(query, min, max, options) + cnt = 0 + while search.next(): + # outPrint('Mol #{0} with sim value {1}'.format(search.getCurrentId(), round(search.getCurrentSimilarityValue(), 4)), pid, output) + cnt += 1 + # outPrint('{0} results'.format(cnt)) + # f1=open('sim_out.txt', 'a+') + # f1.write('PID {0}) Total count in db #{1} {2}\n'.format(pid, db, cnt)) + outPrint("PID {0}) Total count {1}\n\n".format(pid, cnt), pid, output) + + +def makeSearchSub(db, pid, query, options, output=None): + outPrint("\n\nSubSearch:".format(db), pid, output) + search = db.searchSub(query, options) + cnt = 0 + while search.next(): + # outPrint('Mol #{0}'.format(search.getCurrentId()), pid, output) + cnt = cnt + 1 + # f1=open('sub_out.txt', 'a+') + # f1.write('PID {0}) Total count in db #{1} {2}\n'.format(pid, db, cnt)) + outPrint("PID {0}) Total count {1}\n".format(pid, cnt), pid, output) + + +def makeSearchExact(db, pid, query, options, output=None): + outPrint("ExactSearch:".format(db), pid, output) + search = db.searchExact(query, options) + cnt = 0 + while search.next(): + # outPrint('Mol #{0}'.format(search.getCurrentId()), pid, output) + cnt = cnt + 1 + # f1=open('./exact_out.txt', 'a+') + # f1.write('PID {0}) Total count in db #{1} {2}\n'.format(pid, db, cnt)) + outPrint("PID {0}) Total count {1}\n".format(pid, cnt), pid, output) + + +indigo = Indigo() +indigo1 = Indigo() + + +def consTest(): + bingo1 = Bingo.createDatabaseFile(indigo, db_dir1, "molecule", "") + bingo2 = Bingo.createDatabaseFile(indigo, db_dir2, "molecule", "") + + insertProc(bingo1, 0, "sample_2000_2.smi") + insertProc(bingo1, 0, "sample_2000_2.smi") + insertProc(bingo1, 0, "sample_2000_3.smi") + + insertProc(bingo2, 0, "sample_2000_1.smi") + insertProc(bingo2, 0, "sample_2000_2.smi") + insertProc(bingo2, 0, "sample_2000_4.smi") + insertProc(bingo2, 0, "sample_2000_5.smi") + + query = indigo.loadMoleculeFromFile( + joinPathPy("molecules/query_382.smi", __file__) + ) + q_query = indigo.loadQueryMoleculeFromFile( + joinPathPy("molecules/query_382.smi", __file__) + ) + + cnt = 1 + for bingo in [bingo1, bingo2]: + print("Database #{0}".format(cnt)) + makeSearchSim(bingo, 0, query, 0.7, 1, "tanimoto") + makeSearchSim(bingo, 0, query, 0.7, 1, "tversky 0.5 0.5") + makeSearchSim(bingo, 0, query, 0.7, 1, "euclid-sub") + makeSearchSub(bingo, 0, q_query, "") + makeSearchExact(bingo, 0, query, "") + cnt = cnt + 1 + + bingo1.close() + bingo2.close() + + +def insertThr(db, pid, samples, output=None): + for i in samples: + name = "sample_2000_" + str(i) + insertProc(db, pid, name + ".smi", output) + + +def paralSameTest(): + bingo1 = Bingo.createDatabaseFile(indigo, db_dir1, "molecule", "") + + thrs = [] + + for i in range(1, 51): + thrs.insert( + i - 1, + threading.Thread( + target=insertThr, args=(bingo1, [(i - 1) % 5 + 1]) + ), + ) + + for t in thrs: + t.start() + + for t in thrs: + t.join() + + query = indigo.loadMoleculeFromFile( + joinPathPy("molecules/query_2_182.smi", __file__) + ) + q_query = indigo.loadQueryMoleculeFromFile( + joinPathPy("molecules/query_2_182.smi", __file__) + ) + + makeSearchSim(bingo1, 0, query, 0.3, 1, "tanimoto") + + makeSearchSub(bingo1, 0, q_query, "") + + makeSearchExact(bingo1, 0, query, "") + + bingo1.close() + + +def paralBigTest(): + bingo1 = Bingo.createDatabaseFile( + indigo, + db_dir1, + "molecule", + "read_only:false", + ) + bingo2 = Bingo.createDatabaseFile( + indigo, + db_dir2, + "molecule", + "read_only:false", + ) + + thrs = [] + + query = indigo.loadMoleculeFromFile( + joinPathPy("molecules/query_382.smi", __file__) + ) + q_query = indigo.loadQueryMoleculeFromFile( + joinPathPy("molecules/query_382.smi", __file__) + ) + + outp = ["" for x in range(70)] + for i in range(0, 5): + thrs.append( + threading.Thread( + target=insertThr, args=(bingo1, i, [i % 5 + 1], outp) + ) + ) + for i in range(5, 10): + thrs.append( + threading.Thread( + target=insertThr, args=(bingo2, i, [i % 5 + 1], outp) + ) + ) + + for i in range(10, 20): + thrs.append( + threading.Thread( + target=makeSearchSim, + args=(bingo1, i, query, 0.7, 1, "tanimoto", outp), + ) + ) + for i in range(20, 30): + thrs.append( + threading.Thread( + target=makeSearchSub, args=(bingo1, i, q_query, "", outp) + ) + ) + for i in range(30, 40): + thrs.append( + threading.Thread( + target=makeSearchExact, args=(bingo1, i, query, "", outp) + ) + ) + + for i in range(40, 50): + thrs.append( + threading.Thread( + target=makeSearchSim, + args=(bingo2, i, query, 0.7, 1, "tanimoto", outp), + ) + ) + for i in range(50, 60): + thrs.append( + threading.Thread( + target=makeSearchSub, args=(bingo2, i, q_query, "", outp) + ) + ) + for i in range(60, 70): + thrs.append( + threading.Thread( + target=makeSearchExact, args=(bingo2, i, query, "", outp) + ) + ) + + for t in thrs: + t.start() + + for t in thrs: + t.join() + + for i in range(0, 10): + sys.stdout.write(outp[i]) + + print("\n\ncheck..") + + del thrs[:] + thr_outputs = ["" for x in range(10)] + cnt = 1 + for bingo in [bingo1, bingo2]: + print("Database #{0}".format(cnt)) + off = (cnt - 1) * 5 + thrs.append( + threading.Thread( + target=makeSearchSim, + args=(bingo, 0 + off, query, 0.7, 1, "tanimoto", thr_outputs), + ) + ) + thrs.append( + threading.Thread( + target=makeSearchSim, + args=( + bingo, + 1 + off, + query, + 0.7, + 1, + "tversky 0.2 0.8", + thr_outputs, + ), + ) + ) + thrs.append( + threading.Thread( + target=makeSearchSim, + args=( + bingo, + 2 + off, + query, + 0.7, + 1, + "euclid-sub", + thr_outputs, + ), + ) + ) + thrs.append( + threading.Thread( + target=makeSearchSub, + args=(bingo, 3 + off, q_query, "", thr_outputs), + ) + ) + thrs.append( + threading.Thread( + target=makeSearchExact, + args=(bingo, 4 + off, query, "", thr_outputs), + ) + ) + cnt = cnt + 1 + + for t in thrs: + t.start() + + for t in thrs: + t.join() + + for output in thr_outputs: + print(output) + + bingo1.close() + bingo2.close() + + +def difIndigoTest(): + indigo1 = Indigo() + indigo2 = Indigo() + bingo1 = Bingo.createDatabaseFile(indigo1, db_dir1, "molecule", "") + bingo2 = Bingo.createDatabaseFile(indigo2, db_dir2, "molecule", "") + + t1 = threading.Thread(target=insertThr, args=(bingo1, [2, 3])) + t2 = threading.Thread(target=insertThr, args=(bingo2, [1, 4, 5])) + + t1.start() + t2.start() + + t1.join() + t2.join() + + query = indigo.loadMoleculeFromFile( + joinPathPy("molecules/query_382.smi", __file__) + ) + q_query = indigo.loadQueryMoleculeFromFile( + joinPathPy("molecules/query_382.smi", __file__) + ) + + makeSearchSim(bingo1, 0, query, 0.3, 1, "tanimoto") + makeSearchSim(bingo2, 0, query, 0.3, 1, "tanimoto") + + makeSearchSub(bingo1, 0, q_query, "") + makeSearchSub(bingo2, 0, q_query, "") + + makeSearchExact(bingo1, 0, query, "") + makeSearchExact(bingo2, 0, query, "") + + bingo1.close() + bingo2.close() + + +print("\n2 BINGO WITH SAME INDIGO\n") +consTest() +print("\nMULTITHREADING TEST\n") +paralBigTest() diff --git a/api/tests/integration/tests/bingo/triple.py b/api/tests/integration/tests/bingo/triple.py index e2d9bcc5a2..f2defb805a 100644 --- a/api/tests/integration/tests/bingo/triple.py +++ b/api/tests/integration/tests/bingo/triple.py @@ -6,8 +6,14 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * - +from env_indigo import ( + Bingo, + Indigo, + dir_exists, + joinPathPy, + makedirs, + rmdir, +) indigo = Indigo() smilesList = [ diff --git a/api/tests/integration/tests/calc/crippen.py b/api/tests/integration/tests/calc/crippen.py index 4a1df0a0eb..34161edcda 100644 --- a/api/tests/integration/tests/calc/crippen.py +++ b/api/tests/integration/tests/calc/crippen.py @@ -6,7 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import Indigo try: basestring diff --git a/api/tests/integration/tests/calc/lipinski.py b/api/tests/integration/tests/calc/lipinski.py index 703d61eecb..13b7e39d6f 100644 --- a/api/tests/integration/tests/calc/lipinski.py +++ b/api/tests/integration/tests/calc/lipinski.py @@ -6,7 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import Indigo indigo = Indigo() diff --git a/api/tests/integration/tests/calc/mass_and_gross_fmla.py b/api/tests/integration/tests/calc/mass_and_gross_fmla.py index 016655286f..d1080dbf52 100644 --- a/api/tests/integration/tests/calc/mass_and_gross_fmla.py +++ b/api/tests/integration/tests/calc/mass_and_gross_fmla.py @@ -6,7 +6,12 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import ( + Indigo, + IndigoException, + getIndigoExceptionText, + joinPathPy, +) indigo = Indigo() diff --git a/api/tests/integration/tests/calc/molecular_formula.py b/api/tests/integration/tests/calc/molecular_formula.py index 85d048653b..cdc28724dd 100644 --- a/api/tests/integration/tests/calc/molecular_formula.py +++ b/api/tests/integration/tests/calc/molecular_formula.py @@ -6,8 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * - +from env_indigo import Indigo, joinPathPy print("3012_iupac_molecular_formula") indigo = Indigo() m = indigo.loadMoleculeFromFile( diff --git a/api/tests/integration/tests/calc/pka_basic.py b/api/tests/integration/tests/calc/pka_basic.py index c9426f6ff7..828f129519 100644 --- a/api/tests/integration/tests/calc/pka_basic.py +++ b/api/tests/integration/tests/calc/pka_basic.py @@ -6,7 +6,13 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import ( + Indigo, + IndigoRenderer, + isIronPython, + joinPathPy, + makedirs, +) indigo = Indigo() indigo.setOption("molfile-saving-skip-date", "true") diff --git a/api/tests/integration/tests/calc/reaction_mass_and_gross_fmla.py b/api/tests/integration/tests/calc/reaction_mass_and_gross_fmla.py index 50c8ff6c30..49fc9a6c0c 100644 --- a/api/tests/integration/tests/calc/reaction_mass_and_gross_fmla.py +++ b/api/tests/integration/tests/calc/reaction_mass_and_gross_fmla.py @@ -6,7 +6,12 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import ( + Indigo, + IndigoException, + getIndigoExceptionText, + joinPathPy, +) indigo = Indigo() diff --git a/api/tests/integration/tests/calc/tpsa_basic.py b/api/tests/integration/tests/calc/tpsa_basic.py index 9eeabc6d1c..8edbdffb93 100644 --- a/api/tests/integration/tests/calc/tpsa_basic.py +++ b/api/tests/integration/tests/calc/tpsa_basic.py @@ -6,7 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import Indigo indigo = Indigo() diff --git a/api/tests/integration/tests/cano/cano_all.py b/api/tests/integration/tests/cano/cano_all.py index ee09c130f9..849b604a58 100644 --- a/api/tests/integration/tests/cano/cano_all.py +++ b/api/tests/integration/tests/cano/cano_all.py @@ -6,7 +6,13 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import ( + Indigo, + IndigoException, + getIndigoExceptionText, + joinPathPy, + relativePath, +) indigo = Indigo() indigo.setOption("treat-x-as-pseudoatom", "1") diff --git a/api/tests/integration/tests/cano/cano_as_se.py b/api/tests/integration/tests/cano/cano_as_se.py index bdfab7a509..aa90efece7 100644 --- a/api/tests/integration/tests/cano/cano_as_se.py +++ b/api/tests/integration/tests/cano/cano_as_se.py @@ -6,8 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * - +from env_indigo import Indigo indigo = Indigo() smiles = [ "C1=CC=[As]C=C1", diff --git a/api/tests/integration/tests/cano/cano_hard.py b/api/tests/integration/tests/cano/cano_hard.py index 238da24ca6..74991bf750 100644 --- a/api/tests/integration/tests/cano/cano_hard.py +++ b/api/tests/integration/tests/cano/cano_hard.py @@ -6,7 +6,12 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import ( + Indigo, + IndigoException, + getIndigoExceptionText, + joinPathPy, +) indigo = Indigo() indigo.setOption("timeout", "6000") diff --git a/api/tests/integration/tests/cano/e-z-isomerism.py b/api/tests/integration/tests/cano/e-z-isomerism.py index 07742f292d..45adfbcd82 100644 --- a/api/tests/integration/tests/cano/e-z-isomerism.py +++ b/api/tests/integration/tests/cano/e-z-isomerism.py @@ -6,8 +6,12 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * - +from env_indigo import ( + Indigo, + IndigoException, + getIndigoExceptionText, + joinPathPy, +) indigo = Indigo() for idx, r in enumerate( diff --git a/api/tests/integration/tests/cano/permutations.py b/api/tests/integration/tests/cano/permutations.py index 117c6f0ed4..97d6e27b79 100644 --- a/api/tests/integration/tests/cano/permutations.py +++ b/api/tests/integration/tests/cano/permutations.py @@ -7,7 +7,13 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import ( + Indigo, + IndigoException, + getIndigoExceptionText, + joinPathPy, + relativePath, +) indigo = Indigo() indigo.setOption("treat-x-as-pseudoatom", "1") diff --git a/api/tests/integration/tests/cano/ring_cis_trans.py b/api/tests/integration/tests/cano/ring_cis_trans.py index 0c0366368f..0ebe377b9a 100644 --- a/api/tests/integration/tests/cano/ring_cis_trans.py +++ b/api/tests/integration/tests/cano/ring_cis_trans.py @@ -7,7 +7,13 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import ( + Indigo, + IndigoException, + getIndigoExceptionText, + joinPathPy, + relativePath, +) indigo = Indigo() indigo.setOption("treat-x-as-pseudoatom", "1") diff --git a/api/tests/integration/tests/cano/stereo_cis_trans.py b/api/tests/integration/tests/cano/stereo_cis_trans.py index e02c6ed368..6a1c417ef0 100644 --- a/api/tests/integration/tests/cano/stereo_cis_trans.py +++ b/api/tests/integration/tests/cano/stereo_cis_trans.py @@ -1,117 +1,124 @@ -import errno -import os -import sys - -sys.path.append( - os.path.normpath( - os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") - ) -) -from env_indigo import * # noqa - -indigo = Indigo() -indigo.setOption("treat-x-as-pseudoatom", "1") -mol_db_names = [ - ( - joinPathPy( - "../../../../../data/molecules/basic/zinc-slice.sdf.gz", __file__ - ), - indigo.iterateSDFile, - ), - ( - joinPathPy( - "../../../../../data/molecules/basic/thiazolidines.sdf", __file__ - ), - indigo.iterateSDFile, - ), - ( - joinPathPy("../../../../../data/molecules/basic/sugars.sdf", __file__), - indigo.iterateSDFile, - ), - ( - joinPathPy( - "../../../../../data/molecules/stereo/stereo_cis_trans.sdf", - __file__, - ), - indigo.iterateSDFile, - ), - ( - joinPathPy("../../../../../data/molecules/basic/helma.smi", __file__), - indigo.iterateSmilesFile, - ), -] - -if not os.path.exists(joinPathPy("out", __file__)): - try: - os.makedirs(joinPathPy("out", __file__)) - except OSError as e: - if e.errno != errno.EEXIST: - raise - - -def testAll(clear_cis_trans): - for db_name, load_fund in mol_db_names: - print("Database: %s" % relativePath(db_name)) - idx = 1 - db_name_print = os.path.basename(db_name) - for item in load_fund(db_name): - try: - mol = item.clone() - - # for bond in mol.iterateBonds(): - # if bond.topology() == Indigo.RING and bond.bondOrder() == 2: - # bond.resetStereo() - - mol.dearomatize() - cansm = mol.canonicalSmiles() - mol2 = indigo.loadMolecule(cansm) - if clear_cis_trans: - mol2.clearCisTrans() - mol2.layout() - mol2.markEitherCisTrans() - # issue #1200 related. - # saveMolfile add MRV_IMPLICIT_H Data S-groups for saving the number of implicit H for aromatic atoms. - # these Data S-Groups removed in readMolfile. - # so generate SMILES before save to avoid differences. - cansm2 = mol2.canonicalSmiles() - mol2.saveMolfile(joinPathPy("out/out.mol", __file__)) - mol3 = indigo.loadMoleculeFromFile( - joinPathPy("out/out.mol", __file__) - ) - cansm3 = mol3.canonicalSmiles() - if cansm2 != cansm3: - sys.stderr.write( - "Different canonical smiles for #%s:\n" % idx - ) - sys.stderr.write(" %s\n" % cansm2) - sys.stderr.write(" %s\n" % cansm3) - sys.stderr.write( - " %s (cansm - before cis-trans removed)\n" % cansm - ) - sys.stderr.write("Database: %s" % relativePath(db_name)) - if not os.path.exists(joinPathPy("bugs", __file__)): - os.mkdir(joinPathPy("bugs", __file__)) - mol2.saveMolfile( - joinPathPy( - "bugs/bug_%s_%s_mol2.mol" % (db_name_print, idx), - __file__, - ) - ) - mol3.saveMolfile( - joinPathPy( - "bugs/bug_%s_%s_mol3.mol" % (db_name_print, idx), - __file__, - ) - ) - except IndigoException as e: - print( - "Exception for #%s: %s" % (idx, getIndigoExceptionText(e)) - ) - # sys.stderr.write("%s %s\n" % (db_name_print, idx)) - idx += 1 - - -print("*** With clearing cis-trans ***") -testAll(True) -print("*** Without clearing cis-trans ***") -testAll(False) +import errno +import os +import sys + +sys.path.append( + os.path.normpath( + os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") + ) +) +from env_indigo import ( + Indigo, + IndigoException, + getIndigoExceptionText, + joinPathPy, + makedirs, + relativePath, +) + +indigo = Indigo() +indigo.setOption("treat-x-as-pseudoatom", "1") +mol_db_names = [ + ( + joinPathPy( + "../../../../../data/molecules/basic/zinc-slice.sdf.gz", __file__ + ), + indigo.iterateSDFile, + ), + ( + joinPathPy( + "../../../../../data/molecules/basic/thiazolidines.sdf", __file__ + ), + indigo.iterateSDFile, + ), + ( + joinPathPy("../../../../../data/molecules/basic/sugars.sdf", __file__), + indigo.iterateSDFile, + ), + ( + joinPathPy( + "../../../../../data/molecules/stereo/stereo_cis_trans.sdf", + __file__, + ), + indigo.iterateSDFile, + ), + ( + joinPathPy("../../../../../data/molecules/basic/helma.smi", __file__), + indigo.iterateSmilesFile, + ), +] + +if not os.path.exists(joinPathPy("out", __file__)): + try: + os.makedirs(joinPathPy("out", __file__)) + except OSError as e: + if e.errno != errno.EEXIST: + raise + + +def testAll(clear_cis_trans): + for db_name, load_fund in mol_db_names: + print("Database: %s" % relativePath(db_name)) + idx = 1 + db_name_print = os.path.basename(db_name) + for item in load_fund(db_name): + try: + mol = item.clone() + + # for bond in mol.iterateBonds(): + # if bond.topology() == Indigo.RING and bond.bondOrder() == 2: + # bond.resetStereo() + + mol.dearomatize() + cansm = mol.canonicalSmiles() + mol2 = indigo.loadMolecule(cansm) + if clear_cis_trans: + mol2.clearCisTrans() + mol2.layout() + mol2.markEitherCisTrans() + # issue #1200 related. + # saveMolfile add MRV_IMPLICIT_H Data S-groups for saving the number of implicit H for aromatic atoms. + # these Data S-Groups removed in readMolfile. + # so generate SMILES before save to avoid differences. + cansm2 = mol2.canonicalSmiles() + mol2.saveMolfile(joinPathPy("out/out.mol", __file__)) + mol3 = indigo.loadMoleculeFromFile( + joinPathPy("out/out.mol", __file__) + ) + cansm3 = mol3.canonicalSmiles() + if cansm2 != cansm3: + sys.stderr.write( + "Different canonical smiles for #%s:\n" % idx + ) + sys.stderr.write(" %s\n" % cansm2) + sys.stderr.write(" %s\n" % cansm3) + sys.stderr.write( + " %s (cansm - before cis-trans removed)\n" % cansm + ) + sys.stderr.write("Database: %s" % relativePath(db_name)) + if not os.path.exists(joinPathPy("bugs", __file__)): + os.mkdir(joinPathPy("bugs", __file__)) + mol2.saveMolfile( + joinPathPy( + "bugs/bug_%s_%s_mol2.mol" % (db_name_print, idx), + __file__, + ) + ) + mol3.saveMolfile( + joinPathPy( + "bugs/bug_%s_%s_mol3.mol" % (db_name_print, idx), + __file__, + ) + ) + except IndigoException as e: + print( + "Exception for #%s: %s" % (idx, getIndigoExceptionText(e)) + ) + # sys.stderr.write("%s %s\n" % (db_name_print, idx)) + idx += 1 + + +print("*** With clearing cis-trans ***") +testAll(True) +print("*** Without clearing cis-trans ***") +testAll(False) diff --git a/api/tests/integration/tests/cano/symmetry_classes.py b/api/tests/integration/tests/cano/symmetry_classes.py index 53acbaaa82..42a0ce58d0 100644 --- a/api/tests/integration/tests/cano/symmetry_classes.py +++ b/api/tests/integration/tests/cano/symmetry_classes.py @@ -6,7 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import Indigo, joinPathPy indigo = Indigo() diff --git a/api/tests/integration/tests/check/check-issue731.py b/api/tests/integration/tests/check/check-issue731.py index d811b759a1..d9423f94f4 100644 --- a/api/tests/integration/tests/check/check-issue731.py +++ b/api/tests/integration/tests/check/check-issue731.py @@ -6,8 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * - +from env_indigo import Indigo, joinPathPy indigo = Indigo() options = { diff --git a/api/tests/integration/tests/check/check.py b/api/tests/integration/tests/check/check.py index 3bf1996f8f..683ed0ebed 100644 --- a/api/tests/integration/tests/check/check.py +++ b/api/tests/integration/tests/check/check.py @@ -6,8 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * - +from env_indigo import Indigo, joinPathPy indigo = Indigo() indigo.setOption("ignore-noncritical-query-features", "true") diff --git a/api/tests/integration/tests/composition/basic.py b/api/tests/integration/tests/composition/basic.py index 8deb922aaa..8cc039a453 100644 --- a/api/tests/integration/tests/composition/basic.py +++ b/api/tests/integration/tests/composition/basic.py @@ -6,8 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * - +from env_indigo import Indigo, joinPathPy indigo = Indigo() diff --git a/api/tests/integration/tests/deco/deco_arom_query.py b/api/tests/integration/tests/deco/deco_arom_query.py index 4414ef9cc1..8f53c77c76 100644 --- a/api/tests/integration/tests/deco/deco_arom_query.py +++ b/api/tests/integration/tests/deco/deco_arom_query.py @@ -6,10 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * - - -# +from env_indigo import Indigo # Prepare a molecule for printing out # def prepareStructure(mol): diff --git a/api/tests/integration/tests/deco/deco_iter.py b/api/tests/integration/tests/deco/deco_iter.py index 976c86c654..350ab8093a 100644 --- a/api/tests/integration/tests/deco/deco_iter.py +++ b/api/tests/integration/tests/deco/deco_iter.py @@ -6,7 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import Indigo, joinPathPy # diff --git a/api/tests/integration/tests/deco/deco_matches.py b/api/tests/integration/tests/deco/deco_matches.py index 2dcce3eeb8..adbf3660d8 100644 --- a/api/tests/integration/tests/deco/deco_matches.py +++ b/api/tests/integration/tests/deco/deco_matches.py @@ -6,10 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * - - -# +from env_indigo import Indigo # Prepare a molecule for printing out # def prepareStructure(mol): diff --git a/api/tests/integration/tests/deco/deco_recursive_smarts.py b/api/tests/integration/tests/deco/deco_recursive_smarts.py index 134ff52f3e..4608706203 100644 --- a/api/tests/integration/tests/deco/deco_recursive_smarts.py +++ b/api/tests/integration/tests/deco/deco_recursive_smarts.py @@ -6,8 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * - +from env_indigo import Indigo indigo = Indigo() structures = ["CN(c1ccccc1)C=O", "CN(c1ccc(O)cc1)C=OP"] diff --git a/api/tests/integration/tests/deco/deco_sdf.py b/api/tests/integration/tests/deco/deco_sdf.py index 979018dc5b..c27d133e60 100644 --- a/api/tests/integration/tests/deco/deco_sdf.py +++ b/api/tests/integration/tests/deco/deco_sdf.py @@ -6,7 +6,12 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * # noqa +from env_indigo import ( + Indigo, + IndigoException, + getIndigoExceptionText, + joinPathPy, +) # diff --git a/api/tests/integration/tests/deco/decompose_molecules.py b/api/tests/integration/tests/deco/decompose_molecules.py index ccdc7aff16..4deaaa1678 100644 --- a/api/tests/integration/tests/deco/decompose_molecules.py +++ b/api/tests/integration/tests/deco/decompose_molecules.py @@ -6,10 +6,7 @@ os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import * - - -# +from env_indigo import Indigo # Prepare a molecule for printing out # def prepareStructure(mol): From 9a594fd2b870b5cd9d29efe5bc86476223ecf464 Mon Sep 17 00:00:00 2001 From: "copilot-swe-agent[bot]" <198982749+Copilot@users.noreply.github.com> Date: Fri, 20 Feb 2026 14:49:01 +0000 Subject: [PATCH 3/3] Move threading import to stdlib section per code review feedback Import threading directly as a standard library module instead of getting it through env_indigo in threads_test.py, molfile_stereo_desc.py, and ketfile_stereo_desc.py. Co-authored-by: AlexeyGirin <26869421+AlexeyGirin@users.noreply.github.com> --- api/tests/integration/tests/basic/ketfile_stereo_desc.py | 8 ++------ api/tests/integration/tests/basic/molfile_stereo_desc.py | 8 ++------ api/tests/integration/tests/bingo/threads_test.py | 2 +- 3 files changed, 5 insertions(+), 13 deletions(-) diff --git a/api/tests/integration/tests/basic/ketfile_stereo_desc.py b/api/tests/integration/tests/basic/ketfile_stereo_desc.py index b63b3e333c..5b5c119b21 100644 --- a/api/tests/integration/tests/basic/ketfile_stereo_desc.py +++ b/api/tests/integration/tests/basic/ketfile_stereo_desc.py @@ -1,6 +1,7 @@ import difflib import os import sys +import threading def find_diff(a, b): @@ -13,12 +14,7 @@ def find_diff(a, b): ) ) -from env_indigo import ( - Indigo, - isJython, - joinPathPy, - threading, -) +from env_indigo import Indigo, isJython, joinPathPy threading.stack_size(2 * 1024 * 1024) diff --git a/api/tests/integration/tests/basic/molfile_stereo_desc.py b/api/tests/integration/tests/basic/molfile_stereo_desc.py index 5308dcec6c..1fd3134c54 100644 --- a/api/tests/integration/tests/basic/molfile_stereo_desc.py +++ b/api/tests/integration/tests/basic/molfile_stereo_desc.py @@ -1,17 +1,13 @@ import os import sys +import threading sys.path.append( os.path.normpath( os.path.join(os.path.abspath(__file__), "..", "..", "..", "common") ) ) -from env_indigo import ( - Indigo, - isJython, - joinPathPy, - threading, -) +from env_indigo import Indigo, isJython, joinPathPy threading.stack_size(2 * 1024 * 1024) diff --git a/api/tests/integration/tests/bingo/threads_test.py b/api/tests/integration/tests/bingo/threads_test.py index c2dada591c..0d1d64cb8b 100644 --- a/api/tests/integration/tests/bingo/threads_test.py +++ b/api/tests/integration/tests/bingo/threads_test.py @@ -1,5 +1,6 @@ import os import sys +import threading sys.path.append( os.path.normpath( @@ -12,7 +13,6 @@ Indigo, getIndigoExceptionText, joinPathPy, - threading, ) db_dir1 = joinPathPy("out/mol_test_db1", __file__)